| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/html/lightbox1.html |
| — | — | @@ -0,0 +1,266 @@ |
| | 2 | +<!-- load styles from original first steps --> |
| | 3 | +<!--[if lt IE 7]><style type="text/css">body{behavior:url("/w/skins-1.17/vector/csshover.min.htc")}</style><![endif]--> |
| | 4 | +<!-- start Webitects styles --> |
| | 5 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.js'></script> |
| | 6 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.client.js'></script> |
| | 7 | +<!-- |
| | 8 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.min.js'></script> |
| | 9 | +--> |
| | 10 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.core.js'></script> |
| | 11 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.widget.js'></script> |
| | 12 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.mouse.js'></script> |
| | 13 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.position.js'></script> |
| | 14 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.draggable.js'></script> |
| | 15 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.resizable.js'></script> |
| | 16 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.button.js'></script> |
| | 17 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.dialog.js'></script> |
| | 18 | + |
| | 19 | +<script type='text/javascript' src='@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/lightbox1.js'></script> |
| | 20 | +<link rel="stylesheet" href="@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/jquery.ui.core.css" /> |
| | 21 | +<link rel="stylesheet" href="@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/jquery.ui.theme.css" /> |
| | 22 | +<link rel="stylesheet" href="@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/jquery.ui.dialog.css" /> |
| | 23 | +<link rel="stylesheet" href="@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/jquery.ui.button.css" /> |
| | 24 | +<link rel="stylesheet" href="@script_path/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/lightbox1.css" /> |
| | 25 | +<style type="text/css"> |
| | 26 | + |
| | 27 | +</style> |
| | 28 | + |
| | 29 | + <div class="ltr"> |
| | 30 | + <div id="appeal"> |
| | 31 | + <div id="appeal-content"> |
| | 32 | + <div class="call-r"> |
| | 33 | + <div id="donate"> |
| | 34 | + <h3 id="amount-heading">Donate</h3> |
| | 35 | + |
| | 36 | + <form method="post" name="paypalcontribution"> |
| | 37 | + <div style="display: block;" id="amount-content"> |
| | 38 | + |
| | 39 | + <table id="amount-table"> |
| | 40 | + <tr> |
| | 41 | + <td><label><input type="radio" name="amountRadio" value="5" /> $5</label></td> |
| | 42 | + <td><label><input type="radio" name="amountRadio" value="10" /> $10</label></td> |
| | 43 | + <td><label><input type="radio" name="amountRadio" value="20" /> $20</label></td> |
| | 44 | + <td><label><input type="radio" name="amountRadio" value="35" /> $35</label></td> |
| | 45 | + </tr> |
| | 46 | + <tr> |
| | 47 | + <td><label><input type="radio" name="amountRadio" value="50" /> $50</label></td> |
| | 48 | + <td><label><input type="radio" name="amountRadio" value="100" /> $100</label></td> |
| | 49 | + <td><label><input type="radio" name="amountRadio" value="250" /> $250</label></td> |
| | 50 | + <td><input type="radio" name="amountRadio" id="input_amount_other" value="other" /> <label>$<input type="text" name="amountGiven" size="4" id="other-amount" placeholder="Other" onfocus="this.form.input_amount_other.checked=true;"/></label></td> |
| | 51 | + </tr> |
| | 52 | + </table> |
| | 53 | + |
| | 54 | + <p class="donate-options"> |
| | 55 | + <input class="btn" id="cc" value="Donate by Credit Card" type="button"> |
| | 56 | + <br><input class="btn" id="pp" value="Donate via PayPal" type="button"><span id="loading"></span> |
| | 57 | + </p> |
| | 58 | + </div> |
| | 59 | + |
| | 60 | + </form> |
| | 61 | + </div> |
| | 62 | + |
| | 63 | + <div id="callout-content"> |
| | 64 | + <hr> |
| | 65 | + <h3>Where your donation goes</h3> |
| | 66 | + <p><strong>Technology:</strong> Servers, bandwidth, |
| | 67 | +maintenance, development. Wikipedia is the #5 website in the world and |
| | 68 | +it runs on a fraction of what other top websites spend.</p> |
| | 69 | + <p><strong>People:</strong> The other top 10 website |
| | 70 | +have thousands of employees. We have fewer than 100, making your |
| | 71 | +donation a great investment in a highly-efficient not-for-profit |
| | 72 | +organization.</p> |
| | 73 | + </div> |
| | 74 | + </div> |
| | 75 | + |
| | 76 | + <h2 id="appeal-head"> <span class="mw-headline" id="From_Wikipedia_programmer_Brandon_Harris">From Wikipedia programmer Brandon Harris</span></h2> |
| | 77 | + <div id="appeal-body" class="plainlinks"> |
| | 78 | + <p>I feel like I'm living the first line of my obituary.</p> |
| | 79 | + <p>I don't think there will be anything else that I do in my |
| | 80 | + life as important as what I do now for Wikipedia. We're not just |
| | 81 | +building an encyclopedia, we're working to make people free. When we |
| | 82 | +have access to free knowledge, we are better people. We understand the |
| | 83 | +world is bigger than us, and we become infected with tolerance and |
| | 84 | +understanding.</p> |
| | 85 | + <p>Wikipedia is the 5th largest website in the world. I work |
| | 86 | + at the small non-profit that keeps it on the web. We don't run ads |
| | 87 | +because doing so would sacrifice our independence. The site is not and |
| | 88 | +should never be a propaganda tool.</p> |
| | 89 | + <p>Our work is possible because of donations from our |
| | 90 | +readers. Will you help protect Wikipedia by donating $5, $10, $20 or |
| | 91 | +whatever you can afford?</p> |
| | 92 | + <p>I work at the Wikimedia Foundation because everything in |
| | 93 | +my soul tells me it's the right thing to do. I've worked at huge tech |
| | 94 | +companies, doing some job to build some crappy thing that's designed to |
| | 95 | +steal money from some kid who doesn't know it. I would come home from |
| | 96 | +work crushed.</p> |
| | 97 | + <p>You might not know this, but the Wikimedia Foundation |
| | 98 | +operates with a very small staff. Most other top-ten sites have tens of |
| | 99 | +thousands of people and massive budgets. But they produce a fraction of |
| | 100 | +what we pull off with sticks and wire.</p> |
| | 101 | + <p>When you give to Wikipedia, you're supporting free |
| | 102 | +knowledge around the world. You're not only leaving a legacy for your |
| | 103 | +children and for their children, you're elevating people around the |
| | 104 | +world who have access to this treasure. You're assuring that one day |
| | 105 | +everyone else will too.</p> |
| | 106 | + <p>Thank you,</p> |
| | 107 | + <p><strong>Brandon Harris</strong><br></p> |
| | 108 | + <p>Programmer, Wikimedia Foundation</p> |
| | 109 | + </div> |
| | 110 | + </div> |
| | 111 | + </div> |
| | 112 | + |
| | 113 | + <hr> |
| | 114 | + |
| | 115 | + <p>We do not store your credit card information, and your personal data is subject to our <a target="_blank" href="http://wikimediafoundation.org/wiki/Donor_policy"> donor privacy policy</a>.</p> |
| | 116 | + <p><a href="http://wikipedia.webitects.com/wiki/Ways_to_Give/en">More information or other ways to give</a><br><a href="http://wikipedia.webitects.com/wiki/FAQ/en">Answers to frequently asked questions</a></p> |
| | 117 | + </div> |
| | 118 | + |
| | 119 | +<div id="dialog"> |
| | 120 | + <div id="steps"> |
| | 121 | + <form id="donationForm" name="donationForm" action="" method="post"> |
| | 122 | + <fieldset class="step"> |
| | 123 | + <legend>Personal Information</legend> |
| | 124 | + <input type="hidden" name="gateway" value="payflowpro" id="gateway" /> |
| | 125 | + <input type="hidden" name="returnto" value="Thank_You/en" /> |
| | 126 | + <input type="hidden" value="@action" name="action" /> |
| | 127 | + <input type="hidden" value="@amount" name="amount" /> |
| | 128 | + <input type="hidden" value="@country" name="country" id="country" /> |
| | 129 | + <input type="hidden" value="@expiration" name="expiration" /> |
| | 130 | + <input type="hidden" value="@currency_code" name="currency" /> |
| | 131 | + <input type="hidden" value="@utm_source" name="utm_source"/> |
| | 132 | + <input type="hidden" value="@utm_medium" name="utm_medium"/> |
| | 133 | + <input type="hidden" value="@utm_campaign" name="utm_campaign"/> |
| | 134 | + <input type="hidden" value="@language" name="language"/> |
| | 135 | + <input type="hidden" value="@referrer" name="referrer"/> |
| | 136 | + <input type="hidden" value="@comment" name="comment"/> |
| | 137 | + <input type="hidden" value="@comment-option" name="comment-option"/> |
| | 138 | + <input type="hidden" value="@email-opt" name="email-opt"/> |
| | 139 | + <input type="hidden" value="processed" name="payment_method"/> |
| | 140 | + <input type="hidden" value="@token" name="token"/> |
| | 141 | + <input type="hidden" value="@order_id" name="order_id"/> |
| | 142 | + <input type="hidden" value="@numAttempt" name="numAttempt"/> |
| | 143 | + <input type="hidden" value="@contribution_tracking_id" name="contribution_tracking_id"/> |
| | 144 | + <input type="hidden" value="@data_hash" name="data_hash"/> |
| | 145 | + <input type="hidden" value="@owa_session" name="owa_session"/> |
| | 146 | + <input type="hidden" value="@owa_ref" name="owa_ref"/> |
| | 147 | + <div class="step-content"> |
| | 148 | + <div class="stuff"> |
| | 149 | + <table> |
| | 150 | + <tr> |
| | 151 | + <td class="label"> |
| | 152 | + <label for="fname">Name</label> |
| | 153 | + </td> |
| | 154 | + <td> |
| | 155 | + <input name="fname" placeholder="First name" size="25" value="@fname" type="text" maxlength="30" class="required" id="fname" style="width: 136px;" /> <input name="lname" placeholder="Last name" size="25" value="@lname" type="text" maxlength="30" class="required" id="lname" style="width: 136px;" /> |
| | 156 | + </td> |
| | 157 | + </tr> |
| | 158 | + </table> |
| | 159 | + </div> |
| | 160 | + <div class="stuff"> |
| | 161 | + <table> |
| | 162 | + <tr> |
| | 163 | + <td class="label"> |
| | 164 | + <label for="street">Billing Address</label> |
| | 165 | + </td> |
| | 166 | + <td> |
| | 167 | + <input name="street" placeholder="Street" size="30" value="@street" type="text" maxlength="100" class="required" id="street" style="width: 258px;" /> |
| | 168 | + </td> |
| | 169 | + </tr> |
| | 170 | + <tr> |
| | 171 | + <td class="label"> </td> |
| | 172 | + <td> |
| | 173 | + <input name="city" placeholder="City" class="required" size="18" value="@city" type="text" maxlength="40" id="city" style="width: 136px;"/> |
| | 174 | + <select name="state" class="required" id="state" value="@state"><option value="" /><option value="AK">AK</option><option value="AL">AL</option><option value="AR">AR</option><option value="AZ">AZ</option><option value="CA">CA</option><option value="CO">CO</option><option value="CT">CT</option><option value="DC">DC</option><option value="DE">DE</option><option value="FL">FL</option><option value="GA">GA</option><option value="HI">HI</option><option value="IA">IA</option><option value="ID">ID</option><option value="IL">IL</option><option value="IN">IN</option><option value="KS">KS</option><option value="KY">KY</option><option value="LA">LA</option><option value="MA">MA</option><option value="MD">MD</option><option value="ME">ME</option><option value="MI">MI</option><option value="MN">MN</option><option value="MO">MO</option><option value="MS">MS</option><option value="MT">MT</option><option value="NC">NC</option><option value="ND">ND</option><option value="NE">NE</option><option value="NH">NH</option><option value="NJ">NJ</option><option value="NM">NM</option><option value="NV">NV</option><option value="NY">NY</option><option value="OH">OH</option><option value="OK">OK</option><option value="OR">OR</option><option value="PA">PA</option><option value="PR">PR</option><option value="RI">RI</option><option value="SC">SC</option><option value="SD">SD</option><option value="TN">TN</option><option value="TX">TX</option><option value="UT">UT</option><option value="VA">VA</option><option value="VT">VT</option><option value="WA">WA</option><option value="WI">WI</option><option value="WV">WV</option><option value="WY">WY</option><option value="AA">AA</option><option value="AE">AE</option><option value="AP">AP</option></select> |
| | 175 | + <input name="zip" placeholder="Zip" class="required" size="5" value="@zip" type="text" maxlength="10" id="zip" style="width: 48px;" /><input type="hidden" value="US" name="country" /> |
| | 176 | + </td> |
| | 177 | + </tr> |
| | 178 | + </table> |
| | 179 | + </div> |
| | 180 | + <div class="stuff"> |
| | 181 | + <table> |
| | 182 | + <tr> |
| | 183 | + <td class="label"> |
| | 184 | + <label for="email">Email</label> |
| | 185 | + </td> |
| | 186 | + <td> |
| | 187 | + <input name="emailAdd" placeholder="Email address" size="30" value="@emailAdd" type="text" maxlength="100" class="required" id="email" style="width: 258px;" /> |
| | 188 | + </td> |
| | 189 | + </tr> |
| | 190 | + </table> |
| | 191 | + </div> |
| | 192 | + <a href="#" class="continue-button">Continue</a> |
| | 193 | + </div> |
| | 194 | + </fieldset> |
| | 195 | + <fieldset class="step"> |
| | 196 | + <legend>Payment</legend> |
| | 197 | + <div class="step-content"> |
| | 198 | + <div class="stuff"> |
| | 199 | + <table> |
| | 200 | + <tr> |
| | 201 | + <td class="label"> |
| | 202 | + <label for="email">Card Number</label> |
| | 203 | + </td> |
| | 204 | + <td> |
| | 205 | + <input name="card_num" size="30" value="@card_num" type="text" maxlength="100" class="required" id="card_num" style="width: 258px;" /> |
| | 206 | + </td> |
| | 207 | + </tr> |
| | 208 | + </table> |
| | 209 | + </div> |
| | 210 | + <div class="stuff"> |
| | 211 | + <table> |
| | 212 | + <tr> |
| | 213 | + <td class="label"> |
| | 214 | + <label for="expiration">Expiration Date</label> |
| | 215 | + </td> |
| | 216 | + <td> |
| | 217 | + <select name="mos" id="expiration"> |
| | 218 | + <option value="01">1 (January)</option> |
| | 219 | + <option value="02">2 (February)</option> |
| | 220 | + <option value="03">3 (March)</option> |
| | 221 | + <option value="04">4 (April)</option> |
| | 222 | + <option value="05">5 (May)</option> |
| | 223 | + <option value="06">6 (June)</option> |
| | 224 | + <option value="07">7 (July)</option> |
| | 225 | + <option value="08">8 (August)</option> |
| | 226 | + <option value="09">9 (September)</option> |
| | 227 | + <option value="10">10 (October)</option> |
| | 228 | + <option value="11">11 (November)</option> |
| | 229 | + <option value="12">12 (December)</option> |
| | 230 | + </select> |
| | 231 | + / |
| | 232 | + <select name="year" id="year"> |
| | 233 | + <option value="2011">2011</option> |
| | 234 | + <option value="2012">2012</option> |
| | 235 | + <option value="2013">2013</option> |
| | 236 | + <option value="2014">2014</option> |
| | 237 | + <option value="2015">2015</option> |
| | 238 | + <option value="2016">2016</option> |
| | 239 | + <option value="2017">2017</option> |
| | 240 | + <option value="2018">2018</option> |
| | 241 | + <option value="2019">2019</option> |
| | 242 | + <option value="2020">2020</option> |
| | 243 | + <option value="2021">2021</option> |
| | 244 | + </select> |
| | 245 | + </td> |
| | 246 | + </tr> |
| | 247 | + </table> |
| | 248 | + </div> |
| | 249 | + <div class="stuff"> |
| | 250 | + <table> |
| | 251 | + <tr> |
| | 252 | + <td class="label"> |
| | 253 | + <label for="email">Security Code</label> |
| | 254 | + </td> |
| | 255 | + <td> |
| | 256 | + <input name="cvv" size="30" value="@cvv" type="text" maxlength="100" class="required" id="cvv" style="width: 50px;" /> |
| | 257 | + </td> |
| | 258 | + </tr> |
| | 259 | + </table> |
| | 260 | + </div> |
| | 261 | + <a href="#" class="back-button" id="goback">Back</a> |
| | 262 | + <a href="#" class="continue-button" id="submitcreditcard">Continue</a> |
| | 263 | + </div> |
| | 264 | + </fieldset> |
| | 265 | + </form> |
| | 266 | + </div> |
| | 267 | +</div> |
| \ No newline at end of file |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/jquery.ui.dialog.css |
| — | — | @@ -0,0 +1,37 @@ |
| | 2 | +/* Dialog |
| | 3 | +----------------------------------*/ |
| | 4 | +.ui-dialog { position: absolute; padding: 0; width: 300px; } |
| | 5 | +.ui-dialog .ui-dialog-titlebar { padding: .75em; position: relative; } |
| | 6 | +.ui-dialog .ui-dialog-title { float: left; margin: 0; } |
| | 7 | +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .75em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } |
| | 8 | +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } |
| | 9 | +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } |
| | 10 | +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } |
| | 11 | +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } |
| | 12 | +.ui-dialog .ui-dialog-buttonpane button { float: right; } |
| | 13 | +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } |
| | 14 | +.ui-draggable .ui-dialog-titlebar { cursor: move; } |
| | 15 | +/* Customizations */ |
| | 16 | +body .ui-dialog .ui-dialog-titlebar-close:hover { |
| | 17 | + text-decoration: none; |
| | 18 | +} |
| | 19 | +body .ui-dialog .ui-dialog-content .status-invalid input { |
| | 20 | + border: 2px solid red; |
| | 21 | + padding: 2px 1px; |
| | 22 | +} |
| | 23 | +body .ui-dialog .ui-dialog-titlebar { |
| | 24 | + padding: 0.9em 1.4em 0.6em !important; |
| | 25 | +} |
| | 26 | +body .ui-dialog .ui-widget-header { |
| | 27 | + /* @embed */ |
| | 28 | + background: #f0f0f0 url(images/titlebar-fade.png) repeat-x scroll 50% 100% !important; |
| | 29 | +} |
| | 30 | +/* FIXME: Should just update the icon sprite if we're keeping this X */ |
| | 31 | +body .ui-dialog .ui-icon-closethick { |
| | 32 | + /* @embed */ |
| | 33 | + background: url(images/close.png) no-repeat 50% 50% !important; |
| | 34 | +} |
| | 35 | +body .ui-dialog .ui-dialog-buttonpane { |
| | 36 | + margin-top: 0 !important; |
| | 37 | + padding:0.3em 1.4em 0.5em 1.4em !important; |
| | 38 | +} |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/jquery.ui.theme.css |
| — | — | @@ -0,0 +1,248 @@ |
| | 2 | + |
| | 3 | + |
| | 4 | +/* |
| | 5 | +* jQuery UI CSS Framework |
| | 6 | +* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) |
| | 7 | +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. |
| | 8 | +* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=sans-serif&fwDefault=normal&fsDefault=1.0em&cornerRadius=3px&bgColorHeader=ffffff&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=100&borderColorHeader=aed0ea&fcHeader=222222&iconColorHeader=72a7cf&bgColorContent=f2f5f7&bgTextureContent=04_highlight_hard.png&bgImgOpacityContent=100&borderColorContent=cccccc&fcContent=362b36&iconColorContent=72a7cf&bgColorDefault=d7ebf9&bgTextureDefault=04_highlight_hard.png&bgImgOpacityDefault=80&borderColorDefault=aed0ea&fcDefault=2779aa&iconColorDefault=3d80b3&bgColorHover=e4f1fb&bgTextureHover=03_highlight_soft.png&bgImgOpacityHover=100&borderColorHover=74b2e2&fcHover=0070a3&iconColorHover=2694e8&bgColorActive=f0f0f0&bgTextureActive=06_inset_hard.png&bgImgOpacityActive=100&borderColorActive=cccccc&fcActive=000000&iconColorActive=666666&bgColorHighlight=ffef8f&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=25&borderColorHighlight=f9dd34&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=cd0a0a&bgTextureError=01_flat.png&bgImgOpacityError=15&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffffff&bgColorOverlay=000000&bgTextureOverlay=21_glow_ball.png&bgImgOpacityOverlay=100&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=70&opacityShadow=20&thicknessShadow=7px&offsetTopShadow=-7px&offsetLeftShadow=-7px&cornerRadiusShadow=8px |
| | 9 | +*/ |
| | 10 | + |
| | 11 | + |
| | 12 | +/* Component containers |
| | 13 | +----------------------------------*/ |
| | 14 | +.ui-widget { font-family: sans-serif; font-size: 0.8em; } |
| | 15 | +.ui-widget .ui-widget { font-size: 1em; } |
| | 16 | +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: sans-serif; font-size: 1em; } |
| | 17 | +.ui-widget-content { border: 1px solid #cccccc; /* @embed */ background: #f2f5f7 url(images/ui-bg_highlight-hard_100_f2f5f7_1x100.png) 50% top repeat-x; color: #362b36; } |
| | 18 | +.ui-widget-content a { color: #362b36; } |
| | 19 | +.ui-widget-header { border-bottom: 1px solid #bbbbbb; line-height: 1em; /* @embed */ background: #ffffff url(images/ui-bg_highlight-soft_100_ffffff_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } |
| | 20 | +.ui-widget-header a { color: #222222; } |
| | 21 | + |
| | 22 | +/* Interaction states |
| | 23 | +----------------------------------*/ |
| | 24 | +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #aed0ea; /* @embed */ background: #d7ebf9 url(images/ui-bg_highlight-hard_80_d7ebf9_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #2779aa; } |
| | 25 | +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #2779aa; text-decoration: none; } |
| | 26 | +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #74b2e2; /* @embed */ background: #e4f1fb url(images/ui-bg_highlight-soft_100_e4f1fb_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #0070a3; } |
| | 27 | +.ui-state-hover a, .ui-state-hover a:hover { color: #0070a3; text-decoration: none; } |
| | 28 | +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #cccccc; background: #f0f0f0 /* @embed */ url(images/ui-bg_inset-hard_100_f0f0f0_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; } |
| | 29 | +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #000000; text-decoration: none; } |
| | 30 | +.ui-widget :active { outline: none; } |
| | 31 | + |
| | 32 | +/* Interaction Cues |
| | 33 | +----------------------------------*/ |
| | 34 | +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #f9dd34; background: #ffef8f /* @embed */ url(images/ui-bg_highlight-soft_25_ffef8f_1x100.png) 50% top repeat-x; color: #363636; } |
| | 35 | +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } |
| | 36 | +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #cd0a0a /* @embed */ url(images/ui-bg_flat_15_cd0a0a_40x100.png) 50% 50% repeat-x; color: #ffffff; } |
| | 37 | +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } |
| | 38 | +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } |
| | 39 | +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } |
| | 40 | +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } |
| | 41 | +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } |
| | 42 | + |
| | 43 | +/* Icons |
| | 44 | +----------------------------------*/ |
| | 45 | + |
| | 46 | +/* states and images */ |
| | 47 | +.ui-icon { width: 16px; height: 16px; } |
| | 48 | +.ui-icon, .ui-widget-content .ui-icon, .ui-widget-header .ui-icon { /* @embed */ background-image: url(images/ui-icons_72a7cf_256x240.png); } |
| | 49 | +.ui-state-default .ui-icon { /* @embed */ background-image: url(images/ui-icons_3d80b3_256x240.png); } |
| | 50 | +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon { /* @embed */ background-image: url(images/ui-icons_2694e8_256x240.png); } |
| | 51 | +.ui-state-active .ui-icon { /* @embed */ background-image: url(images/ui-icons_666666_256x240.png); } |
| | 52 | +.ui-state-highlight .ui-icon { /* @embed */ background-image: url(images/ui-icons_2e83ff_256x240.png); } |
| | 53 | +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon { /* @embed */ background-image: url(images/ui-icons_ffffff_256x240.png); } |
| | 54 | + |
| | 55 | +/* positioning */ |
| | 56 | +.ui-icon-carat-1-n { background-position: 0 0; } |
| | 57 | +.ui-icon-carat-1-ne { background-position: -16px 0; } |
| | 58 | +.ui-icon-carat-1-e { background-position: -32px 0; } |
| | 59 | +.ui-icon-carat-1-se { background-position: -48px 0; } |
| | 60 | +.ui-icon-carat-1-s { background-position: -64px 0; } |
| | 61 | +.ui-icon-carat-1-sw { background-position: -80px 0; } |
| | 62 | +.ui-icon-carat-1-w { background-position: -96px 0; } |
| | 63 | +.ui-icon-carat-1-nw { background-position: -112px 0; } |
| | 64 | +.ui-icon-carat-2-n-s { background-position: -128px 0; } |
| | 65 | +.ui-icon-carat-2-e-w { background-position: -144px 0; } |
| | 66 | +.ui-icon-triangle-1-n { background-position: 0 -16px; } |
| | 67 | +.ui-icon-triangle-1-ne { background-position: -16px -16px; } |
| | 68 | +.ui-icon-triangle-1-e { background-position: -32px -16px; } |
| | 69 | +.ui-icon-triangle-1-se { background-position: -48px -16px; } |
| | 70 | +.ui-icon-triangle-1-s { background-position: -64px -16px; } |
| | 71 | +.ui-icon-triangle-1-sw { background-position: -80px -16px; } |
| | 72 | +.ui-icon-triangle-1-w { background-position: -96px -16px; } |
| | 73 | +.ui-icon-triangle-1-nw { background-position: -112px -16px; } |
| | 74 | +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } |
| | 75 | +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } |
| | 76 | +.ui-icon-arrow-1-n { background-position: 0 -32px; } |
| | 77 | +.ui-icon-arrow-1-ne { background-position: -16px -32px; } |
| | 78 | +.ui-icon-arrow-1-e { background-position: -32px -32px; } |
| | 79 | +.ui-icon-arrow-1-se { background-position: -48px -32px; } |
| | 80 | +.ui-icon-arrow-1-s { background-position: -64px -32px; } |
| | 81 | +.ui-icon-arrow-1-sw { background-position: -80px -32px; } |
| | 82 | +.ui-icon-arrow-1-w { background-position: -96px -32px; } |
| | 83 | +.ui-icon-arrow-1-nw { background-position: -112px -32px; } |
| | 84 | +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } |
| | 85 | +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } |
| | 86 | +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } |
| | 87 | +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } |
| | 88 | +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } |
| | 89 | +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } |
| | 90 | +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } |
| | 91 | +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } |
| | 92 | +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } |
| | 93 | +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } |
| | 94 | +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } |
| | 95 | +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } |
| | 96 | +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } |
| | 97 | +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } |
| | 98 | +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } |
| | 99 | +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } |
| | 100 | +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } |
| | 101 | +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } |
| | 102 | +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } |
| | 103 | +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } |
| | 104 | +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } |
| | 105 | +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } |
| | 106 | +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } |
| | 107 | +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } |
| | 108 | +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } |
| | 109 | +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } |
| | 110 | +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } |
| | 111 | +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } |
| | 112 | +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } |
| | 113 | +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } |
| | 114 | +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } |
| | 115 | +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } |
| | 116 | +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } |
| | 117 | +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } |
| | 118 | +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } |
| | 119 | +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } |
| | 120 | +.ui-icon-arrow-4 { background-position: 0 -80px; } |
| | 121 | +.ui-icon-arrow-4-diag { background-position: -16px -80px; } |
| | 122 | +.ui-icon-extlink { background-position: -32px -80px; } |
| | 123 | +.ui-icon-newwin { background-position: -48px -80px; } |
| | 124 | +.ui-icon-refresh { background-position: -64px -80px; } |
| | 125 | +.ui-icon-shuffle { background-position: -80px -80px; } |
| | 126 | +.ui-icon-transfer-e-w { background-position: -96px -80px; } |
| | 127 | +.ui-icon-transferthick-e-w { background-position: -112px -80px; } |
| | 128 | +.ui-icon-folder-collapsed { background-position: 0 -96px; } |
| | 129 | +.ui-icon-folder-open { background-position: -16px -96px; } |
| | 130 | +.ui-icon-document { background-position: -32px -96px; } |
| | 131 | +.ui-icon-document-b { background-position: -48px -96px; } |
| | 132 | +.ui-icon-note { background-position: -64px -96px; } |
| | 133 | +.ui-icon-mail-closed { background-position: -80px -96px; } |
| | 134 | +.ui-icon-mail-open { background-position: -96px -96px; } |
| | 135 | +.ui-icon-suitcase { background-position: -112px -96px; } |
| | 136 | +.ui-icon-comment { background-position: -128px -96px; } |
| | 137 | +.ui-icon-person { background-position: -144px -96px; } |
| | 138 | +.ui-icon-print { background-position: -160px -96px; } |
| | 139 | +.ui-icon-trash { background-position: -176px -96px; } |
| | 140 | +.ui-icon-locked { background-position: -192px -96px; } |
| | 141 | +.ui-icon-unlocked { background-position: -208px -96px; } |
| | 142 | +.ui-icon-bookmark { background-position: -224px -96px; } |
| | 143 | +.ui-icon-tag { background-position: -240px -96px; } |
| | 144 | +.ui-icon-home { background-position: 0 -112px; } |
| | 145 | +.ui-icon-flag { background-position: -16px -112px; } |
| | 146 | +.ui-icon-calendar { background-position: -32px -112px; } |
| | 147 | +.ui-icon-cart { background-position: -48px -112px; } |
| | 148 | +.ui-icon-pencil { background-position: -64px -112px; } |
| | 149 | +.ui-icon-clock { background-position: -80px -112px; } |
| | 150 | +.ui-icon-disk { background-position: -96px -112px; } |
| | 151 | +.ui-icon-calculator { background-position: -112px -112px; } |
| | 152 | +.ui-icon-zoomin { background-position: -128px -112px; } |
| | 153 | +.ui-icon-zoomout { background-position: -144px -112px; } |
| | 154 | +.ui-icon-search { background-position: -160px -112px; } |
| | 155 | +.ui-icon-wrench { background-position: -176px -112px; } |
| | 156 | +.ui-icon-gear { background-position: -192px -112px; } |
| | 157 | +.ui-icon-heart { background-position: -208px -112px; } |
| | 158 | +.ui-icon-star { background-position: -224px -112px; } |
| | 159 | +.ui-icon-link { background-position: -240px -112px; } |
| | 160 | +.ui-icon-cancel { background-position: 0 -128px; } |
| | 161 | +.ui-icon-plus { background-position: -16px -128px; } |
| | 162 | +.ui-icon-plusthick { background-position: -32px -128px; } |
| | 163 | +.ui-icon-minus { background-position: -48px -128px; } |
| | 164 | +.ui-icon-minusthick { background-position: -64px -128px; } |
