| Index: trunk/extensions/MultilingualLiquidThreads/jquery/plugins.js |
| — | — | @@ -1,3783 +1,3783 @@ |
| 2 | | -/*
|
| 3 | | - * jQuery UI 1.7.2
|
| 4 | | - *
|
| 5 | | - * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
|
| 6 | | - * Dual licensed under the MIT (MIT-LICENSE.txt)
|
| 7 | | - * and GPL (GPL-LICENSE.txt) licenses.
|
| 8 | | - *
|
| 9 | | - * http://docs.jquery.com/UI
|
| 10 | | - */
|
| 11 | | -;jQuery.ui || (function($) {
|
| 12 | | -
|
| 13 | | -var _remove = $.fn.remove,
|
| 14 | | - isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
|
| 15 | | -
|
| 16 | | -//Helper functions and ui object
|
| 17 | | -$.ui = {
|
| 18 | | - version: "1.7.2",
|
| 19 | | -
|
| 20 | | - // $.ui.plugin is deprecated. Use the proxy pattern instead.
|
| 21 | | - plugin: {
|
| 22 | | - add: function(module, option, set) {
|
| 23 | | - var proto = $.ui[module].prototype;
|
| 24 | | - for(var i in set) {
|
| 25 | | - proto.plugins[i] = proto.plugins[i] || [];
|
| 26 | | - proto.plugins[i].push([option, set[i]]);
|
| 27 | | - }
|
| 28 | | - },
|
| 29 | | - call: function(instance, name, args) {
|
| 30 | | - var set = instance.plugins[name];
|
| 31 | | - if(!set || !instance.element[0].parentNode) { return; }
|
| 32 | | -
|
| 33 | | - for (var i = 0; i < set.length; i++) {
|
| 34 | | - if (instance.options[set[i][0]]) {
|
| 35 | | - set[i][1].apply(instance.element, args);
|
| 36 | | - }
|
| 37 | | - }
|
| 38 | | - }
|
| 39 | | - },
|
| 40 | | -
|
| 41 | | - contains: function(a, b) {
|
| 42 | | - return document.compareDocumentPosition
|
| 43 | | - ? a.compareDocumentPosition(b) & 16
|
| 44 | | - : a !== b && a.contains(b);
|
| 45 | | - },
|
| 46 | | -
|
| 47 | | - hasScroll: function(el, a) {
|
| 48 | | -
|
| 49 | | - //If overflow is hidden, the element might have extra content, but the user wants to hide it
|
| 50 | | - if ($(el).css('overflow') == 'hidden') { return false; }
|
| 51 | | -
|
| 52 | | - var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
|
| 53 | | - has = false;
|
| 54 | | -
|
| 55 | | - if (el[scroll] > 0) { return true; }
|
| 56 | | -
|
| 57 | | - // TODO: determine which cases actually cause this to happen
|
| 58 | | - // if the element doesn't have the scroll set, see if it's possible to
|
| 59 | | - // set the scroll
|
| 60 | | - el[scroll] = 1;
|
| 61 | | - has = (el[scroll] > 0);
|
| 62 | | - el[scroll] = 0;
|
| 63 | | - return has;
|
| 64 | | - },
|
| 65 | | -
|
| 66 | | - isOverAxis: function(x, reference, size) {
|
| 67 | | - //Determines when x coordinate is over "b" element axis
|
| 68 | | - return (x > reference) && (x < (reference + size));
|
| 69 | | - },
|
| 70 | | -
|
| 71 | | - isOver: function(y, x, top, left, height, width) {
|
| 72 | | - //Determines when x, y coordinates is over "b" element
|
| 73 | | - return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
|
| 74 | | - },
|
| 75 | | -
|
| 76 | | - keyCode: {
|
| 77 | | - BACKSPACE: 8,
|
| 78 | | - CAPS_LOCK: 20,
|
| 79 | | - COMMA: 188,
|
| 80 | | - CONTROL: 17,
|
| 81 | | - DELETE: 46,
|
| 82 | | - DOWN: 40,
|
| 83 | | - END: 35,
|
| 84 | | - ENTER: 13,
|
| 85 | | - ESCAPE: 27,
|
| 86 | | - HOME: 36,
|
| 87 | | - INSERT: 45,
|
| 88 | | - LEFT: 37,
|
| 89 | | - NUMPAD_ADD: 107,
|
| 90 | | - NUMPAD_DECIMAL: 110,
|
| 91 | | - NUMPAD_DIVIDE: 111,
|
| 92 | | - NUMPAD_ENTER: 108,
|
| 93 | | - NUMPAD_MULTIPLY: 106,
|
| 94 | | - NUMPAD_SUBTRACT: 109,
|
| 95 | | - PAGE_DOWN: 34,
|
| 96 | | - PAGE_UP: 33,
|
| 97 | | - PERIOD: 190,
|
| 98 | | - RIGHT: 39,
|
| 99 | | - SHIFT: 16,
|
| 100 | | - SPACE: 32,
|
| 101 | | - TAB: 9,
|
| 102 | | - UP: 38
|
| 103 | | - }
|
| 104 | | -};
|
| 105 | | -
|
| 106 | | -// WAI-ARIA normalization
|
| 107 | | -if (isFF2) {
|
| 108 | | - var attr = $.attr,
|
| 109 | | - removeAttr = $.fn.removeAttr,
|
| 110 | | - ariaNS = "http://www.w3.org/2005/07/aaa",
|
| 111 | | - ariaState = /^aria-/,
|
| 112 | | - ariaRole = /^wairole:/;
|
| 113 | | -
|
| 114 | | - $.attr = function(elem, name, value) {
|
| 115 | | - var set = value !== undefined;
|
| 116 | | -
|
| 117 | | - return (name == 'role'
|
| 118 | | - ? (set
|
| 119 | | - ? attr.call(this, elem, name, "wairole:" + value)
|
| 120 | | - : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
|
| 121 | | - : (ariaState.test(name)
|
| 122 | | - ? (set
|
| 123 | | - ? elem.setAttributeNS(ariaNS,
|
| 124 | | - name.replace(ariaState, "aaa:"), value)
|
| 125 | | - : attr.call(this, elem, name.replace(ariaState, "aaa:")))
|
| 126 | | - : attr.apply(this, arguments)));
|
| 127 | | - };
|
| 128 | | -
|
| 129 | | - $.fn.removeAttr = function(name) {
|
| 130 | | - return (ariaState.test(name)
|
| 131 | | - ? this.each(function() {
|
| 132 | | - this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
|
| 133 | | - }) : removeAttr.call(this, name));
|
| 134 | | - };
|
| 135 | | -}
|
| 136 | | -
|
| 137 | | -//jQuery plugins
|
| 138 | | -$.fn.extend({
|
| 139 | | - remove: function() {
|
| 140 | | - // Safari has a native remove event which actually removes DOM elements,
|
| 141 | | - // so we have to use triggerHandler instead of trigger (#3037).
|
| 142 | | - $("*", this).add(this).each(function() {
|
| 143 | | - $(this).triggerHandler("remove");
|
| 144 | | - });
|
| 145 | | - return _remove.apply(this, arguments );
|
| 146 | | - },
|
| 147 | | -
|
| 148 | | - enableSelection: function() {
|
| 149 | | - return this
|
| 150 | | - .attr('unselectable', 'off')
|
| 151 | | - .css('MozUserSelect', '')
|
| 152 | | - .unbind('selectstart.ui');
|
| 153 | | - },
|
| 154 | | -
|
| 155 | | - disableSelection: function() {
|
| 156 | | - return this
|
| 157 | | - .attr('unselectable', 'on')
|
| 158 | | - .css('MozUserSelect', 'none')
|
| 159 | | - .bind('selectstart.ui', function() { return false; });
|
| 160 | | - },
|
| 161 | | -
|
| 162 | | - scrollParent: function() {
|
| 163 | | - var scrollParent;
|
| 164 | | - if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
|
| 165 | | - scrollParent = this.parents().filter(function() {
|
| 166 | | - return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
|
| 167 | | - }).eq(0);
|
| 168 | | - } else {
|
| 169 | | - scrollParent = this.parents().filter(function() {
|
| 170 | | - return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
|
| 171 | | - }).eq(0);
|
| 172 | | - }
|
| 173 | | -
|
| 174 | | - return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
|
| 175 | | - }
|
| 176 | | -});
|
| 177 | | -
|
| 178 | | -
|
| 179 | | -//Additional selectors
|
| 180 | | -$.extend($.expr[':'], {
|
| 181 | | - data: function(elem, i, match) {
|
| 182 | | - return !!$.data(elem, match[3]);
|
| 183 | | - },
|
| 184 | | -
|
| 185 | | - focusable: function(element) {
|
| 186 | | - var nodeName = element.nodeName.toLowerCase(),
|
| 187 | | - tabIndex = $.attr(element, 'tabindex');
|
| 188 | | - return (/input|select|textarea|button|object/.test(nodeName)
|
| 189 | | - ? !element.disabled
|
| 190 | | - : 'a' == nodeName || 'area' == nodeName
|
| 191 | | - ? element.href || !isNaN(tabIndex)
|
| 192 | | - : !isNaN(tabIndex))
|
| 193 | | - // the element and all of its ancestors must be visible
|
| 194 | | - // the browser may report that the area is hidden
|
| 195 | | - && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
|
| 196 | | - },
|
| 197 | | -
|
| 198 | | - tabbable: function(element) {
|
| 199 | | - var tabIndex = $.attr(element, 'tabindex');
|
| 200 | | - return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
|
| 201 | | - }
|
| 202 | | -});
|
| 203 | | -
|
| 204 | | -
|
| 205 | | -// $.widget is a factory to create jQuery plugins
|
| 206 | | -// taking some boilerplate code out of the plugin code
|
| 207 | | -function getter(namespace, plugin, method, args) {
|
| 208 | | - function getMethods(type) {
|
| 209 | | - var methods = $[namespace][plugin][type] || [];
|
| 210 | | - return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
|
| 211 | | - }
|
| 212 | | -
|
| 213 | | - var methods = getMethods('getter');
|
| 214 | | - if (args.length == 1 && typeof args[0] == 'string') {
|
| 215 | | - methods = methods.concat(getMethods('getterSetter'));
|
| 216 | | - }
|
| 217 | | - return ($.inArray(method, methods) != -1);
|
| 218 | | -}
|
| 219 | | -
|
| 220 | | -$.widget = function(name, prototype) {
|
| 221 | | - var namespace = name.split(".")[0];
|
| 222 | | - name = name.split(".")[1];
|
| 223 | | -
|
| 224 | | - // create plugin method
|
| 225 | | - $.fn[name] = function(options) {
|
| 226 | | - var isMethodCall = (typeof options == 'string'),
|
| 227 | | - args = Array.prototype.slice.call(arguments, 1);
|
| 228 | | -
|
| 229 | | - // prevent calls to internal methods
|
| 230 | | - if (isMethodCall && options.substring(0, 1) == '_') {
|
| 231 | | - return this;
|
| 232 | | - }
|
| 233 | | -
|
| 234 | | - // handle getter methods
|
| 235 | | - if (isMethodCall && getter(namespace, name, options, args)) {
|
| 236 | | - var instance = $.data(this[0], name);
|
| 237 | | - return (instance ? instance[options].apply(instance, args)
|
| 238 | | - : undefined);
|
| 239 | | - }
|
| 240 | | -
|
| 241 | | - // handle initialization and non-getter methods
|
| 242 | | - return this.each(function() {
|
| 243 | | - var instance = $.data(this, name);
|
| 244 | | -
|
| 245 | | - // constructor
|
| 246 | | - (!instance && !isMethodCall &&
|
| 247 | | - $.data(this, name, new $[namespace][name](this, options))._init());
|
| 248 | | -
|
| 249 | | - // method call
|
| 250 | | - (instance && isMethodCall && $.isFunction(instance[options]) &&
|
| 251 | | - instance[options].apply(instance, args));
|
| 252 | | - });
|
| 253 | | - };
|
| 254 | | -
|
| 255 | | - // create widget constructor
|
| 256 | | - $[namespace] = $[namespace] || {};
|
| 257 | | - $[namespace][name] = function(element, options) {
|
| 258 | | - var self = this;
|
| 259 | | -
|
| 260 | | - this.namespace = namespace;
|
| 261 | | - this.widgetName = name;
|
| 262 | | - this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
|
| 263 | | - this.widgetBaseClass = namespace + '-' + name;
|
| 264 | | -
|
| 265 | | - this.options = $.extend({},
|
| 266 | | - $.widget.defaults,
|
| 267 | | - $[namespace][name].defaults,
|
| 268 | | - $.metadata && $.metadata.get(element)[name],
|
| 269 | | - options);
|
| 270 | | -
|
| 271 | | - this.element = $(element)
|
| 272 | | - .bind('setData.' + name, function(event, key, value) {
|
| 273 | | - if (event.target == element) {
|
| 274 | | - return self._setData(key, value);
|
| 275 | | - }
|
| 276 | | - })
|
| 277 | | - .bind('getData.' + name, function(event, key) {
|
| 278 | | - if (event.target == element) {
|
| 279 | | - return self._getData(key);
|
| 280 | | - }
|
| 281 | | - })
|
| 282 | | - .bind('remove', function() {
|
| 283 | | - return self.destroy();
|
| 284 | | - });
|
| 285 | | - };
|
| 286 | | -
|
| 287 | | - // add widget prototype
|
| 288 | | - $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
|
| 289 | | -
|
| 290 | | - // TODO: merge getter and getterSetter properties from widget prototype
|
| 291 | | - // and plugin prototype
|
| 292 | | - $[namespace][name].getterSetter = 'option';
|
| 293 | | -};
|
| 294 | | -
|
| 295 | | -$.widget.prototype = {
|
| 296 | | - _init: function() {},
|
| 297 | | - destroy: function() {
|
| 298 | | - this.element.removeData(this.widgetName)
|
| 299 | | - .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
|
| 300 | | - .removeAttr('aria-disabled');
|
| 301 | | - },
|
| 302 | | -
|
| 303 | | - option: function(key, value) {
|
| 304 | | - var options = key,
|
| 305 | | - self = this;
|
| 306 | | -
|
| 307 | | - if (typeof key == "string") {
|
| 308 | | - if (value === undefined) {
|
| 309 | | - return this._getData(key);
|
| 310 | | - }
|
| 311 | | - options = {};
|
| 312 | | - options[key] = value;
|
| 313 | | - }
|
| 314 | | -
|
| 315 | | - $.each(options, function(key, value) {
|
| 316 | | - self._setData(key, value);
|
| 317 | | - });
|
| 318 | | - },
|
| 319 | | - _getData: function(key) {
|
| 320 | | - return this.options[key];
|
| 321 | | - },
|
| 322 | | - _setData: function(key, value) {
|
| 323 | | - this.options[key] = value;
|
| 324 | | -
|
| 325 | | - if (key == 'disabled') {
|
| 326 | | - this.element
|
| 327 | | - [value ? 'addClass' : 'removeClass'](
|
| 328 | | - this.widgetBaseClass + '-disabled' + ' ' +
|
| 329 | | - this.namespace + '-state-disabled')
|
| 330 | | - .attr("aria-disabled", value);
|
| 331 | | - }
|
| 332 | | - },
|
| 333 | | -
|
| 334 | | - enable: function() {
|
| 335 | | - this._setData('disabled', false);
|
| 336 | | - },
|
| 337 | | - disable: function() {
|
| 338 | | - this._setData('disabled', true);
|
| 339 | | - },
|
| 340 | | -
|
| 341 | | - _trigger: function(type, event, data) {
|
| 342 | | - var callback = this.options[type],
|
| 343 | | - eventName = (type == this.widgetEventPrefix
|
| 344 | | - ? type : this.widgetEventPrefix + type);
|
| 345 | | -
|
| 346 | | - event = $.Event(event);
|
| 347 | | - event.type = eventName;
|
| 348 | | -
|
| 349 | | - // copy original event properties over to the new event
|
| 350 | | - // this would happen if we could call $.event.fix instead of $.Event
|
| 351 | | - // but we don't have a way to force an event to be fixed multiple times
|
| 352 | | - if (event.originalEvent) {
|
| 353 | | - for (var i = $.event.props.length, prop; i;) {
|
| 354 | | - prop = $.event.props[--i];
|
| 355 | | - event[prop] = event.originalEvent[prop];
|
| 356 | | - }
|
| 357 | | - }
|
| 358 | | -
|
| 359 | | - this.element.trigger(event, data);
|
| 360 | | -
|
| 361 | | - return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
|
| 362 | | - || event.isDefaultPrevented());
|
| 363 | | - }
|
| 364 | | -};
|
| 365 | | -
|
| 366 | | -$.widget.defaults = {
|
| 367 | | - disabled: false
|
| 368 | | -};
|
| 369 | | -
|
| 370 | | -
|
| 371 | | -/** Mouse Interaction Plugin **/
|
| 372 | | -
|
| 373 | | -$.ui.mouse = {
|
| 374 | | - _mouseInit: function() {
|
| 375 | | - var self = this;
|
| 376 | | -
|
| 377 | | - this.element
|
| 378 | | - .bind('mousedown.'+this.widgetName, function(event) {
|
| 379 | | - return self._mouseDown(event);
|
| 380 | | - })
|
| 381 | | - .bind('click.'+this.widgetName, function(event) {
|
| 382 | | - if(self._preventClickEvent) {
|
| 383 | | - self._preventClickEvent = false;
|
| 384 | | - event.stopImmediatePropagation();
|
| 385 | | - return false;
|
| 386 | | - }
|
| 387 | | - });
|
| 388 | | -
|
| 389 | | - // Prevent text selection in IE
|
| 390 | | - if ($.browser.msie) {
|
| 391 | | - this._mouseUnselectable = this.element.attr('unselectable');
|
| 392 | | - this.element.attr('unselectable', 'on');
|
| 393 | | - }
|
| 394 | | -
|
| 395 | | - this.started = false;
|
| 396 | | - },
|
| 397 | | -
|
| 398 | | - // TODO: make sure destroying one instance of mouse doesn't mess with
|
| 399 | | - // other instances of mouse
|
| 400 | | - _mouseDestroy: function() {
|
| 401 | | - this.element.unbind('.'+this.widgetName);
|
| 402 | | -
|
| 403 | | - // Restore text selection in IE
|
| 404 | | - ($.browser.msie
|
| 405 | | - && this.element.attr('unselectable', this._mouseUnselectable));
|
| 406 | | - },
|
| 407 | | -
|
| 408 | | - _mouseDown: function(event) {
|
| 409 | | - // don't let more than one widget handle mouseStart
|
| 410 | | - // TODO: figure out why we have to use originalEvent
|
| 411 | | - event.originalEvent = event.originalEvent || {};
|
| 412 | | - if (event.originalEvent.mouseHandled) { return; }
|
| 413 | | -
|
| 414 | | - // we may have missed mouseup (out of window)
|
| 415 | | - (this._mouseStarted && this._mouseUp(event));
|
| 416 | | -
|
| 417 | | - this._mouseDownEvent = event;
|
| 418 | | -
|
| 419 | | - var self = this,
|
| 420 | | - btnIsLeft = (event.which == 1),
|
| 421 | | - elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
|
| 422 | | - if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
|
| 423 | | - return true;
|
| 424 | | - }
|
| 425 | | -
|
| 426 | | - this.mouseDelayMet = !this.options.delay;
|
| 427 | | - if (!this.mouseDelayMet) {
|
| 428 | | - this._mouseDelayTimer = setTimeout(function() {
|
| 429 | | - self.mouseDelayMet = true;
|
| 430 | | - }, this.options.delay);
|
| 431 | | - }
|
| 432 | | -
|
| 433 | | - if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
| 434 | | - this._mouseStarted = (this._mouseStart(event) !== false);
|
| 435 | | - if (!this._mouseStarted) {
|
| 436 | | - event.preventDefault();
|
| 437 | | - return true;
|
| 438 | | - }
|
| 439 | | - }
|
| 440 | | -
|
| 441 | | - // these delegates are required to keep context
|
| 442 | | - this._mouseMoveDelegate = function(event) {
|
| 443 | | - return self._mouseMove(event);
|
| 444 | | - };
|
| 445 | | - this._mouseUpDelegate = function(event) {
|
| 446 | | - return self._mouseUp(event);
|
| 447 | | - };
|
| 448 | | - $(document)
|
| 449 | | - .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
|
| 450 | | - .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
|
| 451 | | -
|
| 452 | | - // preventDefault() is used to prevent the selection of text here -
|
| 453 | | - // however, in Safari, this causes select boxes not to be selectable
|
| 454 | | - // anymore, so this fix is needed
|
| 455 | | - ($.browser.safari || event.preventDefault());
|
| 456 | | -
|
| 457 | | - event.originalEvent.mouseHandled = true;
|
| 458 | | - return true;
|
| 459 | | - },
|
| 460 | | -
|
| 461 | | - _mouseMove: function(event) {
|
| 462 | | - // IE mouseup check - mouseup happened when mouse was out of window
|
| 463 | | - if ($.browser.msie && !event.button) {
|
| 464 | | - return this._mouseUp(event);
|
| 465 | | - }
|
| 466 | | -
|
| 467 | | - if (this._mouseStarted) {
|
| 468 | | - this._mouseDrag(event);
|
| 469 | | - return event.preventDefault();
|
| 470 | | - }
|
| 471 | | -
|
| 472 | | - if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
| 473 | | - this._mouseStarted =
|
| 474 | | - (this._mouseStart(this._mouseDownEvent, event) !== false);
|
| 475 | | - (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
|
| 476 | | - }
|
| 477 | | -
|
| 478 | | - return !this._mouseStarted;
|
| 479 | | - },
|
| 480 | | -
|
| 481 | | - _mouseUp: function(event) {
|
| 482 | | - $(document)
|
| 483 | | - .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
|
| 484 | | - .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
|
| 485 | | -
|
| 486 | | - if (this._mouseStarted) {
|
| 487 | | - this._mouseStarted = false;
|
| 488 | | - this._preventClickEvent = (event.target == this._mouseDownEvent.target);
|
| 489 | | - this._mouseStop(event);
|
| 490 | | - }
|
| 491 | | -
|
| 492 | | - return false;
|
| 493 | | - },
|
| 494 | | -
|
| 495 | | - _mouseDistanceMet: function(event) {
|
| 496 | | - return (Math.max(
|
| 497 | | - Math.abs(this._mouseDownEvent.pageX - event.pageX),
|
| 498 | | - Math.abs(this._mouseDownEvent.pageY - event.pageY)
|
| 499 | | - ) >= this.options.distance
|
| 500 | | - );
|
| 501 | | - },
|
| 502 | | -
|
| 503 | | - _mouseDelayMet: function(event) {
|
| 504 | | - return this.mouseDelayMet;
|
| 505 | | - },
|
| 506 | | -
|
| 507 | | - // These are placeholder methods, to be overriden by extending plugin
|
| 508 | | - _mouseStart: function(event) {},
|
| 509 | | - _mouseDrag: function(event) {},
|
| 510 | | - _mouseStop: function(event) {},
|
| 511 | | - _mouseCapture: function(event) { return true; }
|
| 512 | | -};
|
| 513 | | -
|
| 514 | | -$.ui.mouse.defaults = {
|
| 515 | | - cancel: null,
|
| 516 | | - distance: 1,
|
| 517 | | - delay: 0
|
| 518 | | -};
|
| 519 | | -
|
| 520 | | -})(jQuery);
|
| 521 | | -/*
|
| 522 | | - * jQuery UI Draggable 1.7.2
|
| 523 | | - *
|
| 524 | | - * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
|
| 525 | | - * Dual licensed under the MIT (MIT-LICENSE.txt)
|
| 526 | | - * and GPL (GPL-LICENSE.txt) licenses.
|
| 527 | | - *
|
| 528 | | - * http://docs.jquery.com/UI/Draggables
|
| 529 | | - *
|
| 530 | | - * Depends:
|
| 531 | | - * ui.core.js
|
| 532 | | - */
|
| 533 | | -(function($) {
|
| 534 | | -
|
| 535 | | -$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
|
| 536 | | -
|
| 537 | | - _init: function() {
|
| 538 | | -
|
| 539 | | - if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
|
| 540 | | - this.element[0].style.position = 'relative';
|
| 541 | | -
|
| 542 | | - (this.options.addClasses && this.element.addClass("ui-draggable"));
|
| 543 | | - (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
|
| 544 | | -
|
| 545 | | - this._mouseInit();
|
| 546 | | -
|
| 547 | | - },
|
| 548 | | -
|
| 549 | | - destroy: function() {
|
| 550 | | - if(!this.element.data('draggable')) return;
|
| 551 | | - this.element
|
| 552 | | - .removeData("draggable")
|
| 553 | | - .unbind(".draggable")
|
| 554 | | - .removeClass("ui-draggable"
|
| 555 | | - + " ui-draggable-dragging"
|
| 556 | | - + " ui-draggable-disabled");
|
| 557 | | - this._mouseDestroy();
|
| 558 | | - },
|
| 559 | | -
|
| 560 | | - _mouseCapture: function(event) {
|
| 561 | | -
|
| 562 | | - var o = this.options;
|
| 563 | | -
|
| 564 | | - if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
|
| 565 | | - return false;
|
| 566 | | -
|
| 567 | | - //Quit if we're not on a valid handle
|
| 568 | | - this.handle = this._getHandle(event);
|
| 569 | | - if (!this.handle)
|
| 570 | | - return false;
|
| 571 | | -
|
| 572 | | - return true;
|
| 573 | | -
|
| 574 | | - },
|
| 575 | | -
|
| 576 | | - _mouseStart: function(event) {
|
| 577 | | -
|
| 578 | | - var o = this.options;
|
| 579 | | -
|
| 580 | | - //Create and append the visible helper
|
| 581 | | - this.helper = this._createHelper(event);
|
| 582 | | -
|
| 583 | | - //Cache the helper size
|
| 584 | | - this._cacheHelperProportions();
|
| 585 | | -
|
| 586 | | - //If ddmanager is used for droppables, set the global draggable
|
| 587 | | - if($.ui.ddmanager)
|
| 588 | | - $.ui.ddmanager.current = this;
|
| 589 | | -
|
| 590 | | - /*
|
| 591 | | - * - Position generation -
|
| 592 | | - * This block generates everything position related - it's the core of draggables.
|
| 593 | | - */
|
| 594 | | -
|
| 595 | | - //Cache the margins of the original element
|
| 596 | | - this._cacheMargins();
|
| 597 | | -
|
| 598 | | - //Store the helper's css position
|
| 599 | | - this.cssPosition = this.helper.css("position");
|
| 600 | | - this.scrollParent = this.helper.scrollParent();
|
| 601 | | -
|
| 602 | | - //The element's absolute position on the page minus margins
|
| 603 | | - this.offset = this.element.offset();
|
| 604 | | - this.offset = {
|
| 605 | | - top: this.offset.top - this.margins.top,
|
| 606 | | - left: this.offset.left - this.margins.left
|
| 607 | | - };
|
| 608 | | -
|
| 609 | | - $.extend(this.offset, {
|
| 610 | | - click: { //Where the click happened, relative to the element
|
| 611 | | - left: event.pageX - this.offset.left,
|
| 612 | | - top: event.pageY - this.offset.top
|
| 613 | | - },
|
| 614 | | - parent: this._getParentOffset(),
|
| 615 | | - relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
|
| 616 | | - });
|
| 617 | | -
|
| 618 | | - //Generate the original position
|
| 619 | | - this.originalPosition = this._generatePosition(event);
|
| 620 | | - this.originalPageX = event.pageX;
|
| 621 | | - this.originalPageY = event.pageY;
|
| 622 | | -
|
| 623 | | - //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
|
| 624 | | - if(o.cursorAt)
|
| 625 | | - this._adjustOffsetFromHelper(o.cursorAt);
|
| 626 | | -
|
| 627 | | - //Set a containment if given in the options
|
| 628 | | - if(o.containment)
|
| 629 | | - this._setContainment();
|
| 630 | | -
|
| 631 | | - //Call plugins and callbacks
|
| 632 | | - this._trigger("start", event);
|
| 633 | | -
|
| 634 | | - //Recache the helper size
|
| 635 | | - this._cacheHelperProportions();
|
| 636 | | -
|
| 637 | | - //Prepare the droppable offsets
|
| 638 | | - if ($.ui.ddmanager && !o.dropBehaviour)
|
| 639 | | - $.ui.ddmanager.prepareOffsets(this, event);
|
| 640 | | -
|
| 641 | | - this.helper.addClass("ui-draggable-dragging");
|
| 642 | | - this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
|
| 643 | | - return true;
|
| 644 | | - },
|
| 645 | | -
|
| 646 | | - _mouseDrag: function(event, noPropagation) {
|
| 647 | | -
|
| 648 | | - //Compute the helpers position
|
| 649 | | - this.position = this._generatePosition(event);
|
| 650 | | - this.positionAbs = this._convertPositionTo("absolute");
|
| 651 | | -
|
| 652 | | - //Call plugins and callbacks and use the resulting position if something is returned
|
| 653 | | - if (!noPropagation) {
|
| 654 | | - var ui = this._uiHash();
|
| 655 | | - this._trigger('drag', event, ui);
|
| 656 | | - this.position = ui.position;
|
| 657 | | - }
|
| 658 | | -
|
| 659 | | - if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
|
| 660 | | - if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
|
| 661 | | - if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
|
| 662 | | -
|
| 663 | | - return false;
|
| 664 | | - },
|
| 665 | | -
|
| 666 | | - _mouseStop: function(event) {
|
| 667 | | -
|
| 668 | | - //If we are using droppables, inform the manager about the drop
|
| 669 | | - var dropped = false;
|
| 670 | | - if ($.ui.ddmanager && !this.options.dropBehaviour)
|
| 671 | | - dropped = $.ui.ddmanager.drop(this, event);
|
| 672 | | -
|
| 673 | | - //if a drop comes from outside (a sortable)
|
| 674 | | - if(this.dropped) {
|
| 675 | | - dropped = this.dropped;
|
| 676 | | - this.dropped = false;
|
| 677 | | - }
|
| 678 | | -
|
| 679 | | - if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
|
| 680 | | - var self = this;
|
| 681 | | - $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
|
| 682 | | - self._trigger("stop", event);
|
| 683 | | - self._clear();
|
| 684 | | - });
|
| 685 | | - } else {
|
| 686 | | - this._trigger("stop", event);
|
| 687 | | - this._clear();
|
| 688 | | - }
|
| 689 | | -
|
| 690 | | - return false;
|
| 691 | | - },
|
| 692 | | -
|
| 693 | | - _getHandle: function(event) {
|
| 694 | | -
|
| 695 | | - var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
|
| 696 | | - $(this.options.handle, this.element)
|
| 697 | | - .find("*")
|
| 698 | | - .andSelf()
|
| 699 | | - .each(function() {
|
| 700 | | - if(this == event.target) handle = true;
|
| 701 | | - });
|
| 702 | | -
|
| 703 | | - return handle;
|
| 704 | | -
|
| 705 | | - },
|
| 706 | | -
|
| 707 | | - _createHelper: function(event) {
|
| 708 | | -
|
| 709 | | - var o = this.options;
|
| 710 | | - var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
|
| 711 | | -
|
| 712 | | - if(!helper.parents('body').length)
|
| 713 | | - helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
|
| 714 | | -
|
| 715 | | - if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
|
| 716 | | - helper.css("position", "absolute");
|
| 717 | | -
|
| 718 | | - return helper;
|
| 719 | | -
|
| 720 | | - },
|
| 721 | | -
|
| 722 | | - _adjustOffsetFromHelper: function(obj) {
|
| 723 | | - if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
|
| 724 | | - if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
|
| 725 | | - if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
|
| 726 | | - if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
|
| 727 | | - },
|
| 728 | | -
|
| 729 | | - _getParentOffset: function() {
|
| 730 | | -
|
| 731 | | - //Get the offsetParent and cache its position
|
| 732 | | - this.offsetParent = this.helper.offsetParent();
|
| 733 | | - var po = this.offsetParent.offset();
|
| 734 | | -
|
| 735 | | - // This is a special case where we need to modify a offset calculated on start, since the following happened:
|
| 736 | | - // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
|
| 737 | | - // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
|
| 738 | | - // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
|
| 739 | | - if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
|
| 740 | | - po.left += this.scrollParent.scrollLeft();
|
| 741 | | - po.top += this.scrollParent.scrollTop();
|
| 742 | | - }
|
| 743 | | -
|
| 744 | | - if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
|
| 745 | | - || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
|
| 746 | | - po = { top: 0, left: 0 };
|
| 747 | | -
|
| 748 | | - return {
|
| 749 | | - top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
|
| 750 | | - left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
|
| 751 | | - };
|
| 752 | | -
|
| 753 | | - },
|
| 754 | | -
|
| 755 | | - _getRelativeOffset: function() {
|
| 756 | | -
|
| 757 | | - if(this.cssPosition == "relative") {
|
| 758 | | - var p = this.element.position();
|
| 759 | | - return {
|
| 760 | | - top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
|
| 761 | | - left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
|
| 762 | | - };
|
| 763 | | - } else {
|
| 764 | | - return { top: 0, left: 0 };
|
| 765 | | - }
|
| 766 | | -
|
| 767 | | - },
|
| 768 | | -
|
| 769 | | - _cacheMargins: function() {
|
| 770 | | - this.margins = {
|
| 771 | | - left: (parseInt(this.element.css("marginLeft"),10) || 0),
|
| 772 | | - top: (parseInt(this.element.css("marginTop"),10) || 0)
|
| 773 | | - };
|
| 774 | | - },
|
| 775 | | -
|
| 776 | | - _cacheHelperProportions: function() {
|
| 777 | | - this.helperProportions = {
|
| 778 | | - width: this.helper.outerWidth(),
|
| 779 | | - height: this.helper.outerHeight()
|
| 780 | | - };
|
| 781 | | - },
|
| 782 | | -
|
| 783 | | - _setContainment: function() {
|
| 784 | | -
|
| 785 | | - var o = this.options;
|
| 786 | | - if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
|
| 787 | | - if(o.containment == 'document' || o.containment == 'window') this.containment = [
|
| 788 | | - 0 - this.offset.relative.left - this.offset.parent.left,
|
| 789 | | - 0 - this.offset.relative.top - this.offset.parent.top,
|
| 790 | | - $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
|
| 791 | | - ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
|
| 792 | | - ];
|
| 793 | | -
|
| 794 | | - if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
|
| 795 | | - var ce = $(o.containment)[0]; if(!ce) return;
|
| 796 | | - var co = $(o.containment).offset();
|
| 797 | | - var over = ($(ce).css("overflow") != 'hidden');
|
| 798 | | -
|
| 799 | | - this.containment = [
|
| 800 | | - co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
|
| 801 | | - co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
|
| 802 | | - co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
|
| 803 | | - co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
|
| 804 | | - ];
|
| 805 | | - } else if(o.containment.constructor == Array) {
|
| 806 | | - this.containment = o.containment;
|
| 807 | | - }
|
| 808 | | -
|
| 809 | | - },
|
| 810 | | -
|
| 811 | | - _convertPositionTo: function(d, pos) {
|
| 812 | | -
|
| 813 | | - if(!pos) pos = this.position;
|
| 814 | | - var mod = d == "absolute" ? 1 : -1;
|
| 815 | | - var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
| 816 | | -
|
| 817 | | - return {
|
| 818 | | - top: (
|
| 819 | | - pos.top // The absolute mouse position
|
| 820 | | - + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
|
| 821 | | - + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
|
| 822 | | - - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
|
| 823 | | - ),
|
| 824 | | - left: (
|
| 825 | | - pos.left // The absolute mouse position
|
| 826 | | - + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
|
| 827 | | - + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
|
| 828 | | - - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
|
| 829 | | - )
|
| 830 | | - };
|
| 831 | | -
|
| 832 | | - },
|
| 833 | | -
|
| 834 | | - _generatePosition: function(event) {
|
| 835 | | -
|
| 836 | | - var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
| 837 | | -
|
| 838 | | - // This is another very weird special case that only happens for relative elements:
|
| 839 | | - // 1. If the css position is relative
|
| 840 | | - // 2. and the scroll parent is the document or similar to the offset parent
|
| 841 | | - // we have to refresh the relative offset during the scroll so there are no jumps
|
| 842 | | - if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
|
| 843 | | - this.offset.relative = this._getRelativeOffset();
|
| 844 | | - }
|
| 845 | | -
|
| 846 | | - var pageX = event.pageX;
|
| 847 | | - var pageY = event.pageY;
|
| 848 | | -
|
| 849 | | - /*
|
| 850 | | - * - Position constraining -
|
| 851 | | - * Constrain the position to a mix of grid, containment.
|
| 852 | | - */
|
| 853 | | -
|
| 854 | | - if(this.originalPosition) { //If we are not dragging yet, we won't check for options
|
| 855 | | -
|
| 856 | | - if(this.containment) {
|
| 857 | | - if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
|
| 858 | | - if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
|
| 859 | | - if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
|
| 860 | | - if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
|
| 861 | | - }
|
| 862 | | -
|
| 863 | | - if(o.grid) {
|
| 864 | | - var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
|
| 865 | | - pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
|
| 866 | | -
|
| 867 | | - var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
|
| 868 | | - pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
|
| 869 | | - }
|
| 870 | | -
|
| 871 | | - }
|
| 872 | | -
|
| 873 | | - return {
|
| 874 | | - top: (
|
| 875 | | - pageY // The absolute mouse position
|
| 876 | | - - this.offset.click.top // Click offset (relative to the element)
|
| 877 | | - - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
|
| 878 | | - - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
|
| 879 | | - + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
|
| 880 | | - ),
|
| 881 | | - left: (
|
| 882 | | - pageX // The absolute mouse position
|
| 883 | | - - this.offset.click.left // Click offset (relative to the element)
|
| 884 | | - - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
|
| 885 | | - - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
|
| 886 | | - + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
|
| 887 | | - )
|
| 888 | | - };
|
| 889 | | -
|
| 890 | | - },
|
| 891 | | -
|
| 892 | | - _clear: function() {
|
| 893 | | - this.helper.removeClass("ui-draggable-dragging");
|
| 894 | | - if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
|
| 895 | | - //if($.ui.ddmanager) $.ui.ddmanager.current = null;
|
| 896 | | - this.helper = null;
|
| 897 | | - this.cancelHelperRemoval = false;
|
| 898 | | - },
|
| 899 | | -
|
| 900 | | - // From now on bulk stuff - mainly helpers
|
| 901 | | -
|
| 902 | | - _trigger: function(type, event, ui) {
|
| 903 | | - ui = ui || this._uiHash();
|
| 904 | | - $.ui.plugin.call(this, type, [event, ui]);
|
| 905 | | - if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
|
| 906 | | - return $.widget.prototype._trigger.call(this, type, event, ui);
|
| 907 | | - },
|
| 908 | | -
|
| 909 | | - plugins: {},
|
| 910 | | -
|
| 911 | | - _uiHash: function(event) {
|
| 912 | | - return {
|
| 913 | | - helper: this.helper,
|
| 914 | | - position: this.position,
|
| 915 | | - absolutePosition: this.positionAbs, //deprecated
|
| 916 | | - offset: this.positionAbs
|
| 917 | | - };
|
| 918 | | - }
|
| 919 | | -
|
| 920 | | -}));
|
| 921 | | -
|
| 922 | | -$.extend($.ui.draggable, {
|
| 923 | | - version: "1.7.2",
|
| 924 | | - eventPrefix: "drag",
|
| 925 | | - defaults: {
|
| 926 | | - addClasses: true,
|
| 927 | | - appendTo: "parent",
|
| 928 | | - axis: false,
|
| 929 | | - cancel: ":input,option",
|
| 930 | | - connectToSortable: false,
|
| 931 | | - containment: false,
|
| 932 | | - cursor: "auto",
|
| 933 | | - cursorAt: false,
|
| 934 | | - delay: 0,
|
| 935 | | - distance: 1,
|
| 936 | | - grid: false,
|
| 937 | | - handle: false,
|
| 938 | | - helper: "original",
|
| 939 | | - iframeFix: false,
|
| 940 | | - opacity: false,
|
| 941 | | - refreshPositions: false,
|
| 942 | | - revert: false,
|
| 943 | | - revertDuration: 500,
|
| 944 | | - scope: "default",
|
| 945 | | - scroll: true,
|
| 946 | | - scrollSensitivity: 20,
|
| 947 | | - scrollSpeed: 20,
|
| 948 | | - snap: false,
|
| 949 | | - snapMode: "both",
|
| 950 | | - snapTolerance: 20,
|
| 951 | | - stack: false,
|
| 952 | | - zIndex: false
|
| 953 | | - }
|
| 954 | | -});
|
| 955 | | -
|
| 956 | | -$.ui.plugin.add("draggable", "connectToSortable", {
|
| 957 | | - start: function(event, ui) {
|
| 958 | | -
|
| 959 | | - var inst = $(this).data("draggable"), o = inst.options,
|
| 960 | | - uiSortable = $.extend({}, ui, { item: inst.element });
|
| 961 | | - inst.sortables = [];
|
| 962 | | - $(o.connectToSortable).each(function() {
|
| 963 | | - var sortable = $.data(this, 'sortable');
|
| 964 | | - if (sortable && !sortable.options.disabled) {
|
| 965 | | - inst.sortables.push({
|
| 966 | | - instance: sortable,
|
| 967 | | - shouldRevert: sortable.options.revert
|
| 968 | | - });
|
| 969 | | - sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
|
| 970 | | - sortable._trigger("activate", event, uiSortable);
|
| 971 | | - }
|
| 972 | | - });
|
| 973 | | -
|
| 974 | | - },
|
| 975 | | - stop: function(event, ui) {
|
| 976 | | -
|
| 977 | | - //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
|
| 978 | | - var inst = $(this).data("draggable"),
|
| 979 | | - uiSortable = $.extend({}, ui, { item: inst.element });
|
| 980 | | -
|
| 981 | | - $.each(inst.sortables, function() {
|
| 982 | | - if(this.instance.isOver) {
|
| 983 | | -
|
| 984 | | - this.instance.isOver = 0;
|
| 985 | | -
|
| 986 | | - inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
|
| 987 | | - this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
|
| 988 | | -
|
| 989 | | - //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
|
| 990 | | - if(this.shouldRevert) this.instance.options.revert = true;
|
| 991 | | -
|
| 992 | | - //Trigger the stop of the sortable
|
| 993 | | - this.instance._mouseStop(event);
|
| 994 | | -
|
| 995 | | - this.instance.options.helper = this.instance.options._helper;
|
| 996 | | -
|
| 997 | | - //If the helper has been the original item, restore properties in the sortable
|
| 998 | | - if(inst.options.helper == 'original')
|
| 999 | | - this.instance.currentItem.css({ top: 'auto', left: 'auto' });
|
| 1000 | | -
|
| 1001 | | - } else {
|
| 1002 | | - this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
|
| 1003 | | - this.instance._trigger("deactivate", event, uiSortable);
|
| 1004 | | - }
|
| 1005 | | -
|
| 1006 | | - });
|
| 1007 | | -
|
| 1008 | | - },
|
| 1009 | | - drag: function(event, ui) {
|
| 1010 | | -
|
| 1011 | | - var inst = $(this).data("draggable"), self = this;
|
| 1012 | | -
|
| 1013 | | - var checkPos = function(o) {
|
| 1014 | | - var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
|
| 1015 | | - var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
|
| 1016 | | - var itemHeight = o.height, itemWidth = o.width;
|
| 1017 | | - var itemTop = o.top, itemLeft = o.left;
|
| 1018 | | -
|
| 1019 | | - return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
|
| 1020 | | - };
|
| 1021 | | -
|
| 1022 | | - $.each(inst.sortables, function(i) {
|
| 1023 | | -
|
| 1024 | | - //Copy over some variables to allow calling the sortable's native _intersectsWith
|
| 1025 | | - this.instance.positionAbs = inst.positionAbs;
|
| 1026 | | - this.instance.helperProportions = inst.helperProportions;
|
| 1027 | | - this.instance.offset.click = inst.offset.click;
|
| 1028 | | -
|
| 1029 | | - if(this.instance._intersectsWith(this.instance.containerCache)) {
|
| 1030 | | -
|
| 1031 | | - //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
|
| 1032 | | - if(!this.instance.isOver) {
|
| 1033 | | -
|
| 1034 | | - this.instance.isOver = 1;
|
| 1035 | | - //Now we fake the start of dragging for the sortable instance,
|
| 1036 | | - //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
|
| 1037 | | - //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
|
| 1038 | | - this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
|
| 1039 | | - this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
|
| 1040 | | - this.instance.options.helper = function() { return ui.helper[0]; };
|
| 1041 | | -
|
| 1042 | | - event.target = this.instance.currentItem[0];
|
| 1043 | | - this.instance._mouseCapture(event, true);
|
| 1044 | | - this.instance._mouseStart(event, true, true);
|
| 1045 | | -
|
| 1046 | | - //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
|
| 1047 | | - this.instance.offset.click.top = inst.offset.click.top;
|
| 1048 | | - this.instance.offset.click.left = inst.offset.click.left;
|
| 1049 | | - this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
|
| 1050 | | - this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
|
| 1051 | | -
|
| 1052 | | - inst._trigger("toSortable", event);
|
| 1053 | | - inst.dropped = this.instance.element; //draggable revert needs that
|
| 1054 | | - //hack so receive/update callbacks work (mostly)
|
| 1055 | | - inst.currentItem = inst.element;
|
| 1056 | | - this.instance.fromOutside = inst;
|
| 1057 | | -
|
| 1058 | | - }
|
| 1059 | | -
|
| 1060 | | - //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
|
| 1061 | | - if(this.instance.currentItem) this.instance._mouseDrag(event);
|
| 1062 | | -
|
| 1063 | | - } else {
|
| 1064 | | -
|
| 1065 | | - //If it doesn't intersect with the sortable, and it intersected before,
|
| 1066 | | - //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
|
| 1067 | | - if(this.instance.isOver) {
|
| 1068 | | -
|
| 1069 | | - this.instance.isOver = 0;
|
| 1070 | | - this.instance.cancelHelperRemoval = true;
|
| 1071 | | -
|
| 1072 | | - //Prevent reverting on this forced stop
|
| 1073 | | - this.instance.options.revert = false;
|
| 1074 | | -
|
| 1075 | | - // The out event needs to be triggered independently
|
| 1076 | | - this.instance._trigger('out', event, this.instance._uiHash(this.instance));
|
| 1077 | | -
|
| 1078 | | - this.instance._mouseStop(event, true);
|
| 1079 | | - this.instance.options.helper = this.instance.options._helper;
|
| 1080 | | -
|
| 1081 | | - //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
|
| 1082 | | - this.instance.currentItem.remove();
|
| 1083 | | - if(this.instance.placeholder) this.instance.placeholder.remove();
|
| 1084 | | -
|
| 1085 | | - inst._trigger("fromSortable", event);
|
| 1086 | | - inst.dropped = false; //draggable revert needs that
|
| 1087 | | - }
|
| 1088 | | -
|
| 1089 | | - };
|
| 1090 | | -
|
| 1091 | | - });
|
| 1092 | | -
|
| 1093 | | - }
|
| 1094 | | -});
|
| 1095 | | -
|
| 1096 | | -$.ui.plugin.add("draggable", "cursor", {
|
| 1097 | | - start: function(event, ui) {
|
| 1098 | | - var t = $('body'), o = $(this).data('draggable').options;
|
| 1099 | | - if (t.css("cursor")) o._cursor = t.css("cursor");
|
| 1100 | | - t.css("cursor", o.cursor);
|
| 1101 | | - },
|
| 1102 | | - stop: function(event, ui) {
|
| 1103 | | - var o = $(this).data('draggable').options;
|
| 1104 | | - if (o._cursor) $('body').css("cursor", o._cursor);
|
| 1105 | | - }
|
| 1106 | | -});
|
| 1107 | | -
|
| 1108 | | -$.ui.plugin.add("draggable", "iframeFix", {
|
| 1109 | | - start: function(event, ui) {
|
| 1110 | | - var o = $(this).data('draggable').options;
|
| 1111 | | - $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
|
| 1112 | | - $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
|
| 1113 | | - .css({
|
| 1114 | | - width: this.offsetWidth+"px", height: this.offsetHeight+"px",
|
| 1115 | | - position: "absolute", opacity: "0.001", zIndex: 1000
|
| 1116 | | - })
|
| 1117 | | - .css($(this).offset())
|
| 1118 | | - .appendTo("body");
|
| 1119 | | - });
|
| 1120 | | - },
|
| 1121 | | - stop: function(event, ui) {
|
| 1122 | | - $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
|
| 1123 | | - }
|
| 1124 | | -});
|
| 1125 | | -
|
| 1126 | | -$.ui.plugin.add("draggable", "opacity", {
|
| 1127 | | - start: function(event, ui) {
|
| 1128 | | - var t = $(ui.helper), o = $(this).data('draggable').options;
|
| 1129 | | - if(t.css("opacity")) o._opacity = t.css("opacity");
|
| 1130 | | - t.css('opacity', o.opacity);
|
| 1131 | | - },
|
| 1132 | | - stop: function(event, ui) {
|
| 1133 | | - var o = $(this).data('draggable').options;
|
| 1134 | | - if(o._opacity) $(ui.helper).css('opacity', o._opacity);
|
| 1135 | | - }
|
| 1136 | | -});
|
| 1137 | | -
|
| 1138 | | -$.ui.plugin.add("draggable", "scroll", {
|
| 1139 | | - start: function(event, ui) {
|
| 1140 | | - var i = $(this).data("draggable");
|
| 1141 | | - if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
|
| 1142 | | - },
|
| 1143 | | - drag: function(event, ui) {
|
| 1144 | | -
|
| 1145 | | - var i = $(this).data("draggable"), o = i.options, scrolled = false;
|
| 1146 | | -
|
| 1147 | | - if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
|
| 1148 | | -
|
| 1149 | | - if(!o.axis || o.axis != 'x') {
|
| 1150 | | - if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
|
| 1151 | | - i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
|
| 1152 | | - else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
|
| 1153 | | - i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
|
| 1154 | | - }
|
| 1155 | | -
|
| 1156 | | - if(!o.axis || o.axis != 'y') {
|
| 1157 | | - if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
|
| 1158 | | - i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
|
| 1159 | | - else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
|
| 1160 | | - i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
|
| 1161 | | - }
|
| 1162 | | -
|
| 1163 | | - } else {
|
| 1164 | | -
|
| 1165 | | - if(!o.axis || o.axis != 'x') {
|
| 1166 | | - if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
|
| 1167 | | - scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
|
| 1168 | | - else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
|
| 1169 | | - scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
|
| 1170 | | - }
|
| 1171 | | -
|
| 1172 | | - if(!o.axis || o.axis != 'y') {
|
| 1173 | | - if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
|
| 1174 | | - scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
|
| 1175 | | - else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
|
| 1176 | | - scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
|
| 1177 | | - }
|
| 1178 | | -
|
| 1179 | | - }
|
| 1180 | | -
|
| 1181 | | - if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
|
| 1182 | | - $.ui.ddmanager.prepareOffsets(i, event);
|
| 1183 | | -
|
| 1184 | | - }
|
| 1185 | | -});
|
| 1186 | | -
|
| 1187 | | -$.ui.plugin.add("draggable", "snap", {
|
| 1188 | | - start: function(event, ui) {
|
| 1189 | | -
|
| 1190 | | - var i = $(this).data("draggable"), o = i.options;
|
| 1191 | | - i.snapElements = [];
|
| 1192 | | -
|
| 1193 | | - $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
|
| 1194 | | - var $t = $(this); var $o = $t.offset();
|
| 1195 | | - if(this != i.element[0]) i.snapElements.push({
|
| 1196 | | - item: this,
|
| 1197 | | - width: $t.outerWidth(), height: $t.outerHeight(),
|
| 1198 | | - top: $o.top, left: $o.left
|
| 1199 | | - });
|
| 1200 | | - });
|
| 1201 | | -
|
| 1202 | | - },
|
| 1203 | | - drag: function(event, ui) {
|
| 1204 | | -
|
| 1205 | | - var inst = $(this).data("draggable"), o = inst.options;
|
| 1206 | | - var d = o.snapTolerance;
|
| 1207 | | -
|
| 1208 | | - var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
|
| 1209 | | - y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
|
| 1210 | | -
|
| 1211 | | - for (var i = inst.snapElements.length - 1; i >= 0; i--){
|
| 1212 | | -
|
| 1213 | | - var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
|
| 1214 | | - t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
|
| 1215 | | -
|
| 1216 | | - //Yes, I know, this is insane ;)
|
| 1217 | | - if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
|
| 1218 | | - if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
|
| 1219 | | - inst.snapElements[i].snapping = false;
|
| 1220 | | - continue;
|
| 1221 | | - }
|
| 1222 | | -
|
| 1223 | | - if(o.snapMode != 'inner') {
|
| 1224 | | - var ts = Math.abs(t - y2) <= d;
|
| 1225 | | - var bs = Math.abs(b - y1) <= d;
|
| 1226 | | - var ls = Math.abs(l - x2) <= d;
|
| 1227 | | - var rs = Math.abs(r - x1) <= d;
|
| 1228 | | - if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
|
| 1229 | | - if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
|
| 1230 | | - if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
|
| 1231 | | - if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
|
| 1232 | | - }
|
| 1233 | | -
|
| 1234 | | - var first = (ts || bs || ls || rs);
|
| 1235 | | -
|
| 1236 | | - if(o.snapMode != 'outer') {
|
| 1237 | | - var ts = Math.abs(t - y1) <= d;
|
| 1238 | | - var bs = Math.abs(b - y2) <= d;
|
| 1239 | | - var ls = Math.abs(l - x1) <= d;
|
| 1240 | | - var rs = Math.abs(r - x2) <= d;
|
| 1241 | | - if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
|
| 1242 | | - if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
|
| 1243 | | - if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
|
| 1244 | | - if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
|
| 1245 | | - }
|
| 1246 | | -
|
| 1247 | | - if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
|
| 1248 | | - (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
|
| 1249 | | - inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
|
| 1250 | | -
|
| 1251 | | - };
|
| 1252 | | -
|
| 1253 | | - }
|
| 1254 | | -});
|
| 1255 | | -
|
| 1256 | | -$.ui.plugin.add("draggable", "stack", {
|
| 1257 | | - start: function(event, ui) {
|
| 1258 | | -
|
| 1259 | | - var o = $(this).data("draggable").options;
|
| 1260 | | -
|
| 1261 | | - var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
|
| 1262 | | - return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
|
| 1263 | | - });
|
| 1264 | | -
|
| 1265 | | - $(group).each(function(i) {
|
| 1266 | | - this.style.zIndex = o.stack.min + i;
|
| 1267 | | - });
|
| 1268 | | -
|
| 1269 | | - this[0].style.zIndex = o.stack.min + group.length;
|
| 1270 | | -
|
| 1271 | | - }
|
| 1272 | | -});
|
| 1273 | | -
|
| 1274 | | -$.ui.plugin.add("draggable", "zIndex", {
|
| 1275 | | - start: function(event, ui) {
|
| 1276 | | - var t = $(ui.helper), o = $(this).data("draggable").options;
|
| 1277 | | - if(t.css("zIndex")) o._zIndex = t.css("zIndex");
|
| 1278 | | - t.css('zIndex', o.zIndex);
|
| 1279 | | - },
|
| 1280 | | - stop: function(event, ui) {
|
| 1281 | | - var o = $(this).data("draggable").options;
|
| 1282 | | - if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
|
| 1283 | | - }
|
| 1284 | | -});
|
| 1285 | | -
|
| 1286 | | -})(jQuery);
|
| 1287 | | -
|
| 1288 | | -/*
|
| 1289 | | - * jQuery UI Droppable 1.7.2
|
| 1290 | | - *
|
| 1291 | | - * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
|
| 1292 | | - * Dual licensed under the MIT (MIT-LICENSE.txt)
|
| 1293 | | - * and GPL (GPL-LICENSE.txt) licenses.
|
| 1294 | | - *
|
| 1295 | | - * http://docs.jquery.com/UI/Droppables
|
| 1296 | | - *
|
| 1297 | | - * Depends:
|
| 1298 | | - * ui.core.js
|
| 1299 | | - * ui.draggable.js
|
| 1300 | | - */
|
| 1301 | | -(function($) {
|
| 1302 | | -
|
| 1303 | | -$.widget("ui.droppable", {
|
| 1304 | | -
|
| 1305 | | - _init: function() {
|
| 1306 | | -
|
| 1307 | | - var o = this.options, accept = o.accept;
|
| 1308 | | - this.isover = 0; this.isout = 1;
|
| 1309 | | -
|
| 1310 | | - this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) {
|
| 1311 | | - return d.is(accept);
|
| 1312 | | - };
|
| 1313 | | -
|
| 1314 | | - //Store the droppable's proportions
|
| 1315 | | - this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
|
| 1316 | | -
|
| 1317 | | - // Add the reference and positions to the manager
|
| 1318 | | - $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || [];
|
| 1319 | | - $.ui.ddmanager.droppables[this.options.scope].push(this);
|
| 1320 | | -
|
| 1321 | | - (this.options.addClasses && this.element.addClass("ui-droppable"));
|
| 1322 | | -
|
| 1323 | | - },
|
| 1324 | | -
|
| 1325 | | - destroy: function() {
|
| 1326 | | - var drop = $.ui.ddmanager.droppables[this.options.scope];
|
| 1327 | | - for ( var i = 0; i < drop.length; i++ )
|
| 1328 | | - if ( drop[i] == this )
|
| 1329 | | - drop.splice(i, 1);
|
| 1330 | | -
|
| 1331 | | - this.element
|
| 1332 | | - .removeClass("ui-droppable ui-droppable-disabled")
|
| 1333 | | - .removeData("droppable")
|
| 1334 | | - .unbind(".droppable");
|
| 1335 | | - },
|
| 1336 | | -
|
| 1337 | | - _setData: function(key, value) {
|
| 1338 | | -
|
| 1339 | | - if(key == 'accept') {
|
| 1340 | | - this.options.accept = value && $.isFunction(value) ? value : function(d) {
|
| 1341 | | - return d.is(value);
|
| 1342 | | - };
|
| 1343 | | - } else {
|
| 1344 | | - $.widget.prototype._setData.apply(this, arguments);
|
| 1345 | | - }
|
| 1346 | | -
|
| 1347 | | - },
|
| 1348 | | -
|
| 1349 | | - _activate: function(event) {
|
| 1350 | | - var draggable = $.ui.ddmanager.current;
|
| 1351 | | - if(this.options.activeClass) this.element.addClass(this.options.activeClass);
|
| 1352 | | - (draggable && this._trigger('activate', event, this.ui(draggable)));
|
| 1353 | | - },
|
| 1354 | | -
|
| 1355 | | - _deactivate: function(event) {
|
| 1356 | | - var draggable = $.ui.ddmanager.current;
|
| 1357 | | - if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
|
| 1358 | | - (draggable && this._trigger('deactivate', event, this.ui(draggable)));
|
| 1359 | | - },
|
| 1360 | | -
|
| 1361 | | - _over: function(event) {
|
| 1362 | | -
|
| 1363 | | - var draggable = $.ui.ddmanager.current;
|
| 1364 | | - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
|
| 1365 | | -
|
| 1366 | | - if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
|
| 1367 | | - if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
|
| 1368 | | - this._trigger('over', event, this.ui(draggable));
|
| 1369 | | - }
|
| 1370 | | -
|
| 1371 | | - },
|
| 1372 | | -
|
| 1373 | | - _out: function(event) {
|
| 1374 | | -
|
| 1375 | | - var draggable = $.ui.ddmanager.current;
|
| 1376 | | - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
|
| 1377 | | -
|
| 1378 | | - if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
|
| 1379 | | - if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
|
| 1380 | | - this._trigger('out', event, this.ui(draggable));
|
| 1381 | | - }
|
| 1382 | | -
|
| 1383 | | - },
|
| 1384 | | -
|
| 1385 | | - _drop: function(event,custom) {
|
| 1386 | | -
|
| 1387 | | - var draggable = custom || $.ui.ddmanager.current;
|
| 1388 | | - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
|
| 1389 | | -
|
| 1390 | | - var childrenIntersection = false;
|
| 1391 | | - this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
|
| 1392 | | - var inst = $.data(this, 'droppable');
|
| 1393 | | - if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) {
|
| 1394 | | - childrenIntersection = true; return false;
|
| 1395 | | - }
|
| 1396 | | - });
|
| 1397 | | - if(childrenIntersection) return false;
|
| 1398 | | -
|
| 1399 | | - if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
|
| 1400 | | - if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
|
| 1401 | | - if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
|
| 1402 | | - this._trigger('drop', event, this.ui(draggable));
|
| 1403 | | - return this.element;
|
| 1404 | | - }
|
| 1405 | | -
|
| 1406 | | - return false;
|
| 1407 | | -
|
| 1408 | | - },
|
| 1409 | | -
|
| 1410 | | - ui: function(c) {
|
| 1411 | | - return {
|
| 1412 | | - draggable: (c.currentItem || c.element),
|
| 1413 | | - helper: c.helper,
|
| 1414 | | - position: c.position,
|
| 1415 | | - absolutePosition: c.positionAbs, //deprecated
|
| 1416 | | - offset: c.positionAbs
|
| 1417 | | - };
|
| 1418 | | - }
|
| 1419 | | -
|
| 1420 | | -});
|
| 1421 | | -
|
| 1422 | | -$.extend($.ui.droppable, {
|
| 1423 | | - version: "1.7.2",
|
| 1424 | | - eventPrefix: 'drop',
|
| 1425 | | - defaults: {
|
| 1426 | | - accept: '*',
|
| 1427 | | - activeClass: false,
|
| 1428 | | - addClasses: true,
|
| 1429 | | - greedy: false,
|
| 1430 | | - hoverClass: false,
|
| 1431 | | - scope: 'default',
|
| 1432 | | - tolerance: 'intersect'
|
| 1433 | | - }
|
| 1434 | | -});
|
| 1435 | | -
|
| 1436 | | -$.ui.intersect = function(draggable, droppable, toleranceMode) {
|
| 1437 | | -
|
| 1438 | | - if (!droppable.offset) return false;
|
| 1439 | | -
|
| 1440 | | - var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
|
| 1441 | | - y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
|
| 1442 | | - var l = droppable.offset.left, r = l + droppable.proportions.width,
|
| 1443 | | - t = droppable.offset.top, b = t + droppable.proportions.height;
|
| 1444 | | -
|
| 1445 | | - switch (toleranceMode) {
|
| 1446 | | - case 'fit':
|
| 1447 | | - return (l < x1 && x2 < r
|
| 1448 | | - && t < y1 && y2 < b);
|
| 1449 | | - break;
|
| 1450 | | - case 'intersect':
|
| 1451 | | - return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
|
| 1452 | | - && x2 - (draggable.helperProportions.width / 2) < r // Left Half
|
| 1453 | | - && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
|
| 1454 | | - && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
|
| 1455 | | - break;
|
| 1456 | | - case 'pointer':
|
| 1457 | | - var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
|
| 1458 | | - draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
|
| 1459 | | - isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
|
| 1460 | | - return isOver;
|
| 1461 | | - break;
|
| 1462 | | - case 'touch':
|
| 1463 | | - return (
|
| 1464 | | - (y1 >= t && y1 <= b) || // Top edge touching
|
| 1465 | | - (y2 >= t && y2 <= b) || // Bottom edge touching
|
| 1466 | | - (y1 < t && y2 > b) // Surrounded vertically
|
| 1467 | | - ) && (
|
| 1468 | | - (x1 >= l && x1 <= r) || // Left edge touching
|
| 1469 | | - (x2 >= l && x2 <= r) || // Right edge touching
|
| 1470 | | - (x1 < l && x2 > r) // Surrounded horizontally
|
| 1471 | | - );
|
| 1472 | | - break;
|
| 1473 | | - default:
|
| 1474 | | - return false;
|
| 1475 | | - break;
|
| 1476 | | - }
|
| 1477 | | -
|
| 1478 | | -};
|
| 1479 | | -
|
| 1480 | | -/*
|
| 1481 | | - This manager tracks offsets of draggables and droppables
|
| 1482 | | -*/
|
| 1483 | | -$.ui.ddmanager = {
|
| 1484 | | - current: null,
|
| 1485 | | - droppables: { 'default': [] },
|
| 1486 | | - prepareOffsets: function(t, event) {
|
| 1487 | | -
|
| 1488 | | - var m = $.ui.ddmanager.droppables[t.options.scope];
|
| 1489 | | - var type = event ? event.type : null; // workaround for #2317
|
| 1490 | | - var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
|
| 1491 | | -
|
| 1492 | | - droppablesLoop: for (var i = 0; i < m.length; i++) {
|
| 1493 | | -
|
| 1494 | | - if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
|
| 1495 | | - for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
|
| 1496 | | - m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
|
| 1497 | | -
|
| 1498 | | - m[i].offset = m[i].element.offset();
|
| 1499 | | - m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
|
| 1500 | | -
|
| 1501 | | - if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
|
| 1502 | | -
|
| 1503 | | - }
|
| 1504 | | -
|
| 1505 | | - },
|
| 1506 | | - drop: function(draggable, event) {
|
| 1507 | | -
|
| 1508 | | - var dropped = false;
|
| 1509 | | - $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
|
| 1510 | | -
|
| 1511 | | - if(!this.options) return;
|
| 1512 | | - if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
|
| 1513 | | - dropped = this._drop.call(this, event);
|
| 1514 | | -
|
| 1515 | | - if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
|
| 1516 | | - this.isout = 1; this.isover = 0;
|
| 1517 | | - this._deactivate.call(this, event);
|
| 1518 | | - }
|
| 1519 | | -
|
| 1520 | | - });
|
| 1521 | | - return dropped;
|
| 1522 | | -
|
| 1523 | | - },
|
| 1524 | | - drag: function(draggable, event) {
|
| 1525 | | -
|
| 1526 | | - //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
|
| 1527 | | - if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
|
| 1528 | | -
|
| 1529 | | - //Run through all droppables and check their positions based on specific tolerance options
|
| 1530 | | -
|
| 1531 | | - $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
|
| 1532 | | -
|
| 1533 | | - if(this.options.disabled || this.greedyChild || !this.visible) return;
|
| 1534 | | - var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
|
| 1535 | | -
|
| 1536 | | - var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
|
| 1537 | | - if(!c) return;
|
| 1538 | | -
|
| 1539 | | - var parentInstance;
|
| 1540 | | - if (this.options.greedy) {
|
| 1541 | | - var parent = this.element.parents(':data(droppable):eq(0)');
|
| 1542 | | - if (parent.length) {
|
| 1543 | | - parentInstance = $.data(parent[0], 'droppable');
|
| 1544 | | - parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
|
| 1545 | | - }
|
| 1546 | | - }
|
| 1547 | | -
|
| 1548 | | - // we just moved into a greedy child
|
| 1549 | | - if (parentInstance && c == 'isover') {
|
| 1550 | | - parentInstance['isover'] = 0;
|
| 1551 | | - parentInstance['isout'] = 1;
|
| 1552 | | - parentInstance._out.call(parentInstance, event);
|
| 1553 | | - }
|
| 1554 | | -
|
| 1555 | | - this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
|
| 1556 | | - this[c == "isover" ? "_over" : "_out"].call(this, event);
|
| 1557 | | -
|
| 1558 | | - // we just moved out of a greedy child
|
| 1559 | | - if (parentInstance && c == 'isout') {
|
| 1560 | | - parentInstance['isout'] = 0;
|
| 1561 | | - parentInstance['isover'] = 1;
|
| 1562 | | - parentInstance._over.call(parentInstance, event);
|
| 1563 | | - }
|
| 1564 | | - });
|
| 1565 | | -
|
| 1566 | | - }
|
| 1567 | | -};
|
| 1568 | | -
|
| 1569 | | -})(jQuery);
|
| 1570 | | -
|
| 1571 | | -/*
|
| 1572 | | - * jQuery UI Resizable 1.7.2
|
| 1573 | | - *
|
| 1574 | | - * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
|
| 1575 | | - * Dual licensed under the MIT (MIT-LICENSE.txt)
|
| 1576 | | - * and GPL (GPL-LICENSE.txt) licenses.