| | 165 | +.ui-icon-close { background-position: -80px -128px; } |
| | 166 | +.ui-icon-closethick { background-position: -96px -128px; } |
| | 167 | +.ui-icon-key { background-position: -112px -128px; } |
| | 168 | +.ui-icon-lightbulb { background-position: -128px -128px; } |
| | 169 | +.ui-icon-scissors { background-position: -144px -128px; } |
| | 170 | +.ui-icon-clipboard { background-position: -160px -128px; } |
| | 171 | +.ui-icon-copy { background-position: -176px -128px; } |
| | 172 | +.ui-icon-contact { background-position: -192px -128px; } |
| | 173 | +.ui-icon-image { background-position: -208px -128px; } |
| | 174 | +.ui-icon-video { background-position: -224px -128px; } |
| | 175 | +.ui-icon-script { background-position: -240px -128px; } |
| | 176 | +.ui-icon-alert { background-position: 0 -144px; } |
| | 177 | +.ui-icon-info { background-position: -16px -144px; } |
| | 178 | +.ui-icon-notice { background-position: -32px -144px; } |
| | 179 | +.ui-icon-help { background-position: -48px -144px; } |
| | 180 | +.ui-icon-check { background-position: -64px -144px; } |
| | 181 | +.ui-icon-bullet { background-position: -80px -144px; } |
| | 182 | +.ui-icon-radio-off { background-position: -96px -144px; } |
| | 183 | +.ui-icon-radio-on { background-position: -112px -144px; } |
| | 184 | +.ui-icon-pin-w { background-position: -128px -144px; } |
| | 185 | +.ui-icon-pin-s { background-position: -144px -144px; } |
| | 186 | +.ui-icon-play { background-position: 0 -160px; } |
| | 187 | +.ui-icon-pause { background-position: -16px -160px; } |
| | 188 | +.ui-icon-seek-next { background-position: -32px -160px; } |
| | 189 | +.ui-icon-seek-prev { background-position: -48px -160px; } |
| | 190 | +.ui-icon-seek-end { background-position: -64px -160px; } |
| | 191 | +.ui-icon-seek-start { background-position: -80px -160px; } |
| | 192 | +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ |
| | 193 | +.ui-icon-seek-first { background-position: -80px -160px; } |
| | 194 | +.ui-icon-stop { background-position: -96px -160px; } |
| | 195 | +.ui-icon-eject { background-position: -112px -160px; } |
| | 196 | +.ui-icon-volume-off { background-position: -128px -160px; } |
| | 197 | +.ui-icon-volume-on { background-position: -144px -160px; } |
| | 198 | +.ui-icon-power { background-position: 0 -176px; } |
| | 199 | +.ui-icon-signal-diag { background-position: -16px -176px; } |
| | 200 | +.ui-icon-signal { background-position: -32px -176px; } |
| | 201 | +.ui-icon-battery-0 { background-position: -48px -176px; } |
| | 202 | +.ui-icon-battery-1 { background-position: -64px -176px; } |
| | 203 | +.ui-icon-battery-2 { background-position: -80px -176px; } |
| | 204 | +.ui-icon-battery-3 { background-position: -96px -176px; } |
| | 205 | +.ui-icon-circle-plus { background-position: 0 -192px; } |
| | 206 | +.ui-icon-circle-minus { background-position: -16px -192px; } |
| | 207 | +.ui-icon-circle-close { background-position: -32px -192px; } |
| | 208 | +.ui-icon-circle-triangle-e { background-position: -48px -192px; } |
| | 209 | +.ui-icon-circle-triangle-s { background-position: -64px -192px; } |
| | 210 | +.ui-icon-circle-triangle-w { background-position: -80px -192px; } |
| | 211 | +.ui-icon-circle-triangle-n { background-position: -96px -192px; } |
| | 212 | +.ui-icon-circle-arrow-e { background-position: -112px -192px; } |
| | 213 | +.ui-icon-circle-arrow-s { background-position: -128px -192px; } |
| | 214 | +.ui-icon-circle-arrow-w { background-position: -144px -192px; } |
| | 215 | +.ui-icon-circle-arrow-n { background-position: -160px -192px; } |
| | 216 | +.ui-icon-circle-zoomin { background-position: -176px -192px; } |
| | 217 | +.ui-icon-circle-zoomout { background-position: -192px -192px; } |
| | 218 | +.ui-icon-circle-check { background-position: -208px -192px; } |
| | 219 | +.ui-icon-circlesmall-plus { background-position: 0 -208px; } |
| | 220 | +.ui-icon-circlesmall-minus { background-position: -16px -208px; } |
| | 221 | +.ui-icon-circlesmall-close { background-position: -32px -208px; } |
| | 222 | +.ui-icon-squaresmall-plus { background-position: -48px -208px; } |
| | 223 | +.ui-icon-squaresmall-minus { background-position: -64px -208px; } |
| | 224 | +.ui-icon-squaresmall-close { background-position: -80px -208px; } |
| | 225 | +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } |
| | 226 | +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } |
| | 227 | +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } |
| | 228 | +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } |
| | 229 | +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } |
| | 230 | +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } |
| | 231 | + |
| | 232 | + |
| | 233 | +/* Misc visuals |
| | 234 | +----------------------------------*/ |
| | 235 | + |
| | 236 | +/* Corner radius */ |
| | 237 | +.ui-corner-tl { -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; } |
| | 238 | +.ui-corner-tr { -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; } |
| | 239 | +.ui-corner-bl { -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; } |
| | 240 | +.ui-corner-br { -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; } |
| | 241 | +.ui-corner-top { -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; } |
| | 242 | +.ui-corner-bottom { -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; } |
| | 243 | +.ui-corner-right { -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; } |
| | 244 | +.ui-corner-left { -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; } |
| | 245 | +.ui-corner-all { -moz-border-radius: 0; -webkit-border-radius: 0; } |
| | 246 | + |
| | 247 | +/* Overlays */ |
| | 248 | +.ui-widget-overlay { background: #000000; opacity: .75;filter:Alpha(Opacity=75); } |
| | 249 | +.ui-widget-shadow { margin: -7px 0 0 -7px; padding: 7px; /* @embed */ background: #000000 url(images/ui-bg_flat_70_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; } |
| \ No newline at end of file |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-over-red.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-over-red.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 1 | 250 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_666666_256x240.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_666666_256x240.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 2 | 251 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-soft_100_e4f1fb_1x100.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-soft_100_e4f1fb_1x100.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 3 | 252 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-down-blue.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-down-blue.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 4 | 253 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_2e83ff_256x240.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_2e83ff_256x240.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 5 | 254 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-disabled-green.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-disabled-green.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 6 | 255 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-soft_100_ffffff_1x100.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-soft_100_ffffff_1x100.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 7 | 256 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-disabled.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-disabled.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 8 | 257 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-over-green.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-over-green.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 9 | 258 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-over.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-over.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 10 | 259 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-down-red.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-down-red.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 11 | 260 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_flat_70_000000_40x100.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_flat_70_000000_40x100.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 12 | 261 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_inset-hard_100_f0f0f0_1x100.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_inset-hard_100_f0f0f0_1x100.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 13 | 262 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-off-red.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-off-red.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 14 | 263 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-hard_100_f2f5f7_1x100.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-hard_100_f2f5f7_1x100.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 15 | 264 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_flat_15_cd0a0a_40x100.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_flat_15_cd0a0a_40x100.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 16 | 265 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_ffffff_256x240.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_ffffff_256x240.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 17 | 266 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/titlebar-fade.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/titlebar-fade.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 18 | 267 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-disabled-blue.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-disabled-blue.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 19 | 268 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/close.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/close.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 20 | 269 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-hard_80_d7ebf9_1x100.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-hard_80_d7ebf9_1x100.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 21 | 270 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-off-blue.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-off-blue.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 22 | 271 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-over-blue.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-over-blue.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 23 | 272 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_72a7cf_256x240.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_72a7cf_256x240.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 24 | 273 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-down-green.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-down-green.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 25 | 274 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-down.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-down.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 26 | 275 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-off-green.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-off-green.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 27 | 276 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_2694e8_256x240.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_2694e8_256x240.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 28 | 277 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-off.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-off.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 29 | 278 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_3d80b3_256x240.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-icons_3d80b3_256x240.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 30 | 279 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-anim_basic_16x16.gif |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-anim_basic_16x16.gif |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 31 | 280 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-soft_25_ffef8f_1x100.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/ui-bg_highlight-soft_25_ffef8f_1x100.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 32 | 281 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-disabled-red.png |
| Cannot display: file marked as a binary type. |
| svn:mime-type = application/octet-stream |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/images/button-disabled-red.png |
| ___________________________________________________________________ |
| Added: svn:mime-type |
| 33 | 282 | + application/octet-stream |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/lightbox1.css |
| — | — | @@ -0,0 +1,288 @@ |
| | 2 | +/* Pitch */ |
| | 3 | +#pitch { |
| | 4 | + height: 236px; |
| | 5 | + background-image: url(http://upload.wikimedia.org/wikipedia/foundation/d/dc/Jimmy_Appeal_2009.jpg); |
| | 6 | + background-position: right top; |
| | 7 | + background-repeat: no-repeat; |
| | 8 | + background-color: #1e1e1e; |
| | 9 | + border: 1px solid gray; |
| | 10 | + border-bottom-width: 0; |
| | 11 | +} |
| | 12 | +#pitch-head { |
| | 13 | + width: 50%; |
| | 14 | + font-size: 1.75em; |
| | 15 | + line-height: 1.5em; |
| | 16 | + color: white; |
| | 17 | + margin-top: 16px; |
| | 18 | + margin-left: 24px; |
| | 19 | +} |
| | 20 | +#pitch-body { |
| | 21 | + width: 50%; |
| | 22 | + font-size: 1em; |
| | 23 | + line-height: 1.5em; |
| | 24 | + color: white; |
| | 25 | + margin-top: 16px; |
| | 26 | + margin-left: 24px; |
| | 27 | +} |
| | 28 | + |
| | 29 | +#appeal-head { |
| | 30 | + font-size: 1.5em; |
| | 31 | + line-height: 1.125em; |
| | 32 | + padding-bottom: 0.5em; |
| | 33 | + padding-top: 0.125em; |
| | 34 | +} |
| | 35 | +#appeal-body { |
| | 36 | + padding: 0.2em 0em; |
| | 37 | + font-size: 1.125em; |
| | 38 | + margin-bottom: 1em; |
| | 39 | +} |
| | 40 | +/* Donate */ |
| | 41 | +#donate { |
| | 42 | + font-size: 16px; |
| | 43 | +} |
| | 44 | +#amount-table td { |
| | 45 | + font-size: 100%; |
| | 46 | + padding: 4px; |
| | 47 | +} |
| | 48 | + |
| | 49 | +#donate-content { |
| | 50 | + background-color: #CCE7CD; |
| | 51 | + border: 1px solid #5eac58; |
| | 52 | +} |
| | 53 | +#donate-head { |
| | 54 | + font-size: 1.5em; |
| | 55 | + line-height: 1.125em; |
| | 56 | + padding-bottom: 0.5em; |
| | 57 | + padding-top: 0.125em; |
| | 58 | + border-color: #5eac58; |
| | 59 | +} |
| | 60 | +#donate-body { |
| | 61 | + font-size: 1.25em; |
| | 62 | +} |
| | 63 | + |
| | 64 | +.donate-body-small { |
| | 65 | + font-size: .75em; |
| | 66 | + margin-bottom:1em; |
| | 67 | +} |
| | 68 | +.donate-options { |
| | 69 | + text-align: center; |
| | 70 | +} |
| | 71 | +.donate-options input { |
| | 72 | + width: 15em; |
| | 73 | +} |
| | 74 | + |
| | 75 | +input.button, select#input_currency_code { |
| | 76 | + font-size: 95%; |
| | 77 | +} |
| | 78 | + |
| | 79 | +table { |
| | 80 | + background-color: transparent; |
| | 81 | +} |
| | 82 | + |
| | 83 | +#footer { |
| | 84 | + background-image: none !important; |
| | 85 | +} |
| | 86 | + |
| | 87 | +#mw-head-base { |
| | 88 | + height: 1em !important; |
| | 89 | +} |
| | 90 | + |
| | 91 | +#mw-panel div.portal { |
| | 92 | + display: none !important; |
| | 93 | +} |
| | 94 | + |
| | 95 | +#p-namespaces, #p-views, #p-cactions, #p-search, #p-personal, #catlinks, #firstHeading, #contentSub, #siteSub { |
| | 96 | + display: none; |
| | 97 | +} |
| | 98 | + |
| | 99 | +div#content { |
| | 100 | + background-color: transparent !important; |
| | 101 | + background-image: none !important; |
| | 102 | +} |
| | 103 | + |
| | 104 | +div#mw-head-base { |
| | 105 | + background-image: none !important; |
| | 106 | +} |
| | 107 | + |
| | 108 | +.l { |
| | 109 | + float: left; |
| | 110 | +} |
| | 111 | +.r { |
| | 112 | + float: right; |
| | 113 | +} |
| | 114 | +hr { |
| | 115 | + margin: 1.5em 0 0.5em; |
| | 116 | +} |
| | 117 | +h3 span { |
| | 118 | + font-weight: normal; |
| | 119 | +} |
| | 120 | +#amount-table td { |
| | 121 | + white-space: nowrap; |
| | 122 | +} |
| | 123 | +.call-l { |
| | 124 | + float: left; |
| | 125 | + margin: 0.2em 1em 1em 0; |
| | 126 | +} |
| | 127 | +.call-l, .call-r { |
| | 128 | + background: none repeat scroll 0 0 #FFFFFF; |
| | 129 | + border: 1px solid #444444; |
| | 130 | + font-size: 13px; |
| | 131 | + padding: 15px 20px; |
| | 132 | +} |
| | 133 | +.call-l h3, .call-r h3 { |
| | 134 | + font-size: 17px; |
| | 135 | +} |
| | 136 | +.call-l .loading, .call-r .loading { |
| | 137 | + background-image: url("../images/loading-white.gif"); |
| | 138 | +} |
| | 139 | +.call-r { |
| | 140 | + float: right; |
| | 141 | + margin: 0.2em 0 1em 1em; |
| | 142 | +} |
| | 143 | +#loading { |
| | 144 | + font-size: 12px; |
| | 145 | + margin-left: 0.5em; |
| | 146 | + vertical-align: middle; |
| | 147 | +} |
| | 148 | +.loading { |
| | 149 | + background: url("../images/loading-green.gif") no-repeat scroll 50% 50% transparent; |
| | 150 | + padding: 10px; |
| | 151 | +} |
| | 152 | +.mute { |
| | 153 | + font-size: 12px; |
| | 154 | +} |
| | 155 | + |
| | 156 | +/* Callouts */ |
| | 157 | +.call-l, .call-r { width: 310px; } |
| | 158 | + |
| | 159 | +/* Layout */ |
| | 160 | +.clear { clear: both; } |
| | 161 | + |
| | 162 | +/* Lightbox */ |
| | 163 | +div.ui-dialog { |
| | 164 | + width: 600px; |
| | 165 | + overflow: hidden; |
| | 166 | +} |
| | 167 | +.ui-dialog .ui-dialog-title { |
| | 168 | + font-size: 1em; |
| | 169 | + font-weight: normal; |
| | 170 | +} |
| | 171 | +.ui-widget { |
| | 172 | + font-size: 1em; |
| | 173 | +} |
| | 174 | +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { |
| | 175 | + font-size: 0.8em; |
| | 176 | +} |
| | 177 | +input.btn { |
| | 178 | + font-size: 15px; |
| | 179 | + margin-bottom: 3px; |
| | 180 | +} |
| | 181 | +#dialog{ |
| | 182 | + overflow: hidden; |
| | 183 | +} |
| | 184 | +.ui-dialog .ui-dialog-content { |
| | 185 | + padding: 0; |
| | 186 | +} |
| | 187 | +#steps{ |
| | 188 | + width:600px; |
| | 189 | + overflow:hidden; |
| | 190 | + font-family:sans-serif; |
| | 191 | +} |
| | 192 | +.step{ |
| | 193 | + float:left; |
| | 194 | + width:600px; |
| | 195 | + position: relative; |
| | 196 | +} |
| | 197 | +.step-content { |
| | 198 | + padding: 20px; |
| | 199 | + height: 260px; |
| | 200 | +} |
| | 201 | + |
| | 202 | +#steps form fieldset{ |
| | 203 | + border:none; |
| | 204 | + padding: 0; |
| | 205 | + margin: 0; |
| | 206 | +} |
| | 207 | +#steps form legend{ |
| | 208 | + text-align:left; |
| | 209 | + color:#666; |
| | 210 | + font-size:24px; |
| | 211 | + /* text-shadow:1px 1px 1px #aaa; */ |
| | 212 | + font-weight:bold; |
| | 213 | + float:left; |
| | 214 | + width:580px; |
| | 215 | + padding:8px 0px 5px 20px; |
| | 216 | + margin:10px 0px; |
| | 217 | +} |
| | 218 | +#steps form div.stuff{ |
| | 219 | + clear:both; |
| | 220 | + margin:3px 0px; |
| | 221 | + width:auto; |
| | 222 | + padding:5px 10px; |
| | 223 | + /* |
| | 224 | + background-color:#f4f4f4; |
| | 225 | + border:1px solid #fff; |
| | 226 | + -moz-border-radius: 5px; |
| | 227 | + -webkit-border-radius: 5px; |
| | 228 | + border-radius: 5px; |
| | 229 | + -moz-box-shadow:0px 0px 3px #aaa; |
| | 230 | + -webkit-box-shadow:0px 0px 3px #aaa; |
| | 231 | + box-shadow:0px 0px 3px #aaa; |
| | 232 | + */ |
| | 233 | +} |
| | 234 | +#steps form div.stuff label{ |
| | 235 | + width:140px; |
| | 236 | + float:left; |
| | 237 | + text-align:right; |
| | 238 | + margin-right:12px; |
| | 239 | + line-height:26px; |
| | 240 | + color:#666; |
| | 241 | + /* text-shadow:1px 1px 1px #fff; */ |
| | 242 | + font-weight:bold; |
| | 243 | + font-size: 15px; |
| | 244 | +} |
| | 245 | +#steps form input:not([type=radio]), |
| | 246 | +#steps form textarea, |
| | 247 | +#steps form select{ |
| | 248 | + background: #ffffff; |
| | 249 | + border: 1px solid #ccc; |
| | 250 | + -moz-border-radius: 3px; |
| | 251 | + -webkit-border-radius: 3px; |
| | 252 | + border-radius: 3px; |
| | 253 | + outline: none; |
| | 254 | + padding: 5px; |
| | 255 | +} |
| | 256 | +#steps form input.widefield{ |
| | 257 | + width: 200px; |
| | 258 | + float:left; |
| | 259 | +} |
| | 260 | +#steps form input.large{ |
| | 261 | + font-size: 20px; |
| | 262 | + line-height: 22px; |
| | 263 | + width: 62px; |
| | 264 | +} |
| | 265 | +#steps form input:focus{ |
| | 266 | + -moz-box-shadow:0px 0px 3px #aaa; |
| | 267 | + -webkit-box-shadow:0px 0px 3px #aaa; |
| | 268 | + box-shadow:0px 0px 3px #aaa; |
| | 269 | + background-color:#FFFEEF; |
| | 270 | +} |
| | 271 | +#steps form p.submit{ |
| | 272 | + background:none; |
| | 273 | + border:none; |
| | 274 | + -moz-box-shadow:none; |
| | 275 | + -webkit-box-shadow:none; |
| | 276 | + box-shadow:none; |
| | 277 | +} |
| | 278 | +#steps form a.back-button { |
| | 279 | + position: absolute; |
| | 280 | + bottom: 25px; |
| | 281 | + left: 25px; |
| | 282 | + margin: 0 !important; |
| | 283 | +} |
| | 284 | +#steps form a.continue-button { |
| | 285 | + position: absolute; |
| | 286 | + bottom: 25px; |
| | 287 | + right: 25px; |
| | 288 | + margin: 0 !important; |
| | 289 | +} |
| \ No newline at end of file |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/jquery.ui.core.css |
| — | — | @@ -0,0 +1,37 @@ |
| | 2 | +/* |
| | 3 | +* jQuery UI CSS Framework |
| | 4 | +* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about) |
| | 5 | +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. |
| | 6 | +*/ |
| | 7 | + |
| | 8 | +/* Layout helpers |
| | 9 | +----------------------------------*/ |
| | 10 | +.ui-helper-hidden { display: none; } |
| | 11 | +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } |
| | 12 | +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } |
| | 13 | +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } |
| | 14 | +.ui-helper-clearfix { display: inline-block; } |
| | 15 | +/* required comment for clearfix to work in Opera \*/ |
| | 16 | +* html .ui-helper-clearfix { height:1%; } |
| | 17 | +.ui-helper-clearfix { display:block; } |
| | 18 | +/* end clearfix */ |
| | 19 | +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } |
| | 20 | + |
| | 21 | + |
| | 22 | +/* Interaction Cues |
| | 23 | +----------------------------------*/ |
| | 24 | +.ui-state-disabled { cursor: default !important; } |
| | 25 | + |
| | 26 | + |
| | 27 | +/* Icons |
| | 28 | +----------------------------------*/ |
| | 29 | + |
| | 30 | +/* states and images */ |
| | 31 | +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } |
| | 32 | + |
| | 33 | + |
| | 34 | +/* Misc visuals |
| | 35 | +----------------------------------*/ |
| | 36 | + |
| | 37 | +/* Overlays */ |
| | 38 | +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/css/jquery.ui.button.css |
| — | — | @@ -0,0 +1,147 @@ |
| | 2 | +/* Button |
| | 3 | +----------------------------------*/ |
| | 4 | + |
| | 5 | +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ |
| | 6 | +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ |
| | 7 | +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ |
| | 8 | +.ui-button-icons-only { width: 3.4em; } |
| | 9 | +button.ui-button-icons-only { width: 3.7em; } |
| | 10 | + |
| | 11 | +/*button text element */ |
| | 12 | +.ui-button .ui-button-text { display: block; line-height: 1.4em; } |
| | 13 | +.ui-button-text-only .ui-button-text { padding: 0.3em 1em 0.25em 1em; } |
| | 14 | +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: 0.3em; text-indent: -9999999px; } |
| | 15 | +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: 0.3em 1em 0.25em 2.1em; } |
| | 16 | +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: 0.3em 2.1em 0.25em 1em; } |
| | 17 | +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } |
| | 18 | +/* for older versions of jQuery UI */ |
| | 19 | +.ui-button-text-icon .ui-button-text { padding: 0.3em 1em 0.3em 2.1em; } |
| | 20 | + |
| | 21 | +/* no icon support for input elements, provide padding by default */ |
| | 22 | +input.ui-button { padding: 0.3em 1em; } |
| | 23 | + |
| | 24 | +/*button icon element(s) */ |
| | 25 | +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -9px; } |
| | 26 | +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } |
| | 27 | +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: 0.5em; } |
| | 28 | +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icon .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: 0.5em; } |
| | 29 | + |
| | 30 | +/*button sets*/ |
| | 31 | +.ui-buttonset { margin-right: 7px; } |
| | 32 | +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } |
| | 33 | + |
| | 34 | +/* workarounds */ |
| | 35 | +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ |
| | 36 | + |
| | 37 | +body .ui-button { |
| | 38 | + -moz-border-radius: 4px; |
| | 39 | + -webkit-border-radius: 4px; |
| | 40 | + border-radius: 4px; |
| | 41 | + margin: 0.5em 0 0.5em 0.4em !important; |
| | 42 | + border: 1px solid #a6a6a6 !important; |
| | 43 | + /* @embed */ |
| | 44 | + background: #f2f2f2 url(images/button-off.png) repeat-x scroll 50% 100% !important; |
| | 45 | + cursor: pointer; |
| | 46 | + font-size: 1em; |
| | 47 | + line-height: 1.4em; |
| | 48 | + width: auto; |
| | 49 | + overflow: visible; |
| | 50 | +} |
| | 51 | +body .ui-button:hover { |
| | 52 | + border-color: #6e7273; |
| | 53 | + /* @embed */ |
| | 54 | + background: #e1e1e1 url(images/button-over.png) repeat-x scroll 50% 100% !important; |
| | 55 | +} |
| | 56 | +body .ui-button:active, |
| | 57 | +body .ui-button:focus { |
| | 58 | + border-color: #707271; |
| | 59 | + /* @embed */ |
| | 60 | + background: #bfbfbf url(images/button-down.png) repeat-x scroll 50% 100% !important; |
| | 61 | +} |
| | 62 | +body .ui-button.disabled { |
| | 63 | + color: #7f7f7f; |
| | 64 | + border-color: #cccccc; |
| | 65 | + /* @embed */ |
| | 66 | + background: #f2f2f2 url(images/button-disabled.png) repeat-x scroll 50% 100% !important; |
| | 67 | +} |
| | 68 | +/* Disables the annoying dashed border Firefox puts on active buttons */ |
| | 69 | +body button.ui-button::-moz-focus-inner { |
| | 70 | + border: 0; |
| | 71 | +} |
| | 72 | + |
| | 73 | +/* Green buttons */ |
| | 74 | + |
| | 75 | +body .ui-button.ui-button-green { |
| | 76 | + color: white; |
| | 77 | + border-color: #97af7e !important; |
| | 78 | + /* @embed */ |
| | 79 | + background: #85c940 url(images/button-off-green.png) repeat-x scroll 50% 100% !important; |
| | 80 | +} |
| | 81 | +body .ui-button.ui-button-green:hover { |
| | 82 | + border-color: #778e61; |
| | 83 | + /* @embed */ |
| | 84 | + background: #77ad40 url(images/button-over-green.png) repeat-x scroll 50% 100% !important; |
| | 85 | +} |
| | 86 | +body .ui-button.ui-button-green:active, |
| | 87 | +body .ui-button.ui-button-green:focus { |
| | 88 | + border-color: #61b000; |
| | 89 | + /* @embed */ |
| | 90 | + background: #54a800 url(images/button-down-green.png) repeat-x scroll 50% 100% !important; |
| | 91 | +} |
| | 92 | +body .ui-button.ui-button-green.disabled { |
| | 93 | + color: #7f7f7f; |
| | 94 | + border-color: #b8d29f; |
| | 95 | + /* @embed */ |
| | 96 | + background: #c9cfc3 url(images/button-disabled-green.png) repeat-x scroll 50% 100% !important; |
| | 97 | +} |
| | 98 | + |
| | 99 | +/* Blue buttons */ |
| | 100 | + |
| | 101 | +body .ui-button.ui-button-blue { |
| | 102 | + color: white; |
| | 103 | + border-color: #407ec9 !important; |
| | 104 | + /* @embed */ |
| | 105 | + background: #407ec9 url(images/button-off-blue.png) repeat-x scroll 50% 100% !important; |
| | 106 | +} |
| | 107 | +body .ui-button.ui-button-blue:hover { |
| | 108 | + border-color: #245289; |
| | 109 | + /* @embed */ |
| | 110 | + background: #4071ad url(images/button-over-blue.png) repeat-x scroll 50% 100% !important; |
| | 111 | +} |
| | 112 | +body .ui-button.ui-button-blue:active, |
| | 113 | +body .ui-button.ui-button-blue:focus { |
| | 114 | + border-color: #003980; |
| | 115 | + /* @embed */ |
| | 116 | + background: #004daa url(images/button-down-blue.png) repeat-x scroll 50% 100% !important; |
| | 117 | +} |
| | 118 | +body .ui-button.ui-button-blue.disabled { |
| | 119 | + border-color: #9eafc6; |
| | 120 | + /* @embed */ |
| | 121 | + background: #c3c8cf url(images/button-disabled-blue.png) repeat-x scroll 50% 100% !important; |
| | 122 | +} |
| | 123 | + |
| | 124 | +/* Red buttons */ |
| | 125 | + |
| | 126 | +body .ui-button.ui-button-red { |
| | 127 | + color: white; |
| | 128 | + border-color: #af977e !important; |
| | 129 | + /* @embed */ |
| | 130 | + background: #c9404c url(images/button-off-red.png) repeat-x scroll 50% 100% !important; |
| | 131 | +} |
| | 132 | +body .ui-button.ui-button-red:hover { |
| | 133 | + border-color: #8e7761; |
| | 134 | + /* @embed */ |
| | 135 | + background: #ad404a url(images/button-over-red.png) repeat-x scroll 50% 100% !important; |
| | 136 | +} |
| | 137 | +body .ui-button.ui-button-red:active, |
| | 138 | +body .ui-button.ui-button-red:focus { |
| | 139 | + border-color: #b06100; |
| | 140 | + /* @embed */ |
| | 141 | + background: #aa000f url(images/button-down-red.png) repeat-x scroll 50% 100% !important; |
| | 142 | +} |
| | 143 | +body .ui-button.ui-button-red.disabled { |
| | 144 | + color: #7f7f7f; |
| | 145 | + border-color: #c3acae; |
| | 146 | + /* @embed */ |
| | 147 | + background: #cfc3c4 url(images/button-disabled-red.png) repeat-x scroll 50% 100% !important; |
| | 148 | +} |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.button.js |
| — | — | @@ -0,0 +1,387 @@ |
| | 2 | +/* |
| | 3 | + * jQuery UI Button 1.8.11 |
| | 4 | + * |
| | 5 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 6 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 7 | + * http://jquery.org/license |
| | 8 | + * |
| | 9 | + * http://docs.jquery.com/UI/Button |
| | 10 | + * |
| | 11 | + * Depends: |
| | 12 | + * jquery.ui.core.js |
| | 13 | + * jquery.ui.widget.js |
| | 14 | + */ |
| | 15 | +(function( $, undefined ) { |
| | 16 | + |
| | 17 | +var lastActive, |
| | 18 | + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", |
| | 19 | + stateClasses = "ui-state-hover ui-state-active ", |
| | 20 | + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", |
| | 21 | + formResetHandler = function( event ) { |
| | 22 | + $( ":ui-button", event.target.form ).each(function() { |
| | 23 | + var inst = $( this ).data( "button" ); |
| | 24 | + setTimeout(function() { |
| | 25 | + inst.refresh(); |
| | 26 | + }, 1 ); |
| | 27 | + }); |
| | 28 | + }, |
| | 29 | + radioGroup = function( radio ) { |
| | 30 | + var name = radio.name, |
| | 31 | + form = radio.form, |
| | 32 | + radios = $( [] ); |
| | 33 | + if ( name ) { |
| | 34 | + if ( form ) { |
| | 35 | + radios = $( form ).find( "[name='" + name + "']" ); |
| | 36 | + } else { |
| | 37 | + radios = $( "[name='" + name + "']", radio.ownerDocument ) |
| | 38 | + .filter(function() { |
| | 39 | + return !this.form; |
| | 40 | + }); |
| | 41 | + } |
| | 42 | + } |
| | 43 | + return radios; |
| | 44 | + }; |