|
| 1577 | | - *
|
| 1578 | | - * http://docs.jquery.com/UI/Resizables
|
| 1579 | | - *
|
| 1580 | | - * Depends:
|
| 1581 | | - * ui.core.js
|
| 1582 | | - */
|
| 1583 | | -(function($) {
|
| 1584 | | -
|
| 1585 | | -$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
|
| 1586 | | -
|
| 1587 | | - _init: function() {
|
| 1588 | | -
|
| 1589 | | - var self = this, o = this.options;
|
| 1590 | | - this.element.addClass("ui-resizable");
|
| 1591 | | -
|
| 1592 | | - $.extend(this, {
|
| 1593 | | - _aspectRatio: !!(o.aspectRatio),
|
| 1594 | | - aspectRatio: o.aspectRatio,
|
| 1595 | | - originalElement: this.element,
|
| 1596 | | - _proportionallyResizeElements: [],
|
| 1597 | | - _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
|
| 1598 | | - });
|
| 1599 | | -
|
| 1600 | | - //Wrap the element if it cannot hold child nodes
|
| 1601 | | - if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
|
| 1602 | | -
|
| 1603 | | - //Opera fix for relative positioning
|
| 1604 | | - if (/relative/.test(this.element.css('position')) && $.browser.opera)
|
| 1605 | | - this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
|
| 1606 | | -
|
| 1607 | | - //Create a wrapper element and set the wrapper to the new current internal element
|
| 1608 | | - this.element.wrap(
|
| 1609 | | - $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
|
| 1610 | | - position: this.element.css('position'),
|
| 1611 | | - width: this.element.outerWidth(),
|
| 1612 | | - height: this.element.outerHeight(),
|
| 1613 | | - top: this.element.css('top'),
|
| 1614 | | - left: this.element.css('left')
|
| 1615 | | - })
|
| 1616 | | - );
|
| 1617 | | -
|
| 1618 | | - //Overwrite the original this.element
|
| 1619 | | - this.element = this.element.parent().data(
|
| 1620 | | - "resizable", this.element.data('resizable')
|
| 1621 | | - );
|
| 1622 | | -
|
| 1623 | | - this.elementIsWrapper = true;
|
| 1624 | | -
|
| 1625 | | - //Move margins to the wrapper
|
| 1626 | | - this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
|
| 1627 | | - this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
|
| 1628 | | -
|
| 1629 | | - //Prevent Safari textarea resize
|
| 1630 | | - this.originalResizeStyle = this.originalElement.css('resize');
|
| 1631 | | - this.originalElement.css('resize', 'none');
|
| 1632 | | -
|
| 1633 | | - //Push the actual element to our proportionallyResize internal array
|
| 1634 | | - this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
|
| 1635 | | -
|
| 1636 | | - // avoid IE jump (hard set the margin)
|
| 1637 | | - this.originalElement.css({ margin: this.originalElement.css('margin') });
|
| 1638 | | -
|
| 1639 | | - // fix handlers offset
|
| 1640 | | - this._proportionallyResize();
|
| 1641 | | -
|
| 1642 | | - }
|
| 1643 | | -
|
| 1644 | | - this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
|
| 1645 | | - if(this.handles.constructor == String) {
|
| 1646 | | -
|
| 1647 | | - if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
|
| 1648 | | - var n = this.handles.split(","); this.handles = {};
|
| 1649 | | -
|
| 1650 | | - for(var i = 0; i < n.length; i++) {
|
| 1651 | | -
|
| 1652 | | - var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
|
| 1653 | | - var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
|
| 1654 | | -
|
| 1655 | | - // increase zIndex of sw, se, ne, nw axis
|
| 1656 | | - //TODO : this modifies original option
|
| 1657 | | - if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
|
| 1658 | | -
|
| 1659 | | - //TODO : What's going on here?
|
| 1660 | | - if ('se' == handle) {
|
| 1661 | | - axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
|
| 1662 | | - };
|
| 1663 | | -
|
| 1664 | | - //Insert into internal handles object and append to element
|
| 1665 | | - this.handles[handle] = '.ui-resizable-'+handle;
|
| 1666 | | - this.element.append(axis);
|
| 1667 | | - }
|
| 1668 | | -
|
| 1669 | | - }
|
| 1670 | | -
|
| 1671 | | - this._renderAxis = function(target) {
|
| 1672 | | -
|
| 1673 | | - target = target || this.element;
|
| 1674 | | -
|
| 1675 | | - for(var i in this.handles) {
|
| 1676 | | -
|
| 1677 | | - if(this.handles[i].constructor == String)
|
| 1678 | | - this.handles[i] = $(this.handles[i], this.element).show();
|
| 1679 | | -
|
| 1680 | | - //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
|
| 1681 | | - if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
|
| 1682 | | -
|
| 1683 | | - var axis = $(this.handles[i], this.element), padWrapper = 0;
|
| 1684 | | -
|
| 1685 | | - //Checking the correct pad and border
|
| 1686 | | - padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
|
| 1687 | | -
|
| 1688 | | - //The padding type i have to apply...
|
| 1689 | | - var padPos = [ 'padding',
|
| 1690 | | - /ne|nw|n/.test(i) ? 'Top' :
|
| 1691 | | - /se|sw|s/.test(i) ? 'Bottom' :
|
| 1692 | | - /^e$/.test(i) ? 'Right' : 'Left' ].join("");
|
| 1693 | | -
|
| 1694 | | - target.css(padPos, padWrapper);
|
| 1695 | | -
|
| 1696 | | - this._proportionallyResize();
|
| 1697 | | -
|
| 1698 | | - }
|
| 1699 | | -
|
| 1700 | | - //TODO: What's that good for? There's not anything to be executed left
|
| 1701 | | - if(!$(this.handles[i]).length)
|
| 1702 | | - continue;
|
| 1703 | | -
|
| 1704 | | - }
|
| 1705 | | - };
|
| 1706 | | -
|
| 1707 | | - //TODO: make renderAxis a prototype function
|
| 1708 | | - this._renderAxis(this.element);
|
| 1709 | | -
|
| 1710 | | - this._handles = $('.ui-resizable-handle', this.element)
|
| 1711 | | - .disableSelection();
|
| 1712 | | -
|
| 1713 | | - //Matching axis name
|
| 1714 | | - this._handles.mouseover(function() {
|
| 1715 | | - if (!self.resizing) {
|
| 1716 | | - if (this.className)
|
| 1717 | | - var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
|
| 1718 | | - //Axis, default = se
|
| 1719 | | - self.axis = axis && axis[1] ? axis[1] : 'se';
|
| 1720 | | - }
|
| 1721 | | - });
|
| 1722 | | -
|
| 1723 | | - //If we want to auto hide the elements
|
| 1724 | | - if (o.autoHide) {
|
| 1725 | | - this._handles.hide();
|
| 1726 | | - $(this.element)
|
| 1727 | | - .addClass("ui-resizable-autohide")
|
| 1728 | | - .hover(function() {
|
| 1729 | | - $(this).removeClass("ui-resizable-autohide");
|
| 1730 | | - self._handles.show();
|
| 1731 | | - },
|
| 1732 | | - function(){
|
| 1733 | | - if (!self.resizing) {
|
| 1734 | | - $(this).addClass("ui-resizable-autohide");
|
| 1735 | | - self._handles.hide();
|
| 1736 | | - }
|
| 1737 | | - });
|
| 1738 | | - }
|
| 1739 | | -
|
| 1740 | | - //Initialize the mouse interaction
|
| 1741 | | - this._mouseInit();
|
| 1742 | | -
|
| 1743 | | - },
|
| 1744 | | -
|
| 1745 | | - destroy: function() {
|
| 1746 | | -
|
| 1747 | | - this._mouseDestroy();
|
| 1748 | | -
|
| 1749 | | - var _destroy = function(exp) {
|
| 1750 | | - $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
|
| 1751 | | - .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
|
| 1752 | | - };
|
| 1753 | | -
|
| 1754 | | - //TODO: Unwrap at same DOM position
|
| 1755 | | - if (this.elementIsWrapper) {
|
| 1756 | | - _destroy(this.element);
|
| 1757 | | - var wrapper = this.element;
|
| 1758 | | - wrapper.parent().append(
|
| 1759 | | - this.originalElement.css({
|
| 1760 | | - position: wrapper.css('position'),
|
| 1761 | | - width: wrapper.outerWidth(),
|
| 1762 | | - height: wrapper.outerHeight(),
|
| 1763 | | - top: wrapper.css('top'),
|
| 1764 | | - left: wrapper.css('left')
|
| 1765 | | - })
|
| 1766 | | - ).end().remove();
|
| 1767 | | - }
|
| 1768 | | -
|
| 1769 | | - this.originalElement.css('resize', this.originalResizeStyle);
|
| 1770 | | - _destroy(this.originalElement);
|
| 1771 | | -
|
| 1772 | | - },
|
| 1773 | | -
|
| 1774 | | - _mouseCapture: function(event) {
|
| 1775 | | -
|
| 1776 | | - var handle = false;
|
| 1777 | | - for(var i in this.handles) {
|
| 1778 | | - if($(this.handles[i])[0] == event.target) handle = true;
|
| 1779 | | - }
|
| 1780 | | -
|
| 1781 | | - return this.options.disabled || !!handle;
|
| 1782 | | -
|
| 1783 | | - },
|
| 1784 | | -
|
| 1785 | | - _mouseStart: function(event) {
|
| 1786 | | -
|
| 1787 | | - var o = this.options, iniPos = this.element.position(), el = this.element;
|
| 1788 | | -
|
| 1789 | | - this.resizing = true;
|
| 1790 | | - this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
|
| 1791 | | -
|
| 1792 | | - // bugfix for http://dev.jquery.com/ticket/1749
|
| 1793 | | - if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
|
| 1794 | | - el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
|
| 1795 | | - }
|
| 1796 | | -
|
| 1797 | | - //Opera fixing relative position
|
| 1798 | | - if ($.browser.opera && (/relative/).test(el.css('position')))
|
| 1799 | | - el.css({ position: 'relative', top: 'auto', left: 'auto' });
|
| 1800 | | -
|
| 1801 | | - this._renderProxy();
|
| 1802 | | -
|
| 1803 | | - var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
|
| 1804 | | -
|
| 1805 | | - if (o.containment) {
|
| 1806 | | - curleft += $(o.containment).scrollLeft() || 0;
|
| 1807 | | - curtop += $(o.containment).scrollTop() || 0;
|
| 1808 | | - }
|
| 1809 | | -
|
| 1810 | | - //Store needed variables
|
| 1811 | | - this.offset = this.helper.offset();
|
| 1812 | | - this.position = { left: curleft, top: curtop };
|
| 1813 | | - this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
|
| 1814 | | - this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
|
| 1815 | | - this.originalPosition = { left: curleft, top: curtop };
|
| 1816 | | - this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
|
| 1817 | | - this.originalMousePosition = { left: event.pageX, top: event.pageY };
|
| 1818 | | -
|
| 1819 | | - //Aspect Ratio
|
| 1820 | | - this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
|
| 1821 | | -
|
| 1822 | | - var cursor = $('.ui-resizable-' + this.axis).css('cursor');
|
| 1823 | | - $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
|
| 1824 | | -
|
| 1825 | | - el.addClass("ui-resizable-resizing");
|
| 1826 | | - this._propagate("start", event);
|
| 1827 | | - return true;
|
| 1828 | | - },
|
| 1829 | | -
|
| 1830 | | - _mouseDrag: function(event) {
|
| 1831 | | -
|
| 1832 | | - //Increase performance, avoid regex
|
| 1833 | | - var el = this.helper, o = this.options, props = {},
|
| 1834 | | - self = this, smp = this.originalMousePosition, a = this.axis;
|
| 1835 | | -
|
| 1836 | | - var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
|
| 1837 | | - var trigger = this._change[a];
|
| 1838 | | - if (!trigger) return false;
|
| 1839 | | -
|
| 1840 | | - // Calculate the attrs that will be change
|
| 1841 | | - var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
|
| 1842 | | -
|
| 1843 | | - if (this._aspectRatio || event.shiftKey)
|
| 1844 | | - data = this._updateRatio(data, event);
|
| 1845 | | -
|
| 1846 | | - data = this._respectSize(data, event);
|
| 1847 | | -
|
| 1848 | | - // plugins callbacks need to be called first
|
| 1849 | | - this._propagate("resize", event);
|
| 1850 | | -
|
| 1851 | | - el.css({
|
| 1852 | | - top: this.position.top + "px", left: this.position.left + "px",
|
| 1853 | | - width: this.size.width + "px", height: this.size.height + "px"
|
| 1854 | | - });
|
| 1855 | | -
|
| 1856 | | - if (!this._helper && this._proportionallyResizeElements.length)
|
| 1857 | | - this._proportionallyResize();
|
| 1858 | | -
|
| 1859 | | - this._updateCache(data);
|
| 1860 | | -
|
| 1861 | | - // calling the user callback at the end
|
| 1862 | | - this._trigger('resize', event, this.ui());
|
| 1863 | | -
|
| 1864 | | - return false;
|
| 1865 | | - },
|
| 1866 | | -
|
| 1867 | | - _mouseStop: function(event) {
|
| 1868 | | -
|
| 1869 | | - this.resizing = false;
|
| 1870 | | - var o = this.options, self = this;
|
| 1871 | | -
|
| 1872 | | - if(this._helper) {
|
| 1873 | | - var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
|
| 1874 | | - soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
|
| 1875 | | - soffsetw = ista ? 0 : self.sizeDiff.width;
|
| 1876 | | -
|
| 1877 | | - var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
|
| 1878 | | - left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
|
| 1879 | | - top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
|
| 1880 | | -
|
| 1881 | | - if (!o.animate)
|
| 1882 | | - this.element.css($.extend(s, { top: top, left: left }));
|
| 1883 | | -
|
| 1884 | | - self.helper.height(self.size.height);
|
| 1885 | | - self.helper.width(self.size.width);
|
| 1886 | | -
|
| 1887 | | - if (this._helper && !o.animate) this._proportionallyResize();
|
| 1888 | | - }
|
| 1889 | | -
|
| 1890 | | - $('body').css('cursor', 'auto');
|
| 1891 | | -
|
| 1892 | | - this.element.removeClass("ui-resizable-resizing");
|
| 1893 | | -
|
| 1894 | | - this._propagate("stop", event);
|
| 1895 | | -
|
| 1896 | | - if (this._helper) this.helper.remove();
|
| 1897 | | - return false;
|
| 1898 | | -
|
| 1899 | | - },
|
| 1900 | | -
|
| 1901 | | - _updateCache: function(data) {
|
| 1902 | | - var o = this.options;
|
| 1903 | | - this.offset = this.helper.offset();
|
| 1904 | | - if (isNumber(data.left)) this.position.left = data.left;
|
| 1905 | | - if (isNumber(data.top)) this.position.top = data.top;
|
| 1906 | | - if (isNumber(data.height)) this.size.height = data.height;
|
| 1907 | | - if (isNumber(data.width)) this.size.width = data.width;
|
| 1908 | | - },
|
| 1909 | | -
|
| 1910 | | - _updateRatio: function(data, event) {
|
| 1911 | | -
|
| 1912 | | - var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
|
| 1913 | | -
|
| 1914 | | - if (data.height) data.width = (csize.height * this.aspectRatio);
|
| 1915 | | - else if (data.width) data.height = (csize.width / this.aspectRatio);
|
| 1916 | | -
|
| 1917 | | - if (a == 'sw') {
|
| 1918 | | - data.left = cpos.left + (csize.width - data.width);
|
| 1919 | | - data.top = null;
|
| 1920 | | - }
|
| 1921 | | - if (a == 'nw') {
|
| 1922 | | - data.top = cpos.top + (csize.height - data.height);
|
| 1923 | | - data.left = cpos.left + (csize.width - data.width);
|
| 1924 | | - }
|
| 1925 | | -
|
| 1926 | | - return data;
|
| 1927 | | - },
|
| 1928 | | -
|
| 1929 | | - _respectSize: function(data, event) {
|
| 1930 | | -
|
| 1931 | | - var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
|
| 1932 | | - ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
|
| 1933 | | - isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
|
| 1934 | | -
|
| 1935 | | - if (isminw) data.width = o.minWidth;
|
| 1936 | | - if (isminh) data.height = o.minHeight;
|
| 1937 | | - if (ismaxw) data.width = o.maxWidth;
|
| 1938 | | - if (ismaxh) data.height = o.maxHeight;
|
| 1939 | | -
|
| 1940 | | - var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
|
| 1941 | | - var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
|
| 1942 | | -
|
| 1943 | | - if (isminw && cw) data.left = dw - o.minWidth;
|
| 1944 | | - if (ismaxw && cw) data.left = dw - o.maxWidth;
|
| 1945 | | - if (isminh && ch) data.top = dh - o.minHeight;
|
| 1946 | | - if (ismaxh && ch) data.top = dh - o.maxHeight;
|
| 1947 | | -
|
| 1948 | | - // fixing jump error on top/left - bug #2330
|
| 1949 | | - var isNotwh = !data.width && !data.height;
|
| 1950 | | - if (isNotwh && !data.left && data.top) data.top = null;
|
| 1951 | | - else if (isNotwh && !data.top && data.left) data.left = null;
|
| 1952 | | -
|
| 1953 | | - return data;
|
| 1954 | | - },
|
| 1955 | | -
|
| 1956 | | - _proportionallyResize: function() {
|
| 1957 | | -
|
| 1958 | | - var o = this.options;
|
| 1959 | | - if (!this._proportionallyResizeElements.length) return;
|
| 1960 | | - var element = this.helper || this.element;
|
| 1961 | | -
|
| 1962 | | - for (var i=0; i < this._proportionallyResizeElements.length; i++) {
|
| 1963 | | -
|
| 1964 | | - var prel = this._proportionallyResizeElements[i];
|
| 1965 | | -
|
| 1966 | | - if (!this.borderDif) {
|
| 1967 | | - var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
|
| 1968 | | - p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
|
| 1969 | | -
|
| 1970 | | - this.borderDif = $.map(b, function(v, i) {
|
| 1971 | | - var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
|
| 1972 | | - return border + padding;
|
| 1973 | | - });
|
| 1974 | | - }
|
| 1975 | | -
|
| 1976 | | - if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
|
| 1977 | | - continue;
|
| 1978 | | -
|
| 1979 | | - prel.css({
|
| 1980 | | - height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
|
| 1981 | | - width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
|
| 1982 | | - });
|
| 1983 | | -
|
| 1984 | | - };
|
| 1985 | | -
|
| 1986 | | - },
|
| 1987 | | -
|
| 1988 | | - _renderProxy: function() {
|
| 1989 | | -
|
| 1990 | | - var el = this.element, o = this.options;
|
| 1991 | | - this.elementOffset = el.offset();
|
| 1992 | | -
|
| 1993 | | - if(this._helper) {
|
| 1994 | | -
|
| 1995 | | - this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
|
| 1996 | | -
|
| 1997 | | - // fix ie6 offset TODO: This seems broken
|
| 1998 | | - var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
|
| 1999 | | - pxyoffset = ( ie6 ? 2 : -1 );
|
| 2000 | | -
|
| 2001 | | - this.helper.addClass(this._helper).css({
|
| 2002 | | - width: this.element.outerWidth() + pxyoffset,
|
| 2003 | | - height: this.element.outerHeight() + pxyoffset,
|
| 2004 | | - position: 'absolute',
|
| 2005 | | - left: this.elementOffset.left - ie6offset +'px',
|
| 2006 | | - top: this.elementOffset.top - ie6offset +'px',
|
| 2007 | | - zIndex: ++o.zIndex //TODO: Don't modify option
|
| 2008 | | - });
|
| 2009 | | -
|
| 2010 | | - this.helper
|
| 2011 | | - .appendTo("body")
|
| 2012 | | - .disableSelection();
|
| 2013 | | -
|
| 2014 | | - } else {
|
| 2015 | | - this.helper = this.element;
|
| 2016 | | - }
|
| 2017 | | -
|
| 2018 | | - },
|
| 2019 | | -
|
| 2020 | | - _change: {
|
| 2021 | | - e: function(event, dx, dy) {
|
| 2022 | | - return { width: this.originalSize.width + dx };
|
| 2023 | | - },
|
| 2024 | | - w: function(event, dx, dy) {
|
| 2025 | | - var o = this.options, cs = this.originalSize, sp = this.originalPosition;
|
| 2026 | | - return { left: sp.left + dx, width: cs.width - dx };
|
| 2027 | | - },
|
| 2028 | | - n: function(event, dx, dy) {
|
| 2029 | | - var o = this.options, cs = this.originalSize, sp = this.originalPosition;
|
| 2030 | | - return { top: sp.top + dy, height: cs.height - dy };
|
| 2031 | | - },
|
| 2032 | | - s: function(event, dx, dy) {
|
| 2033 | | - return { height: this.originalSize.height + dy };
|
| 2034 | | - },
|
| 2035 | | - se: function(event, dx, dy) {
|
| 2036 | | - return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
|
| 2037 | | - },
|
| 2038 | | - sw: function(event, dx, dy) {
|
| 2039 | | - return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
|
| 2040 | | - },
|
| 2041 | | - ne: function(event, dx, dy) {
|
| 2042 | | - return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
|
| 2043 | | - },
|
| 2044 | | - nw: function(event, dx, dy) {
|
| 2045 | | - return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
|
| 2046 | | - }
|
| 2047 | | - },
|
| 2048 | | -
|
| 2049 | | - _propagate: function(n, event) {
|
| 2050 | | - $.ui.plugin.call(this, n, [event, this.ui()]);
|
| 2051 | | - (n != "resize" && this._trigger(n, event, this.ui()));
|
| 2052 | | - },
|
| 2053 | | -
|
| 2054 | | - plugins: {},
|
| 2055 | | -
|
| 2056 | | - ui: function() {
|
| 2057 | | - return {
|
| 2058 | | - originalElement: this.originalElement,
|
| 2059 | | - element: this.element,
|
| 2060 | | - helper: this.helper,
|
| 2061 | | - position: this.position,
|
| 2062 | | - size: this.size,
|
| 2063 | | - originalSize: this.originalSize,
|
| 2064 | | - originalPosition: this.originalPosition
|
| 2065 | | - };
|
| 2066 | | - }
|
| 2067 | | -
|
| 2068 | | -}));
|
| 2069 | | -
|
| 2070 | | -$.extend($.ui.resizable, {
|
| 2071 | | - version: "1.7.2",
|
| 2072 | | - eventPrefix: "resize",
|
| 2073 | | - defaults: {
|
| 2074 | | - alsoResize: false,
|
| 2075 | | - animate: false,
|
| 2076 | | - animateDuration: "slow",
|
| 2077 | | - animateEasing: "swing",
|
| 2078 | | - aspectRatio: false,
|
| 2079 | | - autoHide: false,
|
| 2080 | | - cancel: ":input,option",
|
| 2081 | | - containment: false,
|
| 2082 | | - delay: 0,
|
| 2083 | | - distance: 1,
|
| 2084 | | - ghost: false,
|
| 2085 | | - grid: false,
|
| 2086 | | - handles: "e,s,se",
|
| 2087 | | - helper: false,
|
| 2088 | | - maxHeight: null,
|
| 2089 | | - maxWidth: null,
|
| 2090 | | - minHeight: 10,
|
| 2091 | | - minWidth: 10,
|
| 2092 | | - zIndex: 1000
|
| 2093 | | - }
|
| 2094 | | -});
|
| 2095 | | -
|
| 2096 | | -/*
|
| 2097 | | - * Resizable Extensions
|
| 2098 | | - */
|
| 2099 | | -
|
| 2100 | | -$.ui.plugin.add("resizable", "alsoResize", {
|
| 2101 | | -
|
| 2102 | | - start: function(event, ui) {
|
| 2103 | | -
|
| 2104 | | - var self = $(this).data("resizable"), o = self.options;
|
| 2105 | | -
|
| 2106 | | - _store = function(exp) {
|
| 2107 | | - $(exp).each(function() {
|
| 2108 | | - $(this).data("resizable-alsoresize", {
|
| 2109 | | - width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
|
| 2110 | | - left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
|
| 2111 | | - });
|
| 2112 | | - });
|
| 2113 | | - };
|
| 2114 | | -
|
| 2115 | | - if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
|
| 2116 | | - if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
|
| 2117 | | - else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
|
| 2118 | | - }else{
|
| 2119 | | - _store(o.alsoResize);
|
| 2120 | | - }
|
| 2121 | | - },
|
| 2122 | | -
|
| 2123 | | - resize: function(event, ui){
|
| 2124 | | - var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
|
| 2125 | | -
|
| 2126 | | - var delta = {
|
| 2127 | | - height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
|
| 2128 | | - top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
|
| 2129 | | - },
|
| 2130 | | -
|
| 2131 | | - _alsoResize = function(exp, c) {
|
| 2132 | | - $(exp).each(function() {
|
| 2133 | | - var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
|
| 2134 | | -
|
| 2135 | | - $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
|
| 2136 | | - var sum = (start[prop]||0) + (delta[prop]||0);
|
| 2137 | | - if (sum && sum >= 0)
|
| 2138 | | - style[prop] = sum || null;
|
| 2139 | | - });
|
| 2140 | | -
|
| 2141 | | - //Opera fixing relative position
|
| 2142 | | - if (/relative/.test(el.css('position')) && $.browser.opera) {
|
| 2143 | | - self._revertToRelativePosition = true;
|
| 2144 | | - el.css({ position: 'absolute', top: 'auto', left: 'auto' });
|
| 2145 | | - }
|
| 2146 | | -
|
| 2147 | | - el.css(style);
|
| 2148 | | - });
|
| 2149 | | - };
|
| 2150 | | -
|
| 2151 | | - if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
|
| 2152 | | - $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
|
| 2153 | | - }else{
|
| 2154 | | - _alsoResize(o.alsoResize);
|
| 2155 | | - }
|
| 2156 | | - },
|
| 2157 | | -
|
| 2158 | | - stop: function(event, ui){
|
| 2159 | | - var self = $(this).data("resizable");
|
| 2160 | | -
|
| 2161 | | - //Opera fixing relative position
|
| 2162 | | - if (self._revertToRelativePosition && $.browser.opera) {
|
| 2163 | | - self._revertToRelativePosition = false;
|
| 2164 | | - el.css({ position: 'relative' });
|
| 2165 | | - }
|
| 2166 | | -
|
| 2167 | | - $(this).removeData("resizable-alsoresize-start");
|
| 2168 | | - }
|
| 2169 | | -});
|
| 2170 | | -
|
| 2171 | | -$.ui.plugin.add("resizable", "animate", {
|
| 2172 | | -
|
| 2173 | | - stop: function(event, ui) {
|
| 2174 | | - var self = $(this).data("resizable"), o = self.options;
|
| 2175 | | -
|
| 2176 | | - var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
|
| 2177 | | - soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
|
| 2178 | | - soffsetw = ista ? 0 : self.sizeDiff.width;
|
| 2179 | | -
|
| 2180 | | - var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
|
| 2181 | | - left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
|
| 2182 | | - top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
|
| 2183 | | -
|
| 2184 | | - self.element.animate(
|
| 2185 | | - $.extend(style, top && left ? { top: top, left: left } : {}), {
|
| 2186 | | - duration: o.animateDuration,
|
| 2187 | | - easing: o.animateEasing,
|
| 2188 | | - step: function() {
|
| 2189 | | -
|
| 2190 | | - var data = {
|
| 2191 | | - width: parseInt(self.element.css('width'), 10),
|
| 2192 | | - height: parseInt(self.element.css('height'), 10),
|
| 2193 | | - top: parseInt(self.element.css('top'), 10),
|
| 2194 | | - left: parseInt(self.element.css('left'), 10)
|
| 2195 | | - };
|
| 2196 | | -
|
| 2197 | | - if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
|
| 2198 | | -
|
| 2199 | | - // propagating resize, and updating values for each animation step
|
| 2200 | | - self._updateCache(data);
|
| 2201 | | - self._propagate("resize", event);
|
| 2202 | | -
|
| 2203 | | - }
|
| 2204 | | - }
|
| 2205 | | - );
|
| 2206 | | - }
|
| 2207 | | -
|
| 2208 | | -});
|
| 2209 | | -
|
| 2210 | | -$.ui.plugin.add("resizable", "containment", {
|
| 2211 | | -
|
| 2212 | | - start: function(event, ui) {
|
| 2213 | | - var self = $(this).data("resizable"), o = self.options, el = self.element;
|
| 2214 | | - var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
|
| 2215 | | - if (!ce) return;
|
| 2216 | | -
|
| 2217 | | - self.containerElement = $(ce);
|
| 2218 | | -
|
| 2219 | | - if (/document/.test(oc) || oc == document) {
|
| 2220 | | - self.containerOffset = { left: 0, top: 0 };
|
| 2221 | | - self.containerPosition = { left: 0, top: 0 };
|
| 2222 | | -
|
| 2223 | | - self.parentData = {
|
| 2224 | | - element: $(document), left: 0, top: 0,
|
| 2225 | | - width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
|
| 2226 | | - };
|
| 2227 | | - }
|
| 2228 | | -
|
| 2229 | | - // i'm a node, so compute top, left, right, bottom
|
| 2230 | | - else {
|
| 2231 | | - var element = $(ce), p = [];
|
| 2232 | | - $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
|
| 2233 | | -
|
| 2234 | | - self.containerOffset = element.offset();
|
| 2235 | | - self.containerPosition = element.position();
|
| 2236 | | - self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
|
| 2237 | | -
|
| 2238 | | - var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
|
| 2239 | | - width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
|
| 2240 | | -
|
| 2241 | | - self.parentData = {
|
| 2242 | | - element: ce, left: co.left, top: co.top, width: width, height: height
|
| 2243 | | - };
|
| 2244 | | - }
|
| 2245 | | - },
|
| 2246 | | -
|
| 2247 | | - resize: function(event, ui) {
|
| 2248 | | - var self = $(this).data("resizable"), o = self.options,
|
| 2249 | | - ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
|
| 2250 | | - pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
|
| 2251 | | -
|
| 2252 | | - if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
|
| 2253 | | -
|
| 2254 | | - if (cp.left < (self._helper ? co.left : 0)) {
|
| 2255 | | - self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
|
| 2256 | | - if (pRatio) self.size.height = self.size.width / o.aspectRatio;
|
| 2257 | | - self.position.left = o.helper ? co.left : 0;
|
| 2258 | | - }
|
| 2259 | | -
|
| 2260 | | - if (cp.top < (self._helper ? co.top : 0)) {
|
| 2261 | | - self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
|
| 2262 | | - if (pRatio) self.size.width = self.size.height * o.aspectRatio;
|
| 2263 | | - self.position.top = self._helper ? co.top : 0;
|
| 2264 | | - }
|
| 2265 | | -
|
| 2266 | | - self.offset.left = self.parentData.left+self.position.left;
|
| 2267 | | - self.offset.top = self.parentData.top+self.position.top;
|
| 2268 | | -
|
| 2269 | | - var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
|
| 2270 | | - hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
|
| 2271 | | -
|
| 2272 | | - var isParent = self.containerElement.get(0) == self.element.parent().get(0),
|
| 2273 | | - isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
|
| 2274 | | -
|
| 2275 | | - if(isParent && isOffsetRelative) woset -= self.parentData.left;
|
| 2276 | | -
|
| 2277 | | - if (woset + self.size.width >= self.parentData.width) {
|
| 2278 | | - self.size.width = self.parentData.width - woset;
|
| 2279 | | - if (pRatio) self.size.height = self.size.width / self.aspectRatio;
|
| 2280 | | - }
|
| 2281 | | -
|
| 2282 | | - if (hoset + self.size.height >= self.parentData.height) {
|
| 2283 | | - self.size.height = self.parentData.height - hoset;
|
| 2284 | | - if (pRatio) self.size.width = self.size.height * self.aspectRatio;
|
| 2285 | | - }
|
| 2286 | | - },
|
| 2287 | | -
|
| 2288 | | - stop: function(event, ui){
|
| 2289 | | - var self = $(this).data("resizable"), o = self.options, cp = self.position,
|
| 2290 | | - co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
|
| 2291 | | -
|
| 2292 | | - var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
|
| 2293 | | -
|
| 2294 | | - if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
|
| 2295 | | - $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
|
| 2296 | | -
|
| 2297 | | - if (self._helper && !o.animate && (/static/).test(ce.css('position')))
|
| 2298 | | - $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
|
| 2299 | | -
|
| 2300 | | - }
|
| 2301 | | -});
|
| 2302 | | -
|
| 2303 | | -$.ui.plugin.add("resizable", "ghost", {
|
| 2304 | | -
|
| 2305 | | - start: function(event, ui) {
|
| 2306 | | -
|
| 2307 | | - var self = $(this).data("resizable"), o = self.options, cs = self.size;
|
| 2308 | | -
|
| 2309 | | - self.ghost = self.originalElement.clone();
|
| 2310 | | - self.ghost
|
| 2311 | | - .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
|
| 2312 | | - .addClass('ui-resizable-ghost')
|
| 2313 | | - .addClass(typeof o.ghost == 'string' ? o.ghost : '');
|
| 2314 | | -
|
| 2315 | | - self.ghost.appendTo(self.helper);
|
| 2316 | | -
|
| 2317 | | - },
|
| 2318 | | -
|
| 2319 | | - resize: function(event, ui){
|
| 2320 | | - var self = $(this).data("resizable"), o = self.options;
|
| 2321 | | - if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
|
| 2322 | | - },
|
| 2323 | | -
|
| 2324 | | - stop: function(event, ui){
|
| 2325 | | - var self = $(this).data("resizable"), o = self.options;
|
| 2326 | | - if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
|
| 2327 | | - }
|
| 2328 | | -
|
| 2329 | | -});
|
| 2330 | | -
|
| 2331 | | -$.ui.plugin.add("resizable", "grid", {
|
| 2332 | | -
|
| 2333 | | - resize: function(event, ui) {
|
| 2334 | | - var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
|
| 2335 | | - o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
|
| 2336 | | - var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
|
| 2337 | | -
|
| 2338 | | - if (/^(se|s|e)$/.test(a)) {
|
| 2339 | | - self.size.width = os.width + ox;
|
| 2340 | | - self.size.height = os.height + oy;
|
| 2341 | | - }
|
| 2342 | | - else if (/^(ne)$/.test(a)) {
|
| 2343 | | - self.size.width = os.width + ox;
|
| 2344 | | - self.size.height = os.height + oy;
|
| 2345 | | - self.position.top = op.top - oy;
|
| 2346 | | - }
|
| 2347 | | - else if (/^(sw)$/.test(a)) {
|
| 2348 | | - self.size.width = os.width + ox;
|
| 2349 | | - self.size.height = os.height + oy;
|
| 2350 | | - self.position.left = op.left - ox;
|
| 2351 | | - }
|
| 2352 | | - else {
|
| 2353 | | - self.size.width = os.width + ox;
|
| 2354 | | - self.size.height = os.height + oy;
|
| 2355 | | - self.position.top = op.top - oy;
|
| 2356 | | - self.position.left = op.left - ox;
|
| 2357 | | - }
|
| 2358 | | - }
|
| 2359 | | -
|
| 2360 | | -});
|
| 2361 | | -
|
| 2362 | | -var num = function(v) {
|
| 2363 | | - return parseInt(v, 10) || 0;
|
| 2364 | | -};
|
| 2365 | | -
|
| 2366 | | -var isNumber = function(value) {
|
| 2367 | | - return !isNaN(parseInt(value, 10));
|
| 2368 | | -};
|
| 2369 | | -
|
| 2370 | | -})(jQuery);
|
| 2371 | | -/*
|
| 2372 | | - * jQuery UI Dialog 1.7.2
|
| 2373 | | - *
|
| 2374 | | - * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
|
| 2375 | | - * Dual licensed under the MIT (MIT-LICENSE.txt)
|
| 2376 | | - * and GPL (GPL-LICENSE.txt) licenses.
|
| 2377 | | - *
|
| 2378 | | - * http://docs.jquery.com/UI/Dialog
|
| 2379 | | - *
|
| 2380 | | - * Depends:
|
| 2381 | | - * ui.core.js
|
| 2382 | | - * ui.draggable.js
|
| 2383 | | - * ui.resizable.js
|
| 2384 | | - */
|
| 2385 | | -(function($) {
|
| 2386 | | -
|
| 2387 | | -var setDataSwitch = {
|
| 2388 | | - dragStart: "start.draggable",
|
| 2389 | | - drag: "drag.draggable",
|
| 2390 | | - dragStop: "stop.draggable",
|
| 2391 | | - maxHeight: "maxHeight.resizable",
|
| 2392 | | - minHeight: "minHeight.resizable",
|
| 2393 | | - maxWidth: "maxWidth.resizable",
|
| 2394 | | - minWidth: "minWidth.resizable",
|
| 2395 | | - resizeStart: "start.resizable",
|
| 2396 | | - resize: "drag.resizable",
|
| 2397 | | - resizeStop: "stop.resizable"
|
| 2398 | | - },
|
| 2399 | | -
|
| 2400 | | - uiDialogClasses =
|
| 2401 | | - 'ui-dialog ' +
|
| 2402 | | - 'ui-widget ' +
|
| 2403 | | - 'ui-widget-content ' +
|
| 2404 | | - 'ui-corner-all ';
|
| 2405 | | -
|
| 2406 | | -$.widget("ui.dialog", {
|
| 2407 | | -
|
| 2408 | | - _init: function() {
|
| 2409 | | - this.originalTitle = this.element.attr('title');
|
| 2410 | | -
|
| 2411 | | - var self = this,
|
| 2412 | | - options = this.options,
|
| 2413 | | -
|
| 2414 | | - title = options.title || this.originalTitle || ' ',
|
| 2415 | | - titleId = $.ui.dialog.getTitleId(this.element),
|
| 2416 | | -
|
| 2417 | | - uiDialog = (this.uiDialog = $('<div/>'))
|
| 2418 | | - .appendTo(document.body)
|
| 2419 | | - .hide()
|
| 2420 | | - .addClass(uiDialogClasses + options.dialogClass)
|
| 2421 | | - .css({
|
| 2422 | | - position: 'absolute',
|
| 2423 | | - overflow: 'hidden',
|
| 2424 | | - zIndex: options.zIndex
|
| 2425 | | - })
|
| 2426 | | - // setting tabIndex makes the div focusable
|
| 2427 | | - // setting outline to 0 prevents a border on focus in Mozilla
|
| 2428 | | - .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
|
| 2429 | | - (options.closeOnEscape && event.keyCode
|
| 2430 | | - && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
|
| 2431 | | - })
|
| 2432 | | - .attr({
|
| 2433 | | - role: 'dialog',
|
| 2434 | | - 'aria-labelledby': titleId
|
| 2435 | | - })
|
| 2436 | | - .mousedown(function(event) {
|
| 2437 | | - self.moveToTop(false, event);
|
| 2438 | | - }),
|
| 2439 | | -
|
| 2440 | | - uiDialogContent = this.element
|
| 2441 | | - .show()
|
| 2442 | | - .removeAttr('title')
|
| 2443 | | - .addClass(
|
| 2444 | | - 'ui-dialog-content ' +
|
| 2445 | | - 'ui-widget-content')
|
| 2446 | | - .appendTo(uiDialog),
|
| 2447 | | -
|
| 2448 | | - uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
|
| 2449 | | - .addClass(
|
| 2450 | | - 'ui-dialog-titlebar ' +
|
| 2451 | | - 'ui-widget-header ' +
|
| 2452 | | - 'ui-corner-all ' +
|
| 2453 | | - 'ui-helper-clearfix'
|
| 2454 | | - )
|
| 2455 | | - .prependTo(uiDialog),
|
| 2456 | | -
|
| 2457 | | - uiDialogTitlebarClose = $('<a href="#"/>')
|
| 2458 | | - .addClass(
|
| 2459 | | - 'ui-dialog-titlebar-close ' +
|
| 2460 | | - 'ui-corner-all'
|
| 2461 | | - )
|
| 2462 | | - .attr('role', 'button')
|
| 2463 | | - .hover(
|
| 2464 | | - function() {
|
| 2465 | | - uiDialogTitlebarClose.addClass('ui-state-hover');
|
| 2466 | | - },
|
| 2467 | | - function() {
|
| 2468 | | - uiDialogTitlebarClose.removeClass('ui-state-hover');
|
| 2469 | | - }
|
| 2470 | | - )
|
| 2471 | | - .focus(function() {
|
| 2472 | | - uiDialogTitlebarClose.addClass('ui-state-focus');
|
| 2473 | | - })
|
| 2474 | | - .blur(function() {
|
| 2475 | | - uiDialogTitlebarClose.removeClass('ui-state-focus');
|
| 2476 | | - })
|
| 2477 | | - .mousedown(function(ev) {
|
| 2478 | | - ev.stopPropagation();
|
| 2479 | | - })
|
| 2480 | | - .click(function(event) {
|
| 2481 | | - self.close(event);
|
| 2482 | | - return false;
|
| 2483 | | - })
|
| 2484 | | - .appendTo(uiDialogTitlebar),
|
| 2485 | | -
|
| 2486 | | - uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
|
| 2487 | | - .addClass(
|
| 2488 | | - 'ui-icon ' +
|
| 2489 | | - 'ui-icon-closethick'
|
| 2490 | | - )
|
| 2491 | | - .text(options.closeText)
|
| 2492 | | - .appendTo(uiDialogTitlebarClose),
|
| 2493 | | -
|
| 2494 | | - uiDialogTitle = $('<span/>')
|
| 2495 | | - .addClass('ui-dialog-title')
|
| 2496 | | - .attr('id', titleId)
|
| 2497 | | - .html(title)
|
| 2498 | | - .prependTo(uiDialogTitlebar);
|
| 2499 | | -
|
| 2500 | | - uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
|
| 2501 | | -
|
| 2502 | | - (options.draggable && $.fn.draggable && this._makeDraggable());
|
| 2503 | | - (options.resizable && $.fn.resizable && this._makeResizable());
|
| 2504 | | -
|
| 2505 | | - this._createButtons(options.buttons);
|
| 2506 | | - this._isOpen = false;
|
| 2507 | | -
|
| 2508 | | - (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
|
| 2509 | | - (options.autoOpen && this.open());
|
| 2510 | | -
|
| 2511 | | - },
|
| 2512 | | -
|
| 2513 | | - destroy: function() {
|
| 2514 | | - (this.overlay && this.overlay.destroy());
|
| 2515 | | - this.uiDialog.hide();
|
| 2516 | | - this.element
|
| 2517 | | - .unbind('.dialog')
|
| 2518 | | - .removeData('dialog')
|
| 2519 | | - .removeClass('ui-dialog-content ui-widget-content')
|
| 2520 | | - .hide().appendTo('body');
|
| 2521 | | - this.uiDialog.remove();
|
| 2522 | | -
|
| 2523 | | - (this.originalTitle && this.element.attr('title', this.originalTitle));
|
| 2524 | | - },
|
| 2525 | | -
|
| 2526 | | - close: function(event) {
|
| 2527 | | - var self = this;
|
| 2528 | | -
|
| 2529 | | - if (false === self._trigger('beforeclose', event)) {
|
| 2530 | | - return;
|
| 2531 | | - }
|
| 2532 | | -
|
| 2533 | | - (self.overlay && self.overlay.destroy());
|
| 2534 | | - self.uiDialog.unbind('keypress.ui-dialog');
|
| 2535 | | -
|
| 2536 | | - (self.options.hide
|
| 2537 | | - ? self.uiDialog.hide(self.options.hide, function() {
|
| 2538 | | - self._trigger('close', event);
|
| 2539 | | - })
|
| 2540 | | - : self.uiDialog.hide() && self._trigger('close', event));
|
| 2541 | | -
|
| 2542 | | - $.ui.dialog.overlay.resize();
|
| 2543 | | -
|
| 2544 | | - self._isOpen = false;
|
| 2545 | | -
|
| 2546 | | - // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
|
| 2547 | | - if (self.options.modal) {
|
| 2548 | | - var maxZ = 0;
|
| 2549 | | - $('.ui-dialog').each(function() {
|
| 2550 | | - if (this != self.uiDialog[0]) {
|
| 2551 | | - maxZ = Math.max(maxZ, $(this).css('z-index'));
|
| 2552 | | - }
|
| 2553 | | - });
|
| 2554 | | - $.ui.dialog.maxZ = maxZ;
|
| 2555 | | - }
|
| 2556 | | - },
|
| 2557 | | -
|
| 2558 | | - isOpen: function() {
|
| 2559 | | - return this._isOpen;
|
| 2560 | | - },
|
| 2561 | | -
|
| 2562 | | - // the force parameter allows us to move modal dialogs to their correct
|
| 2563 | | - // position on open
|
| 2564 | | - moveToTop: function(force, event) {
|
| 2565 | | -
|
| 2566 | | - if ((this.options.modal && !force)
|
| 2567 | | - || (!this.options.stack && !this.options.modal)) {
|
| 2568 | | - return this._trigger('focus', event);
|
| 2569 | | - }
|
| 2570 | | -
|
| 2571 | | - if (this.options.zIndex > $.ui.dialog.maxZ) {
|
| 2572 | | - $.ui.dialog.maxZ = this.options.zIndex;
|
| 2573 | | - }
|
| 2574 | | - (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
|
| 2575 | | -
|
| 2576 | | - //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
|
| 2577 | | - // http://ui.jquery.com/bugs/ticket/3193
|
| 2578 | | - var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
|
| 2579 | | - this.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
|
| 2580 | | - this.element.attr(saveScroll);
|
| 2581 | | - this._trigger('focus', event);
|
| 2582 | | - },
|
| 2583 | | -
|
| 2584 | | - open: function() {
|
| 2585 | | - if (this._isOpen) { return; }
|
| 2586 | | -
|
| 2587 | | - var options = this.options,
|
| 2588 | | - uiDialog = this.uiDialog;
|
| 2589 | | -
|
| 2590 | | - this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
|
| 2591 | | - (uiDialog.next().length && uiDialog.appendTo('body'));
|
| 2592 | | - this._size();
|
| 2593 | | - this._position(options.position);
|
| 2594 | | - uiDialog.show(options.show);
|
| 2595 | | - this.moveToTop(true);
|
| 2596 | | -
|
| 2597 | | - // prevent tabbing out of modal dialogs
|
| 2598 | | - (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
|
| 2599 | | - if (event.keyCode != $.ui.keyCode.TAB) {
|
| 2600 | | - return;
|
| 2601 | | - }
|
| 2602 | | -
|
| 2603 | | - var tabbables = $(':tabbable', this),
|
| 2604 | | - first = tabbables.filter(':first')[0],
|
| 2605 | | - last = tabbables.filter(':last')[0];
|
| 2606 | | -
|
| 2607 | | - if (event.target == last && !event.shiftKey) {
|
| 2608 | | - setTimeout(function() {
|
| 2609 | | - first.focus();
|
| 2610 | | - }, 1);
|
| 2611 | | - } else if (event.target == first && event.shiftKey) {
|
| 2612 | | - setTimeout(function() {
|
| 2613 | | - last.focus();
|
| 2614 | | - }, 1);
|
| 2615 | | - }
|
| 2616 | | - }));
|
| 2617 | | -
|
| 2618 | | - // set focus to the first tabbable element in the content area or the first button
|
| 2619 | | - // if there are no tabbable elements, set focus on the dialog itself
|
| 2620 | | - $([])
|
| 2621 | | - .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
|
| 2622 | | - .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
|
| 2623 | | - .add(uiDialog)
|
| 2624 | | - .filter(':first')
|
| 2625 | | - .focus();
|
| 2626 | | -
|
| 2627 | | - this._trigger('open');
|
| 2628 | | - this._isOpen = true;
|
| 2629 | | - },
|
| 2630 | | -
|
| 2631 | | - _createButtons: function(buttons) {
|
| 2632 | | - var self = this,
|
| 2633 | | - hasButtons = false,
|
| 2634 | | - uiDialogButtonPane = $('<div></div>')
|
| 2635 | | - .addClass(
|
| 2636 | | - 'ui-dialog-buttonpane ' +
|
| 2637 | | - 'ui-widget-content ' +
|
| 2638 | | - 'ui-helper-clearfix'
|
| 2639 | | - );
|
| 2640 | | -
|
| 2641 | | - // if we already have a button pane, remove it
|
| 2642 | | - this.uiDialog.find('.ui-dialog-buttonpane').remove();
|
| 2643 | | -
|
| 2644 | | - (typeof buttons == 'object' && buttons !== null &&
|
| 2645 | | - $.each(buttons, function() { return !(hasButtons = true); }));
|
| 2646 | | - if (hasButtons) {
|
| 2647 | | - $.each(buttons, function(name, fn) {
|
| 2648 | | - $('<button type="button"></button>')
|
| 2649 | | - .addClass(
|
| 2650 | | - 'ui-state-default ' +
|
| 2651 | | - 'ui-corner-all'
|
| 2652 | | - )
|
| 2653 | | - .text(name)
|
| 2654 | | - .click(function() { fn.apply(self.element[0], arguments); })
|
| 2655 | | - .hover(
|
| 2656 | | - function() {
|
| 2657 | | - $(this).addClass('ui-state-hover');
|
| 2658 | | - },
|
| 2659 | | - function() {
|
| 2660 | | - $(this).removeClass('ui-state-hover');
|
| 2661 | | - }
|
| 2662 | | - )
|
| 2663 | | - .focus(function() {
|
| 2664 | | - $(this).addClass('ui-state-focus');
|
| 2665 | | - })
|
| 2666 | | - .blur(function() {
|
| 2667 | | - $(this).removeClass('ui-state-focus');
|
| 2668 | | - })
|
| 2669 | | - .appendTo(uiDialogButtonPane);
|
| 2670 | | - });
|
| 2671 | | - uiDialogButtonPane.appendTo(this.uiDialog);
|
| 2672 | | - }
|
| 2673 | | - },
|
| 2674 | | -
|
| 2675 | | - _makeDraggable: function() {
|
| 2676 | | - var self = this,
|
| 2677 | | - options = this.options,
|
| 2678 | | - heightBeforeDrag;
|
| 2679 | | -
|
| 2680 | | - this.uiDialog.draggable({
|
| 2681 | | - cancel: '.ui-dialog-content',
|
| 2682 | | - handle: '.ui-dialog-titlebar',
|
| 2683 | | - containment: 'document',
|
| 2684 | | - start: function() {
|
| 2685 | | - heightBeforeDrag = options.height;
|
| 2686 | | - $(this).height($(this).height()).addClass("ui-dialog-dragging");
|
| 2687 | | - (options.dragStart && options.dragStart.apply(self.element[0], arguments));
|
| 2688 | | - },
|
| 2689 | | - drag: function() {
|
| 2690 | | - (options.drag && options.drag.apply(self.element[0], arguments));
|
| 2691 | | - },
|
| 2692 | | - stop: function() {
|
| 2693 | | - $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
|
| 2694 | | - (options.dragStop && options.dragStop.apply(self.element[0], arguments));
|
| 2695 | | - $.ui.dialog.overlay.resize();
|
| 2696 | | - }
|
| 2697 | | - });
|
| 2698 | | - },
|
| 2699 | | -
|
| 2700 | | - _makeResizable: function(handles) {
|
| 2701 | | - handles = (handles === undefined ? this.options.resizable : handles);
|
| 2702 | | - var self = this,
|
| 2703 | | - options = this.options,
|
| 2704 | | - resizeHandles = typeof handles == 'string'
|
| 2705 | | - ? handles
|
| 2706 | | - : 'n,e,s,w,se,sw,ne,nw';
|
| 2707 | | -
|
| 2708 | | - this.uiDialog.resizable({
|
| 2709 | | - cancel: '.ui-dialog-content',
|
| 2710 | | - alsoResize: this.element,
|
| 2711 | | - maxWidth: options.maxWidth,
|
| 2712 | | - maxHeight: options.maxHeight,
|
| 2713 | | - minWidth: options.minWidth,
|
| 2714 | | - minHeight: options.minHeight,
|
| 2715 | | - start: function() {
|
| 2716 | | - $(this).addClass("ui-dialog-resizing");
|
| 2717 | | - (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
|
| 2718 | | - },
|
| 2719 | | - resize: function() {
|
| 2720 | | - (options.resize && options.resize.apply(self.element[0], arguments));
|
| 2721 | | - },
|
| 2722 | | - handles: resizeHandles,
|
| 2723 | | - stop: function() {
|
| 2724 | | - $(this).removeClass("ui-dialog-resizing");
|
| 2725 | | - options.height = $(this).height();
|
| 2726 | | - options.width = $(this).width();
|
| 2727 | | - (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
|
| 2728 | | - $.ui.dialog.overlay.resize();
|
| 2729 | | - }
|
| 2730 | | - })
|
| 2731 | | - .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
|
| 2732 | | - },
|
| 2733 | | -
|
| 2734 | | - _position: function(pos) {
|
| 2735 | | - var wnd = $(window), doc = $(document),
|
| 2736 | | - pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
|
| 2737 | | - minTop = pTop;
|
| 2738 | | -
|
| 2739 | | - if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
|
| 2740 | | - pos = [
|
| 2741 | | - pos == 'right' || pos == 'left' ? pos : 'center',
|
| 2742 | | - pos == 'top' || pos == 'bottom' ? pos : 'middle'
|
| 2743 | | - ];
|
| 2744 | | - }
|
| 2745 | | - if (pos.constructor != Array) {
|
| 2746 | | - pos = ['center', 'middle'];
|
| 2747 | | - }
|
| 2748 | | - if (pos[0].constructor == Number) {
|
| 2749 | | - pLeft += pos[0];
|
| 2750 | | - } else {
|
| 2751 | | - switch (pos[0]) {
|
| 2752 | | - case 'left':
|
| 2753 | | - pLeft += 0;
|
| 2754 | | - break;
|
| 2755 | | - case 'right':
|
| 2756 | | - pLeft += wnd.width() - this.uiDialog.outerWidth();
|
| 2757 | | - break;
|
| 2758 | | - default:
|
| 2759 | | - case 'center':
|
| 2760 | | - pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
|
| 2761 | | - }
|
| 2762 | | - }
|
| 2763 | | - if (pos[1].constructor == Number) {
|
| 2764 | | - pTop += pos[1];
|
| 2765 | | - } else {
|
| 2766 | | - switch (pos[1]) {
|
| 2767 | | - case 'top':
|
| 2768 | | - pTop += 0;
|
| 2769 | | - break;
|
| 2770 | | - case 'bottom':
|
| 2771 | | - pTop += wnd.height() - this.uiDialog.outerHeight();
|
| 2772 | | - break;
|
| 2773 | | - default:
|
| 2774 | | - case 'middle':
|
| 2775 | | - pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
|
| 2776 | | - }
|
| 2777 | | - }
|
| 2778 | | -
|
| 2779 | | - // prevent the dialog from being too high (make sure the titlebar
|
| 2780 | | - // is accessible)
|
| 2781 | | - pTop = Math.max(pTop, minTop);
|
| 2782 | | - this.uiDialog.css({top: pTop, left: pLeft});
|
| 2783 | | - },
|
| 2784 | | -
|
| 2785 | | - _setData: function(key, value){
|
| 2786 | | - (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
|
| 2787 | | - switch (key) {
|
| 2788 | | - case "buttons":
|
| 2789 | | - this._createButtons(value);
|
| 2790 | | - break;
|
| 2791 | | - case "closeText":
|
| 2792 | | - this.uiDialogTitlebarCloseText.text(value);
|
| 2793 | | - break;
|
| 2794 | | - case "dialogClass":
|
| 2795 | | - this.uiDialog
|
| 2796 | | - .removeClass(this.options.dialogClass)
|
| 2797 | | - .addClass(uiDialogClasses + value);
|
| 2798 | | - break;
|
| 2799 | | - case "draggable":
|
| 2800 | | - (value
|
| 2801 | | - ? this._makeDraggable()
|
| 2802 | | - : this.uiDialog.draggable('destroy'));
|
| 2803 | | - break;
|
| 2804 | | - case "height":
|
| 2805 | | - this.uiDialog.height(value);
|
| 2806 | | - break;
|
| 2807 | | - case "position":
|
| 2808 | | - this._position(value);
|
| 2809 | | - break;
|
| 2810 | | - case "resizable":
|
| 2811 | | - var uiDialog = this.uiDialog,
|
| 2812 | | - isResizable = this.uiDialog.is(':data(resizable)');
|
| 2813 | | -
|
| 2814 | | - // currently resizable, becoming non-resizable
|
| 2815 | | - (isResizable && !value && uiDialog.resizable('destroy'));
|
| 2816 | | -
|
| 2817 | | - // currently resizable, changing handles
|
| 2818 | | - (isResizable && typeof value == 'string' &&
|
| 2819 | | - uiDialog.resizable('option', 'handles', value));
|
| 2820 | | -
|
| 2821 | | - // currently non-resizable, becoming resizable
|
| 2822 | | - (isResizable || this._makeResizable(value));
|
| 2823 | | - break;
|
| 2824 | | - case "title":
|
| 2825 | | - $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' ');
|
| 2826 | | - break;
|
| 2827 | | - case "width":
|
| 2828 | | - this.uiDialog.width(value);
|
| 2829 | | - break;
|
| 2830 | | - }
|
| 2831 | | -
|
| 2832 | | - $.widget.prototype._setData.apply(this, arguments);
|
| 2833 | | - },
|
| 2834 | | -
|
| 2835 | | - _size: function() {
|
| 2836 | | - /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
|
| 2837 | | - * divs will both have width and height set, so we need to reset them
|
| 2838 | | - */
|
| 2839 | | - var options = this.options;
|
| 2840 | | -
|
| 2841 | | - // reset content sizing
|
| 2842 | | - this.element.css({
|
| 2843 | | - height: 0,
|
| 2844 | | - minHeight: 0,
|
| 2845 | | - width: 'auto'
|
| 2846 | | - });
|
| 2847 | | -
|
| 2848 | | - // reset wrapper sizing
|
| 2849 | | - // determine the height of all the non-content elements
|
| 2850 | | - var nonContentHeight = this.uiDialog.css({
|
| 2851 | | - height: 'auto',
|
| 2852 | | - width: options.width
|
| 2853 | | - })
|
| 2854 | | - .height();
|
| 2855 | | -
|
| 2856 | | - this.element
|
| 2857 | | - .css({
|
| 2858 | | - minHeight: Math.max(options.minHeight - nonContentHeight, 0),
|
| 2859 | | - height: options.height == 'auto'
|
| 2860 | | - ? 'auto'
|
| 2861 | | - : Math.max(options.height - nonContentHeight, 0)
|
| 2862 | | - });
|
| 2863 | | - }
|
| 2864 | | -});
|
| 2865 | | -
|
| 2866 | | -$.extend($.ui.dialog, {
|
| 2867 | | - version: "1.7.2",
|
| 2868 | | - defaults: {
|
| 2869 | | - autoOpen: true,
|
| 2870 | | - bgiframe: false,
|
| 2871 | | - buttons: {},
|
| 2872 | | - closeOnEscape: true,
|
| 2873 | | - closeText: 'close',
|
| 2874 | | - dialogClass: '',
|
| 2875 | | - draggable: true,
|
| 2876 | | - hide: null,
|
| 2877 | | - height: 'auto',
|
| 2878 | | - maxHeight: false,
|
| 2879 | | - maxWidth: false,
|
| 2880 | | - minHeight: 150,
|
| 2881 | | - minWidth: 150,
|
| 2882 | | - modal: false,
|
| 2883 | | - position: 'center',
|
| 2884 | | - resizable: true,
|
| 2885 | | - show: null,
|
| 2886 | | - stack: true,
|
| 2887 | | - title: '',
|
| 2888 | | - width: 300,
|
| 2889 | | - zIndex: 1000
|
| 2890 | | - },
|
| 2891 | | -
|
| 2892 | | - getter: 'isOpen',
|
| 2893 | | -
|
| 2894 | | - uuid: 0,
|
| 2895 | | - maxZ: 0,
|
| 2896 | | -
|
| 2897 | | - getTitleId: function($el) {
|
| 2898 | | - return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
|
| 2899 | | - },
|
| 2900 | | -
|
| 2901 | | - overlay: function(dialog) {
|
| 2902 | | - this.$el = $.ui.dialog.overlay.create(dialog);
|
| 2903 | | - }
|
| 2904 | | -});
|
| 2905 | | -
|
| 2906 | | -$.extend($.ui.dialog.overlay, {
|
| 2907 | | - instances: [],
|
| 2908 | | - maxZ: 0,
|
| 2909 | | - events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
|
| 2910 | | - function(event) { return event + '.dialog-overlay'; }).join(' '),
|
| 2911 | | - create: function(dialog) {
|
| 2912 | | - if (this.instances.length === 0) {
|
| 2913 | | - // prevent use of anchors and inputs
|
| 2914 | | - // we use a setTimeout in case the overlay is created from an
|
| 2915 | | - // event that we're going to be cancelling (see #2804)
|
| 2916 | | - setTimeout(function() {
|
| 2917 | | - // handle $(el).dialog().dialog('close') (see #4065)
|
| 2918 | | - if ($.ui.dialog.overlay.instances.length) {
|
| 2919 | | - $(document).bind($.ui.dialog.overlay.events, function(event) {
|
| 2920 | | - var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
|
| 2921 | | - return (dialogZ > $.ui.dialog.overlay.maxZ);
|
| 2922 | | - });
|
| 2923 | | - }
|
| 2924 | | - }, 1);
|
| 2925 | | -
|
| 2926 | | - // allow closing by pressing the escape key
|
| 2927 | | - $(document).bind('keydown.dialog-overlay', function(event) {
|
| 2928 | | - (dialog.options.closeOnEscape && event.keyCode
|
| 2929 | | - && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
|
| 2930 | | - });
|
| 2931 | | -
|
| 2932 | | - // handle window resize
|
| 2933 | | - $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
|
| 2934 | | - }
|
| 2935 | | -
|
| 2936 | | - var $el = $('<div></div>').appendTo(document.body)
|
| 2937 | | - .addClass('ui-widget-overlay').css({
|
| 2938 | | - width: this.width(),
|
| 2939 | | - height: this.height()
|
| 2940 | | - });
|
| 2941 | | -
|
| 2942 | | - (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
|
| 2943 | | -
|
| 2944 | | - this.instances.push($el);
|
| 2945 | | - return $el;
|
| 2946 | | - },
|
| 2947 | | -
|
| 2948 | | - destroy: function($el) {
|
| 2949 | | - this.instances.splice($.inArray(this.instances, $el), 1);
|
| 2950 | | -
|
| 2951 | | - if (this.instances.length === 0) {
|
| 2952 | | - $([document, window]).unbind('.dialog-overlay');
|
| 2953 | | - }
|
| 2954 | | -
|
| 2955 | | - $el.remove();
|
| 2956 | | -
|
| 2957 | | - // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
|
| 2958 | | - var maxZ = 0;
|
| 2959 | | - $.each(this.instances, function() {
|
| 2960 | | - maxZ = Math.max(maxZ, this.css('z-index'));
|
| 2961 | | - });
|
| 2962 | | - this.maxZ = maxZ;
|
| 2963 | | - },
|
| 2964 | | -
|
| 2965 | | - height: function() {
|
| 2966 | | - // handle IE 6
|
| 2967 | | - if ($.browser.msie && $.browser.version < 7) {
|
| 2968 | | - var scrollHeight = Math.max(
|
| 2969 | | - document.documentElement.scrollHeight,
|
| 2970 | | - document.body.scrollHeight
|
| 2971 | | - );
|
| 2972 | | - var offsetHeight = Math.max(
|
| 2973 | | - document.documentElement.offsetHeight,
|
| 2974 | | - document.body.offsetHeight
|
| 2975 | | - );
|
| 2976 | | -
|
| 2977 | | - if (scrollHeight < offsetHeight) {
|
| 2978 | | - return $(window).height() + 'px';
|
| 2979 | | - } else {
|
| 2980 | | - return scrollHeight + 'px';
|
| 2981 | | - }
|
| 2982 | | - // handle "good" browsers
|
| 2983 | | - } else {
|
| 2984 | | - return $(document).height() + 'px';
|
| 2985 | | - }
|
| 2986 | | - },
|
| 2987 | | -
|
| 2988 | | - width: function() {
|
| 2989 | | - // handle IE 6
|
| 2990 | | - if ($.browser.msie && $.browser.version < 7) {
|
| 2991 | | - var scrollWidth = Math.max(
|
| 2992 | | - document.documentElement.scrollWidth,
|
| 2993 | | - document.body.scrollWidth
|
| 2994 | | - );
|
| 2995 | | - var offsetWidth = Math.max(
|
| 2996 | | - document.documentElement.offsetWidth,
|
| 2997 | | - document.body.offsetWidth
|
| 2998 | | - );
|
| 2999 | | -
|
| 3000 | | - if (scrollWidth < offsetWidth) {
|
| 3001 | | - return $(window).width() + 'px';
|
| 3002 | | - } else {
|
| 3003 | | - return scrollWidth + 'px';
|
| 3004 | | - }
|
| 3005 | | - // handle "good" browsers
|
| 3006 | | - } else {
|
| 3007 | | - return $(document).width() + 'px';
|
| 3008 | | - }
|
| 3009 | | - },
|
| 3010 | | -
|
| 3011 | | - resize: function() {
|
| 3012 | | - /* If the dialog is draggable and the user drags it past the
|
| 3013 | | - * right edge of the window, the document becomes wider so we
|
| 3014 | | - * need to stretch the overlay. If the user then drags the
|
| 3015 | | - * dialog back to the left, the document will become narrower,
|
| 3016 | | - * so we need to shrink the overlay to the appropriate size.