| | 45 | + |
| | 46 | +$.widget( "ui.button", { |
| | 47 | + options: { |
| | 48 | + disabled: null, |
| | 49 | + text: true, |
| | 50 | + label: null, |
| | 51 | + icons: { |
| | 52 | + primary: null, |
| | 53 | + secondary: null |
| | 54 | + } |
| | 55 | + }, |
| | 56 | + _create: function() { |
| | 57 | + this.element.closest( "form" ) |
| | 58 | + .unbind( "reset.button" ) |
| | 59 | + .bind( "reset.button", formResetHandler ); |
| | 60 | + |
| | 61 | + if ( typeof this.options.disabled !== "boolean" ) { |
| | 62 | + this.options.disabled = this.element.attr( "disabled" ); |
| | 63 | + } |
| | 64 | + |
| | 65 | + this._determineButtonType(); |
| | 66 | + this.hasTitle = !!this.buttonElement.attr( "title" ); |
| | 67 | + |
| | 68 | + var self = this, |
| | 69 | + options = this.options, |
| | 70 | + toggleButton = this.type === "checkbox" || this.type === "radio", |
| | 71 | + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), |
| | 72 | + focusClass = "ui-state-focus"; |
| | 73 | + |
| | 74 | + if ( options.label === null ) { |
| | 75 | + options.label = this.buttonElement.html(); |
| | 76 | + } |
| | 77 | + |
| | 78 | + if ( this.element.is( ":disabled" ) ) { |
| | 79 | + options.disabled = true; |
| | 80 | + } |
| | 81 | + |
| | 82 | + this.buttonElement |
| | 83 | + .addClass( baseClasses ) |
| | 84 | + .attr( "role", "button" ) |
| | 85 | + .bind( "mouseenter.button", function() { |
| | 86 | + if ( options.disabled ) { |
| | 87 | + return; |
| | 88 | + } |
| | 89 | + $( this ).addClass( "ui-state-hover" ); |
| | 90 | + if ( this === lastActive ) { |
| | 91 | + $( this ).addClass( "ui-state-active" ); |
| | 92 | + } |
| | 93 | + }) |
| | 94 | + .bind( "mouseleave.button", function() { |
| | 95 | + if ( options.disabled ) { |
| | 96 | + return; |
| | 97 | + } |
| | 98 | + $( this ).removeClass( hoverClass ); |
| | 99 | + }) |
| | 100 | + .bind( "focus.button", function() { |
| | 101 | + // no need to check disabled, focus won't be triggered anyway |
| | 102 | + $( this ).addClass( focusClass ); |
| | 103 | + }) |
| | 104 | + .bind( "blur.button", function() { |
| | 105 | + $( this ).removeClass( focusClass ); |
| | 106 | + }); |
| | 107 | + |
| | 108 | + if ( toggleButton ) { |
| | 109 | + this.element.bind( "change.button", function() { |
| | 110 | + self.refresh(); |
| | 111 | + }); |
| | 112 | + } |
| | 113 | + |
| | 114 | + if ( this.type === "checkbox" ) { |
| | 115 | + this.buttonElement.bind( "click.button", function() { |
| | 116 | + if ( options.disabled ) { |
| | 117 | + return false; |
| | 118 | + } |
| | 119 | + $( this ).toggleClass( "ui-state-active" ); |
| | 120 | + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); |
| | 121 | + }); |
| | 122 | + } else if ( this.type === "radio" ) { |
| | 123 | + this.buttonElement.bind( "click.button", function() { |
| | 124 | + if ( options.disabled ) { |
| | 125 | + return false; |
| | 126 | + } |
| | 127 | + $( this ).addClass( "ui-state-active" ); |
| | 128 | + self.buttonElement.attr( "aria-pressed", true ); |
| | 129 | + |
| | 130 | + var radio = self.element[ 0 ]; |
| | 131 | + radioGroup( radio ) |
| | 132 | + .not( radio ) |
| | 133 | + .map(function() { |
| | 134 | + return $( this ).button( "widget" )[ 0 ]; |
| | 135 | + }) |
| | 136 | + .removeClass( "ui-state-active" ) |
| | 137 | + .attr( "aria-pressed", false ); |
| | 138 | + }); |
| | 139 | + } else { |
| | 140 | + this.buttonElement |
| | 141 | + .bind( "mousedown.button", function() { |
| | 142 | + if ( options.disabled ) { |
| | 143 | + return false; |
| | 144 | + } |
| | 145 | + $( this ).addClass( "ui-state-active" ); |
| | 146 | + lastActive = this; |
| | 147 | + $( document ).one( "mouseup", function() { |
| | 148 | + lastActive = null; |
| | 149 | + }); |
| | 150 | + }) |
| | 151 | + .bind( "mouseup.button", function() { |
| | 152 | + if ( options.disabled ) { |
| | 153 | + return false; |
| | 154 | + } |
| | 155 | + $( this ).removeClass( "ui-state-active" ); |
| | 156 | + }) |
| | 157 | + .bind( "keydown.button", function(event) { |
| | 158 | + if ( options.disabled ) { |
| | 159 | + return false; |
| | 160 | + } |
| | 161 | + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { |
| | 162 | + $( this ).addClass( "ui-state-active" ); |
| | 163 | + } |
| | 164 | + }) |
| | 165 | + .bind( "keyup.button", function() { |
| | 166 | + $( this ).removeClass( "ui-state-active" ); |
| | 167 | + }); |
| | 168 | + |
| | 169 | + if ( this.buttonElement.is("a") ) { |
| | 170 | + this.buttonElement.keyup(function(event) { |
| | 171 | + if ( event.keyCode === $.ui.keyCode.SPACE ) { |
| | 172 | + // TODO pass through original event correctly (just as 2nd argument doesn't work) |
| | 173 | + $( this ).click(); |
| | 174 | + } |
| | 175 | + }); |
| | 176 | + } |
| | 177 | + } |
| | 178 | + |
| | 179 | + // TODO: pull out $.Widget's handling for the disabled option into |
| | 180 | + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can |
| | 181 | + // be overridden by individual plugins |
| | 182 | + this._setOption( "disabled", options.disabled ); |
| | 183 | + }, |
| | 184 | + |
| | 185 | + _determineButtonType: function() { |
| | 186 | + |
| | 187 | + if ( this.element.is(":checkbox") ) { |
| | 188 | + this.type = "checkbox"; |
| | 189 | + } else { |
| | 190 | + if ( this.element.is(":radio") ) { |
| | 191 | + this.type = "radio"; |
| | 192 | + } else { |
| | 193 | + if ( this.element.is("input") ) { |
| | 194 | + this.type = "input"; |
| | 195 | + } else { |
| | 196 | + this.type = "button"; |
| | 197 | + } |
| | 198 | + } |
| | 199 | + } |
| | 200 | + |
| | 201 | + if ( this.type === "checkbox" || this.type === "radio" ) { |
| | 202 | + // we don't search against the document in case the element |
| | 203 | + // is disconnected from the DOM |
| | 204 | + var ancestor = this.element.parents().filter(":last"), |
| | 205 | + labelSelector = "label[for=" + this.element.attr("id") + "]"; |
| | 206 | + this.buttonElement = ancestor.find( labelSelector ); |
| | 207 | + if ( !this.buttonElement.length ) { |
| | 208 | + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); |
| | 209 | + this.buttonElement = ancestor.filter( labelSelector ); |
| | 210 | + if ( !this.buttonElement.length ) { |
| | 211 | + this.buttonElement = ancestor.find( labelSelector ); |
| | 212 | + } |
| | 213 | + } |
| | 214 | + this.element.addClass( "ui-helper-hidden-accessible" ); |
| | 215 | + |
| | 216 | + var checked = this.element.is( ":checked" ); |
| | 217 | + if ( checked ) { |
| | 218 | + this.buttonElement.addClass( "ui-state-active" ); |
| | 219 | + } |
| | 220 | + this.buttonElement.attr( "aria-pressed", checked ); |
| | 221 | + } else { |
| | 222 | + this.buttonElement = this.element; |
| | 223 | + } |
| | 224 | + }, |
| | 225 | + |
| | 226 | + widget: function() { |
| | 227 | + return this.buttonElement; |
| | 228 | + }, |
| | 229 | + |
| | 230 | + destroy: function() { |
| | 231 | + this.element |
| | 232 | + .removeClass( "ui-helper-hidden-accessible" ); |
| | 233 | + this.buttonElement |
| | 234 | + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) |
| | 235 | + .removeAttr( "role" ) |
| | 236 | + .removeAttr( "aria-pressed" ) |
| | 237 | + .html( this.buttonElement.find(".ui-button-text").html() ); |
| | 238 | + |
| | 239 | + if ( !this.hasTitle ) { |
| | 240 | + this.buttonElement.removeAttr( "title" ); |
| | 241 | + } |
| | 242 | + |
| | 243 | + $.Widget.prototype.destroy.call( this ); |
| | 244 | + }, |
| | 245 | + |
| | 246 | + _setOption: function( key, value ) { |
| | 247 | + $.Widget.prototype._setOption.apply( this, arguments ); |
| | 248 | + if ( key === "disabled" ) { |
| | 249 | + if ( value ) { |
| | 250 | + this.element.attr( "disabled", true ); |
| | 251 | + } else { |
| | 252 | + this.element.removeAttr( "disabled" ); |
| | 253 | + } |
| | 254 | + } |
| | 255 | + this._resetButton(); |
| | 256 | + }, |
| | 257 | + |
| | 258 | + refresh: function() { |
| | 259 | + var isDisabled = this.element.is( ":disabled" ); |
| | 260 | + if ( isDisabled !== this.options.disabled ) { |
| | 261 | + this._setOption( "disabled", isDisabled ); |
| | 262 | + } |
| | 263 | + if ( this.type === "radio" ) { |
| | 264 | + radioGroup( this.element[0] ).each(function() { |
| | 265 | + if ( $( this ).is( ":checked" ) ) { |
| | 266 | + $( this ).button( "widget" ) |
| | 267 | + .addClass( "ui-state-active" ) |
| | 268 | + .attr( "aria-pressed", true ); |
| | 269 | + } else { |
| | 270 | + $( this ).button( "widget" ) |
| | 271 | + .removeClass( "ui-state-active" ) |
| | 272 | + .attr( "aria-pressed", false ); |
| | 273 | + } |
| | 274 | + }); |
| | 275 | + } else if ( this.type === "checkbox" ) { |
| | 276 | + if ( this.element.is( ":checked" ) ) { |
| | 277 | + this.buttonElement |
| | 278 | + .addClass( "ui-state-active" ) |
| | 279 | + .attr( "aria-pressed", true ); |
| | 280 | + } else { |
| | 281 | + this.buttonElement |
| | 282 | + .removeClass( "ui-state-active" ) |
| | 283 | + .attr( "aria-pressed", false ); |
| | 284 | + } |
| | 285 | + } |
| | 286 | + }, |
| | 287 | + |
| | 288 | + _resetButton: function() { |
| | 289 | + if ( this.type === "input" ) { |
| | 290 | + if ( this.options.label ) { |
| | 291 | + this.element.val( this.options.label ); |
| | 292 | + } |
| | 293 | + return; |
| | 294 | + } |
| | 295 | + var buttonElement = this.buttonElement.removeClass( typeClasses ), |
| | 296 | + buttonText = $( "<span></span>" ) |
| | 297 | + .addClass( "ui-button-text" ) |
| | 298 | + .html( this.options.label ) |
| | 299 | + .appendTo( buttonElement.empty() ) |
| | 300 | + .text(), |
| | 301 | + icons = this.options.icons, |
| | 302 | + multipleIcons = icons.primary && icons.secondary, |
| | 303 | + buttonClasses = []; |
| | 304 | + |
| | 305 | + if ( icons.primary || icons.secondary ) { |
| | 306 | + if ( this.options.text ) { |
| | 307 | + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); |
| | 308 | + } |
| | 309 | + |
| | 310 | + if ( icons.primary ) { |
| | 311 | + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); |
| | 312 | + } |
| | 313 | + |
| | 314 | + if ( icons.secondary ) { |
| | 315 | + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); |
| | 316 | + } |
| | 317 | + |
| | 318 | + if ( !this.options.text ) { |
| | 319 | + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); |
| | 320 | + |
| | 321 | + if ( !this.hasTitle ) { |
| | 322 | + buttonElement.attr( "title", buttonText ); |
| | 323 | + } |
| | 324 | + } |
| | 325 | + } else { |
| | 326 | + buttonClasses.push( "ui-button-text-only" ); |
| | 327 | + } |
| | 328 | + buttonElement.addClass( buttonClasses.join( " " ) ); |
| | 329 | + } |
| | 330 | +}); |
| | 331 | + |
| | 332 | +$.widget( "ui.buttonset", { |
| | 333 | + options: { |
| | 334 | + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" |
| | 335 | + }, |
| | 336 | + |
| | 337 | + _create: function() { |
| | 338 | + this.element.addClass( "ui-buttonset" ); |
| | 339 | + }, |
| | 340 | + |
| | 341 | + _init: function() { |
| | 342 | + this.refresh(); |
| | 343 | + }, |
| | 344 | + |
| | 345 | + _setOption: function( key, value ) { |
| | 346 | + if ( key === "disabled" ) { |
| | 347 | + this.buttons.button( "option", key, value ); |
| | 348 | + } |
| | 349 | + |
| | 350 | + $.Widget.prototype._setOption.apply( this, arguments ); |
| | 351 | + }, |
| | 352 | + |
| | 353 | + refresh: function() { |
| | 354 | + this.buttons = this.element.find( this.options.items ) |
| | 355 | + .filter( ":ui-button" ) |
| | 356 | + .button( "refresh" ) |
| | 357 | + .end() |
| | 358 | + .not( ":ui-button" ) |
| | 359 | + .button() |
| | 360 | + .end() |
| | 361 | + .map(function() { |
| | 362 | + return $( this ).button( "widget" )[ 0 ]; |
| | 363 | + }) |
| | 364 | + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) |
| | 365 | + .filter( ":first" ) |
| | 366 | + .addClass( "ui-corner-left" ) |
| | 367 | + .end() |
| | 368 | + .filter( ":last" ) |
| | 369 | + .addClass( "ui-corner-right" ) |
| | 370 | + .end() |
| | 371 | + .end(); |
| | 372 | + }, |
| | 373 | + |
| | 374 | + destroy: function() { |
| | 375 | + this.element.removeClass( "ui-buttonset" ); |
| | 376 | + this.buttons |
| | 377 | + .map(function() { |
| | 378 | + return $( this ).button( "widget" )[ 0 ]; |
| | 379 | + }) |
| | 380 | + .removeClass( "ui-corner-left ui-corner-right" ) |
| | 381 | + .end() |
| | 382 | + .button( "destroy" ); |
| | 383 | + |
| | 384 | + $.Widget.prototype.destroy.call( this ); |
| | 385 | + } |
| | 386 | +}); |
| | 387 | + |
| | 388 | +}( jQuery ) ); |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.dialog.js |
| — | — | @@ -0,0 +1,857 @@ |
| | 2 | +/* |
| | 3 | + * jQuery UI Dialog 1.8.11 |
| | 4 | + * |
| | 5 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 6 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 7 | + * http://jquery.org/license |
| | 8 | + * |
| | 9 | + * http://docs.jquery.com/UI/Dialog |
| | 10 | + * |
| | 11 | + * Depends: |
| | 12 | + * jquery.ui.core.js |
| | 13 | + * jquery.ui.widget.js |
| | 14 | + * jquery.ui.button.js |
| | 15 | + * jquery.ui.draggable.js |
| | 16 | + * jquery.ui.mouse.js |
| | 17 | + * jquery.ui.position.js |
| | 18 | + * jquery.ui.resizable.js |
| | 19 | + */ |
| | 20 | +(function( $, undefined ) { |
| | 21 | + |
| | 22 | +var uiDialogClasses = |
| | 23 | + 'ui-dialog ' + |
| | 24 | + 'ui-widget ' + |
| | 25 | + 'ui-widget-content ' + |
| | 26 | + 'ui-corner-all ', |
| | 27 | + sizeRelatedOptions = { |
| | 28 | + buttons: true, |
| | 29 | + height: true, |
| | 30 | + maxHeight: true, |
| | 31 | + maxWidth: true, |
| | 32 | + minHeight: true, |
| | 33 | + minWidth: true, |
| | 34 | + width: true |
| | 35 | + }, |
| | 36 | + resizableRelatedOptions = { |
| | 37 | + maxHeight: true, |
| | 38 | + maxWidth: true, |
| | 39 | + minHeight: true, |
| | 40 | + minWidth: true |
| | 41 | + }; |
| | 42 | + |
| | 43 | +$.widget("ui.dialog", { |
| | 44 | + options: { |
| | 45 | + autoOpen: true, |
| | 46 | + buttons: {}, |
| | 47 | + closeOnEscape: true, |
| | 48 | + closeText: 'close', |
| | 49 | + dialogClass: '', |
| | 50 | + draggable: true, |
| | 51 | + hide: null, |
| | 52 | + height: 'auto', |
| | 53 | + maxHeight: false, |
| | 54 | + maxWidth: false, |
| | 55 | + minHeight: 150, |
| | 56 | + minWidth: 150, |
| | 57 | + modal: false, |
| | 58 | + position: { |
| | 59 | + my: 'center', |
| | 60 | + at: 'center', |
| | 61 | + collision: 'fit', |
| | 62 | + // ensure that the titlebar is never outside the document |
| | 63 | + using: function(pos) { |
| | 64 | + var topOffset = $(this).css(pos).offset().top; |
| | 65 | + if (topOffset < 0) { |
| | 66 | + $(this).css('top', pos.top - topOffset); |
| | 67 | + } |
| | 68 | + } |
| | 69 | + }, |
| | 70 | + resizable: true, |
| | 71 | + show: null, |
| | 72 | + stack: true, |
| | 73 | + title: '', |
| | 74 | + width: 300, |
| | 75 | + zIndex: 1000 |
| | 76 | + }, |
| | 77 | + |
| | 78 | + _create: function() { |
| | 79 | + this.originalTitle = this.element.attr('title'); |
| | 80 | + // #5742 - .attr() might return a DOMElement |
| | 81 | + if ( typeof this.originalTitle !== "string" ) { |
| | 82 | + this.originalTitle = ""; |
| | 83 | + } |
| | 84 | + |
| | 85 | + this.options.title = this.options.title || this.originalTitle; |
| | 86 | + var self = this, |
| | 87 | + options = self.options, |
| | 88 | + |
| | 89 | + title = options.title || ' ', |
| | 90 | + titleId = $.ui.dialog.getTitleId(self.element), |
| | 91 | + |
| | 92 | + uiDialog = (self.uiDialog = $('<div></div>')) |
| | 93 | + .appendTo(document.body) |
| | 94 | + .hide() |
| | 95 | + .addClass(uiDialogClasses + options.dialogClass) |
| | 96 | + .css({ |
| | 97 | + zIndex: options.zIndex |
| | 98 | + }) |
| | 99 | + // setting tabIndex makes the div focusable |
| | 100 | + // setting outline to 0 prevents a border on focus in Mozilla |
| | 101 | + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { |
| | 102 | + if (options.closeOnEscape && event.keyCode && |
| | 103 | + event.keyCode === $.ui.keyCode.ESCAPE) { |
| | 104 | + |
| | 105 | + self.close(event); |
| | 106 | + event.preventDefault(); |
| | 107 | + } |
| | 108 | + }) |
| | 109 | + .attr({ |
| | 110 | + role: 'dialog', |
| | 111 | + 'aria-labelledby': titleId |
| | 112 | + }) |
| | 113 | + .mousedown(function(event) { |
| | 114 | + self.moveToTop(false, event); |
| | 115 | + }), |
| | 116 | + |
| | 117 | + uiDialogContent = self.element |
| | 118 | + .show() |
| | 119 | + .removeAttr('title') |
| | 120 | + .addClass( |
| | 121 | + 'ui-dialog-content ' + |
| | 122 | + 'ui-widget-content') |
| | 123 | + .appendTo(uiDialog), |
| | 124 | + |
| | 125 | + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) |
| | 126 | + .addClass( |
| | 127 | + 'ui-dialog-titlebar ' + |
| | 128 | + 'ui-widget-header ' + |
| | 129 | + 'ui-corner-all ' + |
| | 130 | + 'ui-helper-clearfix' |
| | 131 | + ) |
| | 132 | + .prependTo(uiDialog), |
| | 133 | + |
| | 134 | + uiDialogTitlebarClose = $('<a href="#"></a>') |
| | 135 | + .addClass( |
| | 136 | + 'ui-dialog-titlebar-close ' + |
| | 137 | + 'ui-corner-all' |
| | 138 | + ) |
| | 139 | + .attr('role', 'button') |
| | 140 | + .hover( |
| | 141 | + function() { |
| | 142 | + uiDialogTitlebarClose.addClass('ui-state-hover'); |
| | 143 | + }, |
| | 144 | + function() { |
| | 145 | + uiDialogTitlebarClose.removeClass('ui-state-hover'); |
| | 146 | + } |
| | 147 | + ) |
| | 148 | + .focus(function() { |
| | 149 | + uiDialogTitlebarClose.addClass('ui-state-focus'); |
| | 150 | + }) |
| | 151 | + .blur(function() { |
| | 152 | + uiDialogTitlebarClose.removeClass('ui-state-focus'); |
| | 153 | + }) |
| | 154 | + .click(function(event) { |
| | 155 | + self.close(event); |
| | 156 | + return false; |
| | 157 | + }) |
| | 158 | + .appendTo(uiDialogTitlebar), |
| | 159 | + |
| | 160 | + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) |
| | 161 | + .addClass( |
| | 162 | + 'ui-icon ' + |
| | 163 | + 'ui-icon-closethick' |
| | 164 | + ) |
| | 165 | + .text(options.closeText) |
| | 166 | + .appendTo(uiDialogTitlebarClose), |
| | 167 | + |
| | 168 | + uiDialogTitle = $('<span></span>') |
| | 169 | + .addClass('ui-dialog-title') |
| | 170 | + .attr('id', titleId) |
| | 171 | + .html(title) |
| | 172 | + .prependTo(uiDialogTitlebar); |
| | 173 | + |
| | 174 | + //handling of deprecated beforeclose (vs beforeClose) option |
| | 175 | + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 |
| | 176 | + //TODO: remove in 1.9pre |
| | 177 | + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { |
| | 178 | + options.beforeClose = options.beforeclose; |
| | 179 | + } |
| | 180 | + |
| | 181 | + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); |
| | 182 | + |
| | 183 | + if (options.draggable && $.fn.draggable) { |
| | 184 | + self._makeDraggable(); |
| | 185 | + } |
| | 186 | + if (options.resizable && $.fn.resizable) { |
| | 187 | + self._makeResizable(); |
| | 188 | + } |
| | 189 | + |
| | 190 | + self._createButtons(options.buttons); |
| | 191 | + self._isOpen = false; |
| | 192 | + |
| | 193 | + if ($.fn.bgiframe) { |
| | 194 | + uiDialog.bgiframe(); |
| | 195 | + } |
| | 196 | + }, |
| | 197 | + |
| | 198 | + _init: function() { |
| | 199 | + if ( this.options.autoOpen ) { |
| | 200 | + this.open(); |
| | 201 | + } |
| | 202 | + }, |
| | 203 | + |
| | 204 | + destroy: function() { |
| | 205 | + var self = this; |
| | 206 | + |
| | 207 | + if (self.overlay) { |
| | 208 | + self.overlay.destroy(); |
| | 209 | + } |
| | 210 | + self.uiDialog.hide(); |
| | 211 | + self.element |
| | 212 | + .unbind('.dialog') |
| | 213 | + .removeData('dialog') |
| | 214 | + .removeClass('ui-dialog-content ui-widget-content') |
| | 215 | + .hide().appendTo('body'); |
| | 216 | + self.uiDialog.remove(); |
| | 217 | + |
| | 218 | + if (self.originalTitle) { |
| | 219 | + self.element.attr('title', self.originalTitle); |
| | 220 | + } |
| | 221 | + |
| | 222 | + return self; |
| | 223 | + }, |
| | 224 | + |
| | 225 | + widget: function() { |
| | 226 | + return this.uiDialog; |
| | 227 | + }, |
| | 228 | + |
| | 229 | + close: function(event) { |
| | 230 | + var self = this, |
| | 231 | + maxZ, thisZ; |
| | 232 | + |
| | 233 | + if (false === self._trigger('beforeClose', event)) { |
| | 234 | + return; |
| | 235 | + } |
| | 236 | + |
| | 237 | + if (self.overlay) { |
| | 238 | + self.overlay.destroy(); |
| | 239 | + } |
| | 240 | + self.uiDialog.unbind('keypress.ui-dialog'); |
| | 241 | + |
| | 242 | + self._isOpen = false; |
| | 243 | + |
| | 244 | + if (self.options.hide) { |
| | 245 | + self.uiDialog.hide(self.options.hide, function() { |
| | 246 | + self._trigger('close', event); |
| | 247 | + }); |
| | 248 | + } else { |
| | 249 | + self.uiDialog.hide(); |
| | 250 | + self._trigger('close', event); |
| | 251 | + } |
| | 252 | + |
| | 253 | + $.ui.dialog.overlay.resize(); |
| | 254 | + |
| | 255 | + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) |
| | 256 | + if (self.options.modal) { |
| | 257 | + maxZ = 0; |
| | 258 | + $('.ui-dialog').each(function() { |
| | 259 | + if (this !== self.uiDialog[0]) { |
| | 260 | + thisZ = $(this).css('z-index'); |
| | 261 | + if(!isNaN(thisZ)) { |
| | 262 | + maxZ = Math.max(maxZ, thisZ); |
| | 263 | + } |
| | 264 | + } |
| | 265 | + }); |
| | 266 | + $.ui.dialog.maxZ = maxZ; |
| | 267 | + } |
| | 268 | + |
| | 269 | + return self; |
| | 270 | + }, |
| | 271 | + |
| | 272 | + isOpen: function() { |
| | 273 | + return this._isOpen; |
| | 274 | + }, |
| | 275 | + |
| | 276 | + // the force parameter allows us to move modal dialogs to their correct |
| | 277 | + // position on open |
| | 278 | + moveToTop: function(force, event) { |
| | 279 | + var self = this, |
| | 280 | + options = self.options, |
| | 281 | + saveScroll; |
| | 282 | + |
| | 283 | + if ((options.modal && !force) || |
| | 284 | + (!options.stack && !options.modal)) { |
| | 285 | + return self._trigger('focus', event); |
| | 286 | + } |
| | 287 | + |
| | 288 | + if (options.zIndex > $.ui.dialog.maxZ) { |
| | 289 | + $.ui.dialog.maxZ = options.zIndex; |
| | 290 | + } |
| | 291 | + if (self.overlay) { |
| | 292 | + $.ui.dialog.maxZ += 1; |
| | 293 | + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); |
| | 294 | + } |
| | 295 | + |
| | 296 | + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. |
| | 297 | + // http://ui.jquery.com/bugs/ticket/3193 |
| | 298 | + saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; |
| | 299 | + $.ui.dialog.maxZ += 1; |
| | 300 | + self.uiDialog.css('z-index', $.ui.dialog.maxZ); |
| | 301 | + self.element.attr(saveScroll); |
| | 302 | + self._trigger('focus', event); |
| | 303 | + |
| | 304 | + return self; |
| | 305 | + }, |
| | 306 | + |
| | 307 | + open: function() { |
| | 308 | + if (this._isOpen) { return; } |
| | 309 | + |
| | 310 | + var self = this, |
| | 311 | + options = self.options, |
| | 312 | + uiDialog = self.uiDialog; |
| | 313 | + |
| | 314 | + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; |
| | 315 | + self._size(); |
| | 316 | + self._position(options.position); |
| | 317 | + uiDialog.show(options.show); |
| | 318 | + self.moveToTop(true); |
| | 319 | + |
| | 320 | + // prevent tabbing out of modal dialogs |
| | 321 | + if (options.modal) { |
| | 322 | + uiDialog.bind('keypress.ui-dialog', function(event) { |
| | 323 | + if (event.keyCode !== $.ui.keyCode.TAB) { |
| | 324 | + return; |
| | 325 | + } |
| | 326 | + |
| | 327 | + var tabbables = $(':tabbable', this), |
| | 328 | + first = tabbables.filter(':first'), |
| | 329 | + last = tabbables.filter(':last'); |
| | 330 | + |
| | 331 | + if (event.target === last[0] && !event.shiftKey) { |
| | 332 | + first.focus(1); |
| | 333 | + return false; |
| | 334 | + } else if (event.target === first[0] && event.shiftKey) { |
| | 335 | + last.focus(1); |
| | 336 | + return false; |
| | 337 | + } |
| | 338 | + }); |
| | 339 | + } |
| | 340 | + |
| | 341 | + // set focus to the first tabbable element in the content area or the first button |
| | 342 | + // if there are no tabbable elements, set focus on the dialog itself |
| | 343 | + $(self.element.find(':tabbable').get().concat( |
| | 344 | + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( |
| | 345 | + uiDialog.get()))).eq(0).focus(); |
| | 346 | + |
| | 347 | + self._isOpen = true; |
| | 348 | + self._trigger('open'); |
| | 349 | + |
| | 350 | + return self; |
| | 351 | + }, |
| | 352 | + |
| | 353 | + _createButtons: function(buttons) { |
| | 354 | + var self = this, |
| | 355 | + hasButtons = false, |
| | 356 | + uiDialogButtonPane = $('<div></div>') |
| | 357 | + .addClass( |
| | 358 | + 'ui-dialog-buttonpane ' + |
| | 359 | + 'ui-widget-content ' + |
| | 360 | + 'ui-helper-clearfix' |
| | 361 | + ), |
| | 362 | + uiButtonSet = $( "<div></div>" ) |
| | 363 | + .addClass( "ui-dialog-buttonset" ) |
| | 364 | + .appendTo( uiDialogButtonPane ); |
| | 365 | + |
| | 366 | + // if we already have a button pane, remove it |
| | 367 | + self.uiDialog.find('.ui-dialog-buttonpane').remove(); |
| | 368 | + |
| | 369 | + if (typeof buttons === 'object' && buttons !== null) { |
| | 370 | + $.each(buttons, function() { |
| | 371 | + return !(hasButtons = true); |
| | 372 | + }); |
| | 373 | + } |
| | 374 | + if (hasButtons) { |
| | 375 | + $.each(buttons, function(name, props) { |
| | 376 | + props = $.isFunction( props ) ? |
| | 377 | + { click: props, text: name } : |
| | 378 | + props; |
| | 379 | + var button = $('<button type="button"></button>') |
| | 380 | + .attr( props, true ) |
| | 381 | + .unbind('click') |
| | 382 | + .click(function() { |
| | 383 | + props.click.apply(self.element[0], arguments); |
| | 384 | + }) |
| | 385 | + .appendTo(uiButtonSet); |
| | 386 | + if ($.fn.button) { |
| | 387 | + button.button(); |
| | 388 | + } |
| | 389 | + }); |
| | 390 | + uiDialogButtonPane.appendTo(self.uiDialog); |
| | 391 | + } |
| | 392 | + }, |
| | 393 | + |
| | 394 | + _makeDraggable: function() { |
| | 395 | + var self = this, |
| | 396 | + options = self.options, |
| | 397 | + doc = $(document), |
| | 398 | + heightBeforeDrag; |
| | 399 | + |
| | 400 | + function filteredUi(ui) { |
| | 401 | + return { |
| | 402 | + position: ui.position, |
| | 403 | + offset: ui.offset |
| | 404 | + }; |
| | 405 | + } |
| | 406 | + |
| | 407 | + self.uiDialog.draggable({ |
| | 408 | + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', |
| | 409 | + handle: '.ui-dialog-titlebar', |
| | 410 | + containment: 'document', |
| | 411 | + start: function(event, ui) { |
| | 412 | + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); |
| | 413 | + $(this).height($(this).height()).addClass("ui-dialog-dragging"); |
| | 414 | + self._trigger('dragStart', event, filteredUi(ui)); |
| | 415 | + }, |
| | 416 | + drag: function(event, ui) { |
| | 417 | + self._trigger('drag', event, filteredUi(ui)); |
| | 418 | + }, |
| | 419 | + stop: function(event, ui) { |
| | 420 | + options.position = [ui.position.left - doc.scrollLeft(), |
| | 421 | + ui.position.top - doc.scrollTop()]; |
| | 422 | + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); |
| | 423 | + self._trigger('dragStop', event, filteredUi(ui)); |
| | 424 | + $.ui.dialog.overlay.resize(); |
| | 425 | + } |
| | 426 | + }); |
| | 427 | + }, |
| | 428 | + |
| | 429 | + _makeResizable: function(handles) { |
| | 430 | + handles = (handles === undefined ? this.options.resizable : handles); |
| | 431 | + var self = this, |
| | 432 | + options = self.options, |
| | 433 | + // .ui-resizable has position: relative defined in the stylesheet |
| | 434 | + // but dialogs have to use absolute or fixed positioning |
| | 435 | + position = self.uiDialog.css('position'), |
| | 436 | + resizeHandles = (typeof handles === 'string' ? |
| | 437 | + handles : |
| | 438 | + 'n,e,s,w,se,sw,ne,nw' |
| | 439 | + ); |
| | 440 | + |
| | 441 | + function filteredUi(ui) { |
| | 442 | + return { |
| | 443 | + originalPosition: ui.originalPosition, |
| | 444 | + originalSize: ui.originalSize, |
| | 445 | + position: ui.position, |
| | 446 | + size: ui.size |
| | 447 | + }; |
| | 448 | + } |
| | 449 | + |
| | 450 | + self.uiDialog.resizable({ |
| | 451 | + cancel: '.ui-dialog-content', |
| | 452 | + containment: 'document', |
| | 453 | + alsoResize: self.element, |
| | 454 | + maxWidth: options.maxWidth, |
| | 455 | + maxHeight: options.maxHeight, |
| | 456 | + minWidth: options.minWidth, |
| | 457 | + minHeight: self._minHeight(), |
| | 458 | + handles: resizeHandles, |
| | 459 | + start: function(event, ui) { |
| | 460 | + $(this).addClass("ui-dialog-resizing"); |
| | 461 | + self._trigger('resizeStart', event, filteredUi(ui)); |
| | 462 | + }, |
| | 463 | + resize: function(event, ui) { |
| | 464 | + self._trigger('resize', event, filteredUi(ui)); |
| | 465 | + }, |
| | 466 | + stop: function(event, ui) { |
| | 467 | + $(this).removeClass("ui-dialog-resizing"); |
| | 468 | + options.height = $(this).height(); |
| | 469 | + options.width = $(this).width(); |
| | 470 | + self._trigger('resizeStop', event, filteredUi(ui)); |
| | 471 | + $.ui.dialog.overlay.resize(); |
| | 472 | + } |
| | 473 | + }) |
| | 474 | + .css('position', position) |
| | 475 | + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); |
| | 476 | + }, |
| | 477 | + |
| | 478 | + _minHeight: function() { |
| | 479 | + var options = this.options; |
| | 480 | + |
| | 481 | + if (options.height === 'auto') { |
| | 482 | + return options.minHeight; |
| | 483 | + } else { |
| | 484 | + return Math.min(options.minHeight, options.height); |
| | 485 | + } |
| | 486 | + }, |
| | 487 | + |
| | 488 | + _position: function(position) { |
| | 489 | + var myAt = [], |
| | 490 | + offset = [0, 0], |
| | 491 | + isVisible; |
| | 492 | + |
| | 493 | + if (position) { |
| | 494 | + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( |
| | 495 | + // if (typeof position == 'string' || $.isArray(position)) { |
| | 496 | + // myAt = $.isArray(position) ? position : position.split(' '); |
| | 497 | + |
| | 498 | + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { |
| | 499 | + myAt = position.split ? position.split(' ') : [position[0], position[1]]; |
| | 500 | + if (myAt.length === 1) { |
| | 501 | + myAt[1] = myAt[0]; |
| | 502 | + } |
| | 503 | + |
| | 504 | + $.each(['left', 'top'], function(i, offsetPosition) { |
| | 505 | + if (+myAt[i] === myAt[i]) { |
| | 506 | + offset[i] = myAt[i]; |
| | 507 | + myAt[i] = offsetPosition; |
| | 508 | + } |
| | 509 | + }); |
| | 510 | + |
| | 511 | + position = { |
| | 512 | + my: myAt.join(" "), |
| | 513 | + at: myAt.join(" "), |
| | 514 | + offset: offset.join(" ") |
| | 515 | + }; |
| | 516 | + } |
| | 517 | + |
| | 518 | + position = $.extend({}, $.ui.dialog.prototype.options.position, position); |
| | 519 | + } else { |
| | 520 | + position = $.ui.dialog.prototype.options.position; |
| | 521 | + } |
| | 522 | + |
| | 523 | + // need to show the dialog to get the actual offset in the position plugin |
| | 524 | + isVisible = this.uiDialog.is(':visible'); |
| | 525 | + if (!isVisible) { |
| | 526 | + this.uiDialog.show(); |
| | 527 | + } |
| | 528 | + this.uiDialog |