|
| 3017 | | - * This is handled by shrinking the overlay before setting it
|
| 3018 | | - * to the full document size.
|
| 3019 | | - */
|
| 3020 | | - var $overlays = $([]);
|
| 3021 | | - $.each($.ui.dialog.overlay.instances, function() {
|
| 3022 | | - $overlays = $overlays.add(this);
|
| 3023 | | - });
|
| 3024 | | -
|
| 3025 | | - $overlays.css({
|
| 3026 | | - width: 0,
|
| 3027 | | - height: 0
|
| 3028 | | - }).css({
|
| 3029 | | - width: $.ui.dialog.overlay.width(),
|
| 3030 | | - height: $.ui.dialog.overlay.height()
|
| 3031 | | - });
|
| 3032 | | - }
|
| 3033 | | -});
|
| 3034 | | -
|
| 3035 | | -$.extend($.ui.dialog.overlay.prototype, {
|
| 3036 | | - destroy: function() {
|
| 3037 | | - $.ui.dialog.overlay.destroy(this.$el);
|
| 3038 | | - }
|
| 3039 | | -});
|
| 3040 | | -
|
| 3041 | | -})(jQuery);
|
| 3042 | | -/*
|
| 3043 | | - * jQuery UI Tabs 1.7.2
|
| 3044 | | - *
|
| 3045 | | - * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
|
| 3046 | | - * Dual licensed under the MIT (MIT-LICENSE.txt)
|
| 3047 | | - * and GPL (GPL-LICENSE.txt) licenses.
|
| 3048 | | - *
|
| 3049 | | - * http://docs.jquery.com/UI/Tabs
|
| 3050 | | - *
|
| 3051 | | - * Depends:
|
| 3052 | | - * ui.core.js
|
| 3053 | | - */
|
| 3054 | | -(function($) {
|
| 3055 | | -
|
| 3056 | | -$.widget("ui.tabs", {
|
| 3057 | | -
|
| 3058 | | - _init: function() {
|
| 3059 | | - if (this.options.deselectable !== undefined) {
|
| 3060 | | - this.options.collapsible = this.options.deselectable;
|
| 3061 | | - }
|
| 3062 | | - this._tabify(true);
|
| 3063 | | - },
|
| 3064 | | -
|
| 3065 | | - _setData: function(key, value) {
|
| 3066 | | - if (key == 'selected') {
|
| 3067 | | - if (this.options.collapsible && value == this.options.selected) {
|
| 3068 | | - return;
|
| 3069 | | - }
|
| 3070 | | - this.select(value);
|
| 3071 | | - }
|
| 3072 | | - else {
|
| 3073 | | - this.options[key] = value;
|
| 3074 | | - if (key == 'deselectable') {
|
| 3075 | | - this.options.collapsible = value;
|
| 3076 | | - }
|
| 3077 | | - this._tabify();
|
| 3078 | | - }
|
| 3079 | | - },
|
| 3080 | | -
|
| 3081 | | - _tabId: function(a) {
|
| 3082 | | - return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
|
| 3083 | | - this.options.idPrefix + $.data(a);
|
| 3084 | | - },
|
| 3085 | | -
|
| 3086 | | - _sanitizeSelector: function(hash) {
|
| 3087 | | - return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
|
| 3088 | | - },
|
| 3089 | | -
|
| 3090 | | - _cookie: function() {
|
| 3091 | | - var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
|
| 3092 | | - return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
|
| 3093 | | - },
|
| 3094 | | -
|
| 3095 | | - _ui: function(tab, panel) {
|
| 3096 | | - return {
|
| 3097 | | - tab: tab,
|
| 3098 | | - panel: panel,
|
| 3099 | | - index: this.anchors.index(tab)
|
| 3100 | | - };
|
| 3101 | | - },
|
| 3102 | | -
|
| 3103 | | - _cleanup: function() {
|
| 3104 | | - // restore all former loading tabs labels
|
| 3105 | | - this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
|
| 3106 | | - .find('span:data(label.tabs)')
|
| 3107 | | - .each(function() {
|
| 3108 | | - var el = $(this);
|
| 3109 | | - el.html(el.data('label.tabs')).removeData('label.tabs');
|
| 3110 | | - });
|
| 3111 | | - },
|
| 3112 | | -
|
| 3113 | | - _tabify: function(init) {
|
| 3114 | | -
|
| 3115 | | - this.list = this.element.children('ul:first');
|
| 3116 | | - this.lis = $('li:has(a[href])', this.list);
|
| 3117 | | - this.anchors = this.lis.map(function() { return $('a', this)[0]; });
|
| 3118 | | - this.panels = $([]);
|
| 3119 | | -
|
| 3120 | | - var self = this, o = this.options;
|
| 3121 | | -
|
| 3122 | | - var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
|
| 3123 | | - this.anchors.each(function(i, a) {
|
| 3124 | | - var href = $(a).attr('href');
|
| 3125 | | -
|
| 3126 | | - // For dynamically created HTML that contains a hash as href IE < 8 expands
|
| 3127 | | - // such href to the full page url with hash and then misinterprets tab as ajax.
|
| 3128 | | - // Same consideration applies for an added tab with a fragment identifier
|
| 3129 | | - // since a[href=#fragment-identifier] does unexpectedly not match.
|
| 3130 | | - // Thus normalize href attribute...
|
| 3131 | | - var hrefBase = href.split('#')[0], baseEl;
|
| 3132 | | - if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
|
| 3133 | | - (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
|
| 3134 | | - href = a.hash;
|
| 3135 | | - a.href = href;
|
| 3136 | | - }
|
| 3137 | | -
|
| 3138 | | - // inline tab
|
| 3139 | | - if (fragmentId.test(href)) {
|
| 3140 | | - self.panels = self.panels.add(self._sanitizeSelector(href));
|
| 3141 | | - }
|
| 3142 | | -
|
| 3143 | | - // remote tab
|
| 3144 | | - else if (href != '#') { // prevent loading the page itself if href is just "#"
|
| 3145 | | - $.data(a, 'href.tabs', href); // required for restore on destroy
|
| 3146 | | -
|
| 3147 | | - // TODO until #3808 is fixed strip fragment identifier from url
|
| 3148 | | - // (IE fails to load from such url)
|
| 3149 | | - $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
|
| 3150 | | -
|
| 3151 | | - var id = self._tabId(a);
|
| 3152 | | - a.href = '#' + id;
|
| 3153 | | - var $panel = $('#' + id);
|
| 3154 | | - if (!$panel.length) {
|
| 3155 | | - $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
|
| 3156 | | - .insertAfter(self.panels[i - 1] || self.list);
|
| 3157 | | - $panel.data('destroy.tabs', true);
|
| 3158 | | - }
|
| 3159 | | - self.panels = self.panels.add($panel);
|
| 3160 | | - }
|
| 3161 | | -
|
| 3162 | | - // invalid tab href
|
| 3163 | | - else {
|
| 3164 | | - o.disabled.push(i);
|
| 3165 | | - }
|
| 3166 | | - });
|
| 3167 | | -
|
| 3168 | | - // initialization from scratch
|
| 3169 | | - if (init) {
|
| 3170 | | -
|
| 3171 | | - // attach necessary classes for styling
|
| 3172 | | - this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
|
| 3173 | | - this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
|
| 3174 | | - this.lis.addClass('ui-state-default ui-corner-top');
|
| 3175 | | - this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
|
| 3176 | | -
|
| 3177 | | - // Selected tab
|
| 3178 | | - // use "selected" option or try to retrieve:
|
| 3179 | | - // 1. from fragment identifier in url
|
| 3180 | | - // 2. from cookie
|
| 3181 | | - // 3. from selected class attribute on <li>
|
| 3182 | | - if (o.selected === undefined) {
|
| 3183 | | - if (location.hash) {
|
| 3184 | | - this.anchors.each(function(i, a) {
|
| 3185 | | - if (a.hash == location.hash) {
|
| 3186 | | - o.selected = i;
|
| 3187 | | - return false; // break
|
| 3188 | | - }
|
| 3189 | | - });
|
| 3190 | | - }
|
| 3191 | | - if (typeof o.selected != 'number' && o.cookie) {
|
| 3192 | | - o.selected = parseInt(self._cookie(), 10);
|
| 3193 | | - }
|
| 3194 | | - if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
|
| 3195 | | - o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
|
| 3196 | | - }
|
| 3197 | | - o.selected = o.selected || 0;
|
| 3198 | | - }
|
| 3199 | | - else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
|
| 3200 | | - o.selected = -1;
|
| 3201 | | - }
|
| 3202 | | -
|
| 3203 | | - // sanity check - default to first tab...
|
| 3204 | | - o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
|
| 3205 | | -
|
| 3206 | | - // Take disabling tabs via class attribute from HTML
|
| 3207 | | - // into account and update option properly.
|
| 3208 | | - // A selected tab cannot become disabled.
|
| 3209 | | - o.disabled = $.unique(o.disabled.concat(
|
| 3210 | | - $.map(this.lis.filter('.ui-state-disabled'),
|
| 3211 | | - function(n, i) { return self.lis.index(n); } )
|
| 3212 | | - )).sort();
|
| 3213 | | -
|
| 3214 | | - if ($.inArray(o.selected, o.disabled) != -1) {
|
| 3215 | | - o.disabled.splice($.inArray(o.selected, o.disabled), 1);
|
| 3216 | | - }
|
| 3217 | | -
|
| 3218 | | - // highlight selected tab
|
| 3219 | | - this.panels.addClass('ui-tabs-hide');
|
| 3220 | | - this.lis.removeClass('ui-tabs-selected ui-state-active');
|
| 3221 | | - if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
|
| 3222 | | - this.panels.eq(o.selected).removeClass('ui-tabs-hide');
|
| 3223 | | - this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
|
| 3224 | | -
|
| 3225 | | - // seems to be expected behavior that the show callback is fired
|
| 3226 | | - self.element.queue("tabs", function() {
|
| 3227 | | - self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
|
| 3228 | | - });
|
| 3229 | | -
|
| 3230 | | - this.load(o.selected);
|
| 3231 | | - }
|
| 3232 | | -
|
| 3233 | | - // clean up to avoid memory leaks in certain versions of IE 6
|
| 3234 | | - $(window).bind('unload', function() {
|
| 3235 | | - self.lis.add(self.anchors).unbind('.tabs');
|
| 3236 | | - self.lis = self.anchors = self.panels = null;
|
| 3237 | | - });
|
| 3238 | | -
|
| 3239 | | - }
|
| 3240 | | - // update selected after add/remove
|
| 3241 | | - else {
|
| 3242 | | - o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
|
| 3243 | | - }
|
| 3244 | | -
|
| 3245 | | - // update collapsible
|
| 3246 | | - this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
|
| 3247 | | -
|
| 3248 | | - // set or update cookie after init and add/remove respectively
|
| 3249 | | - if (o.cookie) {
|
| 3250 | | - this._cookie(o.selected, o.cookie);
|
| 3251 | | - }
|
| 3252 | | -
|
| 3253 | | - // disable tabs
|
| 3254 | | - for (var i = 0, li; (li = this.lis[i]); i++) {
|
| 3255 | | - $(li)[$.inArray(i, o.disabled) != -1 &&
|
| 3256 | | - !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
|
| 3257 | | - }
|
| 3258 | | -
|
| 3259 | | - // reset cache if switching from cached to not cached
|
| 3260 | | - if (o.cache === false) {
|
| 3261 | | - this.anchors.removeData('cache.tabs');
|
| 3262 | | - }
|
| 3263 | | -
|
| 3264 | | - // remove all handlers before, tabify may run on existing tabs after add or option change
|
| 3265 | | - this.lis.add(this.anchors).unbind('.tabs');
|
| 3266 | | -
|
| 3267 | | - if (o.event != 'mouseover') {
|
| 3268 | | - var addState = function(state, el) {
|
| 3269 | | - if (el.is(':not(.ui-state-disabled)')) {
|
| 3270 | | - el.addClass('ui-state-' + state);
|
| 3271 | | - }
|
| 3272 | | - };
|
| 3273 | | - var removeState = function(state, el) {
|
| 3274 | | - el.removeClass('ui-state-' + state);
|
| 3275 | | - };
|
| 3276 | | - this.lis.bind('mouseover.tabs', function() {
|
| 3277 | | - addState('hover', $(this));
|
| 3278 | | - });
|
| 3279 | | - this.lis.bind('mouseout.tabs', function() {
|
| 3280 | | - removeState('hover', $(this));
|
| 3281 | | - });
|
| 3282 | | - this.anchors.bind('focus.tabs', function() {
|
| 3283 | | - addState('focus', $(this).closest('li'));
|
| 3284 | | - });
|
| 3285 | | - this.anchors.bind('blur.tabs', function() {
|
| 3286 | | - removeState('focus', $(this).closest('li'));
|
| 3287 | | - });
|
| 3288 | | - }
|
| 3289 | | -
|
| 3290 | | - // set up animations
|
| 3291 | | - var hideFx, showFx;
|
| 3292 | | - if (o.fx) {
|
| 3293 | | - if ($.isArray(o.fx)) {
|
| 3294 | | - hideFx = o.fx[0];
|
| 3295 | | - showFx = o.fx[1];
|
| 3296 | | - }
|
| 3297 | | - else {
|
| 3298 | | - hideFx = showFx = o.fx;
|
| 3299 | | - }
|
| 3300 | | - }
|
| 3301 | | -
|
| 3302 | | - // Reset certain styles left over from animation
|
| 3303 | | - // and prevent IE's ClearType bug...
|
| 3304 | | - function resetStyle($el, fx) {
|
| 3305 | | - $el.css({ display: '' });
|
| 3306 | | - if ($.browser.msie && fx.opacity) {
|
| 3307 | | - $el[0].style.removeAttribute('filter');
|
| 3308 | | - }
|
| 3309 | | - }
|
| 3310 | | -
|
| 3311 | | - // Show a tab...
|
| 3312 | | - var showTab = showFx ?
|
| 3313 | | - function(clicked, $show) {
|
| 3314 | | - $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
|
| 3315 | | - $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
|
| 3316 | | - .animate(showFx, showFx.duration || 'normal', function() {
|
| 3317 | | - resetStyle($show, showFx);
|
| 3318 | | - self._trigger('show', null, self._ui(clicked, $show[0]));
|
| 3319 | | - });
|
| 3320 | | - } :
|
| 3321 | | - function(clicked, $show) {
|
| 3322 | | - $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
|
| 3323 | | - $show.removeClass('ui-tabs-hide');
|
| 3324 | | - self._trigger('show', null, self._ui(clicked, $show[0]));
|
| 3325 | | - };
|
| 3326 | | -
|
| 3327 | | - // Hide a tab, $show is optional...
|
| 3328 | | - var hideTab = hideFx ?
|
| 3329 | | - function(clicked, $hide) {
|
| 3330 | | - $hide.animate(hideFx, hideFx.duration || 'normal', function() {
|
| 3331 | | - self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
|
| 3332 | | - $hide.addClass('ui-tabs-hide');
|
| 3333 | | - resetStyle($hide, hideFx);
|
| 3334 | | - self.element.dequeue("tabs");
|
| 3335 | | - });
|
| 3336 | | - } :
|
| 3337 | | - function(clicked, $hide, $show) {
|
| 3338 | | - self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
|
| 3339 | | - $hide.addClass('ui-tabs-hide');
|
| 3340 | | - self.element.dequeue("tabs");
|
| 3341 | | - };
|
| 3342 | | -
|
| 3343 | | - // attach tab event handler, unbind to avoid duplicates from former tabifying...
|
| 3344 | | - this.anchors.bind(o.event + '.tabs', function() {
|
| 3345 | | - var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
|
| 3346 | | - $show = $(self._sanitizeSelector(this.hash));
|
| 3347 | | -
|
| 3348 | | - // If tab is already selected and not collapsible or tab disabled or
|
| 3349 | | - // or is already loading or click callback returns false stop here.
|
| 3350 | | - // Check if click handler returns false last so that it is not executed
|
| 3351 | | - // for a disabled or loading tab!
|
| 3352 | | - if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
|
| 3353 | | - $li.hasClass('ui-state-disabled') ||
|
| 3354 | | - $li.hasClass('ui-state-processing') ||
|
| 3355 | | - self._trigger('select', null, self._ui(this, $show[0])) === false) {
|
| 3356 | | - this.blur();
|
| 3357 | | - return false;
|
| 3358 | | - }
|
| 3359 | | -
|
| 3360 | | - o.selected = self.anchors.index(this);
|
| 3361 | | -
|
| 3362 | | - self.abort();
|
| 3363 | | -
|
| 3364 | | - // if tab may be closed
|
| 3365 | | - if (o.collapsible) {
|
| 3366 | | - if ($li.hasClass('ui-tabs-selected')) {
|
| 3367 | | - o.selected = -1;
|
| 3368 | | -
|
| 3369 | | - if (o.cookie) {
|
| 3370 | | - self._cookie(o.selected, o.cookie);
|
| 3371 | | - }
|
| 3372 | | -
|
| 3373 | | - self.element.queue("tabs", function() {
|
| 3374 | | - hideTab(el, $hide);
|
| 3375 | | - }).dequeue("tabs");
|
| 3376 | | -
|
| 3377 | | - this.blur();
|
| 3378 | | - return false;
|
| 3379 | | - }
|
| 3380 | | - else if (!$hide.length) {
|
| 3381 | | - if (o.cookie) {
|
| 3382 | | - self._cookie(o.selected, o.cookie);
|
| 3383 | | - }
|
| 3384 | | -
|
| 3385 | | - self.element.queue("tabs", function() {
|
| 3386 | | - showTab(el, $show);
|
| 3387 | | - });
|
| 3388 | | -
|
| 3389 | | - self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
|
| 3390 | | -
|
| 3391 | | - this.blur();
|
| 3392 | | - return false;
|
| 3393 | | - }
|
| 3394 | | - }
|
| 3395 | | -
|
| 3396 | | - if (o.cookie) {
|
| 3397 | | - self._cookie(o.selected, o.cookie);
|
| 3398 | | - }
|
| 3399 | | -
|
| 3400 | | - // show new tab
|
| 3401 | | - if ($show.length) {
|
| 3402 | | - if ($hide.length) {
|
| 3403 | | - self.element.queue("tabs", function() {
|
| 3404 | | - hideTab(el, $hide);
|
| 3405 | | - });
|
| 3406 | | - }
|
| 3407 | | - self.element.queue("tabs", function() {
|
| 3408 | | - showTab(el, $show);
|
| 3409 | | - });
|
| 3410 | | -
|
| 3411 | | - self.load(self.anchors.index(this));
|
| 3412 | | - }
|
| 3413 | | - else {
|
| 3414 | | - throw 'jQuery UI Tabs: Mismatching fragment identifier.';
|
| 3415 | | - }
|
| 3416 | | -
|
| 3417 | | - // Prevent IE from keeping other link focussed when using the back button
|
| 3418 | | - // and remove dotted border from clicked link. This is controlled via CSS
|
| 3419 | | - // in modern browsers; blur() removes focus from address bar in Firefox
|
| 3420 | | - // which can become a usability and annoying problem with tabs('rotate').
|
| 3421 | | - if ($.browser.msie) {
|
| 3422 | | - this.blur();
|
| 3423 | | - }
|
| 3424 | | -
|
| 3425 | | - });
|
| 3426 | | -
|
| 3427 | | - // disable click in any case
|
| 3428 | | - this.anchors.bind('click.tabs', function(){return false;});
|
| 3429 | | -
|
| 3430 | | - },
|
| 3431 | | -
|
| 3432 | | - destroy: function() {
|
| 3433 | | - var o = this.options;
|
| 3434 | | -
|
| 3435 | | - this.abort();
|
| 3436 | | -
|
| 3437 | | - this.element.unbind('.tabs')
|
| 3438 | | - .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
|
| 3439 | | - .removeData('tabs');
|
| 3440 | | -
|
| 3441 | | - this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
|
| 3442 | | -
|
| 3443 | | - this.anchors.each(function() {
|
| 3444 | | - var href = $.data(this, 'href.tabs');
|
| 3445 | | - if (href) {
|
| 3446 | | - this.href = href;
|
| 3447 | | - }
|
| 3448 | | - var $this = $(this).unbind('.tabs');
|
| 3449 | | - $.each(['href', 'load', 'cache'], function(i, prefix) {
|
| 3450 | | - $this.removeData(prefix + '.tabs');
|
| 3451 | | - });
|
| 3452 | | - });
|
| 3453 | | -
|
| 3454 | | - this.lis.unbind('.tabs').add(this.panels).each(function() {
|
| 3455 | | - if ($.data(this, 'destroy.tabs')) {
|
| 3456 | | - $(this).remove();
|
| 3457 | | - }
|
| 3458 | | - else {
|
| 3459 | | - $(this).removeClass([
|
| 3460 | | - 'ui-state-default',
|
| 3461 | | - 'ui-corner-top',
|
| 3462 | | - 'ui-tabs-selected',
|
| 3463 | | - 'ui-state-active',
|
| 3464 | | - 'ui-state-hover',
|
| 3465 | | - 'ui-state-focus',
|
| 3466 | | - 'ui-state-disabled',
|
| 3467 | | - 'ui-tabs-panel',
|
| 3468 | | - 'ui-widget-content',
|
| 3469 | | - 'ui-corner-bottom',
|
| 3470 | | - 'ui-tabs-hide'
|
| 3471 | | - ].join(' '));
|
| 3472 | | - }
|
| 3473 | | - });
|
| 3474 | | -
|
| 3475 | | - if (o.cookie) {
|
| 3476 | | - this._cookie(null, o.cookie);
|
| 3477 | | - }
|
| 3478 | | - },
|
| 3479 | | -
|
| 3480 | | - add: function(url, label, index) {
|
| 3481 | | - if (index === undefined) {
|
| 3482 | | - index = this.anchors.length; // append by default
|
| 3483 | | - }
|
| 3484 | | -
|
| 3485 | | - var self = this, o = this.options,
|
| 3486 | | - $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
|
| 3487 | | - id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
|
| 3488 | | -
|
| 3489 | | - $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
|
| 3490 | | -
|
| 3491 | | - // try to find an existing element before creating a new one
|
| 3492 | | - var $panel = $('#' + id);
|
| 3493 | | - if (!$panel.length) {
|
| 3494 | | - $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
|
| 3495 | | - }
|
| 3496 | | - $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
|
| 3497 | | -
|
| 3498 | | - if (index >= this.lis.length) {
|
| 3499 | | - $li.appendTo(this.list);
|
| 3500 | | - $panel.appendTo(this.list[0].parentNode);
|
| 3501 | | - }
|
| 3502 | | - else {
|
| 3503 | | - $li.insertBefore(this.lis[index]);
|
| 3504 | | - $panel.insertBefore(this.panels[index]);
|
| 3505 | | - }
|
| 3506 | | -
|
| 3507 | | - o.disabled = $.map(o.disabled,
|
| 3508 | | - function(n, i) { return n >= index ? ++n : n; });
|
| 3509 | | -
|
| 3510 | | - this._tabify();
|
| 3511 | | -
|
| 3512 | | - if (this.anchors.length == 1) { // after tabify
|
| 3513 | | - $li.addClass('ui-tabs-selected ui-state-active');
|
| 3514 | | - $panel.removeClass('ui-tabs-hide');
|
| 3515 | | - this.element.queue("tabs", function() {
|
| 3516 | | - self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
|
| 3517 | | - });
|
| 3518 | | -
|
| 3519 | | - this.load(0);
|
| 3520 | | - }
|
| 3521 | | -
|
| 3522 | | - // callback
|
| 3523 | | - this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
|
| 3524 | | - },
|
| 3525 | | -
|
| 3526 | | - remove: function(index) {
|
| 3527 | | - var o = this.options, $li = this.lis.eq(index).remove(),
|
| 3528 | | - $panel = this.panels.eq(index).remove();
|
| 3529 | | -
|
| 3530 | | - // If selected tab was removed focus tab to the right or
|
| 3531 | | - // in case the last tab was removed the tab to the left.
|
| 3532 | | - if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
|
| 3533 | | - this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
|
| 3534 | | - }
|
| 3535 | | -
|
| 3536 | | - o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
|
| 3537 | | - function(n, i) { return n >= index ? --n : n; });
|
| 3538 | | -
|
| 3539 | | - this._tabify();
|
| 3540 | | -
|
| 3541 | | - // callback
|
| 3542 | | - this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
|
| 3543 | | - },
|
| 3544 | | -
|
| 3545 | | - enable: function(index) {
|
| 3546 | | - var o = this.options;
|
| 3547 | | - if ($.inArray(index, o.disabled) == -1) {
|
| 3548 | | - return;
|
| 3549 | | - }
|
| 3550 | | -
|
| 3551 | | - this.lis.eq(index).removeClass('ui-state-disabled');
|
| 3552 | | - o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
|
| 3553 | | -
|
| 3554 | | - // callback
|
| 3555 | | - this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
|
| 3556 | | - },
|
| 3557 | | -
|
| 3558 | | - disable: function(index) {
|
| 3559 | | - var self = this, o = this.options;
|
| 3560 | | - if (index != o.selected) { // cannot disable already selected tab
|
| 3561 | | - this.lis.eq(index).addClass('ui-state-disabled');
|
| 3562 | | -
|
| 3563 | | - o.disabled.push(index);
|
| 3564 | | - o.disabled.sort();
|
| 3565 | | -
|
| 3566 | | - // callback
|
| 3567 | | - this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
|
| 3568 | | - }
|
| 3569 | | - },
|
| 3570 | | -
|
| 3571 | | - select: function(index) {
|
| 3572 | | - if (typeof index == 'string') {
|
| 3573 | | - index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
|
| 3574 | | - }
|
| 3575 | | - else if (index === null) { // usage of null is deprecated, TODO remove in next release
|
| 3576 | | - index = -1;
|
| 3577 | | - }
|
| 3578 | | - if (index == -1 && this.options.collapsible) {
|
| 3579 | | - index = this.options.selected;
|
| 3580 | | - }
|
| 3581 | | -
|
| 3582 | | - this.anchors.eq(index).trigger(this.options.event + '.tabs');
|
| 3583 | | - },
|
| 3584 | | -
|
| 3585 | | - load: function(index) {
|
| 3586 | | - var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
|
| 3587 | | -
|
| 3588 | | - this.abort();
|
| 3589 | | -
|
| 3590 | | - // not remote or from cache
|
| 3591 | | - if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
|
| 3592 | | - this.element.dequeue("tabs");
|
| 3593 | | - return;
|
| 3594 | | - }
|
| 3595 | | -
|
| 3596 | | - // load remote from here on
|
| 3597 | | - this.lis.eq(index).addClass('ui-state-processing');
|
| 3598 | | -
|
| 3599 | | - if (o.spinner) {
|
| 3600 | | - var span = $('span', a);
|
| 3601 | | - span.data('label.tabs', span.html()).html(o.spinner);
|
| 3602 | | - }
|
| 3603 | | -
|
| 3604 | | - this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
|
| 3605 | | - url: url,
|
| 3606 | | - success: function(r, s) {
|
| 3607 | | - $(self._sanitizeSelector(a.hash)).html(r);
|
| 3608 | | -
|
| 3609 | | - // take care of tab labels
|
| 3610 | | - self._cleanup();
|
| 3611 | | -
|
| 3612 | | - if (o.cache) {
|
| 3613 | | - $.data(a, 'cache.tabs', true); // if loaded once do not load them again
|
| 3614 | | - }
|
| 3615 | | -
|
| 3616 | | - // callbacks
|
| 3617 | | - self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
|
| 3618 | | - try {
|
| 3619 | | - o.ajaxOptions.success(r, s);
|
| 3620 | | - }
|
| 3621 | | - catch (e) {}
|
| 3622 | | -
|
| 3623 | | - // last, so that load event is fired before show...
|
| 3624 | | - self.element.dequeue("tabs");
|
| 3625 | | - }
|
| 3626 | | - }));
|
| 3627 | | - },
|
| 3628 | | -
|
| 3629 | | - abort: function() {
|
| 3630 | | - // stop possibly running animations
|
| 3631 | | - this.element.queue([]);
|
| 3632 | | - this.panels.stop(false, true);
|
| 3633 | | -
|
| 3634 | | - // terminate pending requests from other tabs
|
| 3635 | | - if (this.xhr) {
|
| 3636 | | - this.xhr.abort();
|
| 3637 | | - delete this.xhr;
|
| 3638 | | - }
|
| 3639 | | -
|
| 3640 | | - // take care of tab labels
|
| 3641 | | - this._cleanup();
|
| 3642 | | -
|
| 3643 | | - },
|
| 3644 | | -
|
| 3645 | | - url: function(index, url) {
|
| 3646 | | - this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
|
| 3647 | | - },
|
| 3648 | | -
|
| 3649 | | - length: function() {
|
| 3650 | | - return this.anchors.length;
|
| 3651 | | - }
|
| 3652 | | -
|
| 3653 | | -});
|
| 3654 | | -
|
| 3655 | | -$.extend($.ui.tabs, {
|
| 3656 | | - version: '1.7.2',
|
| 3657 | | - getter: 'length',
|
| 3658 | | - defaults: {
|
| 3659 | | - ajaxOptions: null,
|
| 3660 | | - cache: false,
|
| 3661 | | - cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
|
| 3662 | | - collapsible: false,
|
| 3663 | | - disabled: [],
|
| 3664 | | - event: 'click',
|
| 3665 | | - fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
|
| 3666 | | - idPrefix: 'ui-tabs-',
|
| 3667 | | - panelTemplate: '<div></div>',
|
| 3668 | | - spinner: '<em>Loading…</em>',
|
| 3669 | | - tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
|
| 3670 | | - }
|
| 3671 | | -});
|
| 3672 | | -
|
| 3673 | | -/*
|
| 3674 | | - * Tabs Extensions
|
| 3675 | | - */
|
| 3676 | | -
|
| 3677 | | -/*
|
| 3678 | | - * Rotate
|
| 3679 | | - */
|
| 3680 | | -$.extend($.ui.tabs.prototype, {
|
| 3681 | | - rotation: null,
|
| 3682 | | - rotate: function(ms, continuing) {
|
| 3683 | | -
|
| 3684 | | - var self = this, o = this.options;
|
| 3685 | | -
|
| 3686 | | - var rotate = self._rotate || (self._rotate = function(e) {
|
| 3687 | | - clearTimeout(self.rotation);
|
| 3688 | | - self.rotation = setTimeout(function() {
|
| 3689 | | - var t = o.selected;
|
| 3690 | | - self.select( ++t < self.anchors.length ? t : 0 );
|
| 3691 | | - }, ms);
|
| 3692 | | -
|
| 3693 | | - if (e) {
|
| 3694 | | - e.stopPropagation();
|
| 3695 | | - }
|
| 3696 | | - });
|
| 3697 | | -
|
| 3698 | | - var stop = self._unrotate || (self._unrotate = !continuing ?
|
| 3699 | | - function(e) {
|
| 3700 | | - if (e.clientX) { // in case of a true click
|
| 3701 | | - self.rotate(null);
|
| 3702 | | - }
|
| 3703 | | - } :
|
| 3704 | | - function(e) {
|
| 3705 | | - t = o.selected;
|
| 3706 | | - rotate();
|
| 3707 | | - });
|
| 3708 | | -
|
| 3709 | | - // start rotation
|
| 3710 | | - if (ms) {
|
| 3711 | | - this.element.bind('tabsshow', rotate);
|
| 3712 | | - this.anchors.bind(o.event + '.tabs', stop);
|
| 3713 | | - rotate();
|
| 3714 | | - }
|
| 3715 | | - // stop rotation
|
| 3716 | | - else {
|
| 3717 | | - clearTimeout(self.rotation);
|
| 3718 | | - this.element.unbind('tabsshow', rotate);
|
| 3719 | | - this.anchors.unbind(o.event + '.tabs', stop);
|
| 3720 | | - delete this._rotate;
|
| 3721 | | - delete this._unrotate;
|
| 3722 | | - }
|
| 3723 | | - }
|
| 3724 | | -});
|
| 3725 | | -
|
| 3726 | | -})(jQuery);
|
| 3727 | | -/* JavaScript for MediaWIki JS2 */
|
| 3728 | | -
|
| 3729 | | -/**
|
| 3730 | | - * This is designed to be directly compatible with (and is essentially taken
|
| 3731 | | - * directly from) the mv_embed code for bringing internationalized messages into
|
| 3732 | | - * the JavaScript space. As such, if we get to the point of merging that stuff
|
| 3733 | | - * into the main branch this code will be uneeded and probably cause issues.
|
| 3734 | | - */
|
| 3735 | | -// Creates global message object if not already in existence
|
| 3736 | | -if ( !gMsg ) var gMsg = {};
|
| 3737 | | -if( ! mw ) var mw = { };
|
| 3738 | | -
|
| 3739 | | -/**
|
| 3740 | | - * Caches a list of messages for later retrieval
|
| 3741 | | - * @param {Object} msgSet Hash of key:value pairs of messages to cache
|
| 3742 | | - */
|
| 3743 | | -if( ! mw.addMessages ){
|
| 3744 | | - mw.addMessages = function( msgSet ){
|
| 3745 | | - for ( var i in msgSet ){
|
| 3746 | | - gMsg[ i ] = msgSet[i];
|
| 3747 | | - }
|
| 3748 | | - }
|
| 3749 | | -}
|
| 3750 | | -
|
| 3751 | | -/**
|
| 3752 | | - * Retieves a message from the global message cache, performing on-the-fly
|
| 3753 | | - * replacements using MediaWiki message syntax ($1, $2, etc.)
|
| 3754 | | - * @param {String} key Name of message as it is in MediaWiki
|
| 3755 | | - * @param {Array} args Array of replacement arguments
|
| 3756 | | - */
|
| 3757 | | -function gM( key, args ) {
|
| 3758 | | - var ms = '';
|
| 3759 | | - if ( key in gMsg ) {
|
| 3760 | | - ms = gMsg[ key ];
|
| 3761 | | - if ( typeof args == 'object' || typeof args == 'array' ) {
|
| 3762 | | - for ( var v in args ){
|
| 3763 | | - var rep = '\$'+ ( parseInt(v) + 1 );
|
| 3764 | | - ms = ms.replace( rep, args[v]);
|
| 3765 | | - }
|
| 3766 | | - } else if ( typeof args =='string' || typeof args =='number' ) {
|
| 3767 | | - ms = ms.replace( /\$1/, args );
|
| 3768 | | - }
|
| 3769 | | - return ms;
|
| 3770 | | - } else {
|
| 3771 | | - return '[' + key + ']';
|
| 3772 | | - }
|
| 3773 | | -}
|
| 3774 | | -/**
|
| 3775 | | - * Mimics the no-conflict method used by the js2 stuff
|
| 3776 | | - */
|
| 3777 | | -$j = jQuery.noConflict();
|
| 3778 | | -/**
|
| 3779 | | - * Provides js2 compatible onload hook
|
| 3780 | | - * @param func Function to call when ready
|
| 3781 | | - */
|
| 3782 | | -mw.addOnloadHook = function( func ) {
|
| 3783 | | - $j(document).ready( func );
|
| 3784 | | -}
|
| | 2 | +/* |
| | 3 | + * jQuery UI 1.7.2 |
| | 4 | + * |
| | 5 | + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) |
| | 6 | + * Dual licensed under the MIT (MIT-LICENSE.txt) |
| | 7 | + * and GPL (GPL-LICENSE.txt) licenses. |
| | 8 | + * |
| | 9 | + * http://docs.jquery.com/UI |
| | 10 | + */ |
| | 11 | +;jQuery.ui || (function($) { |
| | 12 | + |
| | 13 | +var _remove = $.fn.remove, |
| | 14 | + isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9); |
| | 15 | + |
| | 16 | +//Helper functions and ui object |
| | 17 | +$.ui = { |
| | 18 | + version: "1.7.2", |
| | 19 | + |
| | 20 | + // $.ui.plugin is deprecated. Use the proxy pattern instead. |
| | 21 | + plugin: { |
| | 22 | + add: function(module, option, set) { |
| | 23 | + var proto = $.ui[module].prototype; |
| | 24 | + for(var i in set) { |
| | 25 | + proto.plugins[i] = proto.plugins[i] || []; |
| | 26 | + proto.plugins[i].push([option, set[i]]); |
| | 27 | + } |
| | 28 | + }, |
| | 29 | + call: function(instance, name, args) { |
| | 30 | + var set = instance.plugins[name]; |
| | 31 | + if(!set || !instance.element[0].parentNode) { return; } |
| | 32 | + |
| | 33 | + for (var i = 0; i < set.length; i++) { |
| | 34 | + if (instance.options[set[i][0]]) { |
| | 35 | + set[i][1].apply(instance.element, args); |
| | 36 | + } |
| | 37 | + } |
| | 38 | + } |
| | 39 | + }, |
| | 40 | + |
| | 41 | + contains: function(a, b) { |
| | 42 | + return document.compareDocumentPosition |
| | 43 | + ? a.compareDocumentPosition(b) & 16 |
| | 44 | + : a !== b && a.contains(b); |
| | 45 | + }, |
| | 46 | + |
| | 47 | + hasScroll: function(el, a) { |
| | 48 | + |
| | 49 | + //If overflow is hidden, the element might have extra content, but the user wants to hide it |
| | 50 | + if ($(el).css('overflow') == 'hidden') { return false; } |
| | 51 | + |
| | 52 | + var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop', |
| | 53 | + has = false; |
| | 54 | + |
| | 55 | + if (el[scroll] > 0) { return true; } |
| | 56 | + |
| | 57 | + // TODO: determine which cases actually cause this to happen |
| | 58 | + // if the element doesn't have the scroll set, see if it's possible to |
| | 59 | + // set the scroll |
| | 60 | + el[scroll] = 1; |
| | 61 | + has = (el[scroll] > 0); |
| | 62 | + el[scroll] = 0; |
| | 63 | + return has; |
| | 64 | + }, |
| | 65 | + |
| | 66 | + isOverAxis: function(x, reference, size) { |
| | 67 | + //Determines when x coordinate is over "b" element axis |
| | 68 | + return (x > reference) && (x < (reference + size)); |
| | 69 | + }, |
| | 70 | + |
| | 71 | + isOver: function(y, x, top, left, height, width) { |
| | 72 | + //Determines when x, y coordinates is over "b" element |
| | 73 | + return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width); |
| | 74 | + }, |
| | 75 | + |
| | 76 | + keyCode: { |
| | 77 | + BACKSPACE: 8, |
| | 78 | + CAPS_LOCK: 20, |
| | 79 | + COMMA: 188, |
| | 80 | + CONTROL: 17, |
| | 81 | + DELETE: 46, |
| | 82 | + DOWN: 40, |
| | 83 | + END: 35, |
| | 84 | + ENTER: 13, |
| | 85 | + ESCAPE: 27, |
| | 86 | + HOME: 36, |
| | 87 | + INSERT: 45, |
| | 88 | + LEFT: 37, |
| | 89 | + NUMPAD_ADD: 107, |
| | 90 | + NUMPAD_DECIMAL: 110, |
| | 91 | + NUMPAD_DIVIDE: 111, |
| | 92 | + NUMPAD_ENTER: 108, |
| | 93 | + NUMPAD_MULTIPLY: 106, |
| | 94 | + NUMPAD_SUBTRACT: 109, |
| | 95 | + PAGE_DOWN: 34, |
| | 96 | + PAGE_UP: 33, |
| | 97 | + PERIOD: 190, |
| | 98 | + RIGHT: 39, |
| | 99 | + SHIFT: 16, |
| | 100 | + SPACE: 32, |
| | 101 | + TAB: 9, |
| | 102 | + UP: 38 |
| | 103 | + } |
| | 104 | +}; |
| | 105 | + |
| | 106 | +// WAI-ARIA normalization |
| | 107 | +if (isFF2) { |
| | 108 | + var attr = $.attr, |
| | 109 | + removeAttr = $.fn.removeAttr, |
| | 110 | + ariaNS = "http://www.w3.org/2005/07/aaa", |
| | 111 | + ariaState = /^aria-/, |
| | 112 | + ariaRole = /^wairole:/; |
| | 113 | + |
| | 114 | + $.attr = function(elem, name, value) { |
| | 115 | + var set = value !== undefined; |
| | 116 | + |
| | 117 | + return (name == 'role' |
| | 118 | + ? (set |
| | 119 | + ? attr.call(this, elem, name, "wairole:" + value) |
| | 120 | + : (attr.apply(this, arguments) || "").replace(ariaRole, "")) |
| | 121 | + : (ariaState.test(name) |
| | 122 | + ? (set |
| | 123 | + ? elem.setAttributeNS(ariaNS, |
| | 124 | + name.replace(ariaState, "aaa:"), value) |
| | 125 | + : attr.call(this, elem, name.replace(ariaState, "aaa:"))) |
| | 126 | + : attr.apply(this, arguments))); |
| | 127 | + }; |
| | 128 | + |
| | 129 | + $.fn.removeAttr = function(name) { |
| | 130 | + return (ariaState.test(name) |
| | 131 | + ? this.each(function() { |
| | 132 | + this.removeAttributeNS(ariaNS, name.replace(ariaState, "")); |
| | 133 | + }) : removeAttr.call(this, name)); |
| | 134 | + }; |
| | 135 | +} |
| | 136 | + |
| | 137 | +//jQuery plugins |
| | 138 | +$.fn.extend({ |
| | 139 | + remove: function() { |
| | 140 | + // Safari has a native remove event which actually removes DOM elements, |
| | 141 | + // so we have to use triggerHandler instead of trigger (#3037). |
| | 142 | + $("*", this).add(this).each(function() { |
| | 143 | + $(this).triggerHandler("remove"); |
| | 144 | + }); |
| | 145 | + return _remove.apply(this, arguments ); |
| | 146 | + }, |
| | 147 | + |
| | 148 | + enableSelection: function() { |
| | 149 | + return this |
| | 150 | + .attr('unselectable', 'off') |
| | 151 | + .css('MozUserSelect', '') |
| | 152 | + .unbind('selectstart.ui'); |
| | 153 | + }, |
| | 154 | + |
| | 155 | + disableSelection: function() { |
| | 156 | + return this |
| | 157 | + .attr('unselectable', 'on') |
| | 158 | + .css('MozUserSelect', 'none') |
| | 159 | + .bind('selectstart.ui', function() { return false; }); |
| | 160 | + }, |
| | 161 | + |
| | 162 | + scrollParent: function() { |
| | 163 | + var scrollParent; |
| | 164 | + if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { |
| | 165 | + scrollParent = this.parents().filter(function() { |
| | 166 | + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); |
| | 167 | + }).eq(0); |
| | 168 | + } else { |
| | 169 | + scrollParent = this.parents().filter(function() { |
| | 170 | + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); |
| | 171 | + }).eq(0); |
| | 172 | + } |
| | 173 | + |
| | 174 | + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; |
| | 175 | + } |
| | 176 | +}); |
| | 177 | + |
| | 178 | + |
| | 179 | +//Additional selectors |
| | 180 | +$.extend($.expr[':'], { |
| | 181 | + data: function(elem, i, match) { |
| | 182 | + return !!$.data(elem, match[3]); |
| | 183 | + }, |
| | 184 | + |
| | 185 | + focusable: function(element) { |
| | 186 | + var nodeName = element.nodeName.toLowerCase(), |
| | 187 | + tabIndex = $.attr(element, 'tabindex'); |
| | 188 | + return (/input|select|textarea|button|object/.test(nodeName) |
| | 189 | + ? !element.disabled |
| | 190 | + : 'a' == nodeName || 'area' == nodeName |
| | 191 | + ? element.href || !isNaN(tabIndex) |
| | 192 | + : !isNaN(tabIndex)) |
| | 193 | + // the element and all of its ancestors must be visible |
| | 194 | + // the browser may report that the area is hidden |
| | 195 | + && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length; |
| | 196 | + }, |
| | 197 | + |
| | 198 | + tabbable: function(element) { |
| | 199 | + var tabIndex = $.attr(element, 'tabindex'); |
| | 200 | + return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable'); |
| | 201 | + } |
| | 202 | +}); |
| | 203 | + |
| | 204 | + |
| | 205 | +// $.widget is a factory to create jQuery plugins |
| | 206 | +// taking some boilerplate code out of the plugin code |
| | 207 | +function getter(namespace, plugin, method, args) { |
| | 208 | + function getMethods(type) { |
| | 209 | + var methods = $[namespace][plugin][type] || []; |
| | 210 | + return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods); |
| | 211 | + } |
| | 212 | + |
| | 213 | + var methods = getMethods('getter'); |
| | 214 | + if (args.length == 1 && typeof args[0] == 'string') { |
| | 215 | + methods = methods.concat(getMethods('getterSetter')); |
| | 216 | + } |
| | 217 | + return ($.inArray(method, methods) != -1); |
| | 218 | +} |
| | 219 | + |
| | 220 | +$.widget = function(name, prototype) { |
| | 221 | + var namespace = name.split(".")[0]; |
| | 222 | + name = name.split(".")[1]; |
| | 223 | + |
| | 224 | + // create plugin method |
| | 225 | + $.fn[name] = function(options) { |
| | 226 | + var isMethodCall = (typeof options == 'string'), |
| | 227 | + args = Array.prototype.slice.call(arguments, 1); |
| | 228 | + |
| | 229 | + // prevent calls to internal methods |
| | 230 | + if (isMethodCall && options.substring(0, 1) == '_') { |
| | 231 | + return this; |
| | 232 | + } |
| | 233 | + |
| | 234 | + // handle getter methods |
| | 235 | + if (isMethodCall && getter(namespace, name, options, args)) { |
| | 236 | + var instance = $.data(this[0], name); |
| | 237 | + return (instance ? instance[options].apply(instance, args) |
| | 238 | + : undefined); |
| | 239 | + } |
| | 240 | + |
| | 241 | + // handle initialization and non-getter methods |
| | 242 | + return this.each(function() { |
| | 243 | + var instance = $.data(this, name); |
| | 244 | + |
| | 245 | + // constructor |
| | 246 | + (!instance && !isMethodCall && |
| | 247 | + $.data(this, name, new $[namespace][name](this, options))._init()); |
| | 248 | + |
| | 249 | + // method call |
| | 250 | + (instance && isMethodCall && $.isFunction(instance[options]) && |
| | 251 | + instance[options].apply(instance, args)); |
| | 252 | + }); |
| | 253 | + }; |
| | 254 | + |
| | 255 | + // create widget constructor |
| | 256 | + $[namespace] = $[namespace] || {}; |
| | 257 | + $[namespace][name] = function(element, options) { |
| | 258 | + var self = this; |
| | 259 | + |
| | 260 | + this.namespace = namespace; |
| | 261 | + this.widgetName = name; |
| | 262 | + this.widgetEventPrefix = $[namespace][name].eventPrefix || name; |
| | 263 | + this.widgetBaseClass = namespace + '-' + name; |
| | 264 | + |
| | 265 | + this.options = $.extend({}, |
| | 266 | + $.widget.defaults, |
| | 267 | + $[namespace][name].defaults, |
| | 268 | + $.metadata && $.metadata.get(element)[name], |
| | 269 | + options); |
| | 270 | + |
| | 271 | + this.element = $(element) |
| | 272 | + .bind('setData.' + name, function(event, key, value) { |
| | 273 | + if (event.target == element) { |
| | 274 | + return self._setData(key, value); |
| | 275 | + } |
| | 276 | + }) |
| | 277 | + .bind('getData.' + name, function(event, key) { |
| | 278 | + if (event.target == element) { |
| | 279 | + return self._getData(key); |
| | 280 | + } |
| | 281 | + }) |
| | 282 | + .bind('remove', function() { |
| | 283 | + return self.destroy(); |
| | 284 | + }); |
| | 285 | + }; |
| | 286 | + |
| | 287 | + // add widget prototype |
| | 288 | + $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype); |
| | 289 | + |
| | 290 | + // TODO: merge getter and getterSetter properties from widget prototype |
| | 291 | + // and plugin prototype |
| | 292 | + $[namespace][name].getterSetter = 'option'; |
| | 293 | +}; |
| | 294 | + |
| | 295 | +$.widget.prototype = { |
| | 296 | + _init: function() {}, |
| | 297 | + destroy: function() { |
| | 298 | + this.element.removeData(this.widgetName) |
| | 299 | + .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled') |
| | 300 | + .removeAttr('aria-disabled'); |
| | 301 | + }, |
| | 302 | + |
| | 303 | + option: function(key, value) { |
| | 304 | + var options = key, |
| | 305 | + self = this; |
| | 306 | + |
| | 307 | + if (typeof key == "string") { |
| | 308 | + if (value === undefined) { |
| | 309 | + return this._getData(key); |
| | 310 | + } |
| | 311 | + options = {}; |
| | 312 | + options[key] = value; |
| | 313 | + } |
| | 314 | + |
| | 315 | + $.each(options, function(key, value) { |
| | 316 | + self._setData(key, value); |
| | 317 | + }); |
| | 318 | + }, |
| | 319 | + _getData: function(key) { |
| | 320 | + return this.options[key]; |
| | 321 | + }, |
| | 322 | + _setData: function(key, value) { |
| | 323 | + this.options[key] = value; |
| | 324 | + |
| | 325 | + if (key == 'disabled') { |
| | 326 | + this.element |
| | 327 | + [value ? 'addClass' : 'removeClass']( |
| | 328 | + this.widgetBaseClass + '-disabled' + ' ' + |
| | 329 | + this.namespace + '-state-disabled') |
| | 330 | + .attr("aria-disabled", value); |
| | 331 | + } |
| | 332 | + }, |
| | 333 | + |
| | 334 | + enable: function() { |
| | 335 | + this._setData('disabled', false); |
| | 336 | + }, |
| | 337 | + disable: function() { |
| | 338 | + this._setData('disabled', true); |
| | 339 | + }, |
| | 340 | + |
| | 341 | + _trigger: function(type, event, data) { |
| | 342 | + var callback = this.options[type], |
| | 343 | + eventName = (type == this.widgetEventPrefix |
| | 344 | + ? type : this.widgetEventPrefix + type); |
| | 345 | + |
| | 346 | + event = $.Event(event); |
| | 347 | + event.type = eventName; |
| | 348 | + |
| | 349 | + // copy original event properties over to the new event |
| | 350 | + // this would happen if we could call $.event.fix instead of $.Event |
| | 351 | + // but we don't have a way to force an event to be fixed multiple times |
| | 352 | + if (event.originalEvent) { |
| | 353 | + for (var i = $.event.props.length, prop; i;) { |
| | 354 | + prop = $.event.props[--i]; |
| | 355 | + event[prop] = event.originalEvent[prop]; |
| | 356 | + } |
| | 357 | + } |
| | 358 | + |
| | 359 | + this.element.trigger(event, data); |
| | 360 | + |
| | 361 | + return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false |
| | 362 | + || event.isDefaultPrevented()); |
| | 363 | + } |
| | 364 | +}; |
| | 365 | + |
| | 366 | +$.widget.defaults = { |
| | 367 | + disabled: false |
| | 368 | +}; |
| | 369 | + |
| | 370 | + |
| | 371 | +/** Mouse Interaction Plugin **/ |
| | 372 | + |
| | 373 | +$.ui.mouse = { |
| | 374 | + _mouseInit: function() { |
| | 375 | + var self = this; |
| | 376 | + |
| | 377 | + this.element |
| | 378 | + .bind('mousedown.'+this.widgetName, function(event) { |
| | 379 | + return self._mouseDown(event); |
| | 380 | + }) |
| | 381 | + .bind('click.'+this.widgetName, function(event) { |
| | 382 | + if(self._preventClickEvent) { |
| | 383 | + self._preventClickEvent = false; |
| | 384 | + event.stopImmediatePropagation(); |
| | 385 | + return false; |
| | 386 | + } |
| | 387 | + }); |
| | 388 | + |
| | 389 | + // Prevent text selection in IE |
| | 390 | + if ($.browser.msie) { |
| | 391 | + this._mouseUnselectable = this.element.attr('unselectable'); |
| | 392 | + this.element.attr('unselectable', 'on'); |
| | 393 | + } |
| | 394 | + |
| | 395 | + this.started = false; |
| | 396 | + }, |
| | 397 | + |
| | 398 | + // TODO: make sure destroying one instance of mouse doesn't mess with |
| | 399 | + // other instances of mouse |
| | 400 | + _mouseDestroy: function() { |
| | 401 | + this.element.unbind('.'+this.widgetName); |
| | 402 | + |
| | 403 | + // Restore text selection in IE |
| | 404 | + ($.browser.msie |
| | 405 | + && this.element.attr('unselectable', this._mouseUnselectable)); |
| | 406 | + }, |
| | 407 | + |
| | 408 | + _mouseDown: function(event) { |
| | 409 | + // don't let more than one widget handle mouseStart |
| | 410 | + // TODO: figure out why we have to use originalEvent |
| | 411 | + event.originalEvent = event.originalEvent || {}; |
| | 412 | + if (event.originalEvent.mouseHandled) { return; } |
| | 413 | + |
| | 414 | + // we may have missed mouseup (out of window) |
| | 415 | + (this._mouseStarted && this._mouseUp(event)); |
| | 416 | + |
| | 417 | + this._mouseDownEvent = event; |
| | 418 | + |
| | 419 | + var self = this, |
| | 420 | + btnIsLeft = (event.which == 1), |
| | 421 | + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); |
| | 422 | + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { |
| | 423 | + return true; |
| | 424 | + } |
| | 425 | + |
| | 426 | + this.mouseDelayMet = !this.options.delay; |
| | 427 | + if (!this.mouseDelayMet) { |
| | 428 | + this._mouseDelayTimer = setTimeout(function() { |
| | 429 | + self.mouseDelayMet = true; |
| | 430 | + }, this.options.delay); |
| | 431 | + } |
| | 432 | + |
| | 433 | + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { |
| | 434 | + this._mouseStarted = (this._mouseStart(event) !== false); |
| | 435 | + if (!this._mouseStarted) { |
| | 436 | + event.preventDefault(); |
| | 437 | + return true; |
| | 438 | + } |
| | 439 | + } |
| | 440 | + |
| | 441 | + // these delegates are required to keep context |
| | 442 | + this._mouseMoveDelegate = function(event) { |
| | 443 | + return self._mouseMove(event); |
| | 444 | + }; |
| | 445 | + this._mouseUpDelegate = function(event) { |
| | 446 | + return self._mouseUp(event); |
| | 447 | + }; |
| | 448 | + $(document) |
| | 449 | + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) |
| | 450 | + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); |
| | 451 | + |
| | 452 | + // preventDefault() is used to prevent the selection of text here - |
| | 453 | + // however, in Safari, this causes select boxes not to be selectable |
| | 454 | + // anymore, so this fix is needed |
| | 455 | + ($.browser.safari || event.preventDefault()); |
| | 456 | + |
| | 457 | + event.originalEvent.mouseHandled = true; |
| | 458 | + return true; |
| | 459 | + }, |
| | 460 | + |
| | 461 | + _mouseMove: function(event) { |
| | 462 | + // IE mouseup check - mouseup happened when mouse was out of window |
| | 463 | + if ($.browser.msie && !event.button) { |
| | 464 | + return this._mouseUp(event); |
| | 465 | + } |
| | 466 | + |
| | 467 | + if (this._mouseStarted) { |
| | 468 | + this._mouseDrag(event); |
| | 469 | + return event.preventDefault(); |
| | 470 | + } |
| | 471 | + |
| | 472 | + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { |
| | 473 | + this._mouseStarted = |
| | 474 | + (this._mouseStart(this._mouseDownEvent, event) !== false); |
| | 475 | + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); |
| | 476 | + } |
| | 477 | + |
| | 478 | + return !this._mouseStarted; |
| | 479 | + }, |
| | 480 | + |
| | 481 | + _mouseUp: function(event) { |
| | 482 | + $(document) |
| | 483 | + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) |
| | 484 | + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); |
| | 485 | + |
| | 486 | + if (this._mouseStarted) { |
| | 487 | + this._mouseStarted = false; |
| | 488 | + this._preventClickEvent = (event.target == this._mouseDownEvent.target); |
| | 489 | + this._mouseStop(event); |
| | 490 | + } |
| | 491 | + |
| | 492 | + return false; |
| | 493 | + }, |
| | 494 | + |
| | 495 | + _mouseDistanceMet: function(event) { |
| | 496 | + return (Math.max( |
| | 497 | + Math.abs(this._mouseDownEvent.pageX - event.pageX), |
| | 498 | + Math.abs(this._mouseDownEvent.pageY - event.pageY) |
| | 499 | + ) >= this.options.distance |
| | 500 | + ); |
| | 501 | + }, |
| | 502 | + |
| | 503 | + _mouseDelayMet: function(event) { |
| | 504 | + return this.mouseDelayMet; |
| | 505 | + }, |
| | 506 | + |
| | 507 | + // These are placeholder methods, to be overriden by extending plugin |
| | 508 | + _mouseStart: function(event) {}, |
| | 509 | + _mouseDrag: function(event) {}, |
| | 510 | + _mouseStop: function(event) {}, |
| | 511 | + _mouseCapture: function(event) { return true; } |
| | 512 | +}; |
| | 513 | + |
| | 514 | +$.ui.mouse.defaults = { |
| | 515 | + cancel: null, |
| | 516 | + distance: 1, |
| | 517 | + delay: 0 |
| | 518 | +}; |
| | 519 | + |
| | 520 | +})(jQuery); |
| | 521 | +/* |
| | 522 | + * jQuery UI Draggable 1.7.2 |
| | 523 | + * |
| | 524 | + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) |
| | 525 | + * Dual licensed under the MIT (MIT-LICENSE.txt) |
| | 526 | + * and GPL (GPL-LICENSE.txt) licenses. |
| | 527 | + * |
| | 528 | + * http://docs.jquery.com/UI/Draggables |
| | 529 | + * |
| | 530 | + * Depends: |
| | 531 | + * ui.core.js |
| | 532 | + */ |
| | 533 | +(function($) { |
| | 534 | + |
| | 535 | +$.widget("ui.draggable", $.extend({}, $.ui.mouse, { |
| | 536 | + |