| | 529 | + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 |
| | 530 | + .css({ top: 0, left: 0 }) |
| | 531 | + .position($.extend({ of: window }, position)); |
| | 532 | + if (!isVisible) { |
| | 533 | + this.uiDialog.hide(); |
| | 534 | + } |
| | 535 | + }, |
| | 536 | + |
| | 537 | + _setOptions: function( options ) { |
| | 538 | + var self = this, |
| | 539 | + resizableOptions = {}, |
| | 540 | + resize = false; |
| | 541 | + |
| | 542 | + $.each( options, function( key, value ) { |
| | 543 | + self._setOption( key, value ); |
| | 544 | + |
| | 545 | + if ( key in sizeRelatedOptions ) { |
| | 546 | + resize = true; |
| | 547 | + } |
| | 548 | + if ( key in resizableRelatedOptions ) { |
| | 549 | + resizableOptions[ key ] = value; |
| | 550 | + } |
| | 551 | + }); |
| | 552 | + |
| | 553 | + if ( resize ) { |
| | 554 | + this._size(); |
| | 555 | + } |
| | 556 | + if ( this.uiDialog.is( ":data(resizable)" ) ) { |
| | 557 | + this.uiDialog.resizable( "option", resizableOptions ); |
| | 558 | + } |
| | 559 | + }, |
| | 560 | + |
| | 561 | + _setOption: function(key, value){ |
| | 562 | + var self = this, |
| | 563 | + uiDialog = self.uiDialog; |
| | 564 | + |
| | 565 | + switch (key) { |
| | 566 | + //handling of deprecated beforeclose (vs beforeClose) option |
| | 567 | + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 |
| | 568 | + //TODO: remove in 1.9pre |
| | 569 | + case "beforeclose": |
| | 570 | + key = "beforeClose"; |
| | 571 | + break; |
| | 572 | + case "buttons": |
| | 573 | + self._createButtons(value); |
| | 574 | + break; |
| | 575 | + case "closeText": |
| | 576 | + // ensure that we always pass a string |
| | 577 | + self.uiDialogTitlebarCloseText.text("" + value); |
| | 578 | + break; |
| | 579 | + case "dialogClass": |
| | 580 | + uiDialog |
| | 581 | + .removeClass(self.options.dialogClass) |
| | 582 | + .addClass(uiDialogClasses + value); |
| | 583 | + break; |
| | 584 | + case "disabled": |
| | 585 | + if (value) { |
| | 586 | + uiDialog.addClass('ui-dialog-disabled'); |
| | 587 | + } else { |
| | 588 | + uiDialog.removeClass('ui-dialog-disabled'); |
| | 589 | + } |
| | 590 | + break; |
| | 591 | + case "draggable": |
| | 592 | + var isDraggable = uiDialog.is( ":data(draggable)" ); |
| | 593 | + if ( isDraggable && !value ) { |
| | 594 | + uiDialog.draggable( "destroy" ); |
| | 595 | + } |
| | 596 | + |
| | 597 | + if ( !isDraggable && value ) { |
| | 598 | + self._makeDraggable(); |
| | 599 | + } |
| | 600 | + break; |
| | 601 | + case "position": |
| | 602 | + self._position(value); |
| | 603 | + break; |
| | 604 | + case "resizable": |
| | 605 | + // currently resizable, becoming non-resizable |
| | 606 | + var isResizable = uiDialog.is( ":data(resizable)" ); |
| | 607 | + if (isResizable && !value) { |
| | 608 | + uiDialog.resizable('destroy'); |
| | 609 | + } |
| | 610 | + |
| | 611 | + // currently resizable, changing handles |
| | 612 | + if (isResizable && typeof value === 'string') { |
| | 613 | + uiDialog.resizable('option', 'handles', value); |
| | 614 | + } |
| | 615 | + |
| | 616 | + // currently non-resizable, becoming resizable |
| | 617 | + if (!isResizable && value !== false) { |
| | 618 | + self._makeResizable(value); |
| | 619 | + } |
| | 620 | + break; |
| | 621 | + case "title": |
| | 622 | + // convert whatever was passed in o a string, for html() to not throw up |
| | 623 | + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); |
| | 624 | + break; |
| | 625 | + } |
| | 626 | + |
| | 627 | + $.Widget.prototype._setOption.apply(self, arguments); |
| | 628 | + }, |
| | 629 | + |
| | 630 | + _size: function() { |
| | 631 | + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content |
| | 632 | + * divs will both have width and height set, so we need to reset them |
| | 633 | + */ |
| | 634 | + var options = this.options, |
| | 635 | + nonContentHeight, |
| | 636 | + minContentHeight, |
| | 637 | + isVisible = this.uiDialog.is( ":visible" ); |
| | 638 | + |
| | 639 | + // reset content sizing |
| | 640 | + this.element.show().css({ |
| | 641 | + width: 'auto', |
| | 642 | + minHeight: 0, |
| | 643 | + height: 0 |
| | 644 | + }); |
| | 645 | + |
| | 646 | + if (options.minWidth > options.width) { |
| | 647 | + options.width = options.minWidth; |
| | 648 | + } |
| | 649 | + |
| | 650 | + // reset wrapper sizing |
| | 651 | + // determine the height of all the non-content elements |
| | 652 | + nonContentHeight = this.uiDialog.css({ |
| | 653 | + height: 'auto', |
| | 654 | + width: options.width |
| | 655 | + }) |
| | 656 | + .height(); |
| | 657 | + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); |
| | 658 | + |
| | 659 | + if ( options.height === "auto" ) { |
| | 660 | + // only needed for IE6 support |
| | 661 | + if ( $.support.minHeight ) { |
| | 662 | + this.element.css({ |
| | 663 | + minHeight: minContentHeight, |
| | 664 | + height: "auto" |
| | 665 | + }); |
| | 666 | + } else { |
| | 667 | + this.uiDialog.show(); |
| | 668 | + var autoHeight = this.element.css( "height", "auto" ).height(); |
| | 669 | + if ( !isVisible ) { |
| | 670 | + this.uiDialog.hide(); |
| | 671 | + } |
| | 672 | + this.element.height( Math.max( autoHeight, minContentHeight ) ); |
| | 673 | + } |
| | 674 | + } else { |
| | 675 | + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); |
| | 676 | + } |
| | 677 | + |
| | 678 | + if (this.uiDialog.is(':data(resizable)')) { |
| | 679 | + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); |
| | 680 | + } |
| | 681 | + } |
| | 682 | +}); |
| | 683 | + |
| | 684 | +$.extend($.ui.dialog, { |
| | 685 | + version: "1.8.11", |
| | 686 | + |
| | 687 | + uuid: 0, |
| | 688 | + maxZ: 0, |
| | 689 | + |
| | 690 | + getTitleId: function($el) { |
| | 691 | + var id = $el.attr('id'); |
| | 692 | + if (!id) { |
| | 693 | + this.uuid += 1; |
| | 694 | + id = this.uuid; |
| | 695 | + } |
| | 696 | + return 'ui-dialog-title-' + id; |
| | 697 | + }, |
| | 698 | + |
| | 699 | + overlay: function(dialog) { |
| | 700 | + this.$el = $.ui.dialog.overlay.create(dialog); |
| | 701 | + } |
| | 702 | +}); |
| | 703 | + |
| | 704 | +$.extend($.ui.dialog.overlay, { |
| | 705 | + instances: [], |
| | 706 | + // reuse old instances due to IE memory leak with alpha transparency (see #5185) |
| | 707 | + oldInstances: [], |
| | 708 | + maxZ: 0, |
| | 709 | + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), |
| | 710 | + function(event) { return event + '.dialog-overlay'; }).join(' '), |
| | 711 | + create: function(dialog) { |
| | 712 | + if (this.instances.length === 0) { |
| | 713 | + // prevent use of anchors and inputs |
| | 714 | + // we use a setTimeout in case the overlay is created from an |
| | 715 | + // event that we're going to be cancelling (see #2804) |
| | 716 | + setTimeout(function() { |
| | 717 | + // handle $(el).dialog().dialog('close') (see #4065) |
| | 718 | + if ($.ui.dialog.overlay.instances.length) { |
| | 719 | + $(document).bind($.ui.dialog.overlay.events, function(event) { |
| | 720 | + // stop events if the z-index of the target is < the z-index of the overlay |
| | 721 | + // we cannot return true when we don't want to cancel the event (#3523) |
| | 722 | + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { |
| | 723 | + return false; |
| | 724 | + } |
| | 725 | + }); |
| | 726 | + } |
| | 727 | + }, 1); |
| | 728 | + |
| | 729 | + // allow closing by pressing the escape key |
| | 730 | + $(document).bind('keydown.dialog-overlay', function(event) { |
| | 731 | + if (dialog.options.closeOnEscape && event.keyCode && |
| | 732 | + event.keyCode === $.ui.keyCode.ESCAPE) { |
| | 733 | + |
| | 734 | + dialog.close(event); |
| | 735 | + event.preventDefault(); |
| | 736 | + } |
| | 737 | + }); |
| | 738 | + |
| | 739 | + // handle window resize |
| | 740 | + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); |
| | 741 | + } |
| | 742 | + |
| | 743 | + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) |
| | 744 | + .appendTo(document.body) |
| | 745 | + .css({ |
| | 746 | + width: this.width(), |
| | 747 | + height: this.height() |
| | 748 | + }); |
| | 749 | + |
| | 750 | + if ($.fn.bgiframe) { |
| | 751 | + $el.bgiframe(); |
| | 752 | + } |
| | 753 | + |
| | 754 | + this.instances.push($el); |
| | 755 | + return $el; |
| | 756 | + }, |
| | 757 | + |
| | 758 | + destroy: function($el) { |
| | 759 | + var indexOf = $.inArray($el, this.instances); |
| | 760 | + if (indexOf != -1){ |
| | 761 | + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); |
| | 762 | + } |
| | 763 | + |
| | 764 | + if (this.instances.length === 0) { |
| | 765 | + $([document, window]).unbind('.dialog-overlay'); |
| | 766 | + } |
| | 767 | + |
| | 768 | + $el.remove(); |
| | 769 | + |
| | 770 | + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) |
| | 771 | + var maxZ = 0; |
| | 772 | + $.each(this.instances, function() { |
| | 773 | + maxZ = Math.max(maxZ, this.css('z-index')); |
| | 774 | + }); |
| | 775 | + this.maxZ = maxZ; |
| | 776 | + }, |
| | 777 | + |
| | 778 | + height: function() { |
| | 779 | + var scrollHeight, |
| | 780 | + offsetHeight; |
| | 781 | + // handle IE 6 |
| | 782 | + if ($.browser.msie && $.browser.version < 7) { |
| | 783 | + scrollHeight = Math.max( |
| | 784 | + document.documentElement.scrollHeight, |
| | 785 | + document.body.scrollHeight |
| | 786 | + ); |
| | 787 | + offsetHeight = Math.max( |
| | 788 | + document.documentElement.offsetHeight, |
| | 789 | + document.body.offsetHeight |
| | 790 | + ); |
| | 791 | + |
| | 792 | + if (scrollHeight < offsetHeight) { |
| | 793 | + return $(window).height() + 'px'; |
| | 794 | + } else { |
| | 795 | + return scrollHeight + 'px'; |
| | 796 | + } |
| | 797 | + // handle "good" browsers |
| | 798 | + } else { |
| | 799 | + return $(document).height() + 'px'; |
| | 800 | + } |
| | 801 | + }, |
| | 802 | + |
| | 803 | + width: function() { |
| | 804 | + var scrollWidth, |
| | 805 | + offsetWidth; |
| | 806 | + // handle IE 6 |
| | 807 | + if ($.browser.msie && $.browser.version < 7) { |
| | 808 | + scrollWidth = Math.max( |
| | 809 | + document.documentElement.scrollWidth, |
| | 810 | + document.body.scrollWidth |
| | 811 | + ); |
| | 812 | + offsetWidth = Math.max( |
| | 813 | + document.documentElement.offsetWidth, |
| | 814 | + document.body.offsetWidth |
| | 815 | + ); |
| | 816 | + |
| | 817 | + if (scrollWidth < offsetWidth) { |
| | 818 | + return $(window).width() + 'px'; |
| | 819 | + } else { |
| | 820 | + return scrollWidth + 'px'; |
| | 821 | + } |
| | 822 | + // handle "good" browsers |
| | 823 | + } else { |
| | 824 | + return $(document).width() + 'px'; |
| | 825 | + } |
| | 826 | + }, |
| | 827 | + |
| | 828 | + resize: function() { |
| | 829 | + /* If the dialog is draggable and the user drags it past the |
| | 830 | + * right edge of the window, the document becomes wider so we |
| | 831 | + * need to stretch the overlay. If the user then drags the |
| | 832 | + * dialog back to the left, the document will become narrower, |
| | 833 | + * so we need to shrink the overlay to the appropriate size. |
| | 834 | + * This is handled by shrinking the overlay before setting it |
| | 835 | + * to the full document size. |
| | 836 | + */ |
| | 837 | + var $overlays = $([]); |
| | 838 | + $.each($.ui.dialog.overlay.instances, function() { |
| | 839 | + $overlays = $overlays.add(this); |
| | 840 | + }); |
| | 841 | + |
| | 842 | + $overlays.css({ |
| | 843 | + width: 0, |
| | 844 | + height: 0 |
| | 845 | + }).css({ |
| | 846 | + width: $.ui.dialog.overlay.width(), |
| | 847 | + height: $.ui.dialog.overlay.height() |
| | 848 | + }); |
| | 849 | + } |
| | 850 | +}); |
| | 851 | + |
| | 852 | +$.extend($.ui.dialog.overlay.prototype, { |
| | 853 | + destroy: function() { |
| | 854 | + $.ui.dialog.overlay.destroy(this.$el); |
| | 855 | + } |
| | 856 | +}); |
| | 857 | + |
| | 858 | +}(jQuery)); |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.resizable.js |
| — | — | @@ -0,0 +1,812 @@ |
| | 2 | +/* |
| | 3 | + * jQuery UI Resizable 1.8.11 |
| | 4 | + * |
| | 5 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 6 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 7 | + * http://jquery.org/license |
| | 8 | + * |
| | 9 | + * http://docs.jquery.com/UI/Resizables |
| | 10 | + * |
| | 11 | + * Depends: |
| | 12 | + * jquery.ui.core.js |
| | 13 | + * jquery.ui.mouse.js |
| | 14 | + * jquery.ui.widget.js |
| | 15 | + */ |
| | 16 | +(function( $, undefined ) { |
| | 17 | + |
| | 18 | +$.widget("ui.resizable", $.ui.mouse, { |
| | 19 | + widgetEventPrefix: "resize", |
| | 20 | + options: { |
| | 21 | + alsoResize: false, |
| | 22 | + animate: false, |
| | 23 | + animateDuration: "slow", |
| | 24 | + animateEasing: "swing", |
| | 25 | + aspectRatio: false, |
| | 26 | + autoHide: false, |
| | 27 | + containment: false, |
| | 28 | + ghost: false, |
| | 29 | + grid: false, |
| | 30 | + handles: "e,s,se", |
| | 31 | + helper: false, |
| | 32 | + maxHeight: null, |
| | 33 | + maxWidth: null, |
| | 34 | + minHeight: 10, |
| | 35 | + minWidth: 10, |
| | 36 | + zIndex: 1000 |
| | 37 | + }, |
| | 38 | + _create: function() { |
| | 39 | + |
| | 40 | + var self = this, o = this.options; |
| | 41 | + this.element.addClass("ui-resizable"); |
| | 42 | + |
| | 43 | + $.extend(this, { |
| | 44 | + _aspectRatio: !!(o.aspectRatio), |
| | 45 | + aspectRatio: o.aspectRatio, |
| | 46 | + originalElement: this.element, |
| | 47 | + _proportionallyResizeElements: [], |
| | 48 | + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null |
| | 49 | + }); |
| | 50 | + |
| | 51 | + //Wrap the element if it cannot hold child nodes |
| | 52 | + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { |
| | 53 | + |
| | 54 | + //Opera fix for relative positioning |
| | 55 | + if (/relative/.test(this.element.css('position')) && $.browser.opera) |
| | 56 | + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); |
| | 57 | + |
| | 58 | + //Create a wrapper element and set the wrapper to the new current internal element |
| | 59 | + this.element.wrap( |
| | 60 | + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ |
| | 61 | + position: this.element.css('position'), |
| | 62 | + width: this.element.outerWidth(), |
| | 63 | + height: this.element.outerHeight(), |
| | 64 | + top: this.element.css('top'), |
| | 65 | + left: this.element.css('left') |
| | 66 | + }) |
| | 67 | + ); |
| | 68 | + |
| | 69 | + //Overwrite the original this.element |
| | 70 | + this.element = this.element.parent().data( |
| | 71 | + "resizable", this.element.data('resizable') |
| | 72 | + ); |
| | 73 | + |
| | 74 | + this.elementIsWrapper = true; |
| | 75 | + |
| | 76 | + //Move margins to the wrapper |
| | 77 | + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); |
| | 78 | + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); |
| | 79 | + |
| | 80 | + //Prevent Safari textarea resize |
| | 81 | + this.originalResizeStyle = this.originalElement.css('resize'); |
| | 82 | + this.originalElement.css('resize', 'none'); |
| | 83 | + |
| | 84 | + //Push the actual element to our proportionallyResize internal array |
| | 85 | + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); |
| | 86 | + |
| | 87 | + // avoid IE jump (hard set the margin) |
| | 88 | + this.originalElement.css({ margin: this.originalElement.css('margin') }); |
| | 89 | + |
| | 90 | + // fix handlers offset |
| | 91 | + this._proportionallyResize(); |
| | 92 | + |
| | 93 | + } |
| | 94 | + |
| | 95 | + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); |
| | 96 | + if(this.handles.constructor == String) { |
| | 97 | + |
| | 98 | + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; |
| | 99 | + var n = this.handles.split(","); this.handles = {}; |
| | 100 | + |
| | 101 | + for(var i = 0; i < n.length; i++) { |
| | 102 | + |
| | 103 | + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; |
| | 104 | + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); |
| | 105 | + |
| | 106 | + // increase zIndex of sw, se, ne, nw axis |
| | 107 | + //TODO : this modifies original option |
| | 108 | + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); |
| | 109 | + |
| | 110 | + //TODO : What's going on here? |
| | 111 | + if ('se' == handle) { |
| | 112 | + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); |
| | 113 | + }; |
| | 114 | + |
| | 115 | + //Insert into internal handles object and append to element |
| | 116 | + this.handles[handle] = '.ui-resizable-'+handle; |
| | 117 | + this.element.append(axis); |
| | 118 | + } |
| | 119 | + |
| | 120 | + } |
| | 121 | + |
| | 122 | + this._renderAxis = function(target) { |
| | 123 | + |
| | 124 | + target = target || this.element; |
| | 125 | + |
| | 126 | + for(var i in this.handles) { |
| | 127 | + |
| | 128 | + if(this.handles[i].constructor == String) |
| | 129 | + this.handles[i] = $(this.handles[i], this.element).show(); |
| | 130 | + |
| | 131 | + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) |
| | 132 | + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { |
| | 133 | + |
| | 134 | + var axis = $(this.handles[i], this.element), padWrapper = 0; |
| | 135 | + |
| | 136 | + //Checking the correct pad and border |
| | 137 | + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); |
| | 138 | + |
| | 139 | + //The padding type i have to apply... |
| | 140 | + var padPos = [ 'padding', |
| | 141 | + /ne|nw|n/.test(i) ? 'Top' : |
| | 142 | + /se|sw|s/.test(i) ? 'Bottom' : |
| | 143 | + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); |
| | 144 | + |
| | 145 | + target.css(padPos, padWrapper); |
| | 146 | + |
| | 147 | + this._proportionallyResize(); |
| | 148 | + |
| | 149 | + } |
| | 150 | + |
| | 151 | + //TODO: What's that good for? There's not anything to be executed left |
| | 152 | + if(!$(this.handles[i]).length) |
| | 153 | + continue; |
| | 154 | + |
| | 155 | + } |
| | 156 | + }; |
| | 157 | + |
| | 158 | + //TODO: make renderAxis a prototype function |
| | 159 | + this._renderAxis(this.element); |
| | 160 | + |
| | 161 | + this._handles = $('.ui-resizable-handle', this.element) |
| | 162 | + .disableSelection(); |
| | 163 | + |
| | 164 | + //Matching axis name |
| | 165 | + this._handles.mouseover(function() { |
| | 166 | + if (!self.resizing) { |
| | 167 | + if (this.className) |
| | 168 | + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); |
| | 169 | + //Axis, default = se |
| | 170 | + self.axis = axis && axis[1] ? axis[1] : 'se'; |
| | 171 | + } |
| | 172 | + }); |
| | 173 | + |
| | 174 | + //If we want to auto hide the elements |
| | 175 | + if (o.autoHide) { |
| | 176 | + this._handles.hide(); |
| | 177 | + $(this.element) |
| | 178 | + .addClass("ui-resizable-autohide") |
| | 179 | + .hover(function() { |
| | 180 | + $(this).removeClass("ui-resizable-autohide"); |
| | 181 | + self._handles.show(); |
| | 182 | + }, |
| | 183 | + function(){ |
| | 184 | + if (!self.resizing) { |
| | 185 | + $(this).addClass("ui-resizable-autohide"); |
| | 186 | + self._handles.hide(); |
| | 187 | + } |
| | 188 | + }); |
| | 189 | + } |
| | 190 | + |
| | 191 | + //Initialize the mouse interaction |
| | 192 | + this._mouseInit(); |
| | 193 | + |
| | 194 | + }, |
| | 195 | + |
| | 196 | + destroy: function() { |
| | 197 | + |
| | 198 | + this._mouseDestroy(); |
| | 199 | + |
| | 200 | + var _destroy = function(exp) { |
| | 201 | + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") |
| | 202 | + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); |
| | 203 | + }; |
| | 204 | + |
| | 205 | + //TODO: Unwrap at same DOM position |
| | 206 | + if (this.elementIsWrapper) { |
| | 207 | + _destroy(this.element); |
| | 208 | + var wrapper = this.element; |
| | 209 | + wrapper.after( |
| | 210 | + this.originalElement.css({ |
| | 211 | + position: wrapper.css('position'), |
| | 212 | + width: wrapper.outerWidth(), |
| | 213 | + height: wrapper.outerHeight(), |
| | 214 | + top: wrapper.css('top'), |
| | 215 | + left: wrapper.css('left') |
| | 216 | + }) |
| | 217 | + ).remove(); |
| | 218 | + } |
| | 219 | + |
| | 220 | + this.originalElement.css('resize', this.originalResizeStyle); |
| | 221 | + _destroy(this.originalElement); |
| | 222 | + |
| | 223 | + return this; |
| | 224 | + }, |
| | 225 | + |
| | 226 | + _mouseCapture: function(event) { |
| | 227 | + var handle = false; |
| | 228 | + for (var i in this.handles) { |
| | 229 | + if ($(this.handles[i])[0] == event.target) { |
| | 230 | + handle = true; |
| | 231 | + } |
| | 232 | + } |
| | 233 | + |
| | 234 | + return !this.options.disabled && handle; |
| | 235 | + }, |
| | 236 | + |
| | 237 | + _mouseStart: function(event) { |
| | 238 | + |
| | 239 | + var o = this.options, iniPos = this.element.position(), el = this.element; |
| | 240 | + |
| | 241 | + this.resizing = true; |
| | 242 | + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; |
| | 243 | + |
| | 244 | + // bugfix for http://dev.jquery.com/ticket/1749 |
| | 245 | + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { |
| | 246 | + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); |
| | 247 | + } |
| | 248 | + |
| | 249 | + //Opera fixing relative position |
| | 250 | + if ($.browser.opera && (/relative/).test(el.css('position'))) |
| | 251 | + el.css({ position: 'relative', top: 'auto', left: 'auto' }); |
| | 252 | + |
| | 253 | + this._renderProxy(); |
| | 254 | + |
| | 255 | + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); |
| | 256 | + |
| | 257 | + if (o.containment) { |
| | 258 | + curleft += $(o.containment).scrollLeft() || 0; |
| | 259 | + curtop += $(o.containment).scrollTop() || 0; |
| | 260 | + } |
| | 261 | + |
| | 262 | + //Store needed variables |
| | 263 | + this.offset = this.helper.offset(); |
| | 264 | + this.position = { left: curleft, top: curtop }; |
| | 265 | + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; |
| | 266 | + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; |
| | 267 | + this.originalPosition = { left: curleft, top: curtop }; |
| | 268 | + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; |
| | 269 | + this.originalMousePosition = { left: event.pageX, top: event.pageY }; |
| | 270 | + |
| | 271 | + //Aspect Ratio |
| | 272 | + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); |
| | 273 | + |
| | 274 | + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); |
| | 275 | + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); |
| | 276 | + |
| | 277 | + el.addClass("ui-resizable-resizing"); |
| | 278 | + this._propagate("start", event); |
| | 279 | + return true; |
| | 280 | + }, |
| | 281 | + |
| | 282 | + _mouseDrag: function(event) { |
| | 283 | + |
| | 284 | + //Increase performance, avoid regex |
| | 285 | + var el = this.helper, o = this.options, props = {}, |
| | 286 | + self = this, smp = this.originalMousePosition, a = this.axis; |
| | 287 | + |
| | 288 | + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; |
| | 289 | + var trigger = this._change[a]; |
| | 290 | + if (!trigger) return false; |
| | 291 | + |
| | 292 | + // Calculate the attrs that will be change |
| | 293 | + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; |
| | 294 | + |
| | 295 | + if (this._aspectRatio || event.shiftKey) |
| | 296 | + data = this._updateRatio(data, event); |
| | 297 | + |
| | 298 | + data = this._respectSize(data, event); |
| | 299 | + |
| | 300 | + // plugins callbacks need to be called first |
| | 301 | + this._propagate("resize", event); |
| | 302 | + |
| | 303 | + el.css({ |
| | 304 | + top: this.position.top + "px", left: this.position.left + "px", |
| | 305 | + width: this.size.width + "px", height: this.size.height + "px" |
| | 306 | + }); |
| | 307 | + |
| | 308 | + if (!this._helper && this._proportionallyResizeElements.length) |
| | 309 | + this._proportionallyResize(); |
| | 310 | + |
| | 311 | + this._updateCache(data); |
| | 312 | + |
| | 313 | + // calling the user callback at the end |
| | 314 | + this._trigger('resize', event, this.ui()); |
| | 315 | + |
| | 316 | + return false; |
| | 317 | + }, |
| | 318 | + |
| | 319 | + _mouseStop: function(event) { |
| | 320 | + |
| | 321 | + this.resizing = false; |
| | 322 | + var o = this.options, self = this; |
| | 323 | + |
| | 324 | + if(this._helper) { |
| | 325 | + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), |
| | 326 | + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, |
| | 327 | + soffsetw = ista ? 0 : self.sizeDiff.width; |
| | 328 | + |
| | 329 | + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, |
| | 330 | + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, |
| | 331 | + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; |
| | 332 | + |
| | 333 | + if (!o.animate) |
| | 334 | + this.element.css($.extend(s, { top: top, left: left })); |
| | 335 | + |
| | 336 | + self.helper.height(self.size.height); |
| | 337 | + self.helper.width(self.size.width); |
| | 338 | + |
| | 339 | + if (this._helper && !o.animate) this._proportionallyResize(); |
| | 340 | + } |
| | 341 | + |
| | 342 | + $('body').css('cursor', 'auto'); |
| | 343 | + |
| | 344 | + this.element.removeClass("ui-resizable-resizing"); |
| | 345 | + |
| | 346 | + this._propagate("stop", event); |
| | 347 | + |
| | 348 | + if (this._helper) this.helper.remove(); |
| | 349 | + return false; |
| | 350 | + |
| | 351 | + }, |
| | 352 | + |
| | 353 | + _updateCache: function(data) { |
| | 354 | + var o = this.options; |
| | 355 | + this.offset = this.helper.offset(); |
| | 356 | + if (isNumber(data.left)) this.position.left = data.left; |
| | 357 | + if (isNumber(data.top)) this.position.top = data.top; |
| | 358 | + if (isNumber(data.height)) this.size.height = data.height; |
| | 359 | + if (isNumber(data.width)) this.size.width = data.width; |
| | 360 | + }, |
| | 361 | + |
| | 362 | + _updateRatio: function(data, event) { |
| | 363 | + |
| | 364 | + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; |
| | 365 | + |
| | 366 | + if (data.height) data.width = (csize.height * this.aspectRatio); |
| | 367 | + else if (data.width) data.height = (csize.width / this.aspectRatio); |
| | 368 | + |
| | 369 | + if (a == 'sw') { |
| | 370 | + data.left = cpos.left + (csize.width - data.width); |
| | 371 | + data.top = null; |
| | 372 | + } |
| | 373 | + if (a == 'nw') { |
| | 374 | + data.top = cpos.top + (csize.height - data.height); |
| | 375 | + data.left = cpos.left + (csize.width - data.width); |
| | 376 | + } |
| | 377 | + |
| | 378 | + return data; |
| | 379 | + }, |
| | 380 | + |
| | 381 | + _respectSize: function(data, event) { |
| | 382 | + |
| | 383 | + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, |
| | 384 | + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), |
| | 385 | + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); |
| | 386 | + |
| | 387 | + if (isminw) data.width = o.minWidth; |
| | 388 | + if (isminh) data.height = o.minHeight; |
| | 389 | + if (ismaxw) data.width = o.maxWidth; |
| | 390 | + if (ismaxh) data.height = o.maxHeight; |
| | 391 | + |
| | 392 | + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; |
| | 393 | + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); |
| | 394 | + |
| | 395 | + if (isminw && cw) data.left = dw - o.minWidth; |
| | 396 | + if (ismaxw && cw) data.left = dw - o.maxWidth; |
| | 397 | + if (isminh && ch) data.top = dh - o.minHeight; |
| | 398 | + if (ismaxh && ch) data.top = dh - o.maxHeight; |
| | 399 | + |
| | 400 | + // fixing jump error on top/left - bug #2330 |
| | 401 | + var isNotwh = !data.width && !data.height; |
| | 402 | + if (isNotwh && !data.left && data.top) data.top = null; |
| | 403 | + else if (isNotwh && !data.top && data.left) data.left = null; |
| | 404 | + |
| | 405 | + return data; |
| | 406 | + }, |
| | 407 | + |
| | 408 | + _proportionallyResize: function() { |
| | 409 | + |
| | 410 | + var o = this.options; |
| | 411 | + if (!this._proportionallyResizeElements.length) return; |
| | 412 | + var element = this.helper || this.element; |
| | 413 | + |
| | 414 | + for (var i=0; i < this._proportionallyResizeElements.length; i++) { |
| | 415 | + |
| | 416 | + var prel = this._proportionallyResizeElements[i]; |
| | 417 | + |
| | 418 | + if (!this.borderDif) { |
| | 419 | + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], |
| | 420 | + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; |
| | 421 | + |
| | 422 | + this.borderDif = $.map(b, function(v, i) { |
| | 423 | + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; |
| | 424 | + return border + padding; |
| | 425 | + }); |
| | 426 | + } |
| | 427 | + |
| | 428 | + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) |
| | 429 | + continue; |
| | 430 | + |
| | 431 | + prel.css({ |
| | 432 | + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, |
| | 433 | + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 |
| | 434 | + }); |
| | 435 | + |
| | 436 | + }; |
| | 437 | + |
| | 438 | + }, |
| | 439 | + |
| | 440 | + _renderProxy: function() { |
| | 441 | + |
| | 442 | + var el = this.element, o = this.options; |
| | 443 | + this.elementOffset = el.offset(); |
| | 444 | + |
| | 445 | + if(this._helper) { |
| | 446 | + |
| | 447 | + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); |
| | 448 | + |
| | 449 | + // fix ie6 offset TODO: This seems broken |
| | 450 | + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), |
| | 451 | + pxyoffset = ( ie6 ? 2 : -1 ); |
| | 452 | + |
| | 453 | + this.helper.addClass(this._helper).css({ |
| | 454 | + width: this.element.outerWidth() + pxyoffset, |
| | 455 | + height: this.element.outerHeight() + pxyoffset, |
| | 456 | + position: 'absolute', |
| | 457 | + left: this.elementOffset.left - ie6offset +'px', |
| | 458 | + top: this.elementOffset.top - ie6offset +'px', |
| | 459 | + zIndex: ++o.zIndex //TODO: Don't modify option |
| | 460 | + }); |
| | 461 | + |
| | 462 | + this.helper |
| | 463 | + .appendTo("body") |
| | 464 | + .disableSelection(); |
| | 465 | + |
| | 466 | + } else { |
| | 467 | + this.helper = this.element; |
| | 468 | + } |
| | 469 | + |
| | 470 | + }, |
| | 471 | + |
| | 472 | + _change: { |
| | 473 | + e: function(event, dx, dy) { |
| | 474 | + return { width: this.originalSize.width + dx }; |
| | 475 | + }, |
| | 476 | + w: function(event, dx, dy) { |
| | 477 | + var o = this.options, cs = this.originalSize, sp = this.originalPosition; |
| | 478 | + return { left: sp.left + dx, width: cs.width - dx }; |
| | 479 | + }, |
| | 480 | + n: function(event, dx, dy) { |
| | 481 | + var o = this.options, cs = this.originalSize, sp = this.originalPosition; |
| | 482 | + return { top: sp.top + dy, height: cs.height - dy }; |
| | 483 | + }, |
| | 484 | + s: function(event, dx, dy) { |
| | 485 | + return { height: this.originalSize.height + dy }; |
| | 486 | + }, |
| | 487 | + se: function(event, dx, dy) { |
| | 488 | + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); |
| | 489 | + }, |
| | 490 | + sw: function(event, dx, dy) { |
| | 491 | + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); |
| | 492 | + }, |
| | 493 | + ne: function(event, dx, dy) { |
| | 494 | + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); |
| | 495 | + }, |
| | 496 | + nw: function(event, dx, dy) { |
| | 497 | + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); |
| | 498 | + } |
| | 499 | + }, |
| | 500 | + |
| | 501 | + _propagate: function(n, event) { |
| | 502 | + $.ui.plugin.call(this, n, [event, this.ui()]); |
| | 503 | + (n != "resize" && this._trigger(n, event, this.ui())); |
| | 504 | + }, |
| | 505 | + |
| | 506 | + plugins: {}, |
| | 507 | + |
| | 508 | + ui: function() { |
| | 509 | + return { |
| | 510 | + originalElement: this.originalElement, |
| | 511 | + element: this.element, |
| | 512 | + helper: this.helper, |
| | 513 | + position: this.position, |
| | 514 | + size: this.size, |
| | 515 | + originalSize: this.originalSize, |
| | 516 | + originalPosition: this.originalPosition |
| | 517 | + }; |
| | 518 | + } |
| | 519 | + |
| | 520 | +}); |
| | 521 | + |
| | 522 | +$.extend($.ui.resizable, { |
| | 523 | + version: "1.8.11" |
| | 524 | +}); |
| | 525 | + |
| | 526 | +/* |
| | 527 | + * Resizable Extensions |
| | 528 | + */ |
| | 529 | + |
| | 530 | +$.ui.plugin.add("resizable", "alsoResize", { |
| | 531 | + |
| | 532 | + start: function (event, ui) { |
| | 533 | + var self = $(this).data("resizable"), o = self.options; |
| | 534 | + |
| | 535 | + var _store = function (exp) { |
| | 536 | + $(exp).each(function() { |
| | 537 | + var el = $(this); |
| | 538 | + el.data("resizable-alsoresize", { |
| | 539 | + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), |
| | 540 | + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), |
| | 541 | + position: el.css('position') // to reset Opera on stop() |
| | 542 | + }); |
| | 543 | + }); |
| | 544 | + }; |
| | 545 | + |
| | 546 | + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { |
| | 547 | + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } |
| | 548 | + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } |
| | 549 | + }else{ |
| | 550 | + _store(o.alsoResize); |
| | 551 | + } |
| | 552 | + }, |
| | 553 | + |
| | 554 | + resize: function (event, ui) { |
| | 555 | + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; |
| | 556 | + |
| | 557 | + var delta = { |
| | 558 | + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, |
| | 559 | + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 |
| | 560 | + }, |
| | 561 | + |
| | 562 | + _alsoResize = function (exp, c) { |
| | 563 | + $(exp).each(function() { |
| | 564 | + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, |
| | 565 | + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; |
| | 566 | + |
| | 567 | + $.each(css, function (i, prop) { |
| | 568 | + var sum = (start[prop]||0) + (delta[prop]||0); |
| | 569 | + if (sum && sum >= 0) |
| | 570 | + style[prop] = sum || null; |
| | 571 | + }); |
| | 572 | + |
| | 573 | + // Opera fixing relative position |
| | 574 | + if ($.browser.opera && /relative/.test(el.css('position'))) { |
| | 575 | + self._revertToRelativePosition = true; |
| | 576 | + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); |
| | 577 | + } |
| | 578 | + |
| | 579 | + el.css(style); |
| | 580 | + }); |
| | 581 | + }; |
| | 582 | + |
| | 583 | + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { |
| | 584 | + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); |
| | 585 | + }else{ |
| | 586 | + _alsoResize(o.alsoResize); |
| | 587 | + } |
| | 588 | + }, |
| | 589 | + |
| | 590 | + stop: function (event, ui) { |
| | 591 | + var self = $(this).data("resizable"), o = self.options; |
| | 592 | + |
| | 593 | + var _reset = function (exp) { |
| | 594 | + $(exp).each(function() { |
| | 595 | + var el = $(this); |
| | 596 | + // reset position for Opera - no need to verify it was changed |
| | 597 | + el.css({ position: el.data("resizable-alsoresize").position }); |
| | 598 | + }); |
| | 599 | + }; |
| | 600 | + |
| | 601 | + if (self._revertToRelativePosition) { |
| | 602 | + self._revertToRelativePosition = false; |
| | 603 | + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { |
| | 604 | + $.each(o.alsoResize, function (exp) { _reset(exp); }); |
| | 605 | + }else{ |
| | 606 | + _reset(o.alsoResize); |
| | 607 | + } |
| | 608 | + } |
| | 609 | + |
| | 610 | + $(this).removeData("resizable-alsoresize"); |
| | 611 | + } |
| | 612 | +}); |
| | 613 | + |
| | 614 | +$.ui.plugin.add("resizable", "animate", { |
| | 615 | + |
| | 616 | + stop: function(event, ui) { |
| | 617 | + var self = $(this).data("resizable"), o = self.options; |
| | 618 | + |
| | 619 | + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), |
| | 620 | + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, |
| | 621 | + soffsetw = ista ? 0 : self.sizeDiff.width; |
| | 622 | + |
| | 623 | + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, |
| | 624 | + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, |
| | 625 | + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; |
| | 626 | + |
| | 627 | + self.element.animate( |
| | 628 | + $.extend(style, top && left ? { top: top, left: left } : {}), { |
| | 629 | + duration: o.animateDuration, |
| | 630 | + easing: o.animateEasing, |
| | 631 | + step: function() { |
| | 632 | + |
| | 633 | + var data = { |
| | 634 | + width: parseInt(self.element.css('width'), 10), |
| | 635 | + height: parseInt(self.element.css('height'), 10), |
| | 636 | + top: parseInt(self.element.css('top'), 10), |
| | 637 | + left: parseInt(self.element.css('left'), 10) |
| | 638 | + }; |
| | 639 | + |
| | 640 | + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); |
| | 641 | + |
| | 642 | + // propagating resize, and updating values for each animation step |
| | 643 | + self._updateCache(data); |
| | 644 | + self._propagate("resize", event); |
| | 645 | + |
| | 646 | + } |
| | 647 | + } |
| | 648 | + ); |
| | 649 | + } |
| | 650 | + |
| | 651 | +}); |
| | 652 | + |
| | 653 | +$.ui.plugin.add("resizable", "containment", { |
| | 654 | + |
| | 655 | + start: function(event, ui) { |
| | 656 | + var self = $(this).data("resizable"), o = self.options, el = self.element; |
| | 657 | + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; |
| | 658 | + if (!ce) return; |
| | 659 | + |
| | 660 | + self.containerElement = $(ce); |
| | 661 | + |
| | 662 | + if (/document/.test(oc) || oc == document) { |
| | 663 | + self.containerOffset = { left: 0, top: 0 }; |
| | 664 | + self.containerPosition = { left: 0, top: 0 }; |
| | 665 | + |
| | 666 | + self.parentData = { |
| | 667 | + element: $(document), left: 0, top: 0, |
| | 668 | + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight |
| | 669 | + }; |
| | 670 | + } |
| | 671 | + |
| | 672 | + // i'm a node, so compute top, left, right, bottom |
| | 673 | + else { |
| | 674 | + var element = $(ce), p = []; |
| | 675 | + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); |
| | 676 | + |
| | 677 | + self.containerOffset = element.offset(); |
| | 678 | + self.containerPosition = element.position(); |
| | 679 | + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; |
| | 680 | + |
| | 681 | + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, |
| | 682 | + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); |
| | 683 | + |
| | 684 | + self.parentData = { |
| | 685 | + element: ce, left: co.left, top: co.top, width: width, height: height |
| | 686 | + }; |
| | 687 | + } |
| | 688 | + }, |
| | 689 | + |
| | 690 | + resize: function(event, ui) { |
| | 691 | + var self = $(this).data("resizable"), o = self.options, |
| | 692 | + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, |
| | 693 | + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; |
| | 694 | + |
| | 695 | + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; |
| | 696 | + |
| | 697 | + if (cp.left < (self._helper ? co.left : 0)) { |
| | 698 | + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); |
| | 699 | + if (pRatio) self.size.height = self.size.width / o.aspectRatio; |
| | 700 | + self.position.left = o.helper ? co.left : 0; |
| | 701 | + } |
| | 702 | + |
| | 703 | + if (cp.top < (self._helper ? co.top : 0)) { |
| | 704 | + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); |
| | 705 | + if (pRatio) self.size.width = self.size.height * o.aspectRatio; |
| | 706 | + self.position.top = self._helper ? co.top : 0; |
| | 707 | + } |
| | 708 | + |
| | 709 | + self.offset.left = self.parentData.left+self.position.left; |
| | 710 | + self.offset.top = self.parentData.top+self.position.top; |
| | 711 | + |
| | 712 | + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), |
| | 713 | + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); |
| | 714 | + |
| | 715 | + var isParent = self.containerElement.get(0) == self.element.parent().get(0), |
| | 716 | + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); |
| | 717 | + |
| | 718 | + if(isParent && isOffsetRelative) woset -= self.parentData.left; |
| | 719 | + |
| | 720 | + if (woset + self.size.width >= self.parentData.width) { |
| | 721 | + self.size.width = self.parentData.width - woset; |
| | 722 | + if (pRatio) self.size.height = self.size.width / self.aspectRatio; |
| | 723 | + } |
| | 724 | + |
| | 725 | + if (hoset + self.size.height >= self.parentData.height) { |
| | 726 | + self.size.height = self.parentData.height - hoset; |
| | 727 | + if (pRatio) self.size.width = self.size.height * self.aspectRatio; |
| | 728 | + } |
| | 729 | + }, |
| | 730 | + |
| | 731 | + stop: function(event, ui){ |
| | 732 | + var self = $(this).data("resizable"), o = self.options, cp = self.position, |
| | 733 | + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; |
| | 734 | + |
| | 735 | + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; |
| | 736 | + |
| | 737 | + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) |
| | 738 | + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); |
| | 739 | + |
| | 740 | + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) |
| | 741 | + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); |
| | 742 | + |
| | 743 | + } |
| | 744 | +}); |
| | 745 | + |
| | 746 | +$.ui.plugin.add("resizable", "ghost", { |
| | 747 | + |
| | 748 | + start: function(event, ui) { |
| | 749 | + |
| | 750 | + var self = $(this).data("resizable"), o = self.options, cs = self.size; |
| | 751 | + |
| | 752 | + self.ghost = self.originalElement.clone(); |
| | 753 | + self.ghost |
| | 754 | + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) |
| | 755 | + .addClass('ui-resizable-ghost') |
| | 756 | + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); |
| | 757 | + |
| | 758 | + self.ghost.appendTo(self.helper); |
| | 759 | + |
| | 760 | + }, |
| | 761 | + |
| | 762 | + resize: function(event, ui){ |
| | 763 | + var self = $(this).data("resizable"), o = self.options; |
| | 764 | + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); |
| | 765 | + }, |
| | 766 | + |
| | 767 | + stop: function(event, ui){ |
| | 768 | + var self = $(this).data("resizable"), o = self.options; |
| | 769 | + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); |
| | 770 | + } |
| | 771 | + |
| | 772 | +}); |
| | 773 | + |
| | 774 | +$.ui.plugin.add("resizable", "grid", { |
| | 775 | + |
| | 776 | + resize: function(event, ui) { |
| | 777 | + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; |
| | 778 | + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; |
| | 779 | + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); |
| | 780 | + |
| | 781 | + if (/^(se|s|e)$/.test(a)) { |
| | 782 | + self.size.width = os.width + ox; |
| | 783 | + self.size.height = os.height + oy; |
| | 784 | + } |
| | 785 | + else if (/^(ne)$/.test(a)) { |
| | 786 | + self.size.width = os.width + ox; |
| | 787 | + self.size.height = os.height + oy; |
| | 788 | + self.position.top = op.top - oy; |
| | 789 | + } |
| | 790 | + else if (/^(sw)$/.test(a)) { |
| | 791 | + self.size.width = os.width + ox; |
| | 792 | + self.size.height = os.height + oy; |
| | 793 | + self.position.left = op.left - ox; |
| | 794 | + } |
| | 795 | + else { |
| | 796 | + self.size.width = os.width + ox; |
| | 797 | + self.size.height = os.height + oy; |
| | 798 | + self.position.top = op.top - oy; |
| | 799 | + self.position.left = op.left - ox; |
| | 800 | + } |
| | 801 | + } |
| | 802 | + |
| | 803 | +}); |
| | 804 | + |
| | 805 | +var num = function(v) { |
| | 806 | + return parseInt(v, 10) || 0; |
| | 807 | +}; |
| | 808 | + |
| | 809 | +var isNumber = function(value) { |
| | 810 | + return !isNaN(parseInt(value, 10)); |
| | 811 | +}; |
| | 812 | + |
| | 813 | +})(jQuery); |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.client.js |
| — | — | @@ -0,0 +1,216 @@ |
| | 2 | +/** |
| | 3 | + * User-agent detection |
| | 4 | + */ |
| | 5 | +( function( $ ) { |
| | 6 | + |
| | 7 | + /* Private Members */ |
| | 8 | + |
| | 9 | + /** |
| | 10 | + * @var profileCache {Object} Keyed by userAgent string, |
| | 11 | + * value is the parsed $.client.profile object for that user agent. |
| | 12 | + */ |
| | 13 | + var profileCache = {}; |
| | 14 | + |
| | 15 | + /* Public Methods */ |
| | 16 | + |
| | 17 | + $.client = { |
| | 18 | + |
| | 19 | + /** |
| | 20 | + * Get an object containing information about the client. |
| | 21 | + * |
| | 22 | + * @param nav {Object} An object with atleast a 'userAgent' and 'platform' key.= |
| | 23 | + * Defaults to the global Navigator object. |
| | 24 | + * @return {Object} The resulting client object will be in the following format: |
| | 25 | + * { |
| | 26 | + * 'name': 'firefox', |
| | 27 | + * 'layout': 'gecko', |
| | 28 | + * 'layoutVersion': 20101026, |
| | 29 | + * 'platform': 'linux' |
| | 30 | + * 'version': '3.5.1', |
| | 31 | + * 'versionBase': '3', |
| | 32 | + * 'versionNumber': 3.5, |
| | 33 | + * } |
| | 34 | + */ |
| | 35 | + profile: function( nav ) { |
| | 36 | + if ( nav === undefined ) { |
| | 37 | + nav = window.navigator; |
| | 38 | + } |
| | 39 | + // Use the cached version if possible |
| | 40 | + if ( profileCache[nav.userAgent] === undefined ) { |
| | 41 | + |
| | 42 | + /* Configuration */ |
| | 43 | + |
| | 44 | + // Name of browsers or layout engines we don't recognize |
| | 45 | + var uk = 'unknown'; |
| | 46 | + // Generic version digit |
| | 47 | + var x = 'x'; |
| | 48 | + // Strings found in user agent strings that need to be conformed |
| | 49 | + var wildUserAgents = ['Opera', 'Navigator', 'Minefield', 'KHTML', 'Chrome', 'PLAYSTATION 3']; |
| | 50 | + // Translations for conforming user agent strings |
| | 51 | + var userAgentTranslations = [ |
| | 52 | + // Tons of browsers lie about being something they are not |
| | 53 | + [/(Firefox|MSIE|KHTML,\slike\sGecko|Konqueror)/, ''], |
| | 54 | + // Chrome lives in the shadow of Safari still |
| | 55 | + ['Chrome Safari', 'Chrome'], |
| | 56 | + // KHTML is the layout engine not the browser - LIES! |
| | 57 | + ['KHTML', 'Konqueror'], |
| | 58 | + // Firefox nightly builds |
| | 59 | + ['Minefield', 'Firefox'], |
| | 60 | + // This helps keep differnt versions consistent |
| | 61 | + ['Navigator', 'Netscape'], |
| | 62 | + // This prevents version extraction issues, otherwise translation would happen later |
| | 63 | + ['PLAYSTATION 3', 'PS3'] |
| | 64 | + ]; |
| | 65 | + // Strings which precede a version number in a user agent string - combined and used as match 1 in |
| | 66 | + // version detectection |
| | 67 | + var versionPrefixes = [ |
| | 68 | + 'camino', 'chrome', 'firefox', 'netscape', 'netscape6', 'opera', 'version', 'konqueror', 'lynx', |
| | 69 | + 'msie', 'safari', 'ps3' |
| | 70 | + ]; |
| | 71 | + // Used as matches 2, 3 and 4 in version extraction - 3 is used as actual version number |
| | 72 | + var versionSuffix = '(\\/|\\;?\\s|)([a-z0-9\\.\\+]*?)(\\;|dev|rel|\\)|\\s|$)'; |
| | 73 | + // Names of known browsers |
| | 74 | + var names = [ |
| | 75 | + 'camino', 'chrome', 'firefox', 'netscape', 'konqueror', 'lynx', 'msie', 'opera', 'safari', 'ipod', |
| | 76 | + 'iphone', 'blackberry', 'ps3' |
| | 77 | + ]; |
| | 78 | + // Tanslations for conforming browser names |
| | 79 | + var nameTranslations = []; |
| | 80 | + // Names of known layout engines |
| | 81 | + var layouts = ['gecko', 'konqueror', 'msie', 'opera', 'webkit']; |
| | 82 | + // Translations for conforming layout names |
| | 83 | + var layoutTranslations = [['konqueror', 'khtml'], ['msie', 'trident'], ['opera', 'presto']]; |
| | 84 | + // Names of supported layout engines for version number |
| | 85 | + var layoutVersions = ['applewebkit', 'gecko']; |
| | 86 | + // Names of known operating systems |
| | 87 | + var platforms = ['win', 'mac', 'linux', 'sunos', 'solaris', 'iphone']; |
| | 88 | + // Translations for conforming operating system names |
| | 89 | + var platformTranslations = [['sunos', 'solaris']]; |
| | 90 | + |
| | 91 | + /* Methods */ |
| | 92 | + |
| | 93 | + // Performs multiple replacements on a string |
| | 94 | + var translate = function( source, translations ) { |
| | 95 | + for ( var i = 0; i < translations.length; i++ ) { |
| | 96 | + source = source.replace( translations[i][0], translations[i][1] ); |
| | 97 | + } |
| | 98 | + return source; |
| | 99 | + }; |
| | 100 | + |
| | 101 | + /* Pre-processing */ |
| | 102 | + |
| | 103 | + var ua = nav.userAgent, |
| | 104 | + match, |
| | 105 | + name = uk, |
| | 106 | + layout = uk, |
| | 107 | + layoutversion = uk, |
| | 108 | + platform = uk, |
| | 109 | + version = x; |
| | 110 | + |
| | 111 | + if ( match = new RegExp( '(' + wildUserAgents.join( '|' ) + ')' ).exec( ua ) ) { |
| | 112 | + // Takes a userAgent string and translates given text into something we can more easily work with |
| | 113 | + ua = translate( ua, userAgentTranslations ); |
| | 114 | + } |
| | 115 | + // Everything will be in lowercase from now on |
| | 116 | + ua = ua.toLowerCase(); |
| | 117 | + |
| | 118 | + /* Extraction */ |
| | 119 | + |
| | 120 | + if ( match = new RegExp( '(' + names.join( '|' ) + ')' ).exec( ua ) ) { |
| | 121 | + name = translate( match[1], nameTranslations ); |
| | 122 | + } |
| | 123 | + if ( match = new RegExp( '(' + layouts.join( '|' ) + ')' ).exec( ua ) ) { |
| | 124 | + layout = translate( match[1], layoutTranslations ); |
| | 125 | + } |
| | 126 | + if ( match = new RegExp( '(' + layoutVersions.join( '|' ) + ')\\\/(\\d+)').exec( ua ) ) { |
| | 127 | + layoutversion = parseInt( match[2], 10 ); |
| | 128 | + } |
| | 129 | + if ( match = new RegExp( '(' + platforms.join( '|' ) + ')' ).exec( nav.platform.toLowerCase() ) ) { |
| | 130 | + platform = translate( match[1], platformTranslations ); |
| | 131 | + } |
| | 132 | + if ( match = new RegExp( '(' + versionPrefixes.join( '|' ) + ')' + versionSuffix ).exec( ua ) ) { |
| | 133 | + version = match[3]; |
| | 134 | + } |
| | 135 | + |
| | 136 | + /* Edge Cases -- did I mention about how user agent string lie? */ |
| | 137 | + |
| | 138 | + // Decode Safari's crazy 400+ version numbers |
| | 139 | + if ( name.match( /safari/ ) && version > 400 ) { |
| | 140 | + version = '2.0'; |
| | 141 | + } |
| | 142 | + // Expose Opera 10's lies about being Opera 9.8 |
| | 143 | + if ( name === 'opera' && version >= 9.8) { |
| | 144 | + version = ua.match( /version\/([0-9\.]*)/i )[1] || 10; |
| | 145 | + } |
| | 146 | + var versionNumber = parseFloat( version, 10 ) || 0.0; |
| | 147 | + |
| | 148 | + /* Caching */ |
| | 149 | + |
| | 150 | + profileCache[nav.userAgent] = { |
| | 151 | + 'name': name, |
| | 152 | + 'layout': layout, |
| | 153 | + 'layoutVersion': layoutversion, |
| | 154 | + 'platform': platform, |
| | 155 | + 'version': version, |
| | 156 | + 'versionBase': ( version !== x ? Math.floor( versionNumber ).toString() : x ), |
| | 157 | + 'versionNumber': versionNumber |
| | 158 | + }; |
| | 159 | + } |
| | 160 | + return profileCache[nav.userAgent]; |
| | 161 | + }, |
| | 162 | + |
| | 163 | + /** |
| | 164 | + * Checks the current browser against a support map object to determine if the browser has been black-listed or |
| | 165 | + * not. If the browser was not configured specifically it is assumed to work. It is assumed that the body |
| | 166 | + * element is classified as either "ltr" or "rtl". If neither is set, "ltr" is assumed. |
| | 167 | + * |
| | 168 | + * A browser map is in the following format: |
| | 169 | + * { |
| | 170 | + * 'ltr': { |
| | 171 | + * // Multiple rules with configurable operators |
| | 172 | + * 'msie': [['>=', 7], ['!=', 9]], |
| | 173 | + * // Blocked entirely |
| | 174 | + * 'iphone': false |
| | 175 | + * }, |
| | 176 | + * 'rtl': { |
| | 177 | + * // Test against a string |
| | 178 | + * 'msie': [['!==', '8.1.2.3']], |
| | 179 | + * // RTL rules do not fall through to LTR rules, you must explicity set each of them |
| | 180 | + * 'iphone': false |
| | 181 | + * } |
| | 182 | + * } |
| | 183 | + * |
| | 184 | + * @param map {Object} Browser support map |
| | 185 | + * @param profile {Object} (optional) a client-profile object. |
| | 186 | + * |
| | 187 | + * @return Boolean true if browser known or assumed to be supported, false if blacklisted |
| | 188 | + */ |
| | 189 | + test: function( map, profile ) { |
| | 190 | + profile = $.isPlainObject( profile ) ? profile : $.client.profile(); |
| | 191 | + |
| | 192 | + var dir = $( 'body' ).is( '.rtl' ) ? 'rtl' : 'ltr'; |
| | 193 | + // Check over each browser condition to determine if we are running in a compatible client |
| | 194 | + if ( typeof map[dir] !== 'object' || typeof map[dir][profile.name] === 'undefined' ) { |
| | 195 | + // Unknown, so we assume it's working |
| | 196 | + return true; |
| | 197 | + } |
| | 198 | + var conditions = map[dir][profile.name]; |
| | 199 | + for ( var i = 0; i < conditions.length; i++ ) { |
| | 200 | + var op = conditions[i][0]; |
| | 201 | + var val = conditions[i][1]; |
| | 202 | + if ( val === false ) { |
| | 203 | + return false; |
| | 204 | + } else if ( typeof val == 'string' ) { |
| | 205 | + if ( !( eval( 'profile.version' + op + '"' + val + '"' ) ) ) { |
| | 206 | + return false; |
| | 207 | + } |
| | 208 | + } else if ( typeof val == 'number' ) { |
| | 209 | + if ( !( eval( 'profile.versionNumber' + op + val ) ) ) { |
| | 210 | + return false; |
| | 211 | + } |
| | 212 | + } |
| | 213 | + } |
| | 214 | + return true; |
| | 215 | + } |
| | 216 | + }; |
| | 217 | +} )( jQuery ); |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.min.js |
| — | — | @@ -0,0 +1,783 @@ |
| | 2 | +/*! |
| | 3 | + * jQuery UI 1.8.11 |
| | 4 | + * |
| | 5 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 6 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 7 | + * http://jquery.org/license |
| | 8 | + * |
| | 9 | + * http://docs.jquery.com/UI |
| | 10 | + */ |
| | 11 | +(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.11",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, |
| | 12 | +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this, |
| | 13 | +"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position"); |
| | 14 | +if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f, |
| | 15 | +"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h, |
| | 16 | +d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}}); |
| | 17 | +c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&& |
| | 18 | +b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery); |
| | 19 | +;/*! |
| | 20 | + * jQuery UI Widget 1.8.11 |
| | 21 | + * |
| | 22 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 23 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 24 | + * http://jquery.org/license |
| | 25 | + * |
| | 26 | + * http://docs.jquery.com/UI/Widget |
| | 27 | + */ |
| | 28 | +(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, |
| | 29 | +a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; |
| | 30 | +e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, |
| | 31 | +this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, |
| | 32 | +widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, |
| | 33 | +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); |
| | 34 | +;/*! |
| | 35 | + * jQuery UI Mouse 1.8.11 |
| | 36 | + * |
| | 37 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 38 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 39 | + * http://jquery.org/license |
| | 40 | + * |
| | 41 | + * http://docs.jquery.com/UI/Mouse |
| | 42 | + * |
| | 43 | + * Depends: |
| | 44 | + * jquery.ui.widget.js |
| | 45 | + */ |
| | 46 | +(function(b){b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent= |
| | 47 | +a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,e=a.which==1,f=typeof this.options.cancel=="string"?b(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted= |
| | 48 | +this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(d){return c._mouseMove(d)};this._mouseUpDelegate=function(d){return c._mouseUp(d)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled= |
| | 49 | +true}},_mouseMove:function(a){if(b.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate); |
| | 50 | +if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); |
| | 51 | +;/* |
| | 52 | + * jQuery UI Position 1.8.11 |
| | 53 | + * |
| | 54 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 55 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 56 | + * http://jquery.org/license |
| | 57 | + * |
| | 58 | + * http://docs.jquery.com/UI/Position |
| | 59 | + */ |
| | 60 | +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, |
| | 61 | +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= |
| | 62 | +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= |
| | 63 | +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= |
| | 64 | +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= |
| | 65 | +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), |
| | 66 | +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); |
| | 67 | +;/* |
| | 68 | + * jQuery UI Draggable 1.8.11 |
| | 69 | + * |
| | 70 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 71 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 72 | + * http://jquery.org/license |
| | 73 | + * |
| | 74 | + * http://docs.jquery.com/UI/Draggables |
| | 75 | + * |
| | 76 | + * Depends: |
| | 77 | + * jquery.ui.core.js |
| | 78 | + * jquery.ui.mouse.js |
| | 79 | + * jquery.ui.widget.js |
| | 80 | + */ |
| | 81 | +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== |
| | 82 | +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= |
| | 83 | +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- |
| | 84 | +this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions(); |
| | 85 | +d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| |
| | 86 | +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&& |
| | 87 | +this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== |
| | 88 | +a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]|| |
| | 89 | +0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], |
| | 90 | +this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top- |
| | 91 | +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(), |
| | 92 | +height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"? |
| | 93 | +document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"), |
| | 94 | +10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"), |
| | 95 | +10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&& |
| | 96 | +d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], |
| | 97 | +this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g= |
| | 98 | +this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])? |
| | 99 | +e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft(): |
| | 100 | +f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition, |
| | 101 | +offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.11"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g.refreshPositions();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({}, |
| | 102 | +b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c= |
| | 103 | +d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]}; |
| | 104 | +a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&& |
| | 105 | +this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor", |
| | 106 | +{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+ |
| | 107 | +"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity", |
| | 108 | +a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+ |
| | 109 | +c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()< |
| | 110 | +c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+ |
| | 111 | +c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"), |
| | 112 | +f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top= |
| | 113 | +c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top= |
| | 114 | +c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(), |
| | 115 | +{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b= |
| | 116 | +parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery); |
| | 117 | +;/* |
| | 118 | + * jQuery UI Droppable 1.8.11 |
| | 119 | + * |
| | 120 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 121 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 122 | + * http://jquery.org/license |
| | 123 | + * |
| | 124 | + * http://docs.jquery.com/UI/Droppables |
| | 125 | + * |
| | 126 | + * Depends: |
| | 127 | + * jquery.ui.core.js |
| | 128 | + * jquery.ui.widget.js |
| | 129 | + * jquery.ui.mouse.js |
| | 130 | + * jquery.ui.draggable.js |
| | 131 | + */ |
| | 132 | +(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this); |
| | 133 | +a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&& |
| | 134 | +this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); |
| | 135 | +this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g= |
| | 136 | +d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", |
| | 137 | +a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.11"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height; |
| | 138 | +switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>= |
| | 139 | +i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!= |
| | 140 | +"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem|| |
| | 141 | +a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e= |
| | 142 | +d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery); |
| | 143 | +;/* |
| | 144 | + * jQuery UI Resizable 1.8.11 |
| | 145 | + * |
| | 146 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 147 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 148 | + * http://jquery.org/license |
| | 149 | + * |
| | 150 | + * http://docs.jquery.com/UI/Resizables |
| | 151 | + * |
| | 152 | + * Depends: |
| | 153 | + * jquery.ui.core.js |
| | 154 | + * jquery.ui.mouse.js |
| | 155 | + * jquery.ui.widget.js |
| | 156 | + */ |
| | 157 | +(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element, |
| | 158 | +_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), |
| | 159 | +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= |
| | 160 | +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", |
| | 161 | +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== |
| | 162 | +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); |
| | 163 | +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; |