| | 537 | + _init: function() { |
| | 538 | + |
| | 539 | + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) |
| | 540 | + this.element[0].style.position = 'relative'; |
| | 541 | + |
| | 542 | + (this.options.addClasses && this.element.addClass("ui-draggable")); |
| | 543 | + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); |
| | 544 | + |
| | 545 | + this._mouseInit(); |
| | 546 | + |
| | 547 | + }, |
| | 548 | + |
| | 549 | + destroy: function() { |
| | 550 | + if(!this.element.data('draggable')) return; |
| | 551 | + this.element |
| | 552 | + .removeData("draggable") |
| | 553 | + .unbind(".draggable") |
| | 554 | + .removeClass("ui-draggable" |
| | 555 | + + " ui-draggable-dragging" |
| | 556 | + + " ui-draggable-disabled"); |
| | 557 | + this._mouseDestroy(); |
| | 558 | + }, |
| | 559 | + |
| | 560 | + _mouseCapture: function(event) { |
| | 561 | + |
| | 562 | + var o = this.options; |
| | 563 | + |
| | 564 | + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) |
| | 565 | + return false; |
| | 566 | + |
| | 567 | + //Quit if we're not on a valid handle |
| | 568 | + this.handle = this._getHandle(event); |
| | 569 | + if (!this.handle) |
| | 570 | + return false; |
| | 571 | + |
| | 572 | + return true; |
| | 573 | + |
| | 574 | + }, |
| | 575 | + |
| | 576 | + _mouseStart: function(event) { |
| | 577 | + |
| | 578 | + var o = this.options; |
| | 579 | + |
| | 580 | + //Create and append the visible helper |
| | 581 | + this.helper = this._createHelper(event); |
| | 582 | + |
| | 583 | + //Cache the helper size |
| | 584 | + this._cacheHelperProportions(); |
| | 585 | + |
| | 586 | + //If ddmanager is used for droppables, set the global draggable |
| | 587 | + if($.ui.ddmanager) |
| | 588 | + $.ui.ddmanager.current = this; |
| | 589 | + |
| | 590 | + /* |
| | 591 | + * - Position generation - |
| | 592 | + * This block generates everything position related - it's the core of draggables. |
| | 593 | + */ |
| | 594 | + |
| | 595 | + //Cache the margins of the original element |
| | 596 | + this._cacheMargins(); |
| | 597 | + |
| | 598 | + //Store the helper's css position |
| | 599 | + this.cssPosition = this.helper.css("position"); |
| | 600 | + this.scrollParent = this.helper.scrollParent(); |
| | 601 | + |
| | 602 | + //The element's absolute position on the page minus margins |
| | 603 | + this.offset = this.element.offset(); |
| | 604 | + this.offset = { |
| | 605 | + top: this.offset.top - this.margins.top, |
| | 606 | + left: this.offset.left - this.margins.left |
| | 607 | + }; |
| | 608 | + |
| | 609 | + $.extend(this.offset, { |
| | 610 | + click: { //Where the click happened, relative to the element |
| | 611 | + left: event.pageX - this.offset.left, |
| | 612 | + top: event.pageY - this.offset.top |
| | 613 | + }, |
| | 614 | + parent: this._getParentOffset(), |
| | 615 | + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper |
| | 616 | + }); |
| | 617 | + |
| | 618 | + //Generate the original position |
| | 619 | + this.originalPosition = this._generatePosition(event); |
| | 620 | + this.originalPageX = event.pageX; |
| | 621 | + this.originalPageY = event.pageY; |
| | 622 | + |
| | 623 | + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied |
| | 624 | + if(o.cursorAt) |
| | 625 | + this._adjustOffsetFromHelper(o.cursorAt); |
| | 626 | + |
| | 627 | + //Set a containment if given in the options |
| | 628 | + if(o.containment) |
| | 629 | + this._setContainment(); |
| | 630 | + |
| | 631 | + //Call plugins and callbacks |
| | 632 | + this._trigger("start", event); |
| | 633 | + |
| | 634 | + //Recache the helper size |
| | 635 | + this._cacheHelperProportions(); |
| | 636 | + |
| | 637 | + //Prepare the droppable offsets |
| | 638 | + if ($.ui.ddmanager && !o.dropBehaviour) |
| | 639 | + $.ui.ddmanager.prepareOffsets(this, event); |
| | 640 | + |
| | 641 | + this.helper.addClass("ui-draggable-dragging"); |
| | 642 | + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position |
| | 643 | + return true; |
| | 644 | + }, |
| | 645 | + |
| | 646 | + _mouseDrag: function(event, noPropagation) { |
| | 647 | + |
| | 648 | + //Compute the helpers position |
| | 649 | + this.position = this._generatePosition(event); |
| | 650 | + this.positionAbs = this._convertPositionTo("absolute"); |
| | 651 | + |
| | 652 | + //Call plugins and callbacks and use the resulting position if something is returned |
| | 653 | + if (!noPropagation) { |
| | 654 | + var ui = this._uiHash(); |
| | 655 | + this._trigger('drag', event, ui); |
| | 656 | + this.position = ui.position; |
| | 657 | + } |
| | 658 | + |
| | 659 | + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; |
| | 660 | + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; |
| | 661 | + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); |
| | 662 | + |
| | 663 | + return false; |
| | 664 | + }, |
| | 665 | + |
| | 666 | + _mouseStop: function(event) { |
| | 667 | + |
| | 668 | + //If we are using droppables, inform the manager about the drop |
| | 669 | + var dropped = false; |
| | 670 | + if ($.ui.ddmanager && !this.options.dropBehaviour) |
| | 671 | + dropped = $.ui.ddmanager.drop(this, event); |
| | 672 | + |
| | 673 | + //if a drop comes from outside (a sortable) |
| | 674 | + if(this.dropped) { |
| | 675 | + dropped = this.dropped; |
| | 676 | + this.dropped = false; |
| | 677 | + } |
| | 678 | + |
| | 679 | + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { |
| | 680 | + var self = this; |
| | 681 | + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { |
| | 682 | + self._trigger("stop", event); |
| | 683 | + self._clear(); |
| | 684 | + }); |
| | 685 | + } else { |
| | 686 | + this._trigger("stop", event); |
| | 687 | + this._clear(); |
| | 688 | + } |
| | 689 | + |
| | 690 | + return false; |
| | 691 | + }, |
| | 692 | + |
| | 693 | + _getHandle: function(event) { |
| | 694 | + |
| | 695 | + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; |
| | 696 | + $(this.options.handle, this.element) |
| | 697 | + .find("*") |
| | 698 | + .andSelf() |
| | 699 | + .each(function() { |
| | 700 | + if(this == event.target) handle = true; |
| | 701 | + }); |
| | 702 | + |
| | 703 | + return handle; |
| | 704 | + |
| | 705 | + }, |
| | 706 | + |
| | 707 | + _createHelper: function(event) { |
| | 708 | + |
| | 709 | + var o = this.options; |
| | 710 | + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); |
| | 711 | + |
| | 712 | + if(!helper.parents('body').length) |
| | 713 | + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); |
| | 714 | + |
| | 715 | + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) |
| | 716 | + helper.css("position", "absolute"); |
| | 717 | + |
| | 718 | + return helper; |
| | 719 | + |
| | 720 | + }, |
| | 721 | + |
| | 722 | + _adjustOffsetFromHelper: function(obj) { |
| | 723 | + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; |
| | 724 | + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; |
| | 725 | + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; |
| | 726 | + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; |
| | 727 | + }, |
| | 728 | + |
| | 729 | + _getParentOffset: function() { |
| | 730 | + |
| | 731 | + //Get the offsetParent and cache its position |
| | 732 | + this.offsetParent = this.helper.offsetParent(); |
| | 733 | + var po = this.offsetParent.offset(); |
| | 734 | + |
| | 735 | + // This is a special case where we need to modify a offset calculated on start, since the following happened: |
| | 736 | + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent |
| | 737 | + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that |
| | 738 | + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag |
| | 739 | + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { |
| | 740 | + po.left += this.scrollParent.scrollLeft(); |
| | 741 | + po.top += this.scrollParent.scrollTop(); |
| | 742 | + } |
| | 743 | + |
| | 744 | + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information |
| | 745 | + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix |
| | 746 | + po = { top: 0, left: 0 }; |
| | 747 | + |
| | 748 | + return { |
| | 749 | + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), |
| | 750 | + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) |
| | 751 | + }; |
| | 752 | + |
| | 753 | + }, |
| | 754 | + |
| | 755 | + _getRelativeOffset: function() { |
| | 756 | + |
| | 757 | + if(this.cssPosition == "relative") { |
| | 758 | + var p = this.element.position(); |
| | 759 | + return { |
| | 760 | + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), |
| | 761 | + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() |
| | 762 | + }; |
| | 763 | + } else { |
| | 764 | + return { top: 0, left: 0 }; |
| | 765 | + } |
| | 766 | + |
| | 767 | + }, |
| | 768 | + |
| | 769 | + _cacheMargins: function() { |
| | 770 | + this.margins = { |
| | 771 | + left: (parseInt(this.element.css("marginLeft"),10) || 0), |
| | 772 | + top: (parseInt(this.element.css("marginTop"),10) || 0) |
| | 773 | + }; |
| | 774 | + }, |
| | 775 | + |
| | 776 | + _cacheHelperProportions: function() { |
| | 777 | + this.helperProportions = { |
| | 778 | + width: this.helper.outerWidth(), |
| | 779 | + height: this.helper.outerHeight() |
| | 780 | + }; |
| | 781 | + }, |
| | 782 | + |
| | 783 | + _setContainment: function() { |
| | 784 | + |
| | 785 | + var o = this.options; |
| | 786 | + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; |
| | 787 | + if(o.containment == 'document' || o.containment == 'window') this.containment = [ |
| | 788 | + 0 - this.offset.relative.left - this.offset.parent.left, |
| | 789 | + 0 - this.offset.relative.top - this.offset.parent.top, |
| | 790 | + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, |
| | 791 | + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top |
| | 792 | + ]; |
| | 793 | + |
| | 794 | + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { |
| | 795 | + var ce = $(o.containment)[0]; if(!ce) return; |
| | 796 | + var co = $(o.containment).offset(); |
| | 797 | + var over = ($(ce).css("overflow") != 'hidden'); |
| | 798 | + |
| | 799 | + this.containment = [ |
| | 800 | + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, |
| | 801 | + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, |
| | 802 | + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, |
| | 803 | + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top |
| | 804 | + ]; |
| | 805 | + } else if(o.containment.constructor == Array) { |
| | 806 | + this.containment = o.containment; |
| | 807 | + } |
| | 808 | + |
| | 809 | + }, |
| | 810 | + |
| | 811 | + _convertPositionTo: function(d, pos) { |
| | 812 | + |
| | 813 | + if(!pos) pos = this.position; |
| | 814 | + var mod = d == "absolute" ? 1 : -1; |
| | 815 | + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); |
| | 816 | + |
| | 817 | + return { |
| | 818 | + top: ( |
| | 819 | + pos.top // The absolute mouse position |
| | 820 | + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent |
| | 821 | + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) |
| | 822 | + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) |
| | 823 | + ), |
| | 824 | + left: ( |
| | 825 | + pos.left // The absolute mouse position |
| | 826 | + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent |
| | 827 | + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) |
| | 828 | + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) |
| | 829 | + ) |
| | 830 | + }; |
| | 831 | + |
| | 832 | + }, |
| | 833 | + |
| | 834 | + _generatePosition: function(event) { |
| | 835 | + |
| | 836 | + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); |
| | 837 | + |
| | 838 | + // This is another very weird special case that only happens for relative elements: |
| | 839 | + // 1. If the css position is relative |
| | 840 | + // 2. and the scroll parent is the document or similar to the offset parent |
| | 841 | + // we have to refresh the relative offset during the scroll so there are no jumps |
| | 842 | + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { |
| | 843 | + this.offset.relative = this._getRelativeOffset(); |
| | 844 | + } |
| | 845 | + |
| | 846 | + var pageX = event.pageX; |
| | 847 | + var pageY = event.pageY; |
| | 848 | + |
| | 849 | + /* |
| | 850 | + * - Position constraining - |
| | 851 | + * Constrain the position to a mix of grid, containment. |
| | 852 | + */ |
| | 853 | + |
| | 854 | + if(this.originalPosition) { //If we are not dragging yet, we won't check for options |
| | 855 | + |
| | 856 | + if(this.containment) { |
| | 857 | + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; |
| | 858 | + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; |
| | 859 | + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; |
| | 860 | + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; |
| | 861 | + } |
| | 862 | + |
| | 863 | + if(o.grid) { |
| | 864 | + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; |
| | 865 | + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; |
| | 866 | + |
| | 867 | + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; |
| | 868 | + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; |
| | 869 | + } |
| | 870 | + |
| | 871 | + } |
| | 872 | + |
| | 873 | + return { |
| | 874 | + top: ( |
| | 875 | + pageY // The absolute mouse position |
| | 876 | + - this.offset.click.top // Click offset (relative to the element) |
| | 877 | + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent |
| | 878 | + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) |
| | 879 | + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) |
| | 880 | + ), |
| | 881 | + left: ( |
| | 882 | + pageX // The absolute mouse position |
| | 883 | + - this.offset.click.left // Click offset (relative to the element) |
| | 884 | + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent |
| | 885 | + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) |
| | 886 | + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) |
| | 887 | + ) |
| | 888 | + }; |
| | 889 | + |
| | 890 | + }, |
| | 891 | + |
| | 892 | + _clear: function() { |
| | 893 | + this.helper.removeClass("ui-draggable-dragging"); |
| | 894 | + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); |
| | 895 | + //if($.ui.ddmanager) $.ui.ddmanager.current = null; |
| | 896 | + this.helper = null; |
| | 897 | + this.cancelHelperRemoval = false; |
| | 898 | + }, |
| | 899 | + |
| | 900 | + // From now on bulk stuff - mainly helpers |
| | 901 | + |
| | 902 | + _trigger: function(type, event, ui) { |
| | 903 | + ui = ui || this._uiHash(); |
| | 904 | + $.ui.plugin.call(this, type, [event, ui]); |
| | 905 | + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins |
| | 906 | + return $.widget.prototype._trigger.call(this, type, event, ui); |
| | 907 | + }, |
| | 908 | + |
| | 909 | + plugins: {}, |
| | 910 | + |
| | 911 | + _uiHash: function(event) { |
| | 912 | + return { |
| | 913 | + helper: this.helper, |
| | 914 | + position: this.position, |
| | 915 | + absolutePosition: this.positionAbs, //deprecated |
| | 916 | + offset: this.positionAbs |
| | 917 | + }; |
| | 918 | + } |
| | 919 | + |
| | 920 | +})); |
| | 921 | + |
| | 922 | +$.extend($.ui.draggable, { |
| | 923 | + version: "1.7.2", |
| | 924 | + eventPrefix: "drag", |
| | 925 | + defaults: { |
| | 926 | + addClasses: true, |
| | 927 | + appendTo: "parent", |
| | 928 | + axis: false, |
| | 929 | + cancel: ":input,option", |
| | 930 | + connectToSortable: false, |
| | 931 | + containment: false, |
| | 932 | + cursor: "auto", |
| | 933 | + cursorAt: false, |
| | 934 | + delay: 0, |
| | 935 | + distance: 1, |
| | 936 | + grid: false, |
| | 937 | + handle: false, |
| | 938 | + helper: "original", |
| | 939 | + iframeFix: false, |
| | 940 | + opacity: false, |
| | 941 | + refreshPositions: false, |
| | 942 | + revert: false, |
| | 943 | + revertDuration: 500, |
| | 944 | + scope: "default", |
| | 945 | + scroll: true, |
| | 946 | + scrollSensitivity: 20, |
| | 947 | + scrollSpeed: 20, |
| | 948 | + snap: false, |
| | 949 | + snapMode: "both", |
| | 950 | + snapTolerance: 20, |
| | 951 | + stack: false, |
| | 952 | + zIndex: false |
| | 953 | + } |
| | 954 | +}); |
| | 955 | + |
| | 956 | +$.ui.plugin.add("draggable", "connectToSortable", { |
| | 957 | + start: function(event, ui) { |
| | 958 | + |
| | 959 | + var inst = $(this).data("draggable"), o = inst.options, |
| | 960 | + uiSortable = $.extend({}, ui, { item: inst.element }); |
| | 961 | + inst.sortables = []; |
| | 962 | + $(o.connectToSortable).each(function() { |
| | 963 | + var sortable = $.data(this, 'sortable'); |
| | 964 | + if (sortable && !sortable.options.disabled) { |
| | 965 | + inst.sortables.push({ |
| | 966 | + instance: sortable, |
| | 967 | + shouldRevert: sortable.options.revert |
| | 968 | + }); |
| | 969 | + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache |
| | 970 | + sortable._trigger("activate", event, uiSortable); |
| | 971 | + } |
| | 972 | + }); |
| | 973 | + |
| | 974 | + }, |
| | 975 | + stop: function(event, ui) { |
| | 976 | + |
| | 977 | + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper |
| | 978 | + var inst = $(this).data("draggable"), |
| | 979 | + uiSortable = $.extend({}, ui, { item: inst.element }); |
| | 980 | + |
| | 981 | + $.each(inst.sortables, function() { |
| | 982 | + if(this.instance.isOver) { |
| | 983 | + |
| | 984 | + this.instance.isOver = 0; |
| | 985 | + |
| | 986 | + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance |
| | 987 | + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) |
| | 988 | + |
| | 989 | + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' |
| | 990 | + if(this.shouldRevert) this.instance.options.revert = true; |
| | 991 | + |
| | 992 | + //Trigger the stop of the sortable |
| | 993 | + this.instance._mouseStop(event); |
| | 994 | + |
| | 995 | + this.instance.options.helper = this.instance.options._helper; |
| | 996 | + |
| | 997 | + //If the helper has been the original item, restore properties in the sortable |
| | 998 | + if(inst.options.helper == 'original') |
| | 999 | + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); |
| | 1000 | + |
| | 1001 | + } else { |
| | 1002 | + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance |
| | 1003 | + this.instance._trigger("deactivate", event, uiSortable); |
| | 1004 | + } |
| | 1005 | + |
| | 1006 | + }); |
| | 1007 | + |
| | 1008 | + }, |
| | 1009 | + drag: function(event, ui) { |
| | 1010 | + |
| | 1011 | + var inst = $(this).data("draggable"), self = this; |
| | 1012 | + |
| | 1013 | + var checkPos = function(o) { |
| | 1014 | + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; |
| | 1015 | + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; |
| | 1016 | + var itemHeight = o.height, itemWidth = o.width; |
| | 1017 | + var itemTop = o.top, itemLeft = o.left; |
| | 1018 | + |
| | 1019 | + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); |
| | 1020 | + }; |
| | 1021 | + |
| | 1022 | + $.each(inst.sortables, function(i) { |
| | 1023 | + |
| | 1024 | + //Copy over some variables to allow calling the sortable's native _intersectsWith |
| | 1025 | + this.instance.positionAbs = inst.positionAbs; |
| | 1026 | + this.instance.helperProportions = inst.helperProportions; |
| | 1027 | + this.instance.offset.click = inst.offset.click; |
| | 1028 | + |
| | 1029 | + if(this.instance._intersectsWith(this.instance.containerCache)) { |
| | 1030 | + |
| | 1031 | + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once |
| | 1032 | + if(!this.instance.isOver) { |
| | 1033 | + |
| | 1034 | + this.instance.isOver = 1; |
| | 1035 | + //Now we fake the start of dragging for the sortable instance, |
| | 1036 | + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem |
| | 1037 | + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) |
| | 1038 | + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); |
| | 1039 | + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it |
| | 1040 | + this.instance.options.helper = function() { return ui.helper[0]; }; |
| | 1041 | + |
| | 1042 | + event.target = this.instance.currentItem[0]; |
| | 1043 | + this.instance._mouseCapture(event, true); |
| | 1044 | + this.instance._mouseStart(event, true, true); |
| | 1045 | + |
| | 1046 | + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes |
| | 1047 | + this.instance.offset.click.top = inst.offset.click.top; |
| | 1048 | + this.instance.offset.click.left = inst.offset.click.left; |
| | 1049 | + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; |
| | 1050 | + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; |
| | 1051 | + |
| | 1052 | + inst._trigger("toSortable", event); |
| | 1053 | + inst.dropped = this.instance.element; //draggable revert needs that |
| | 1054 | + //hack so receive/update callbacks work (mostly) |
| | 1055 | + inst.currentItem = inst.element; |
| | 1056 | + this.instance.fromOutside = inst; |
| | 1057 | + |
| | 1058 | + } |
| | 1059 | + |
| | 1060 | + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable |
| | 1061 | + if(this.instance.currentItem) this.instance._mouseDrag(event); |
| | 1062 | + |
| | 1063 | + } else { |
| | 1064 | + |
| | 1065 | + //If it doesn't intersect with the sortable, and it intersected before, |
| | 1066 | + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval |
| | 1067 | + if(this.instance.isOver) { |
| | 1068 | + |
| | 1069 | + this.instance.isOver = 0; |
| | 1070 | + this.instance.cancelHelperRemoval = true; |
| | 1071 | + |
| | 1072 | + //Prevent reverting on this forced stop |
| | 1073 | + this.instance.options.revert = false; |
| | 1074 | + |
| | 1075 | + // The out event needs to be triggered independently |
| | 1076 | + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); |
| | 1077 | + |
| | 1078 | + this.instance._mouseStop(event, true); |
| | 1079 | + this.instance.options.helper = this.instance.options._helper; |
| | 1080 | + |
| | 1081 | + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size |
| | 1082 | + this.instance.currentItem.remove(); |
| | 1083 | + if(this.instance.placeholder) this.instance.placeholder.remove(); |
| | 1084 | + |
| | 1085 | + inst._trigger("fromSortable", event); |
| | 1086 | + inst.dropped = false; //draggable revert needs that |
| | 1087 | + } |
| | 1088 | + |
| | 1089 | + }; |
| | 1090 | + |
| | 1091 | + }); |
| | 1092 | + |
| | 1093 | + } |
| | 1094 | +}); |
| | 1095 | + |
| | 1096 | +$.ui.plugin.add("draggable", "cursor", { |
| | 1097 | + start: function(event, ui) { |
| | 1098 | + var t = $('body'), o = $(this).data('draggable').options; |
| | 1099 | + if (t.css("cursor")) o._cursor = t.css("cursor"); |
| | 1100 | + t.css("cursor", o.cursor); |
| | 1101 | + }, |
| | 1102 | + stop: function(event, ui) { |
| | 1103 | + var o = $(this).data('draggable').options; |
| | 1104 | + if (o._cursor) $('body').css("cursor", o._cursor); |
| | 1105 | + } |
| | 1106 | +}); |
| | 1107 | + |
| | 1108 | +$.ui.plugin.add("draggable", "iframeFix", { |
| | 1109 | + start: function(event, ui) { |
| | 1110 | + var o = $(this).data('draggable').options; |
| | 1111 | + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { |
| | 1112 | + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') |
| | 1113 | + .css({ |
| | 1114 | + width: this.offsetWidth+"px", height: this.offsetHeight+"px", |
| | 1115 | + position: "absolute", opacity: "0.001", zIndex: 1000 |
| | 1116 | + }) |
| | 1117 | + .css($(this).offset()) |
| | 1118 | + .appendTo("body"); |
| | 1119 | + }); |
| | 1120 | + }, |
| | 1121 | + stop: function(event, ui) { |
| | 1122 | + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers |
| | 1123 | + } |
| | 1124 | +}); |
| | 1125 | + |
| | 1126 | +$.ui.plugin.add("draggable", "opacity", { |
| | 1127 | + start: function(event, ui) { |
| | 1128 | + var t = $(ui.helper), o = $(this).data('draggable').options; |
| | 1129 | + if(t.css("opacity")) o._opacity = t.css("opacity"); |
| | 1130 | + t.css('opacity', o.opacity); |
| | 1131 | + }, |
| | 1132 | + stop: function(event, ui) { |
| | 1133 | + var o = $(this).data('draggable').options; |
| | 1134 | + if(o._opacity) $(ui.helper).css('opacity', o._opacity); |
| | 1135 | + } |
| | 1136 | +}); |
| | 1137 | + |
| | 1138 | +$.ui.plugin.add("draggable", "scroll", { |
| | 1139 | + start: function(event, ui) { |
| | 1140 | + var i = $(this).data("draggable"); |
| | 1141 | + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); |
| | 1142 | + }, |
| | 1143 | + drag: function(event, ui) { |
| | 1144 | + |
| | 1145 | + var i = $(this).data("draggable"), o = i.options, scrolled = false; |
| | 1146 | + |
| | 1147 | + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { |
| | 1148 | + |
| | 1149 | + if(!o.axis || o.axis != 'x') { |
| | 1150 | + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) |
| | 1151 | + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; |
| | 1152 | + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) |
| | 1153 | + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; |
| | 1154 | + } |
| | 1155 | + |
| | 1156 | + if(!o.axis || o.axis != 'y') { |
| | 1157 | + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) |
| | 1158 | + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; |
| | 1159 | + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) |
| | 1160 | + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; |
| | 1161 | + } |
| | 1162 | + |
| | 1163 | + } else { |
| | 1164 | + |
| | 1165 | + if(!o.axis || o.axis != 'x') { |
| | 1166 | + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) |
| | 1167 | + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); |
| | 1168 | + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) |
| | 1169 | + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); |
| | 1170 | + } |
| | 1171 | + |
| | 1172 | + if(!o.axis || o.axis != 'y') { |
| | 1173 | + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) |
| | 1174 | + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); |
| | 1175 | + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) |
| | 1176 | + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); |
| | 1177 | + } |
| | 1178 | + |
| | 1179 | + } |
| | 1180 | + |
| | 1181 | + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) |
| | 1182 | + $.ui.ddmanager.prepareOffsets(i, event); |
| | 1183 | + |
| | 1184 | + } |
| | 1185 | +}); |
| | 1186 | + |
| | 1187 | +$.ui.plugin.add("draggable", "snap", { |
| | 1188 | + start: function(event, ui) { |
| | 1189 | + |
| | 1190 | + var i = $(this).data("draggable"), o = i.options; |
| | 1191 | + i.snapElements = []; |
| | 1192 | + |
| | 1193 | + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { |
| | 1194 | + var $t = $(this); var $o = $t.offset(); |
| | 1195 | + if(this != i.element[0]) i.snapElements.push({ |
| | 1196 | + item: this, |
| | 1197 | + width: $t.outerWidth(), height: $t.outerHeight(), |
| | 1198 | + top: $o.top, left: $o.left |
| | 1199 | + }); |
| | 1200 | + }); |
| | 1201 | + |
| | 1202 | + }, |
| | 1203 | + drag: function(event, ui) { |
| | 1204 | + |
| | 1205 | + var inst = $(this).data("draggable"), o = inst.options; |
| | 1206 | + var d = o.snapTolerance; |
| | 1207 | + |
| | 1208 | + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, |
| | 1209 | + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; |
| | 1210 | + |
| | 1211 | + for (var i = inst.snapElements.length - 1; i >= 0; i--){ |
| | 1212 | + |
| | 1213 | + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, |
| | 1214 | + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; |
| | 1215 | + |
| | 1216 | + //Yes, I know, this is insane ;) |
| | 1217 | + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { |
| | 1218 | + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); |
| | 1219 | + inst.snapElements[i].snapping = false; |
| | 1220 | + continue; |
| | 1221 | + } |
| | 1222 | + |
| | 1223 | + if(o.snapMode != 'inner') { |
| | 1224 | + var ts = Math.abs(t - y2) <= d; |
| | 1225 | + var bs = Math.abs(b - y1) <= d; |
| | 1226 | + var ls = Math.abs(l - x2) <= d; |
| | 1227 | + var rs = Math.abs(r - x1) <= d; |
| | 1228 | + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; |
| | 1229 | + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; |
| | 1230 | + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; |
| | 1231 | + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; |
| | 1232 | + } |
| | 1233 | + |
| | 1234 | + var first = (ts || bs || ls || rs); |
| | 1235 | + |
| | 1236 | + if(o.snapMode != 'outer') { |
| | 1237 | + var ts = Math.abs(t - y1) <= d; |
| | 1238 | + var bs = Math.abs(b - y2) <= d; |
| | 1239 | + var ls = Math.abs(l - x1) <= d; |
| | 1240 | + var rs = Math.abs(r - x2) <= d; |
| | 1241 | + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; |
| | 1242 | + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; |
| | 1243 | + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; |
| | 1244 | + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; |
| | 1245 | + } |
| | 1246 | + |
| | 1247 | + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) |
| | 1248 | + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); |
| | 1249 | + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); |