| | 164 | +if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(), |
| | 165 | +d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset= |
| | 166 | +this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio: |
| | 167 | +this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize", |
| | 168 | +b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height; |
| | 169 | +f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing"); |
| | 170 | +this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top= |
| | 171 | +null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+ |
| | 172 | +this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d= |
| | 173 | +[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b= |
| | 174 | +this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b, |
| | 175 | +a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a, |
| | 176 | +c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize, |
| | 177 | +originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.11"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize= |
| | 178 | +b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width", |
| | 179 | +"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})}; |
| | 180 | +if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height- |
| | 181 | +g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width, |
| | 182 | +height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d= |
| | 183 | +e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options, |
| | 184 | +d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper? |
| | 185 | +d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height= |
| | 186 | +a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&& |
| | 187 | +/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable"); |
| | 188 | +b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/ |
| | 189 | +(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery); |
| | 190 | +;/* |
| | 191 | + * jQuery UI Selectable 1.8.11 |
| | 192 | + * |
| | 193 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 194 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 195 | + * http://jquery.org/license |
| | 196 | + * |
| | 197 | + * http://docs.jquery.com/UI/Selectables |
| | 198 | + * |
| | 199 | + * Depends: |
| | 200 | + * jquery.ui.core.js |
| | 201 | + * jquery.ui.mouse.js |
| | 202 | + * jquery.ui.widget.js |
| | 203 | + */ |
| | 204 | +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), |
| | 205 | +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, |
| | 206 | +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", |
| | 207 | +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= |
| | 208 | +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting"); |
| | 209 | +a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&& |
| | 210 | +!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d= |
| | 211 | +e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.11"})})(jQuery); |
| | 212 | +;/* |
| | 213 | + * jQuery UI Sortable 1.8.11 |
| | 214 | + * |
| | 215 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 216 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 217 | + * http://jquery.org/license |
| | 218 | + * |
| | 219 | + * http://docs.jquery.com/UI/Sortables |
| | 220 | + * |
| | 221 | + * Depends: |
| | 222 | + * jquery.ui.core.js |
| | 223 | + * jquery.ui.mouse.js |
| | 224 | + * jquery.ui.widget.js |
| | 225 | + */ |
| | 226 | +(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); |
| | 227 | +this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]= |
| | 228 | +b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false; |
| | 229 | +d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left- |
| | 230 | +this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; |
| | 231 | +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= |
| | 232 | +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); |
| | 233 | +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top< |
| | 234 | +b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()- |
| | 235 | +b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this, |
| | 236 | +a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], |
| | 237 | +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); |
| | 238 | +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): |
| | 239 | +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, |
| | 240 | +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, |
| | 241 | +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers|| |
| | 242 | +this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection(); |
| | 243 | +var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)}, |
| | 244 | +_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); |
| | 245 | +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), |
| | 246 | +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element), |
| | 247 | +this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&& |
| | 248 | +this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left= |
| | 249 | +e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0]; |
| | 250 | +if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder); |
| | 251 | +c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length=== |
| | 252 | +1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer= |
| | 253 | +this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])): |
| | 254 | +b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height== |
| | 255 | +""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= |
| | 256 | +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), |
| | 257 | +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions= |
| | 258 | +{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()|| |
| | 259 | +document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth, |
| | 260 | +b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!= |
| | 261 | +document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft(): |
| | 262 | +e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX- |
| | 263 | +this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top< |
| | 264 | +this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&& |
| | 265 | +this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter= |
| | 266 | +this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show(); |
| | 267 | +this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0], |
| | 268 | +this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out", |
| | 269 | +g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b|| |
| | 270 | +this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position, |
| | 271 | +originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.11"})})(jQuery); |
| | 272 | +;/* |
| | 273 | + * jQuery UI Accordion 1.8.11 |
| | 274 | + * |
| | 275 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 276 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 277 | + * http://jquery.org/license |
| | 278 | + * |
| | 279 | + * http://docs.jquery.com/UI/Accordion |
| | 280 | + * |
| | 281 | + * Depends: |
| | 282 | + * jquery.ui.core.js |
| | 283 | + * jquery.ui.widget.js |
| | 284 | + */ |
| | 285 | +(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); |
| | 286 | +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); |
| | 287 | +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", |
| | 288 | +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= |
| | 289 | +this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); |
| | 290 | +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); |
| | 291 | +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); |
| | 292 | +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ |
| | 293 | +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; |
| | 294 | +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); |
| | 295 | +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), |
| | 296 | +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| |
| | 297 | +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", |
| | 298 | +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.11", |
| | 299 | +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); |
| | 300 | +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", |
| | 301 | +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); |
| | 302 | +;/* |
| | 303 | + * jQuery UI Autocomplete 1.8.11 |
| | 304 | + * |
| | 305 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 306 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 307 | + * http://jquery.org/license |
| | 308 | + * |
| | 309 | + * http://docs.jquery.com/UI/Autocomplete |
| | 310 | + * |
| | 311 | + * Depends: |
| | 312 | + * jquery.ui.core.js |
| | 313 | + * jquery.ui.widget.js |
| | 314 | + * jquery.ui.position.js |
| | 315 | + */ |
| | 316 | +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= |
| | 317 | +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= |
| | 318 | +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; |
| | 319 | +this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& |
| | 320 | +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); |
| | 321 | +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& |
| | 322 | +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= |
| | 323 | +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close(); |
| | 324 | +this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label|| |
| | 325 | +b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this; |
| | 326 | +d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, |
| | 327 | +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); |
| | 328 | +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", |
| | 329 | +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})}, |
| | 330 | +deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0); |
| | 331 | +e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e, |
| | 332 | +g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first")); |
| | 333 | +this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery); |
| | 334 | +;/* |
| | 335 | + * jQuery UI Button 1.8.11 |
| | 336 | + * |
| | 337 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 338 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 339 | + * http://jquery.org/license |
| | 340 | + * |
| | 341 | + * http://docs.jquery.com/UI/Button |
| | 342 | + * |
| | 343 | + * Depends: |
| | 344 | + * jquery.ui.core.js |
| | 345 | + * jquery.ui.widget.js |
| | 346 | + */ |
| | 347 | +(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,f=a([]);if(c)f=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return f};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button", |
| | 348 | +i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button", |
| | 349 | +function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||a(this).removeClass(f)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active"); |
| | 350 | +b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var e=b.element[0];h(e).not(e).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active"); |
| | 351 | +g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(e){if(c.disabled)return false;if(e.keyCode==a.ui.keyCode.SPACE||e.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(e){e.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled", |
| | 352 | +c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){var b=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=b.find(c);if(!this.buttonElement.length){b=b.length?b.siblings():this.element.siblings();this.buttonElement=b.filter(c);if(!this.buttonElement.length)this.buttonElement=b.find(c)}this.element.addClass("ui-helper-hidden-accessible"); |
| | 353 | +(b=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html()); |
| | 354 | +this.hasTitle||this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed", |
| | 355 | +true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), |
| | 356 | +c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.push(f?"ui-button-icons-only": |
| | 357 | +"ui-button-icon-only");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, |
| | 358 | +destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery); |
| | 359 | +;/* |
| | 360 | + * jQuery UI Dialog 1.8.11 |
| | 361 | + * |
| | 362 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 363 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 364 | + * http://jquery.org/license |
| | 365 | + * |
| | 366 | + * http://docs.jquery.com/UI/Dialog |
| | 367 | + * |
| | 368 | + * Depends: |
| | 369 | + * jquery.ui.core.js |
| | 370 | + * jquery.ui.widget.js |
| | 371 | + * jquery.ui.button.js |
| | 372 | + * jquery.ui.draggable.js |
| | 373 | + * jquery.ui.mouse.js |
| | 374 | + * jquery.ui.position.js |
| | 375 | + * jquery.ui.resizable.js |
| | 376 | + */ |
| | 377 | +(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&& |
| | 378 | +c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex", |
| | 379 | +-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role", |
| | 380 | +"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose= |
| | 381 | +b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&& |
| | 382 | +a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index"); |
| | 383 | +isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ); |
| | 384 | +d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}}); |
| | 385 | +c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f, |
| | 386 | +h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('<button type="button"></button>').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g= |
| | 387 | +d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize, |
| | 388 | +position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f, |
| | 389 | +h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length=== |
| | 390 | +1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in |
| | 391 | +l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled"); |
| | 392 | +break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e= |
| | 393 | +this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&& |
| | 394 | +this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.11",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length=== |
| | 395 | +0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), |
| | 396 | +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); |
| | 397 | +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances, |
| | 398 | +function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); |
| | 399 | +;/* |
| | 400 | + * jQuery UI Slider 1.8.11 |
| | 401 | + * |
| | 402 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 403 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 404 | + * http://jquery.org/license |
| | 405 | + * |
| | 406 | + * http://docs.jquery.com/UI/Slider |
| | 407 | + * |
| | 408 | + * Depends: |
| | 409 | + * jquery.ui.core.js |
| | 410 | + * jquery.ui.mouse.js |
| | 411 | + * jquery.ui.widget.js |
| | 412 | + */ |
| | 413 | +(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");a.disabled&&this.element.addClass("ui-slider-disabled ui-disabled"); |
| | 414 | +this.range=d([]);if(a.range){if(a.range===true){this.range=d("<div></div>");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle"); |
| | 415 | +if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length<a.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur(); |
| | 416 | +else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e= |
| | 417 | +false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h=== |
| | 418 | +b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); |
| | 419 | +this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b, |
| | 420 | +g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true}, |
| | 421 | +_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a; |
| | 422 | +if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value= |
| | 423 | +this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c<e))c=e;if(c!==this.values(a)){e=this.values();e[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:e});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a], |
| | 424 | +value:c});b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value= |
| | 425 | +this._trimAlignValue(b);this._refreshValue();this._change(null,0)}return this._value()},values:function(b,a){var c,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):this.value(); |
| | 426 | +else return this._values()},_setOption:function(b,a){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); |
| | 427 | +this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b]; |
| | 428 | +return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, |
| | 429 | +_refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate); |
| | 430 | +if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, |
| | 431 | +1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.11"})})(jQuery); |
| | 432 | +;/* |
| | 433 | + * jQuery UI Tabs 1.8.11 |
| | 434 | + * |
| | 435 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 436 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 437 | + * http://jquery.org/license |
| | 438 | + * |
| | 439 | + * http://docs.jquery.com/UI/Tabs |
| | 440 | + * |
| | 441 | + * Depends: |
| | 442 | + * jquery.ui.core.js |
| | 443 | + * jquery.ui.widget.js |
| | 444 | + */ |
| | 445 | +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& |
| | 446 | +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= |
| | 447 | +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| |
| | 448 | +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); |
| | 449 | +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= |
| | 450 | +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); |
| | 451 | +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); |
| | 452 | +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ |
| | 453 | +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", |
| | 454 | +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; |
| | 455 | +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= |
| | 456 | +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; |
| | 457 | +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= |
| | 458 | +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, |
| | 459 | +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); |
| | 460 | +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); |
| | 461 | +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, |
| | 462 | +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, |
| | 463 | +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, |
| | 464 | +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, |
| | 465 | +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.11"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& |
| | 466 | +a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); |
| | 467 | +;/* |
| | 468 | + * jQuery UI Datepicker 1.8.11 |
| | 469 | + * |
| | 470 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 471 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 472 | + * http://jquery.org/license |
| | 473 | + * |
| | 474 | + * http://docs.jquery.com/UI/Datepicker |
| | 475 | + * |
| | 476 | + * Depends: |
| | 477 | + * jquery.ui.core.js |
| | 478 | + */ |
| | 479 | +(function(d,A){function K(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= |
| | 480 | +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", |
| | 481 | +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", |
| | 482 | +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function F(a,b){d.extend(a,b);for(var c in b)if(b[c]== |
| | 483 | +null||b[c]==A)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.11"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){F(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase(); |
| | 484 | +f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}}, |
| | 485 | +_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&& |
| | 486 | +b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f== |
| | 487 | +""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a, |
| | 488 | +c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b), |
| | 489 | +true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}F(a.settings,e||{}); |
| | 490 | +b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); |
| | 491 | +this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", |
| | 492 | +this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs, |
| | 493 | +function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null: |
| | 494 | +f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({}, |
| | 495 | +e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e,"max");F(e.settings,f);if(i!==null&&f.dateFormat!==A&&f.minDate===A)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==A&&f.maxDate===A)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}}, |
| | 496 | +_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl"); |
| | 497 | +b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"), |
| | 498 | +"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey? |
| | 499 | +-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target, |
| | 500 | ++7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==A?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target); |
| | 501 | +if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a); |
| | 502 | +d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");F(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-= |
| | 503 | +document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim"); |
| | 504 | +var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst= |
| | 505 | +b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover"); |
| | 506 | +this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+ |
| | 507 | +this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&& |
| | 508 | +a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth(): |
| | 509 | +0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a), |
| | 510 | +"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"? |
| | 511 | +"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a= |
| | 512 | +d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a= |
| | 513 | +d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c== |
| | 514 | +"M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth= |
| | 515 | +b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker(); |
| | 516 | +this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0); |
| | 517 | +a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c? |
| | 518 | +c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){var v=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&v?4:p=="o"?3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,v,H){p=o(p)?H:v;for(v=0;v<p.length;v++)if(b.substr(s,p[v].length).toLowerCase()==p[v].toLowerCase()){s+=p[v].length;return v+1}throw"Unknown name at position "+ |
| | 519 | +s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(k)if(a.charAt(z)=="'"&&!o("'"))k=false;else r();else switch(a.charAt(z)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var w=new Date(m("@"));c=w.getFullYear();j=w.getMonth()+1;l=w.getDate();break;case "!":w=new Date((m("!")-this._ticksTo1970)/1E4);c=w.getFullYear();j=w.getMonth()+ |
| | 520 | +1;l=w.getDate();break;case "'":if(o("'"))r();else k=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y", |
| | 521 | +RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&& |
| | 522 | +a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M", |
| | 523 | +b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+= |
| | 524 | +"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==A?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth= |
| | 525 | +f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g= |
| | 526 | +(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j, |
| | 527 | +l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= |
| | 528 | +a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), |
| | 529 | +b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= |
| | 530 | +this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+ |
| | 531 | +(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+ |
| | 532 | +(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a, |
| | 533 | +"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z= |
| | 534 | +this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",D=0;D<i[0];D++){for(var M="",E=0;E<i[1];E++){var N=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(E){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]- |
| | 535 | +1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&D==0?c?f:n:"")+(/all|right/.test(t)&&D==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,D>0||E>0,z,w)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var B=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q= |
| | 536 | +(t+h)%7;B+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=B+"</tr></thead><tbody>";B=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,B);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;B=l?6:Math.ceil((t+B)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O<B;O++){x+="<tr>";var P=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var G= |
| | 537 | +p?p.apply(a.input?a.input[0]:null,[q]):[true,""],C=q.getMonth()!=g,J=C&&!H||!G[0]||k&&q<k||o&&q>o;P+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(C?" ui-datepicker-other-month":"")+(q.getTime()==N.getTime()&&g==a.selectedMonth&&a._keyEvent||L.getTime()==q.getTime()&&L.getTime()==N.getTime()?" "+this._dayOverClass:"")+(J?" "+this._unselectableClass+" ui-state-disabled":"")+(C&&!v?"":" "+G[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today": |
| | 538 | +""))+'"'+((!C||v)&&G[2]?' title="'+G[2]+'"':"")+(J?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(C&&!v?" ":J?'<span class="ui-state-default">'+q.getDate()+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==u.getTime()?" ui-state-active":"")+(C?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+= |
| | 539 | +P+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&E==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">', |
| | 540 | +o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&& |
| | 541 | +l)?" ":""));a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+ |
| | 542 | +a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";if(d.browser.mozilla)k+='<select class="ui-datepicker-year"><option value="'+c+'" selected="selected">'+c+"</option></select>";else{k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e= |
| | 543 | +a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a, |
| | 544 | +"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); |
| | 545 | +c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, |
| | 546 | +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= |
| | 547 | +function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, |
| | 548 | +[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.11";window["DP_jQuery_"+y]=d})(jQuery); |
| | 549 | +;/* |
| | 550 | + * jQuery UI Progressbar 1.8.11 |
| | 551 | + * |
| | 552 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 553 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 554 | + * http://jquery.org/license |
| | 555 | + * |
| | 556 | + * http://docs.jquery.com/UI/Progressbar |
| | 557 | + * |
| | 558 | + * Depends: |
| | 559 | + * jquery.ui.core.js |
| | 560 | + * jquery.ui.widget.js |
| | 561 | + */ |
| | 562 | +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); |
| | 563 | +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* |
| | 564 | +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.11"})})(jQuery); |
| | 565 | +;/* |
| | 566 | + * jQuery UI Effects 1.8.11 |
| | 567 | + * |
| | 568 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 569 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 570 | + * http://jquery.org/license |
| | 571 | + * |
| | 572 | + * http://docs.jquery.com/UI/Effects/ |
| | 573 | + */ |
| | 574 | +jQuery.effects||function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], |
| | 575 | +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, |
| | 576 | +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= |
| | 577 | +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function m(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", |
| | 578 | +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, |
| | 579 | +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, |
| | 580 | +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, |
| | 581 | +d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")||" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0]; |
| | 582 | +h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c, |
| | 583 | +a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.11",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c, |
| | 584 | +a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent", |
| | 585 | +border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c); |
| | 586 | +return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments); |
| | 587 | +else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c), |
| | 588 | +b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c, |
| | 589 | +a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c, |
| | 590 | +a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a== |
| | 591 | +e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c= |
| | 592 | +g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/ |
| | 593 | +h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c, |
| | 594 | +a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery); |
| | 595 | +;/* |
| | 596 | + * jQuery UI Effects Blind 1.8.11 |
| | 597 | + * |
| | 598 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 599 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 600 | + * http://jquery.org/license |
| | 601 | + * |
| | 602 | + * http://docs.jquery.com/UI/Effects/Blind |
| | 603 | + * |
| | 604 | + * Depends: |
| | 605 | + * jquery.effects.core.js |
| | 606 | + */ |
| | 607 | +(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a, |
| | 608 | +g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery); |
| | 609 | +;/* |
| | 610 | + * jQuery UI Effects Bounce 1.8.11 |
| | 611 | + * |
| | 612 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 613 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 614 | + * http://jquery.org/license |
| | 615 | + * |
| | 616 | + * http://docs.jquery.com/UI/Effects/Bounce |
| | 617 | + * |
| | 618 | + * Depends: |
| | 619 | + * jquery.effects.core.js |
| | 620 | + */ |
| | 621 | +(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/ |
| | 622 | +3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a); |
| | 623 | +b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery); |
| | 624 | +;/* |
| | 625 | + * jQuery UI Effects Clip 1.8.11 |
| | 626 | + * |
| | 627 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 628 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 629 | + * http://jquery.org/license |
| | 630 | + * |
| | 631 | + * http://docs.jquery.com/UI/Effects/Clip |
| | 632 | + * |
| | 633 | + * Depends: |
| | 634 | + * jquery.effects.core.js |
| | 635 | + */ |
| | 636 | +(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position, |
| | 637 | +c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery); |
| | 638 | +;/* |
| | 639 | + * jQuery UI Effects Drop 1.8.11 |
| | 640 | + * |
| | 641 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 642 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 643 | + * http://jquery.org/license |
| | 644 | + * |
| | 645 | + * http://docs.jquery.com/UI/Effects/Drop |
| | 646 | + * |
| | 647 | + * Depends: |
| | 648 | + * jquery.effects.core.js |
| | 649 | + */ |
| | 650 | +(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e== |
| | 651 | +"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); |
| | 652 | +;/* |
| | 653 | + * jQuery UI Effects Explode 1.8.11 |
| | 654 | + * |
| | 655 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 656 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 657 | + * http://jquery.org/license |
| | 658 | + * |
| | 659 | + * http://docs.jquery.com/UI/Effects/Explode |
| | 660 | + * |
| | 661 | + * Depends: |
| | 662 | + * jquery.effects.core.js |
| | 663 | + */ |
| | 664 | +(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f= |
| | 665 | +0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ |
| | 666 | +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); |
| | 667 | +;/* |
| | 668 | + * jQuery UI Effects Fade 1.8.11 |
| | 669 | + * |
| | 670 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 671 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 672 | + * http://jquery.org/license |
| | 673 | + * |
| | 674 | + * http://docs.jquery.com/UI/Effects/Fade |
| | 675 | + * |
| | 676 | + * Depends: |
| | 677 | + * jquery.effects.core.js |
| | 678 | + */ |
| | 679 | +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); |
| | 680 | +;/* |
| | 681 | + * jQuery UI Effects Fold 1.8.11 |
| | 682 | + * |
| | 683 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 684 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 685 | + * http://jquery.org/license |
| | 686 | + * |
| | 687 | + * http://docs.jquery.com/UI/Effects/Fold |
| | 688 | + * |
| | 689 | + * Depends: |
| | 690 | + * jquery.effects.core.js |
| | 691 | + */ |
| | 692 | +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], |
| | 693 | +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); |
| | 694 | +;/* |
| | 695 | + * jQuery UI Effects Highlight 1.8.11 |
| | 696 | + * |
| | 697 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 698 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 699 | + * http://jquery.org/license |
| | 700 | + * |
| | 701 | + * http://docs.jquery.com/UI/Effects/Highlight |
| | 702 | + * |
| | 703 | + * Depends: |
| | 704 | + * jquery.effects.core.js |
| | 705 | + */ |
| | 706 | +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& |
| | 707 | +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); |
| | 708 | +;/* |
| | 709 | + * jQuery UI Effects Pulsate 1.8.11 |
| | 710 | + * |
| | 711 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 712 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 713 | + * http://jquery.org/license |
| | 714 | + * |
| | 715 | + * http://docs.jquery.com/UI/Effects/Pulsate |
| | 716 | + * |
| | 717 | + * Depends: |
| | 718 | + * jquery.effects.core.js |
| | 719 | + */ |
| | 720 | +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration, |
| | 721 | +a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery); |
| | 722 | +;/* |
| | 723 | + * jQuery UI Effects Scale 1.8.11 |
| | 724 | + * |
| | 725 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 726 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 727 | + * http://jquery.org/license |
| | 728 | + * |
| | 729 | + * http://docs.jquery.com/UI/Effects/Scale |
| | 730 | + * |
| | 731 | + * Depends: |
| | 732 | + * jquery.effects.core.js |
| | 733 | + */ |
| | 734 | +(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a, |
| | 735 | +b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity= |
| | 736 | +1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"], |
| | 737 | +p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}}; |
| | 738 | +if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a); |
| | 739 | +a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from); |
| | 740 | +child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a, |
| | 741 | +n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); |
| | 742 | +;/* |
| | 743 | + * jQuery UI Effects Shake 1.8.11 |
| | 744 | + * |
| | 745 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 746 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 747 | + * http://jquery.org/license |
| | 748 | + * |
| | 749 | + * http://docs.jquery.com/UI/Effects/Shake |
| | 750 | + * |
| | 751 | + * Depends: |
| | 752 | + * jquery.effects.core.js |
| | 753 | + */ |
| | 754 | +(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]= |
| | 755 | +(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery); |
| | 756 | +;/* |
| | 757 | + * jQuery UI Effects Slide 1.8.11 |
| | 758 | + * |
| | 759 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 760 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 761 | + * http://jquery.org/license |
| | 762 | + * |
| | 763 | + * http://docs.jquery.com/UI/Effects/Slide |
| | 764 | + * |
| | 765 | + * Depends: |
| | 766 | + * jquery.effects.core.js |
| | 767 | + */ |
| | 768 | +(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e); |
| | 769 | +var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); |
| | 770 | +;/* |
| | 771 | + * jQuery UI Effects Transfer 1.8.11 |
| | 772 | + * |
| | 773 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 774 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 775 | + * http://jquery.org/license |
| | 776 | + * |
| | 777 | + * http://docs.jquery.com/UI/Effects/Transfer |
| | 778 | + * |
| | 779 | + * Depends: |
| | 780 | + * jquery.effects.core.js |
| | 781 | + */ |
| | 782 | +(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); |
| | 783 | +b.dequeue()})})}})(jQuery); |
| | 784 | +; |
| \ No newline at end of file |
| Property changes on: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.min.js |
| ___________________________________________________________________ |
| Added: svn:executable |
| 1 | 785 | + * |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.position.js |
| — | — | @@ -0,0 +1,252 @@ |
| | 2 | +/* |
| | 3 | + * jQuery UI Position 1.8.11 |
| | 4 | + * |
| | 5 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 6 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 7 | + * http://jquery.org/license |
| | 8 | + * |
| | 9 | + * http://docs.jquery.com/UI/Position |
| | 10 | + */ |
| | 11 | +(function( $, undefined ) { |
| | 12 | + |
| | 13 | +$.ui = $.ui || {}; |
| | 14 | + |
| | 15 | +var horizontalPositions = /left|center|right/, |
| | 16 | + verticalPositions = /top|center|bottom/, |
| | 17 | + center = "center", |
| | 18 | + _position = $.fn.position, |
| | 19 | + _offset = $.fn.offset; |
| | 20 | + |
| | 21 | +$.fn.position = function( options ) { |
| | 22 | + if ( !options || !options.of ) { |
| | 23 | + return _position.apply( this, arguments ); |
| | 24 | + } |
| | 25 | + |
| | 26 | + // make a copy, we don't want to modify arguments |
| | 27 | + options = $.extend( {}, options ); |
| | 28 | + |
| | 29 | + var target = $( options.of ), |
| | 30 | + targetElem = target[0], |
| | 31 | + collision = ( options.collision || "flip" ).split( " " ), |
| | 32 | + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], |
| | 33 | + targetWidth, |
| | 34 | + targetHeight, |
| | 35 | + basePosition; |
| | 36 | + |
| | 37 | + if ( targetElem.nodeType === 9 ) { |
| | 38 | + targetWidth = target.width(); |
| | 39 | + targetHeight = target.height(); |
| | 40 | + basePosition = { top: 0, left: 0 }; |
| | 41 | + // TODO: use $.isWindow() in 1.9 |
| | 42 | + } else if ( targetElem.setTimeout ) { |
| | 43 | + targetWidth = target.width(); |
| | 44 | + targetHeight = target.height(); |
| | 45 | + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; |
| | 46 | + } else if ( targetElem.preventDefault ) { |
| | 47 | + // force left top to allow flipping |
| | 48 | + options.at = "left top"; |
| | 49 | + targetWidth = targetHeight = 0; |
| | 50 | + basePosition = { top: options.of.pageY, left: options.of.pageX }; |
| | 51 | + } else { |
| | 52 | + targetWidth = target.outerWidth(); |
| | 53 | + targetHeight = target.outerHeight(); |
| | 54 | + basePosition = target.offset(); |
| | 55 | + } |
| | 56 | + |
| | 57 | + // force my and at to have valid horizontal and veritcal positions |
| | 58 | + // if a value is missing or invalid, it will be converted to center |
| | 59 | + $.each( [ "my", "at" ], function() { |
| | 60 | + var pos = ( options[this] || "" ).split( " " ); |
| | 61 | + if ( pos.length === 1) { |
| | 62 | + pos = horizontalPositions.test( pos[0] ) ? |
| | 63 | + pos.concat( [center] ) : |
| | 64 | + verticalPositions.test( pos[0] ) ? |
| | 65 | + [ center ].concat( pos ) : |
| | 66 | + [ center, center ]; |
| | 67 | + } |
| | 68 | + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; |
| | 69 | + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; |
| | 70 | + options[ this ] = pos; |
| | 71 | + }); |
| | 72 | + |
| | 73 | + // normalize collision option |
| | 74 | + if ( collision.length === 1 ) { |
| | 75 | + collision[ 1 ] = collision[ 0 ]; |
| | 76 | + } |
| | 77 | + |
| | 78 | + // normalize offset option |
| | 79 | + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; |
| | 80 | + if ( offset.length === 1 ) { |
| | 81 | + offset[ 1 ] = offset[ 0 ]; |
| | 82 | + } |
| | 83 | + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; |
| | 84 | + |
| | 85 | + if ( options.at[0] === "right" ) { |
| | 86 | + basePosition.left += targetWidth; |
| | 87 | + } else if ( options.at[0] === center ) { |
| | 88 | + basePosition.left += targetWidth / 2; |
| | 89 | + } |
| | 90 | + |
| | 91 | + if ( options.at[1] === "bottom" ) { |
| | 92 | + basePosition.top += targetHeight; |
| | 93 | + } else if ( options.at[1] === center ) { |
| | 94 | + basePosition.top += targetHeight / 2; |
| | 95 | + } |
| | 96 | + |
| | 97 | + basePosition.left += offset[ 0 ]; |
| | 98 | + basePosition.top += offset[ 1 ]; |
| | 99 | + |
| | 100 | + return this.each(function() { |
| | 101 | + var elem = $( this ), |
| | 102 | + elemWidth = elem.outerWidth(), |
| | 103 | + elemHeight = elem.outerHeight(), |
| | 104 | + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, |
| | 105 | + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, |
| | 106 | + collisionWidth = elemWidth + marginLeft + |
| | 107 | + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), |
| | 108 | + collisionHeight = elemHeight + marginTop + |
| | 109 | + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), |
| | 110 | + position = $.extend( {}, basePosition ), |
| | 111 | + collisionPosition; |
| | 112 | + |
| | 113 | + if ( options.my[0] === "right" ) { |
| | 114 | + position.left -= elemWidth; |
| | 115 | + } else if ( options.my[0] === center ) { |
| | 116 | + position.left -= elemWidth / 2; |
| | 117 | + } |
| | 118 | + |
| | 119 | + if ( options.my[1] === "bottom" ) { |
| | 120 | + position.top -= elemHeight; |
| | 121 | + } else if ( options.my[1] === center ) { |
| | 122 | + position.top -= elemHeight / 2; |
| | 123 | + } |
| | 124 | + |
| | 125 | + // prevent fractions (see #5280) |
| | 126 | + position.left = Math.round( position.left ); |
| | 127 | + position.top = Math.round( position.top ); |
| | 128 | + |
| | 129 | + collisionPosition = { |
| | 130 | + left: position.left - marginLeft, |
| | 131 | + top: position.top - marginTop |
| | 132 | + }; |
| | 133 | + |
| | 134 | + $.each( [ "left", "top" ], function( i, dir ) { |
| | 135 | + if ( $.ui.position[ collision[i] ] ) { |
| | 136 | + $.ui.position[ collision[i] ][ dir ]( position, { |
| | 137 | + targetWidth: targetWidth, |
| | 138 | + targetHeight: targetHeight, |
| | 139 | + elemWidth: elemWidth, |
| | 140 | + elemHeight: elemHeight, |
| | 141 | + collisionPosition: collisionPosition, |
| | 142 | + collisionWidth: collisionWidth, |
| | 143 | + collisionHeight: collisionHeight, |
| | 144 | + offset: offset, |
| | 145 | + my: options.my, |
| | 146 | + at: options.at |
| | 147 | + }); |
| | 148 | + } |
| | 149 | + }); |
| | 150 | + |
| | 151 | + if ( $.fn.bgiframe ) { |
| | 152 | + elem.bgiframe(); |
| | 153 | + } |
| | 154 | + elem.offset( $.extend( position, { using: options.using } ) ); |
| | 155 | + }); |
| | 156 | +}; |
| | 157 | + |
| | 158 | +$.ui.position = { |
| | 159 | + fit: { |
| | 160 | + left: function( position, data ) { |
| | 161 | + var win = $( window ), |
| | 162 | + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); |
| | 163 | + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); |
| | 164 | + }, |
| | 165 | + top: function( position, data ) { |
| | 166 | + var win = $( window ), |
| | 167 | + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); |
| | 168 | + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); |
| | 169 | + } |
| | 170 | + }, |
| | 171 | + |
| | 172 | + flip: { |
| | 173 | + left: function( position, data ) { |
| | 174 | + if ( data.at[0] === center ) { |
| | 175 | + return; |
| | 176 | + } |
| | 177 | + var win = $( window ), |
| | 178 | + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), |
| | 179 | + myOffset = data.my[ 0 ] === "left" ? |
| | 180 | + -data.elemWidth : |
| | 181 | + data.my[ 0 ] === "right" ? |
| | 182 | + data.elemWidth : |
| | 183 | + 0, |
| | 184 | + atOffset = data.at[ 0 ] === "left" ? |
| | 185 | + data.targetWidth : |
| | 186 | + -data.targetWidth, |
| | 187 | + offset = -2 * data.offset[ 0 ]; |
| | 188 | + position.left += data.collisionPosition.left < 0 ? |
| | 189 | + myOffset + atOffset + offset : |
| | 190 | + over > 0 ? |
| | 191 | + myOffset + atOffset + offset : |
| | 192 | + 0; |
| | 193 | + }, |
| | 194 | + top: function( position, data ) { |
| | 195 | + if ( data.at[1] === center ) { |
| | 196 | + return; |
| | 197 | + } |
| | 198 | + var win = $( window ), |
| | 199 | + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), |
| | 200 | + myOffset = data.my[ 1 ] === "top" ? |
| | 201 | + -data.elemHeight : |
| | 202 | + data.my[ 1 ] === "bottom" ? |
| | 203 | + data.elemHeight : |
| | 204 | + 0, |
| | 205 | + atOffset = data.at[ 1 ] === "top" ? |
| | 206 | + data.targetHeight : |
| | 207 | + -data.targetHeight, |
| | 208 | + offset = -2 * data.offset[ 1 ]; |
| | 209 | + position.top += data.collisionPosition.top < 0 ? |
| | 210 | + myOffset + atOffset + offset : |
| | 211 | + over > 0 ? |
| | 212 | + myOffset + atOffset + offset : |
| | 213 | + 0; |
| | 214 | + } |
| | 215 | + } |
| | 216 | +}; |
| | 217 | + |
| | 218 | +// offset setter from jQuery 1.4 |
| | 219 | +if ( !$.offset.setOffset ) { |
| | 220 | + $.offset.setOffset = function( elem, options ) { |
| | 221 | + // set position first, in-case top/left are set even on static elem |
| | 222 | + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { |
| | 223 | + elem.style.position = "relative"; |
| | 224 | + } |
| | 225 | + var curElem = $( elem ), |
| | 226 | + curOffset = curElem.offset(), |
| | 227 | + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, |
| | 228 | + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, |
| | 229 | + props = { |
| | 230 | + top: (options.top - curOffset.top) + curTop, |
| | 231 | + left: (options.left - curOffset.left) + curLeft |
| | 232 | + }; |
| | 233 | + |
| | 234 | + if ( 'using' in options ) { |
| | 235 | + options.using.call( elem, props ); |
| | 236 | + } else { |
| | 237 | + curElem.css( props ); |
| | 238 | + } |
| | 239 | + }; |
| | 240 | + |
| | 241 | + $.fn.offset = function( options ) { |
| | 242 | + var elem = this[ 0 ]; |
| | 243 | + if ( !elem || !elem.ownerDocument ) { return null; } |
| | 244 | + if ( options ) { |
| | 245 | + return this.each(function() { |
| | 246 | + $.offset.setOffset( this, options ); |
| | 247 | + }); |
| | 248 | + } |
| | 249 | + return _offset.call( this ); |
| | 250 | + }; |
| | 251 | +} |
| | 252 | + |
| | 253 | +}( jQuery )); |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/lightbox1.js |
| — | — | @@ -0,0 +1,186 @@ |
| | 2 | +$(function() { |
| | 3 | + |
| | 4 | + $( '#dialog' ).dialog( { |
| | 5 | + width: 600, |
| | 6 | + resizable: false, |
| | 7 | + autoOpen: false, |
| | 8 | + modal: true, |
| | 9 | + title: 'Donate by Credit Card' |
| | 10 | + } ); |
| | 11 | + $( '#cc' ).click( function() { |
| | 12 | + if ( validateAmount( document.paypalcontribution ) ) { |
| | 13 | + $( '#dialog' ).dialog( 'open' ); |
| | 14 | + } |
| | 15 | + }); |
| | 16 | + $( '#pp' ).click( function() { |
| | 17 | + if ( validateAmount( document.paypalcontribution ) ) { |
| | 18 | + $( "input[name='gateway']" ).val( 'paypal' ); |
| | 19 | + document.paypalcontribution.action = "https://wikimediafoundation.org/wiki/Special:ContributionTracking/en"; |
| | 20 | + $( '#loading' ).html( "<img src='../images/loading.gif' /> Redirecting to PayPal..." ); |
| | 21 | + document.paypalcontribution.submit(); |
| | 22 | + } |
| | 23 | + }); |
| | 24 | + |
| | 25 | + /* Set selected amount to amount */ |
| | 26 | + $( "input[name='amountRadio']" ).click( function() { setAmount( $( this ) ); } ); |
| | 27 | + $( "#other-amount" ).change( function() { setAmount( $( this ) ); } ); |
| | 28 | + function setAmount(e) { $("input[name='amount']").val( e.val() ); } |
| | 29 | + |
| | 30 | + /* number of fieldsets */ |
| | 31 | + var fieldsetCount = $( '#donationForm' ).children().length; |
| | 32 | + |
| | 33 | + /* current position of fieldset / navigation link */ |
| | 34 | + var current = 1; |
| | 35 | + |
| | 36 | + /* |
| | 37 | + Sum and save the widths of each one of the fieldsets. |
| | 38 | + Set the final sum as the total width of the steps element. |
| | 39 | + */ |
| | 40 | + var stepsWidth = 0; |
| | 41 | + var widths = new Array(); |
| | 42 | + $( '#steps .step' ).each( function(i) { |
| | 43 | + var $step = $( this ); |
| | 44 | + widths[i] = stepsWidth; |
| | 45 | + stepsWidth += $step.width(); |
| | 46 | + } ); |
| | 47 | + $( '#steps' ).width( stepsWidth ); |
| | 48 | + |
| | 49 | + /* To avoid problems in IE, focus the first input of the form */ |
| | 50 | + $( '#donationForm' ).children( ':first' ).find( ':input:first' ).focus(); |
| | 51 | + |
| | 52 | + /* make continue buttons */ |
| | 53 | + $( 'a.continue-button' ).button(); |
| | 54 | + $( 'a.continue-button' ).click( function(e) { |
| | 55 | + var $this = $( this ); |
| | 56 | + current = $( this ).parent().parent().index() + 1; |
| | 57 | + if ( current == fieldsetCount ) { |
| | 58 | + finalSubmit(); |
| | 59 | + return false; |
| | 60 | + } |
| | 61 | + if ( validateStep( current ) === 1 ) { |
| | 62 | + current = current + 1; |
| | 63 | + $( '#steps' ).stop().animate( { marginLeft: '-' + widths[current - 1] + 'px' }, 500, |
| | 64 | + function() { |
| | 65 | + $( '#donationForm' ).children( ':nth-child(' + parseInt(current) + ')' ).find( ':input:first' ).focus(); |
| | 66 | + } |
| | 67 | + ); |
| | 68 | + } else { |
| | 69 | + $this.blur(); |
| | 70 | + } |
| | 71 | + |
| | 72 | + e.preventDefault(); |
| | 73 | + }); |
| | 74 | + |
| | 75 | + /* Make back button */ |
| | 76 | + $( 'a.back-button' ).button(); |
| | 77 | + $( 'a.back-button' ).click( function(e) { |
| | 78 | + var $this = $( this ); |
| | 79 | + /* Set current to 1 less than previous step */ |
| | 80 | + current = $( this ).parent().parent().index(); |
| | 81 | + |
| | 82 | + $( '#steps' ).stop().animate( { marginLeft: '+' + widths[current - 1] + 'px' }, 500 ); |
| | 83 | + |
| | 84 | + e.preventDefault(); |
| | 85 | + }); |
| | 86 | + |
| | 87 | + /* Hitting tab on the last input of each fieldset makes the form slide to the next step. */ |
| | 88 | + $( '#donationForm > fieldset' ).each( function() { |
| | 89 | + var $fieldset = $( this ); |
| | 90 | + $fieldset.find( ':input:last' ).keydown( function(e) { |
| | 91 | + if ( e.which == 9 ){ // 9 is the char code for tab |
| | 92 | + $fieldset.find( 'a.continue-button' ).click(); |
| | 93 | + /* Force the blur for validation */ |
| | 94 | + e.preventDefault(); |
| | 95 | + } |
| | 96 | + }); |
| | 97 | + }); |
| | 98 | + |
| | 99 | + /* |
| | 100 | + Validates errors on all the fieldsets. |
| | 101 | + Records if the form has errors in $( '#donationForm' ).data(). |
| | 102 | + */ |
| | 103 | + function validateSteps() { |
| | 104 | + var formErrors = false; |
| | 105 | + for( var i = 1; i < fieldsetCount; ++i ) { |
| | 106 | + var error = validateStep(i); |
| | 107 | + if ( error == -1 ) formErrors = true; |
| | 108 | + } |
| | 109 | + $( '#donationForm' ).data( 'errors', formErrors ); |
| | 110 | + } |
| | 111 | + |
| | 112 | + function finalSubmit() { |
| | 113 | + var formErrors = false; |
| | 114 | + for( var i = 1; i <= fieldsetCount; ++i ) { |
| | 115 | + var error = validateStep(i); |
| | 116 | + if ( error == -1 ) formErrors = true; |
| | 117 | + } |
| | 118 | + $( '#donationForm' ).data( 'errors', formErrors ); |
| | 119 | + |
| | 120 | + if ( $( '#donationForm' ).data( 'errors' ) ) { |
| | 121 | + alert( 'Please correct the errors in the form.' ); |
| | 122 | + return false; |
| | 123 | + } else { |
| | 124 | + /* Set country to US */ |
| | 125 | + $( "input[name='country']" ).val('US' ); |
| | 126 | + |
| | 127 | + /* Set expiration date */ |
| | 128 | + $( "input[name='expiration']" ).val( |
| | 129 | + $( "select[name='mos']" ).val() + $( "select[name='year']" ).val().substring( 2, 4 ) |
| | 130 | + ) |
| | 131 | + |
| | 132 | + /* Submit the form */ |
| | 133 | + document.donationForm.action = $( "input[name='action']" ).val(); |
| | 134 | + document.donationForm.submit(); |
| | 135 | + } |
| | 136 | + } |
| | 137 | + |
| | 138 | + /* |
| | 139 | + validates one fieldset |
| | 140 | + returns -1 if errors found, or 1 if not |
| | 141 | + */ |
| | 142 | + function validateStep( step ) { |
| | 143 | + var error = 1; |
| | 144 | + $( '#donationForm' ).children( ':nth-child(' + parseInt(step) + ')' ).find( ':input:not(button).required' ).each( function() { |
| | 145 | + var $this = $( this ); |
| | 146 | + var valueLength = jQuery.trim( $this.val() ).length; |
| | 147 | + |
| | 148 | + if ( valueLength == '' ) { |
| | 149 | + error = -1; |
| | 150 | + $this.css( 'background-color', '#FFEDEF' ); |
| | 151 | + } else { |
| | 152 | + $this.css( 'background-color', '#FFFFFF' ); |
| | 153 | + } |
| | 154 | + }); |
| | 155 | + |
| | 156 | + return error; |
| | 157 | + } |
| | 158 | + |
| | 159 | + function validateAmount(){ |
| | 160 | + var minimums = { |
| | 161 | + 'USD' : 1 |
| | 162 | + }; |
| | 163 | + var error = true; |
| | 164 | + var amount = $( "input[name='amount']" ).val(); // get the amount |
| | 165 | + var otherAmount = amount // create a working copy |
| | 166 | + otherAmount = otherAmount.replace( /[,.](\d)$/, '\:$10' ); |
| | 167 | + otherAmount = otherAmount.replace( /[,.](\d)(\d)$/, '\:$1$2' ); |
| | 168 | + otherAmount = otherAmount.replace( /[,.]/g, '' ); |
| | 169 | + otherAmount = otherAmount.replace( /:/, '.' ); |
| | 170 | + amount = otherAmount; // reset amount to working copy amount |
| | 171 | + $( "input[name='amount']" ).val( amount ); // set the new amount back into the form |
| | 172 | + |
| | 173 | + // Check amount is a real number, sets error as true (good) if no issues |
| | 174 | + error = ( amount == null || isNaN( amount ) || amount.value <= 0 ); |
| | 175 | + // Check amount is at least the minimum |
| | 176 | + var currency = 'USD'; // hard-coded for these forms and tests |
| | 177 | + $( "input[name='currency']" ).val( currency ); |
| | 178 | + if ( typeof( minimums[currency] ) == 'undefined' ) { |
| | 179 | + minimums[currency] = 1; |
| | 180 | + } |
| | 181 | + if ( amount < minimums[currency] || error ) { |
| | 182 | + alert( 'You must contribute at least $1'.replace('$1', minimums[currency] + ' ' + currency ) ); |
| | 183 | + error = true; |
| | 184 | + } |
| | 185 | + return !error; |
| | 186 | + }; |
| | 187 | +}); |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.draggable.js |
| — | — | @@ -0,0 +1,799 @@ |
| | 2 | +/* |
| | 3 | + * jQuery UI Draggable 1.8.11 |
| | 4 | + * |
| | 5 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 6 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 7 | + * http://jquery.org/license |
| | 8 | + * |
| | 9 | + * http://docs.jquery.com/UI/Draggables |
| | 10 | + * |
| | 11 | + * Depends: |
| | 12 | + * jquery.ui.core.js |
| | 13 | + * jquery.ui.mouse.js |
| | 14 | + * jquery.ui.widget.js |
| | 15 | + */ |
| | 16 | +(function( $, undefined ) { |
| | 17 | + |
| | 18 | +$.widget("ui.draggable", $.ui.mouse, { |
| | 19 | + widgetEventPrefix: "drag", |
| | 20 | + options: { |
| | 21 | + addClasses: true, |
| | 22 | + appendTo: "parent", |
| | 23 | + axis: false, |
| | 24 | + connectToSortable: false, |
| | 25 | + containment: false, |
| | 26 | + cursor: "auto", |
| | 27 | + cursorAt: false, |
| | 28 | + grid: false, |
| | 29 | + handle: false, |
| | 30 | + helper: "original", |
| | 31 | + iframeFix: false, |
| | 32 | + opacity: false, |
| | 33 | + refreshPositions: false, |
| | 34 | + revert: false, |
| | 35 | + revertDuration: 500, |
| | 36 | + scope: "default", |
| | 37 | + scroll: true, |
| | 38 | + scrollSensitivity: 20, |
| | 39 | + scrollSpeed: 20, |
| | 40 | + snap: false, |
| | 41 | + snapMode: "both", |
| | 42 | + snapTolerance: 20, |
| | 43 | + stack: false, |
| | 44 | + zIndex: false |
| | 45 | + }, |
| | 46 | + _create: function() { |
| | 47 | + |
| | 48 | + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) |
| | 49 | + this.element[0].style.position = 'relative'; |
| | 50 | + |
| | 51 | + (this.options.addClasses && this.element.addClass("ui-draggable")); |
| | 52 | + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); |
| | 53 | + |
| | 54 | + this._mouseInit(); |
| | 55 | + |
| | 56 | + }, |
| | 57 | + |
| | 58 | + destroy: function() { |
| | 59 | + if(!this.element.data('draggable')) return; |
| | 60 | + this.element |
| | 61 | + .removeData("draggable") |
| | 62 | + .unbind(".draggable") |
| | 63 | + .removeClass("ui-draggable" |
| | 64 | + + " ui-draggable-dragging" |
| | 65 | + + " ui-draggable-disabled"); |
| | 66 | + this._mouseDestroy(); |
| | 67 | + |
| | 68 | + return this; |
| | 69 | + }, |
| | 70 | + |
| | 71 | + _mouseCapture: function(event) { |
| | 72 | + |
| | 73 | + var o = this.options; |
| | 74 | + |
| | 75 | + // among others, prevent a drag on a resizable-handle |
| | 76 | + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) |
| | 77 | + return false; |
| | 78 | + |
| | 79 | + //Quit if we're not on a valid handle |
| | 80 | + this.handle = this._getHandle(event); |
| | 81 | + if (!this.handle) |
| | 82 | + return false; |
| | 83 | + |
| | 84 | + return true; |
| | 85 | + |
| | 86 | + }, |
| | 87 | + |
| | 88 | + _mouseStart: function(event) { |
| | 89 | + |
| | 90 | + var o = this.options; |
| | 91 | + |
| | 92 | + //Create and append the visible helper |
| | 93 | + this.helper = this._createHelper(event); |
| | 94 | + |
| | 95 | + //Cache the helper size |
| | 96 | + this._cacheHelperProportions(); |
| | 97 | + |
| | 98 | + //If ddmanager is used for droppables, set the global draggable |
| | 99 | + if($.ui.ddmanager) |
| | 100 | + $.ui.ddmanager.current = this; |
| | 101 | + |
| | 102 | + /* |
| | 103 | + * - Position generation - |
| | 104 | + * This block generates everything position related - it's the core of draggables. |
| | 105 | + */ |
| | 106 | + |
| | 107 | + //Cache the margins of the original element |
| | 108 | + this._cacheMargins(); |
| | 109 | + |
| | 110 | + //Store the helper's css position |
| | 111 | + this.cssPosition = this.helper.css("position"); |
| | 112 | + this.scrollParent = this.helper.scrollParent(); |
| | 113 | + |
| | 114 | + //The element's absolute position on the page minus margins |
| | 115 | + this.offset = this.positionAbs = this.element.offset(); |
| | 116 | + this.offset = { |
| | 117 | + top: this.offset.top - this.margins.top, |
| | 118 | + left: this.offset.left - this.margins.left |
| | 119 | + }; |
| | 120 | + |
| | 121 | + $.extend(this.offset, { |
| | 122 | + click: { //Where the click happened, relative to the element |
| | 123 | + left: event.pageX - this.offset.left, |
| | 124 | + top: event.pageY - this.offset.top |
| | 125 | + }, |
| | 126 | + parent: this._getParentOffset(), |
| | 127 | + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper |
| | 128 | + }); |
| | 129 | + |
| | 130 | + //Generate the original position |
| | 131 | + this.originalPosition = this.position = this._generatePosition(event); |
| | 132 | + this.originalPageX = event.pageX; |
| | 133 | + this.originalPageY = event.pageY; |
| | 134 | + |
| | 135 | + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied |
| | 136 | + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); |
| | 137 | + |
| | 138 | + //Set a containment if given in the options |
| | 139 | + if(o.containment) |
| | 140 | + this._setContainment(); |
| | 141 | + |
| | 142 | + //Trigger event + callbacks |
| | 143 | + if(this._trigger("start", event) === false) { |
| | 144 | + this._clear(); |
| | 145 | + return false; |
| | 146 | + } |
| | 147 | + |
| | 148 | + //Recache the helper size |
| | 149 | + this._cacheHelperProportions(); |
| | 150 | + |
| | 151 | + //Prepare the droppable offsets |
| | 152 | + if ($.ui.ddmanager && !o.dropBehaviour) |
| | 153 | + $.ui.ddmanager.prepareOffsets(this, event); |
| | 154 | + |
| | 155 | + this.helper.addClass("ui-draggable-dragging"); |
| | 156 | + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position |
| | 157 | + return true; |
| | 158 | + }, |
| | 159 | + |
| | 160 | + _mouseDrag: function(event, noPropagation) { |
| | 161 | + |
| | 162 | + //Compute the helpers position |
| | 163 | + this.position = this._generatePosition(event); |
| | 164 | + this.positionAbs = this._convertPositionTo("absolute"); |
| | 165 | + |
| | 166 | + //Call plugins and callbacks and use the resulting position if something is returned |
| | 167 | + if (!noPropagation) { |
| | 168 | + var ui = this._uiHash(); |
| | 169 | + if(this._trigger('drag', event, ui) === false) { |
| | 170 | + this._mouseUp({}); |
| | 171 | + return false; |
| | 172 | + } |
| | 173 | + this.position = ui.position; |
| | 174 | + } |
| | 175 | + |
| | 176 | + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; |
| | 177 | + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; |
| | 178 | + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); |
| | 179 | + |
| | 180 | + return false; |
| | 181 | + }, |
| | 182 | + |
| | 183 | + _mouseStop: function(event) { |
| | 184 | + |
| | 185 | + //If we are using droppables, inform the manager about the drop |
| | 186 | + var dropped = false; |
| | 187 | + if ($.ui.ddmanager && !this.options.dropBehaviour) |
| | 188 | + dropped = $.ui.ddmanager.drop(this, event); |
| | 189 | + |
| | 190 | + //if a drop comes from outside (a sortable) |
| | 191 | + if(this.dropped) { |
| | 192 | + dropped = this.dropped; |
| | 193 | + this.dropped = false; |
| | 194 | + } |
| | 195 | + |
| | 196 | + //if the original element is removed, don't bother to continue if helper is set to "original" |
| | 197 | + if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original") |
| | 198 | + return false; |
| | 199 | + |
| | 200 | + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { |
| | 201 | + var self = this; |
| | 202 | + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { |
| | 203 | + if(self._trigger("stop", event) !== false) { |
| | 204 | + self._clear(); |
| | 205 | + } |
| | 206 | + }); |
| | 207 | + } else { |
| | 208 | + if(this._trigger("stop", event) !== false) { |
| | 209 | + this._clear(); |
| | 210 | + } |
| | 211 | + } |
| | 212 | + |
| | 213 | + return false; |
| | 214 | + }, |
| | 215 | + |
| | 216 | + cancel: function() { |
| | 217 | + |
| | 218 | + if(this.helper.is(".ui-draggable-dragging")) { |
| | 219 | + this._mouseUp({}); |
| | 220 | + } else { |
| | 221 | + this._clear(); |
| | 222 | + } |
| | 223 | + |
| | 224 | + return this; |
| | 225 | + |
| | 226 | + }, |
| | 227 | + |
| | 228 | + _getHandle: function(event) { |
| | 229 | + |
| | 230 | + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; |
| | 231 | + $(this.options.handle, this.element) |
| | 232 | + .find("*") |
| | 233 | + .andSelf() |
| | 234 | + .each(function() { |
| | 235 | + if(this == event.target) handle = true; |
| | 236 | + }); |
| | 237 | + |
| | 238 | + return handle; |
| | 239 | + |
| | 240 | + }, |
| | 241 | + |
| | 242 | + _createHelper: function(event) { |
| | 243 | + |
| | 244 | + var o = this.options; |
| | 245 | + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); |
| | 246 | + |
| | 247 | + if(!helper.parents('body').length) |
| | 248 | + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); |
| | 249 | + |
| | 250 | + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) |
| | 251 | + helper.css("position", "absolute"); |
| | 252 | + |
| | 253 | + return helper; |
| | 254 | + |
| | 255 | + }, |
| | 256 | + |
| | 257 | + _adjustOffsetFromHelper: function(obj) { |
| | 258 | + if (typeof obj == 'string') { |
| | 259 | + obj = obj.split(' '); |
| | 260 | + } |
| | 261 | + if ($.isArray(obj)) { |
| | 262 | + obj = {left: +obj[0], top: +obj[1] || 0}; |
| | 263 | + } |
| | 264 | + if ('left' in obj) { |
| | 265 | + this.offset.click.left = obj.left + this.margins.left; |
| | 266 | + } |
| | 267 | + if ('right' in obj) { |
| | 268 | + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; |
| | 269 | + } |
| | 270 | + if ('top' in obj) { |
| | 271 | + this.offset.click.top = obj.top + this.margins.top; |
| | 272 | + } |
| | 273 | + if ('bottom' in obj) { |
| | 274 | + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; |
| | 275 | + } |
| | 276 | + }, |
| | 277 | + |
| | 278 | + _getParentOffset: function() { |
| | 279 | + |
| | 280 | + //Get the offsetParent and cache its position |
| | 281 | + this.offsetParent = this.helper.offsetParent(); |
| | 282 | + var po = this.offsetParent.offset(); |
| | 283 | + |
| | 284 | + // This is a special case where we need to modify a offset calculated on start, since the following happened: |
| | 285 | + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent |
| | 286 | + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that |
| | 287 | + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag |
| | 288 | + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { |
| | 289 | + po.left += this.scrollParent.scrollLeft(); |
| | 290 | + po.top += this.scrollParent.scrollTop(); |
| | 291 | + } |
| | 292 | + |
| | 293 | + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information |
| | 294 | + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix |
| | 295 | + po = { top: 0, left: 0 }; |
| | 296 | + |
| | 297 | + return { |
| | 298 | + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), |
| | 299 | + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) |
| | 300 | + }; |
| | 301 | + |
| | 302 | + }, |
| | 303 | + |
| | 304 | + _getRelativeOffset: function() { |
| | 305 | + |
| | 306 | + if(this.cssPosition == "relative") { |
| | 307 | + var p = this.element.position(); |
| | 308 | + return { |
| | 309 | + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), |
| | 310 | + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() |
| | 311 | + }; |
| | 312 | + } else { |
| | 313 | + return { top: 0, left: 0 }; |
| | 314 | + } |
| | 315 | + |
| | 316 | + }, |
| | 317 | + |
| | 318 | + _cacheMargins: function() { |
| | 319 | + this.margins = { |
| | 320 | + left: (parseInt(this.element.css("marginLeft"),10) || 0), |
| | 321 | + top: (parseInt(this.element.css("marginTop"),10) || 0), |
| | 322 | + right: (parseInt(this.element.css("marginRight"),10) || 0), |
| | 323 | + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) |
| | 324 | + }; |
| | 325 | + }, |
| | 326 | + |
| | 327 | + _cacheHelperProportions: function() { |
| | 328 | + this.helperProportions = { |
| | 329 | + width: this.helper.outerWidth(), |
| | 330 | + height: this.helper.outerHeight() |
| | 331 | + }; |
| | 332 | + }, |
| | 333 | + |
| | 334 | + _setContainment: function() { |
| | 335 | + |
| | 336 | + var o = this.options; |
| | 337 | + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; |
| | 338 | + if(o.containment == 'document' || o.containment == 'window') this.containment = [ |
| | 339 | + (o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left, |
| | 340 | + (o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top, |
| | 341 | + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, |
| | 342 | + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top |
| | 343 | + ]; |
| | 344 | + |
| | 345 | + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { |
| | 346 | + var ce = $(o.containment)[0]; if(!ce) return; |
| | 347 | + var co = $(o.containment).offset(); |
| | 348 | + var over = ($(ce).css("overflow") != 'hidden'); |
| | 349 | + |
| | 350 | + this.containment = [ |
| | 351 | + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), |
| | 352 | + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), |
| | 353 | + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, |
| | 354 | + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom |
| | 355 | + ]; |
| | 356 | + } else if(o.containment.constructor == Array) { |
| | 357 | + this.containment = o.containment; |
| | 358 | + } |
| | 359 | + |
| | 360 | + }, |
| | 361 | + |
| | 362 | + _convertPositionTo: function(d, pos) { |
| | 363 | + |
| | 364 | + if(!pos) pos = this.position; |
| | 365 | + var mod = d == "absolute" ? 1 : -1; |
| | 366 | + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); |
| | 367 | + |
| | 368 | + return { |
| | 369 | + top: ( |
| | 370 | + pos.top // The absolute mouse position |
| | 371 | + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent |
| | 372 | + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) |
| | 373 | + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) |
| | 374 | + ), |
| | 375 | + left: ( |
| | 376 | + pos.left // The absolute mouse position |
| | 377 | + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent |
| | 378 | + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) |
| | 379 | + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) |
| | 380 | + ) |
| | 381 | + }; |
| | 382 | + |
| | 383 | + }, |
| | 384 | + |
| | 385 | + _generatePosition: function(event) { |
| | 386 | + |
| | 387 | + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); |
| | 388 | + var pageX = event.pageX; |
| | 389 | + var pageY = event.pageY; |
| | 390 | + |
| | 391 | + /* |
| | 392 | + * - Position constraining - |
| | 393 | + * Constrain the position to a mix of grid, containment. |
| | 394 | + */ |
| | 395 | + |
| | 396 | + if(this.originalPosition) { //If we are not dragging yet, we won't check for options |
| | 397 | + |
| | 398 | + if(this.containment) { |
| | 399 | + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; |
| | 400 | + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; |
| | 401 | + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; |
| | 402 | + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; |
| | 403 | + } |
| | 404 | + |
| | 405 | + if(o.grid) { |
| | 406 | + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; |
| | 407 | + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; |
| | 408 | + |
| | 409 | + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; |
| | 410 | + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; |
| | 411 | + } |
| | 412 | + |
| | 413 | + } |
| | 414 | + |
| | 415 | + return { |
| | 416 | + top: ( |
| | 417 | + pageY // The absolute mouse position |
| | 418 | + - this.offset.click.top // Click offset (relative to the element) |
| | 419 | + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent |
| | 420 | + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) |
| | 421 | + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) |
| | 422 | + ), |
| | 423 | + left: ( |
| | 424 | + pageX // The absolute mouse position |
| | 425 | + - this.offset.click.left // Click offset (relative to the element) |
| | 426 | + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent |
| | 427 | + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) |
| | 428 | + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) |
| | 429 | + ) |
| | 430 | + }; |
| | 431 | + |
| | 432 | + }, |
| | 433 | + |
| | 434 | + _clear: function() { |
| | 435 | + this.helper.removeClass("ui-draggable-dragging"); |
| | 436 | + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); |
| | 437 | + //if($.ui.ddmanager) $.ui.ddmanager.current = null; |
| | 438 | + this.helper = null; |
| | 439 | + this.cancelHelperRemoval = false; |
| | 440 | + }, |
| | 441 | + |
| | 442 | + // From now on bulk stuff - mainly helpers |
| | 443 | + |
| | 444 | + _trigger: function(type, event, ui) { |
| | 445 | + ui = ui || this._uiHash(); |
| | 446 | + $.ui.plugin.call(this, type, [event, ui]); |
| | 447 | + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins |
| | 448 | + return $.Widget.prototype._trigger.call(this, type, event, ui); |
| | 449 | + }, |
| | 450 | + |
| | 451 | + plugins: {}, |
| | 452 | + |
| | 453 | + _uiHash: function(event) { |
| | 454 | + return { |
| | 455 | + helper: this.helper, |
| | 456 | + position: this.position, |
| | 457 | + originalPosition: this.originalPosition, |
| | 458 | + offset: this.positionAbs |
| | 459 | + }; |
| | 460 | + } |
| | 461 | + |
| | 462 | +}); |
| | 463 | + |
| | 464 | +$.extend($.ui.draggable, { |
| | 465 | + version: "1.8.11" |
| | 466 | +}); |
| | 467 | + |
| | 468 | +$.ui.plugin.add("draggable", "connectToSortable", { |
| | 469 | + start: function(event, ui) { |
| | 470 | + |
| | 471 | + var inst = $(this).data("draggable"), o = inst.options, |
| | 472 | + uiSortable = $.extend({}, ui, { item: inst.element }); |
| | 473 | + inst.sortables = []; |
| | 474 | + $(o.connectToSortable).each(function() { |
| | 475 | + var sortable = $.data(this, 'sortable'); |
| | 476 | + if (sortable && !sortable.options.disabled) { |
| | 477 | + inst.sortables.push({ |
| | 478 | + instance: sortable, |
| | 479 | + shouldRevert: sortable.options.revert |
| | 480 | + }); |
| | 481 | + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). |
| | 482 | + sortable._trigger("activate", event, uiSortable); |
| | 483 | + } |
| | 484 | + }); |
| | 485 | + |
| | 486 | + }, |
| | 487 | + stop: function(event, ui) { |
| | 488 | + |
| | 489 | + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper |
| | 490 | + var inst = $(this).data("draggable"), |
| | 491 | + uiSortable = $.extend({}, ui, { item: inst.element }); |
| | 492 | + |
| | 493 | + $.each(inst.sortables, function() { |
| | 494 | + if(this.instance.isOver) { |
| | 495 | + |
| | 496 | + this.instance.isOver = 0; |
| | 497 | + |
| | 498 | + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance |
| | 499 | + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) |
| | 500 | + |
| | 501 | + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' |
| | 502 | + if(this.shouldRevert) this.instance.options.revert = true; |
| | 503 | + |
| | 504 | + //Trigger the stop of the sortable |
| | 505 | + this.instance._mouseStop(event); |
| | 506 | + |
| | 507 | + this.instance.options.helper = this.instance.options._helper; |
| | 508 | + |
| | 509 | + //If the helper has been the original item, restore properties in the sortable |
| | 510 | + if(inst.options.helper == 'original') |
| | 511 | + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); |
| | 512 | + |
| | 513 | + } else { |
| | 514 | + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance |
| | 515 | + this.instance._trigger("deactivate", event, uiSortable); |
| | 516 | + } |
| | 517 | + |
| | 518 | + }); |
| | 519 | + |
| | 520 | + }, |
| | 521 | + drag: function(event, ui) { |
| | 522 | + |
| | 523 | + var inst = $(this).data("draggable"), self = this; |
| | 524 | + |
| | 525 | + var checkPos = function(o) { |
| | 526 | + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; |
| | 527 | + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; |
| | 528 | + var itemHeight = o.height, itemWidth = o.width; |
| | 529 | + var itemTop = o.top, itemLeft = o.left; |
| | 530 | + |
| | 531 | + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); |
| | 532 | + }; |
| | 533 | + |
| | 534 | + $.each(inst.sortables, function(i) { |
| | 535 | + |
| | 536 | + //Copy over some variables to allow calling the sortable's native _intersectsWith |
| | 537 | + this.instance.positionAbs = inst.positionAbs; |
| | 538 | + this.instance.helperProportions = inst.helperProportions; |
| | 539 | + this.instance.offset.click = inst.offset.click; |
| | 540 | + |
| | 541 | + if(this.instance._intersectsWith(this.instance.containerCache)) { |
| | 542 | + |
| | 543 | + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once |
| | 544 | + if(!this.instance.isOver) { |
| | 545 | + |
| | 546 | + this.instance.isOver = 1; |
| | 547 | + //Now we fake the start of dragging for the sortable instance, |
| | 548 | + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem |
| | 549 | + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) |
| | 550 | + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); |
| | 551 | + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it |
| | 552 | + this.instance.options.helper = function() { return ui.helper[0]; }; |
| | 553 | + |
| | 554 | + event.target = this.instance.currentItem[0]; |
| | 555 | + this.instance._mouseCapture(event, true); |
| | 556 | + this.instance._mouseStart(event, true, true); |
| | 557 | + |
| | 558 | + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes |
| | 559 | + this.instance.offset.click.top = inst.offset.click.top; |
| | 560 | + this.instance.offset.click.left = inst.offset.click.left; |
| | 561 | + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; |
| | 562 | + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; |
| | 563 | + |
| | 564 | + inst._trigger("toSortable", event); |
| | 565 | + inst.dropped = this.instance.element; //draggable revert needs that |
| | 566 | + //hack so receive/update callbacks work (mostly) |
| | 567 | + inst.currentItem = inst.element; |
| | 568 | + this.instance.fromOutside = inst; |
| | 569 | + |
| | 570 | + } |
| | 571 | + |
| | 572 | + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable |
| | 573 | + if(this.instance.currentItem) this.instance._mouseDrag(event); |
| | 574 | + |
| | 575 | + } else { |
| | 576 | + |
| | 577 | + //If it doesn't intersect with the sortable, and it intersected before, |
| | 578 | + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval |
| | 579 | + if(this.instance.isOver) { |
| | 580 | + |
| | 581 | + this.instance.isOver = 0; |
| | 582 | + this.instance.cancelHelperRemoval = true; |
| | 583 | + |
| | 584 | + //Prevent reverting on this forced stop |
| | 585 | + this.instance.options.revert = false; |
| | 586 | + |
| | 587 | + // The out event needs to be triggered independently |
| | 588 | + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); |
| | 589 | + |
| | 590 | + this.instance._mouseStop(event, true); |
| | 591 | + this.instance.options.helper = this.instance.options._helper; |
| | 592 | + |
| | 593 | + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size |
| | 594 | + this.instance.currentItem.remove(); |
| | 595 | + if(this.instance.placeholder) this.instance.placeholder.remove(); |
| | 596 | + |
| | 597 | + inst._trigger("fromSortable", event); |
| | 598 | + inst.dropped = false; //draggable revert needs that |
| | 599 | + } |
| | 600 | + |
| | 601 | + }; |
| | 602 | + |
| | 603 | + }); |
| | 604 | + |
| | 605 | + } |
| | 606 | +}); |
| | 607 | + |
| | 608 | +$.ui.plugin.add("draggable", "cursor", { |
| | 609 | + start: function(event, ui) { |
| | 610 | + var t = $('body'), o = $(this).data('draggable').options; |
| | 611 | + if (t.css("cursor")) o._cursor = t.css("cursor"); |
| | 612 | + t.css("cursor", o.cursor); |
| | 613 | + }, |
| | 614 | + stop: function(event, ui) { |
| | 615 | + var o = $(this).data('draggable').options; |
| | 616 | + if (o._cursor) $('body').css("cursor", o._cursor); |
| | 617 | + } |
| | 618 | +}); |
| | 619 | + |
| | 620 | +$.ui.plugin.add("draggable", "iframeFix", { |
| | 621 | + start: function(event, ui) { |
| | 622 | + var o = $(this).data('draggable').options; |
| | 623 | + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { |
| | 624 | + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') |
| | 625 | + .css({ |
| | 626 | + width: this.offsetWidth+"px", height: this.offsetHeight+"px", |
| | 627 | + position: "absolute", opacity: "0.001", zIndex: 1000 |
| | 628 | + }) |
| | 629 | + .css($(this).offset()) |
| | 630 | + .appendTo("body"); |
| | 631 | + }); |
| | 632 | + }, |
| | 633 | + stop: function(event, ui) { |
| | 634 | + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers |
| | 635 | + } |
| | 636 | +}); |
| | 637 | + |
| | 638 | +$.ui.plugin.add("draggable", "opacity", { |
| | 639 | + start: function(event, ui) { |
| | 640 | + var t = $(ui.helper), o = $(this).data('draggable').options; |
| | 641 | + if(t.css("opacity")) o._opacity = t.css("opacity"); |
| | 642 | + t.css('opacity', o.opacity); |
| | 643 | + }, |
| | 644 | + stop: function(event, ui) { |
| | 645 | + var o = $(this).data('draggable').options; |
| | 646 | + if(o._opacity) $(ui.helper).css('opacity', o._opacity); |
| | 647 | + } |
| | 648 | +}); |
| | 649 | + |
| | 650 | +$.ui.plugin.add("draggable", "scroll", { |
| | 651 | + start: function(event, ui) { |
| | 652 | + var i = $(this).data("draggable"); |
| | 653 | + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); |
| | 654 | + }, |
| | 655 | + drag: function(event, ui) { |
| | 656 | + |
| | 657 | + var i = $(this).data("draggable"), o = i.options, scrolled = false; |
| | 658 | + |
| | 659 | + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { |
| | 660 | + |
| | 661 | + if(!o.axis || o.axis != 'x') { |
| | 662 | + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) |
| | 663 | + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; |
| | 664 | + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) |
| | 665 | + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; |
| | 666 | + } |
| | 667 | + |
| | 668 | + if(!o.axis || o.axis != 'y') { |
| | 669 | + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) |
| | 670 | + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; |
| | 671 | + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) |
| | 672 | + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; |
| | 673 | + } |
| | 674 | + |
| | 675 | + } else { |
| | 676 | + |
| | 677 | + if(!o.axis || o.axis != 'x') { |
| | 678 | + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) |
| | 679 | + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); |
| | 680 | + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) |
| | 681 | + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); |
| | 682 | + } |
| | 683 | + |
| | 684 | + if(!o.axis || o.axis != 'y') { |
| | 685 | + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) |
| | 686 | + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); |
| | 687 | + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) |
| | 688 | + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); |
| | 689 | + } |
| | 690 | + |
| | 691 | + } |
| | 692 | + |
| | 693 | + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) |
| | 694 | + $.ui.ddmanager.prepareOffsets(i, event); |
| | 695 | + |
| | 696 | + } |
| | 697 | +}); |
| | 698 | + |
| | 699 | +$.ui.plugin.add("draggable", "snap", { |
| | 700 | + start: function(event, ui) { |
| | 701 | + |
| | 702 | + var i = $(this).data("draggable"), o = i.options; |
| | 703 | + i.snapElements = []; |
| | 704 | + |
| | 705 | + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { |
| | 706 | + var $t = $(this); var $o = $t.offset(); |
| | 707 | + if(this != i.element[0]) i.snapElements.push({ |
| | 708 | + item: this, |
| | 709 | + width: $t.outerWidth(), height: $t.outerHeight(), |
| | 710 | + top: $o.top, left: $o.left |
| | 711 | + }); |
| | 712 | + }); |
| | 713 | + |
| | 714 | + }, |
| | 715 | + drag: function(event, ui) { |
| | 716 | + |
| | 717 | + var inst = $(this).data("draggable"), o = inst.options; |
| | 718 | + var d = o.snapTolerance; |
| | 719 | + |
| | 720 | + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, |
| | 721 | + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; |
| | 722 | + |
| | 723 | + for (var i = inst.snapElements.length - 1; i >= 0; i--){ |
| | 724 | + |
| | 725 | + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, |
| | 726 | + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; |
| | 727 | + |
| | 728 | + //Yes, I know, this is insane ;) |
| | 729 | + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { |
| | 730 | + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); |
| | 731 | + inst.snapElements[i].snapping = false; |
| | 732 | + continue; |
| | 733 | + } |
| | 734 | + |
| | 735 | + if(o.snapMode != 'inner') { |
| | 736 | + var ts = Math.abs(t - y2) <= d; |
| | 737 | + var bs = Math.abs(b - y1) <= d; |
| | 738 | + var ls = Math.abs(l - x2) <= d; |
| | 739 | + var rs = Math.abs(r - x1) <= d; |
| | 740 | + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; |
| | 741 | + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; |
| | 742 | + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; |
| | 743 | + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; |
| | 744 | + } |
| | 745 | + |
| | 746 | + var first = (ts || bs || ls || rs); |
| | 747 | + |
| | 748 | + if(o.snapMode != 'outer') { |
| | 749 | + var ts = Math.abs(t - y1) <= d; |
| | 750 | + var bs = Math.abs(b - y2) <= d; |
| | 751 | + var ls = Math.abs(l - x1) <= d; |
| | 752 | + var rs = Math.abs(r - x2) <= d; |
| | 753 | + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; |
| | 754 | + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; |
| | 755 | + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; |
| | 756 | + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; |
| | 757 | + } |
| | 758 | + |
| | 759 | + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) |
| | 760 | + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); |
| | 761 | + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); |
| | 762 | + |
| | 763 | + }; |
| | 764 | + |
| | 765 | + } |
| | 766 | +}); |
| | 767 | + |
| | 768 | +$.ui.plugin.add("draggable", "stack", { |
| | 769 | + start: function(event, ui) { |
| | 770 | + |
| | 771 | + var o = $(this).data("draggable").options; |
| | 772 | + |
| | 773 | + var group = $.makeArray($(o.stack)).sort(function(a,b) { |
| | 774 | + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); |
| | 775 | + }); |
| | 776 | + if (!group.length) { return; } |
| | 777 | + |
| | 778 | + var min = parseInt(group[0].style.zIndex) || 0; |
| | 779 | + $(group).each(function(i) { |
| | 780 | + this.style.zIndex = min + i; |
| | 781 | + }); |
| | 782 | + |
| | 783 | + this[0].style.zIndex = min + group.length; |
| | 784 | + |
| | 785 | + } |
| | 786 | +}); |
| | 787 | + |
| | 788 | +$.ui.plugin.add("draggable", "zIndex", { |
| | 789 | + start: function(event, ui) { |
| | 790 | + var t = $(ui.helper), o = $(this).data("draggable").options; |
| | 791 | + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); |
| | 792 | + t.css('zIndex', o.zIndex); |
| | 793 | + }, |
| | 794 | + stop: function(event, ui) { |
| | 795 | + var o = $(this).data("draggable").options; |
| | 796 | + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); |
| | 797 | + } |
| | 798 | +}); |
| | 799 | + |
| | 800 | +})(jQuery); |
| Index: trunk/extensions/DonationInterface/payflowpro_gateway/forms/rapidhtml/js/jquery.ui.mouse.js |
| — | — | @@ -0,0 +1,156 @@ |
| | 2 | +/*! |
| | 3 | + * jQuery UI Mouse 1.8.11 |
| | 4 | + * |
| | 5 | + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| | 6 | + * Dual licensed under the MIT or GPL Version 2 licenses. |
| | 7 | + * http://jquery.org/license |
| | 8 | + * |
| | 9 | + * http://docs.jquery.com/UI/Mouse |
| | 10 | + * |
| | 11 | + * Depends: |
| | 12 | + * jquery.ui.widget.js |
| | 13 | + */ |
| | 14 | +(function( $, undefined ) { |
| | 15 | + |
| | 16 | +$.widget("ui.mouse", { |
| | 17 | + options: { |
| | 18 | + cancel: ':input,option', |
| | 19 | + distance: 1, |
| | 20 | + delay: 0 |
| | 21 | + }, |
| | 22 | + _mouseInit: function() { |
| | 23 | + var self = this; |
| | 24 | + |
| | 25 | + this.element |
| | 26 | + .bind('mousedown.'+this.widgetName, function(event) { |
| | 27 | + return self._mouseDown(event); |
| | 28 | + }) |
| | 29 | + .bind('click.'+this.widgetName, function(event) { |
| | 30 | + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { |
| | 31 | + $.removeData(event.target, self.widgetName + '.preventClickEvent'); |
| | 32 | + event.stopImmediatePropagation(); |
| | 33 | + return false; |
| | 34 | + } |
| | 35 | + }); |
| | 36 | + |
| | 37 | + this.started = false; |
| | 38 | + }, |
| | 39 | + |
| | 40 | + // TODO: make sure destroying one instance of mouse doesn't mess with |
| | 41 | + // other instances of mouse |
| | 42 | + _mouseDestroy: function() { |
| | 43 | + this.element.unbind('.'+this.widgetName); |
| | 44 | + }, |
| | 45 | + |
| | 46 | + _mouseDown: function(event) { |
| | 47 | + // don't let more than one widget handle mouseStart |
| | 48 | + // TODO: figure out why we have to use originalEvent |
| | 49 | + event.originalEvent = event.originalEvent || {}; |
| | 50 | + if (event.originalEvent.mouseHandled) { return; } |
| | 51 | + |
| | 52 | + // we may have missed mouseup (out of window) |
| | 53 | + (this._mouseStarted && this._mouseUp(event)); |
| | 54 | + |
| | 55 | + this._mouseDownEvent = event; |
| | 56 | + |
| | 57 | + var self = this, |
| | 58 | + btnIsLeft = (event.which == 1), |
| | 59 | + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); |
| | 60 | + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { |
| | 61 | + return true; |
| | 62 | + } |
| | 63 | + |
| | 64 | + this.mouseDelayMet = !this.options.delay; |
| | 65 | + if (!this.mouseDelayMet) { |
| | 66 | + this._mouseDelayTimer = setTimeout(function() { |
| | 67 | + self.mouseDelayMet = true; |
| | 68 | + }, this.options.delay); |
| | 69 | + } |
| | 70 | + |
| | 71 | + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { |
| | 72 | + this._mouseStarted = (this._mouseStart(event) !== false); |
| | 73 | + if (!this._mouseStarted) { |
| | 74 | + event.preventDefault(); |
| | 75 | + return true; |
| | 76 | + } |
| | 77 | + } |
| | 78 | + |
| | 79 | + // Click event may never have fired (Gecko & Opera) |
| | 80 | + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { |
| | 81 | + $.removeData(event.target, this.widgetName + '.preventClickEvent'); |
| | 82 | + } |
| | 83 | + |
| | 84 | + // these delegates are required to keep context |
| | 85 | + this._mouseMoveDelegate = function(event) { |
| | 86 | + return self._mouseMove(event); |
| | 87 | + }; |
| | 88 | + this._mouseUpDelegate = function(event) { |
| | 89 | + return self._mouseUp(event); |
| | 90 | + }; |
| | 91 | + $(document) |
| | 92 | + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) |
| | 93 | + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); |
| | 94 | + |
| | 95 | + event.preventDefault(); |
| | 96 | + event.originalEvent.mouseHandled = true; |
| | 97 | + return true; |
| | 98 | + }, |
| | 99 | + |
| | 100 | + _mouseMove: function(event) { |
| | 101 | + // IE mouseup check - mouseup happened when mouse was out of window |
| | 102 | + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { |
| | 103 | + return this._mouseUp(event); |
| | 104 | + } |
| | 105 | + |
| | 106 | + if (this._mouseStarted) { |
| | 107 | + this._mouseDrag(event); |
| | 108 | + return event.preventDefault(); |
| | 109 | + } |
| | 110 | + |
| | 111 | + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { |
| | 112 | + this._mouseStarted = |
| | 113 | + (this._mouseStart(this._mouseDownEvent, event) !== false); |
| | 114 | + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); |
| | 115 | + } |
| | 116 | + |
| | 117 | + return !this._mouseStarted; |
| | 118 | + }, |
| | 119 | + |
| | 120 | + _mouseUp: function(event) { |
| | 121 | + $(document) |
| | 122 | + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) |
| | 123 | + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); |
| | 124 | + |
| | 125 | + if (this._mouseStarted) { |
| | 126 | + this._mouseStarted = false; |
| | 127 | + |
| | 128 | + if (event.target == this._mouseDownEvent.target) { |
| | 129 | + $.data(event.target, this.widgetName + '.preventClickEvent', true); |
| | 130 | + } |
| | 131 | + |
| | 132 | + this._mouseStop(event); |
| | 133 | + } |
| | 134 | + |
| | 135 | + return false; |
| | 136 | + }, |
| | 137 | + |
| | 138 | + _mouseDistanceMet: function(event) { |
| | 139 | + return (Math.max( |
| | 140 | + Math.abs(this._mouseDownEvent.pageX - event.pageX), |
| | 141 | + Math.abs(this._mouseDownEvent.pageY - event.pageY) |
| | 142 | + ) >= this.options.distance |
| | 143 | + ); |
| | 144 | + }, |
| | 145 | + |
| | 146 | + _mouseDelayMet: function(event) { |
| | 147 | + return this.mouseDelayMet; |
| | 148 | + }, |
| | 149 | + |
| | 150 | + // These are placeholder methods, to be overriden by extending plugin |
| | 151 | + _mouseStart: function(event) {}, |
| | 152 | + _mouseDrag: function(event) {}, |
| | 153 | + _mouseStop: function(event) {}, |
| | 154 | + _mouseCapture: function(event) { return true; } |
| | 155 | +}); |
| | 156 | + |
| | 157 | +})(jQuery); |