| | 1250 | + |
| | 1251 | + }; |
| | 1252 | + |
| | 1253 | + } |
| | 1254 | +}); |
| | 1255 | + |
| | 1256 | +$.ui.plugin.add("draggable", "stack", { |
| | 1257 | + start: function(event, ui) { |
| | 1258 | + |
| | 1259 | + var o = $(this).data("draggable").options; |
| | 1260 | + |
| | 1261 | + var group = $.makeArray($(o.stack.group)).sort(function(a,b) { |
| | 1262 | + return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min); |
| | 1263 | + }); |
| | 1264 | + |
| | 1265 | + $(group).each(function(i) { |
| | 1266 | + this.style.zIndex = o.stack.min + i; |
| | 1267 | + }); |
| | 1268 | + |
| | 1269 | + this[0].style.zIndex = o.stack.min + group.length; |
| | 1270 | + |
| | 1271 | + } |
| | 1272 | +}); |
| | 1273 | + |
| | 1274 | +$.ui.plugin.add("draggable", "zIndex", { |
| | 1275 | + start: function(event, ui) { |
| | 1276 | + var t = $(ui.helper), o = $(this).data("draggable").options; |
| | 1277 | + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); |
| | 1278 | + t.css('zIndex', o.zIndex); |
| | 1279 | + }, |
| | 1280 | + stop: function(event, ui) { |
| | 1281 | + var o = $(this).data("draggable").options; |
| | 1282 | + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); |
| | 1283 | + } |
| | 1284 | +}); |
| | 1285 | + |
| | 1286 | +})(jQuery); |
| | 1287 | + |
| | 1288 | +/* |
| | 1289 | + * jQuery UI Droppable 1.7.2 |
| | 1290 | + * |
| | 1291 | + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) |
| | 1292 | + * Dual licensed under the MIT (MIT-LICENSE.txt) |
| | 1293 | + * and GPL (GPL-LICENSE.txt) licenses. |
| | 1294 | + * |
| | 1295 | + * http://docs.jquery.com/UI/Droppables |
| | 1296 | + * |
| | 1297 | + * Depends: |
| | 1298 | + * ui.core.js |
| | 1299 | + * ui.draggable.js |
| | 1300 | + */ |
| | 1301 | +(function($) { |
| | 1302 | + |
| | 1303 | +$.widget("ui.droppable", { |
| | 1304 | + |
| | 1305 | + _init: function() { |
| | 1306 | + |
| | 1307 | + var o = this.options, accept = o.accept; |
| | 1308 | + this.isover = 0; this.isout = 1; |
| | 1309 | + |
| | 1310 | + this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) { |
| | 1311 | + return d.is(accept); |
| | 1312 | + }; |
| | 1313 | + |
| | 1314 | + //Store the droppable's proportions |
| | 1315 | + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; |
| | 1316 | + |
| | 1317 | + // Add the reference and positions to the manager |
| | 1318 | + $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || []; |
| | 1319 | + $.ui.ddmanager.droppables[this.options.scope].push(this); |
| | 1320 | + |
| | 1321 | + (this.options.addClasses && this.element.addClass("ui-droppable")); |
| | 1322 | + |
| | 1323 | + }, |
| | 1324 | + |
| | 1325 | + destroy: function() { |
| | 1326 | + var drop = $.ui.ddmanager.droppables[this.options.scope]; |
| | 1327 | + for ( var i = 0; i < drop.length; i++ ) |
| | 1328 | + if ( drop[i] == this ) |
| | 1329 | + drop.splice(i, 1); |
| | 1330 | + |
| | 1331 | + this.element |
| | 1332 | + .removeClass("ui-droppable ui-droppable-disabled") |
| | 1333 | + .removeData("droppable") |
| | 1334 | + .unbind(".droppable"); |
| | 1335 | + }, |
| | 1336 | + |
| | 1337 | + _setData: function(key, value) { |
| | 1338 | + |
| | 1339 | + if(key == 'accept') { |
| | 1340 | + this.options.accept = value && $.isFunction(value) ? value : function(d) { |
| | 1341 | + return d.is(value); |
| | 1342 | + }; |
| | 1343 | + } else { |
| | 1344 | + $.widget.prototype._setData.apply(this, arguments); |
| | 1345 | + } |
| | 1346 | + |
| | 1347 | + }, |
| | 1348 | + |
| | 1349 | + _activate: function(event) { |
| | 1350 | + var draggable = $.ui.ddmanager.current; |
| | 1351 | + if(this.options.activeClass) this.element.addClass(this.options.activeClass); |
| | 1352 | + (draggable && this._trigger('activate', event, this.ui(draggable))); |
| | 1353 | + }, |
| | 1354 | + |
| | 1355 | + _deactivate: function(event) { |
| | 1356 | + var draggable = $.ui.ddmanager.current; |
| | 1357 | + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); |
| | 1358 | + (draggable && this._trigger('deactivate', event, this.ui(draggable))); |
| | 1359 | + }, |
| | 1360 | + |
| | 1361 | + _over: function(event) { |
| | 1362 | + |
| | 1363 | + var draggable = $.ui.ddmanager.current; |
| | 1364 | + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element |
| | 1365 | + |
| | 1366 | + if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { |
| | 1367 | + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); |
| | 1368 | + this._trigger('over', event, this.ui(draggable)); |
| | 1369 | + } |
| | 1370 | + |
| | 1371 | + }, |
| | 1372 | + |
| | 1373 | + _out: function(event) { |
| | 1374 | + |
| | 1375 | + var draggable = $.ui.ddmanager.current; |
| | 1376 | + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element |
| | 1377 | + |
| | 1378 | + if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { |
| | 1379 | + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); |
| | 1380 | + this._trigger('out', event, this.ui(draggable)); |
| | 1381 | + } |
| | 1382 | + |
| | 1383 | + }, |
| | 1384 | + |
| | 1385 | + _drop: function(event,custom) { |
| | 1386 | + |
| | 1387 | + var draggable = custom || $.ui.ddmanager.current; |
| | 1388 | + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element |
| | 1389 | + |
| | 1390 | + var childrenIntersection = false; |
| | 1391 | + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { |
| | 1392 | + var inst = $.data(this, 'droppable'); |
| | 1393 | + if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) { |
| | 1394 | + childrenIntersection = true; return false; |
| | 1395 | + } |
| | 1396 | + }); |
| | 1397 | + if(childrenIntersection) return false; |
| | 1398 | + |
| | 1399 | + if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { |
| | 1400 | + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); |
| | 1401 | + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); |
| | 1402 | + this._trigger('drop', event, this.ui(draggable)); |
| | 1403 | + return this.element; |
| | 1404 | + } |
| | 1405 | + |
| | 1406 | + return false; |
| | 1407 | + |
| | 1408 | + }, |
| | 1409 | + |
| | 1410 | + ui: function(c) { |
| | 1411 | + return { |
| | 1412 | + draggable: (c.currentItem || c.element), |
| | 1413 | + helper: c.helper, |
| | 1414 | + position: c.position, |
| | 1415 | + absolutePosition: c.positionAbs, //deprecated |
| | 1416 | + offset: c.positionAbs |
| | 1417 | + }; |
| | 1418 | + } |
| | 1419 | + |
| | 1420 | +}); |
| | 1421 | + |
| | 1422 | +$.extend($.ui.droppable, { |
| | 1423 | + version: "1.7.2", |
| | 1424 | + eventPrefix: 'drop', |
| | 1425 | + defaults: { |
| | 1426 | + accept: '*', |
| | 1427 | + activeClass: false, |
| | 1428 | + addClasses: true, |
| | 1429 | + greedy: false, |
| | 1430 | + hoverClass: false, |
| | 1431 | + scope: 'default', |
| | 1432 | + tolerance: 'intersect' |
| | 1433 | + } |
| | 1434 | +}); |
| | 1435 | + |
| | 1436 | +$.ui.intersect = function(draggable, droppable, toleranceMode) { |
| | 1437 | + |
| | 1438 | + if (!droppable.offset) return false; |
| | 1439 | + |
| | 1440 | + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, |
| | 1441 | + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; |
| | 1442 | + var l = droppable.offset.left, r = l + droppable.proportions.width, |
| | 1443 | + t = droppable.offset.top, b = t + droppable.proportions.height; |
| | 1444 | + |
| | 1445 | + switch (toleranceMode) { |
| | 1446 | + case 'fit': |
| | 1447 | + return (l < x1 && x2 < r |
| | 1448 | + && t < y1 && y2 < b); |
| | 1449 | + break; |
| | 1450 | + case 'intersect': |
| | 1451 | + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half |
| | 1452 | + && x2 - (draggable.helperProportions.width / 2) < r // Left Half |
| | 1453 | + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half |
| | 1454 | + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half |
| | 1455 | + break; |
| | 1456 | + case 'pointer': |
| | 1457 | + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), |
| | 1458 | + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), |
| | 1459 | + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); |
| | 1460 | + return isOver; |
| | 1461 | + break; |
| | 1462 | + case 'touch': |
| | 1463 | + return ( |
| | 1464 | + (y1 >= t && y1 <= b) || // Top edge touching |
| | 1465 | + (y2 >= t && y2 <= b) || // Bottom edge touching |
| | 1466 | + (y1 < t && y2 > b) // Surrounded vertically |
| | 1467 | + ) && ( |
| | 1468 | + (x1 >= l && x1 <= r) || // Left edge touching |
| | 1469 | + (x2 >= l && x2 <= r) || // Right edge touching |
| | 1470 | + (x1 < l && x2 > r) // Surrounded horizontally |
| | 1471 | + ); |
| | 1472 | + break; |
| | 1473 | + default: |
| | 1474 | + return false; |
| | 1475 | + break; |
| | 1476 | + } |
| | 1477 | + |
| | 1478 | +}; |
| | 1479 | + |
| | 1480 | +/* |
| | 1481 | + This manager tracks offsets of draggables and droppables |
| | 1482 | +*/ |
| | 1483 | +$.ui.ddmanager = { |
| | 1484 | + current: null, |
| | 1485 | + droppables: { 'default': [] }, |
| | 1486 | + prepareOffsets: function(t, event) { |
| | 1487 | + |
| | 1488 | + var m = $.ui.ddmanager.droppables[t.options.scope]; |
| | 1489 | + var type = event ? event.type : null; // workaround for #2317 |
| | 1490 | + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); |
| | 1491 | + |
| | 1492 | + droppablesLoop: for (var i = 0; i < m.length; i++) { |
| | 1493 | + |
| | 1494 | + if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted |
| | 1495 | + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item |
| | 1496 | + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue |
| | 1497 | + |
| | 1498 | + m[i].offset = m[i].element.offset(); |
| | 1499 | + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; |
| | 1500 | + |
| | 1501 | + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables |
| | 1502 | + |
| | 1503 | + } |
| | 1504 | + |
| | 1505 | + }, |
| | 1506 | + drop: function(draggable, event) { |
| | 1507 | + |
| | 1508 | + var dropped = false; |
| | 1509 | + $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { |
| | 1510 | + |
| | 1511 | + if(!this.options) return; |
| | 1512 | + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) |
| | 1513 | + dropped = this._drop.call(this, event); |
| | 1514 | + |
| | 1515 | + if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { |
| | 1516 | + this.isout = 1; this.isover = 0; |
| | 1517 | + this._deactivate.call(this, event); |
| | 1518 | + } |
| | 1519 | + |
| | 1520 | + }); |
| | 1521 | + return dropped; |
| | 1522 | + |
| | 1523 | + }, |
| | 1524 | + drag: function(draggable, event) { |
| | 1525 | + |
| | 1526 | + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. |
| | 1527 | + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); |
| | 1528 | + |
| | 1529 | + //Run through all droppables and check their positions based on specific tolerance options |
| | 1530 | + |
| | 1531 | + $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { |
| | 1532 | + |
| | 1533 | + if(this.options.disabled || this.greedyChild || !this.visible) return; |
| | 1534 | + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); |
| | 1535 | + |
| | 1536 | + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); |
| | 1537 | + if(!c) return; |
| | 1538 | + |
| | 1539 | + var parentInstance; |
| | 1540 | + if (this.options.greedy) { |
| | 1541 | + var parent = this.element.parents(':data(droppable):eq(0)'); |
| | 1542 | + if (parent.length) { |
| | 1543 | + parentInstance = $.data(parent[0], 'droppable'); |
| | 1544 | + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); |
| | 1545 | + } |
| | 1546 | + } |
| | 1547 | + |
| | 1548 | + // we just moved into a greedy child |
| | 1549 | + if (parentInstance && c == 'isover') { |
| | 1550 | + parentInstance['isover'] = 0; |
| | 1551 | + parentInstance['isout'] = 1; |
| | 1552 | + parentInstance._out.call(parentInstance, event); |
| | 1553 | + } |
| | 1554 | + |
| | 1555 | + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; |
| | 1556 | + this[c == "isover" ? "_over" : "_out"].call(this, event); |
| | 1557 | + |
| | 1558 | + // we just moved out of a greedy child |
| | 1559 | + if (parentInstance && c == 'isout') { |
| | 1560 | + parentInstance['isout'] = 0; |
| | 1561 | + parentInstance['isover'] = 1; |
| | 1562 | + parentInstance._over.call(parentInstance, event); |
| | 1563 | + } |
| | 1564 | + }); |
| | 1565 | + |
| | 1566 | + } |
| | 1567 | +}; |
| | 1568 | + |
| | 1569 | +})(jQuery); |
| | 1570 | + |
| | 1571 | +/* |
| | 1572 | + * jQuery UI Resizable 1.7.2 |
| | 1573 | + * |
| | 1574 | + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) |
| | 1575 | + * Dual licensed under the MIT (MIT-LICENSE.txt) |
| | 1576 | + * and GPL (GPL-LICENSE.txt) licenses. |
| | 1577 | + * |
| | 1578 | + * http://docs.jquery.com/UI/Resizables |
| | 1579 | + * |
| | 1580 | + * Depends: |
| | 1581 | + * ui.core.js |
| | 1582 | + */ |
| | 1583 | +(function($) { |
| | 1584 | + |
| | 1585 | +$.widget("ui.resizable", $.extend({}, $.ui.mouse, { |
| | 1586 | + |
| | 1587 | + _init: function() { |
| | 1588 | + |
| | 1589 | + var self = this, o = this.options; |
| | 1590 | + this.element.addClass("ui-resizable"); |
| | 1591 | + |
| | 1592 | + $.extend(this, { |
| | 1593 | + _aspectRatio: !!(o.aspectRatio), |
| | 1594 | + aspectRatio: o.aspectRatio, |
| | 1595 | + originalElement: this.element, |
| | 1596 | + _proportionallyResizeElements: [], |
| | 1597 | + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null |
| | 1598 | + }); |
| | 1599 | + |
| | 1600 | + //Wrap the element if it cannot hold child nodes |
| | 1601 | + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { |
| | 1602 | + |
| | 1603 | + //Opera fix for relative positioning |
| | 1604 | + if (/relative/.test(this.element.css('position')) && $.browser.opera) |
| | 1605 | + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); |
| | 1606 | + |
| | 1607 | + //Create a wrapper element and set the wrapper to the new current internal element |
| | 1608 | + this.element.wrap( |
| | 1609 | + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ |
| | 1610 | + position: this.element.css('position'), |
| | 1611 | + width: this.element.outerWidth(), |
| | 1612 | + height: this.element.outerHeight(), |
| | 1613 | + top: this.element.css('top'), |
| | 1614 | + left: this.element.css('left') |
| | 1615 | + }) |
| | 1616 | + ); |
| | 1617 | + |
| | 1618 | + //Overwrite the original this.element |
| | 1619 | + this.element = this.element.parent().data( |
| | 1620 | + "resizable", this.element.data('resizable') |
| | 1621 | + ); |
| | 1622 | + |
| | 1623 | + this.elementIsWrapper = true; |
| | 1624 | + |
| | 1625 | + //Move margins to the wrapper |
| | 1626 | + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); |
| | 1627 | + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); |
| | 1628 | + |
| | 1629 | + //Prevent Safari textarea resize |
| | 1630 | + this.originalResizeStyle = this.originalElement.css('resize'); |
| | 1631 | + this.originalElement.css('resize', 'none'); |
| | 1632 | + |
| | 1633 | + //Push the actual element to our proportionallyResize internal array |
| | 1634 | + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); |
| | 1635 | + |
| | 1636 | + // avoid IE jump (hard set the margin) |
| | 1637 | + this.originalElement.css({ margin: this.originalElement.css('margin') }); |
| | 1638 | + |
| | 1639 | + // fix handlers offset |
| | 1640 | + this._proportionallyResize(); |
| | 1641 | + |
| | 1642 | + } |
| | 1643 | + |
| | 1644 | + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); |
| | 1645 | + if(this.handles.constructor == String) { |
| | 1646 | + |
| | 1647 | + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; |
| | 1648 | + var n = this.handles.split(","); this.handles = {}; |
| | 1649 | + |
| | 1650 | + for(var i = 0; i < n.length; i++) { |
| | 1651 | + |
| | 1652 | + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; |
| | 1653 | + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); |
| | 1654 | + |
| | 1655 | + // increase zIndex of sw, se, ne, nw axis |
| | 1656 | + //TODO : this modifies original option |
| | 1657 | + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); |
| | 1658 | + |
| | 1659 | + //TODO : What's going on here? |
| | 1660 | + if ('se' == handle) { |
| | 1661 | + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); |
| | 1662 | + }; |
| | 1663 | + |
| | 1664 | + //Insert into internal handles object and append to element |
| | 1665 | + this.handles[handle] = '.ui-resizable-'+handle; |
| | 1666 | + this.element.append(axis); |
| | 1667 | + } |
| | 1668 | + |
| | 1669 | + } |
| | 1670 | + |
| | 1671 | + this._renderAxis = function(target) { |
| | 1672 | + |
| | 1673 | + target = target || this.element; |
| | 1674 | + |
| | 1675 | + for(var i in this.handles) { |
| | 1676 | + |
| | 1677 | + if(this.handles[i].constructor == String) |
| | 1678 | + this.handles[i] = $(this.handles[i], this.element).show(); |
| | 1679 | + |
| | 1680 | + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) |
| | 1681 | + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { |
| | 1682 | + |
| | 1683 | + var axis = $(this.handles[i], this.element), padWrapper = 0; |
| | 1684 | + |
| | 1685 | + //Checking the correct pad and border |
| | 1686 | + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); |
| | 1687 | + |
| | 1688 | + //The padding type i have to apply... |
| | 1689 | + var padPos = [ 'padding', |
| | 1690 | + /ne|nw|n/.test(i) ? 'Top' : |
| | 1691 | + /se|sw|s/.test(i) ? 'Bottom' : |
| | 1692 | + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); |
| | 1693 | + |
| | 1694 | + target.css(padPos, padWrapper); |
| | 1695 | + |
| | 1696 | + this._proportionallyResize(); |
| | 1697 | + |
| | 1698 | + } |
| | 1699 | + |
| | 1700 | + //TODO: What's that good for? There's not anything to be executed left |
| | 1701 | + if(!$(this.handles[i]).length) |
| | 1702 | + continue; |
| | 1703 | + |
| | 1704 | + } |
| | 1705 | + }; |
| | 1706 | + |
| | 1707 | + //TODO: make renderAxis a prototype function |
| | 1708 | + this._renderAxis(this.element); |
| | 1709 | + |
| | 1710 | + this._handles = $('.ui-resizable-handle', this.element) |
| | 1711 | + .disableSelection(); |
| | 1712 | + |
| | 1713 | + //Matching axis name |
| | 1714 | + this._handles.mouseover(function() { |
| | 1715 | + if (!self.resizing) { |
| | 1716 | + if (this.className) |
| | 1717 | + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); |
| | 1718 | + //Axis, default = se |
| | 1719 | + self.axis = axis && axis[1] ? axis[1] : 'se'; |
| | 1720 | + } |
| | 1721 | + }); |
| | 1722 | + |
| | 1723 | + //If we want to auto hide the elements |
| | 1724 | + if (o.autoHide) { |
| | 1725 | + this._handles.hide(); |
| | 1726 | + $(this.element) |
| | 1727 | + .addClass("ui-resizable-autohide") |
| | 1728 | + .hover(function() { |
| | 1729 | + $(this).removeClass("ui-resizable-autohide"); |
| | 1730 | + self._handles.show(); |
| | 1731 | + }, |
| | 1732 | + function(){ |
| | 1733 | + if (!self.resizing) { |
| | 1734 | + $(this).addClass("ui-resizable-autohide"); |
| | 1735 | + self._handles.hide(); |
| | 1736 | + } |
| | 1737 | + }); |
| | 1738 | + } |
| | 1739 | + |
| | 1740 | + //Initialize the mouse interaction |
| | 1741 | + this._mouseInit(); |
| | 1742 | + |
| | 1743 | + }, |
| | 1744 | + |
| | 1745 | + destroy: function() { |
| | 1746 | + |
| | 1747 | + this._mouseDestroy(); |
| | 1748 | + |
| | 1749 | + var _destroy = function(exp) { |
| | 1750 | + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") |
| | 1751 | + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); |
| | 1752 | + }; |
| | 1753 | + |
| | 1754 | + //TODO: Unwrap at same DOM position |
| | 1755 | + if (this.elementIsWrapper) { |
| | 1756 | + _destroy(this.element); |
| | 1757 | + var wrapper = this.element; |
| | 1758 | + wrapper.parent().append( |
| | 1759 | + this.originalElement.css({ |
| | 1760 | + position: wrapper.css('position'), |
| | 1761 | + width: wrapper.outerWidth(), |
| | 1762 | + height: wrapper.outerHeight(), |
| | 1763 | + top: wrapper.css('top'), |
| | 1764 | + left: wrapper.css('left') |
| | 1765 | + }) |
| | 1766 | + ).end().remove(); |
| | 1767 | + } |
| | 1768 | + |
| | 1769 | + this.originalElement.css('resize', this.originalResizeStyle); |
| | 1770 | + _destroy(this.originalElement); |
| | 1771 | + |
| | 1772 | + }, |
| | 1773 | + |
| | 1774 | + _mouseCapture: function(event) { |
| | 1775 | + |
| | 1776 | + var handle = false; |
| | 1777 | + for(var i in this.handles) { |
| | 1778 | + if($(this.handles[i])[0] == event.target) handle = true; |
| | 1779 | + } |
| | 1780 | + |
| | 1781 | + return this.options.disabled || !!handle; |
| | 1782 | + |
| | 1783 | + }, |
| | 1784 | + |
| | 1785 | + _mouseStart: function(event) { |
| | 1786 | + |
| | 1787 | + var o = this.options, iniPos = this.element.position(), el = this.element; |
| | 1788 | + |
| | 1789 | + this.resizing = true; |
| | 1790 | + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; |
| | 1791 | + |
| | 1792 | + // bugfix for http://dev.jquery.com/ticket/1749 |
| | 1793 | + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { |
| | 1794 | + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); |
| | 1795 | + } |
| | 1796 | + |
| | 1797 | + //Opera fixing relative position |
| | 1798 | + if ($.browser.opera && (/relative/).test(el.css('position'))) |
| | 1799 | + el.css({ position: 'relative', top: 'auto', left: 'auto' }); |
| | 1800 | + |
| | 1801 | + this._renderProxy(); |
| | 1802 | + |
| | 1803 | + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); |
| | 1804 | + |
| | 1805 | + if (o.containment) { |
| | 1806 | + curleft += $(o.containment).scrollLeft() || 0; |
| | 1807 | + curtop += $(o.containment).scrollTop() || 0; |
| | 1808 | + } |
| | 1809 | + |
| | 1810 | + //Store needed variables |
| | 1811 | + this.offset = this.helper.offset(); |
| | 1812 | + this.position = { left: curleft, top: curtop }; |
| | 1813 | + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; |
| | 1814 | + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; |
| | 1815 | + this.originalPosition = { left: curleft, top: curtop }; |
| | 1816 | + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; |
| | 1817 | + this.originalMousePosition = { left: event.pageX, top: event.pageY }; |
| | 1818 | + |
| | 1819 | + //Aspect Ratio |
| | 1820 | + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); |
| | 1821 | + |
| | 1822 | + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); |
| | 1823 | + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); |
| | 1824 | + |
| | 1825 | + el.addClass("ui-resizable-resizing"); |
| | 1826 | + this._propagate("start", event); |
| | 1827 | + return true; |
| | 1828 | + }, |
| | 1829 | + |
| | 1830 | + _mouseDrag: function(event) { |
| | 1831 | + |
| | 1832 | + //Increase performance, avoid regex |
| | 1833 | + var el = this.helper, o = this.options, props = {}, |
| | 1834 | + self = this, smp = this.originalMousePosition, a = this.axis; |
| | 1835 | + |
| | 1836 | + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; |
| | 1837 | + var trigger = this._change[a]; |
| | 1838 | + if (!trigger) return false; |
| | 1839 | + |
| | 1840 | + // Calculate the attrs that will be change |
| | 1841 | + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; |
| | 1842 | + |
| | 1843 | + if (this._aspectRatio || event.shiftKey) |
| | 1844 | + data = this._updateRatio(data, event); |
| | 1845 | + |
| | 1846 | + data = this._respectSize(data, event); |
| | 1847 | + |
| | 1848 | + // plugins callbacks need to be called first |
| | 1849 | + this._propagate("resize", event); |
| | 1850 | + |
| | 1851 | + el.css({ |
| | 1852 | + top: this.position.top + "px", left: this.position.left + "px", |
| | 1853 | + width: this.size.width + "px", height: this.size.height + "px" |
| | 1854 | + }); |
| | 1855 | + |
| | 1856 | + if (!this._helper && this._proportionallyResizeElements.length) |
| | 1857 | + this._proportionallyResize(); |
| | 1858 | + |
| | 1859 | + this._updateCache(data); |
| | 1860 | + |
| | 1861 | + // calling the user callback at the end |
| | 1862 | + this._trigger('resize', event, this.ui()); |
| | 1863 | + |
| | 1864 | + return false; |
| | 1865 | + }, |
| | 1866 | + |
| | 1867 | + _mouseStop: function(event) { |
| | 1868 | + |
| | 1869 | + this.resizing = false; |
| | 1870 | + var o = this.options, self = this; |
| | 1871 | + |
| | 1872 | + if(this._helper) { |
| | 1873 | + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), |
| | 1874 | + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, |
| | 1875 | + soffsetw = ista ? 0 : self.sizeDiff.width; |
| | 1876 | + |
| | 1877 | + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, |
| | 1878 | + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, |
| | 1879 | + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; |
| | 1880 | + |
| | 1881 | + if (!o.animate) |
| | 1882 | + this.element.css($.extend(s, { top: top, left: left })); |
| | 1883 | + |
| | 1884 | + self.helper.height(self.size.height); |
| | 1885 | + self.helper.width(self.size.width); |
| | 1886 | + |
| | 1887 | + if (this._helper && !o.animate) this._proportionallyResize(); |
| | 1888 | + } |
| | 1889 | + |
| | 1890 | + $('body').css('cursor', 'auto'); |
| | 1891 | + |
| | 1892 | + this.element.removeClass("ui-resizable-resizing"); |
| | 1893 | + |
| | 1894 | + this._propagate("stop", event); |
| | 1895 | + |
| | 1896 | + if (this._helper) this.helper.remove(); |
| | 1897 | + return false; |
| | 1898 | + |
| | 1899 | + }, |
| | 1900 | + |
| | 1901 | + _updateCache: function(data) { |
| | 1902 | + var o = this.options; |
| | 1903 | + this.offset = this.helper.offset(); |
| | 1904 | + if (isNumber(data.left)) this.position.left = data.left; |
| | 1905 | + if (isNumber(data.top)) this.position.top = data.top; |
| | 1906 | + if (isNumber(data.height)) this.size.height = data.height; |
| | 1907 | + if (isNumber(data.width)) this.size.width = data.width; |
| | 1908 | + }, |
| | 1909 | + |
| | 1910 | + _updateRatio: function(data, event) { |
| | 1911 | + |
| | 1912 | + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; |
| | 1913 | + |
| | 1914 | + if (data.height) data.width = (csize.height * this.aspectRatio); |
| | 1915 | + else if (data.width) data.height = (csize.width / this.aspectRatio); |
| | 1916 | + |
| | 1917 | + if (a == 'sw') { |
| | 1918 | + data.left = cpos.left + (csize.width - data.width); |
| | 1919 | + data.top = null; |
| | 1920 | + } |
| | 1921 | + if (a == 'nw') { |
| | 1922 | + data.top = cpos.top + (csize.height - data.height); |
| | 1923 | + data.left = cpos.left + (csize.width - data.width); |
| | 1924 | + } |
| | 1925 | + |
| | 1926 | + return data; |
| | 1927 | + }, |
| | 1928 | + |
| | 1929 | + _respectSize: function(data, event) { |
| | 1930 | + |
| | 1931 | + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, |
| | 1932 | + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), |
| | 1933 | + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); |
| | 1934 | + |
| | 1935 | + if (isminw) data.width = o.minWidth; |
| | 1936 | + if (isminh) data.height = o.minHeight; |
| | 1937 | + if (ismaxw) data.width = o.maxWidth; |
| | 1938 | + if (ismaxh) data.height = o.maxHeight; |
| | 1939 | + |
| | 1940 | + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; |
| | 1941 | + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); |
| | 1942 | + |
| | 1943 | + if (isminw && cw) data.left = dw - o.minWidth; |
| | 1944 | + if (ismaxw && cw) data.left = dw - o.maxWidth; |
| | 1945 | + if (isminh && ch) data.top = dh - o.minHeight; |
| | 1946 | + if (ismaxh && ch) data.top = dh - o.maxHeight; |
| | 1947 | + |
| | 1948 | + // fixing jump error on top/left - bug #2330 |
| | 1949 | + var isNotwh = !data.width && !data.height; |
| | 1950 | + if (isNotwh && !data.left && data.top) data.top = null; |
| | 1951 | + else if (isNotwh && !data.top && data.left) data.left = null; |
| | 1952 | + |
| | 1953 | + return data; |
| | 1954 | + }, |
| | 1955 | + |
| | 1956 | + _proportionallyResize: function() { |
| | 1957 | + |
| | 1958 | + var o = this.options; |
| | 1959 | + if (!this._proportionallyResizeElements.length) return; |
| | 1960 | + var element = this.helper || this.element; |
| | 1961 | + |
| | 1962 | + for (var i=0; i < this._proportionallyResizeElements.length; i++) { |
| | 1963 | + |
| | 1964 | + var prel = this._proportionallyResizeElements[i]; |
| | 1965 | + |
| | 1966 | + if (!this.borderDif) { |
| | 1967 | + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], |
| | 1968 | + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; |
| | 1969 | + |
| | 1970 | + this.borderDif = $.map(b, function(v, i) { |
| | 1971 | + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; |
| | 1972 | + return border + padding; |
| | 1973 | + }); |
| | 1974 | + } |
| | 1975 | + |
| | 1976 | + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) |
| | 1977 | + continue; |
| | 1978 | + |
| | 1979 | + prel.css({ |
| | 1980 | + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, |
| | 1981 | + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 |
| | 1982 | + }); |
| | 1983 | + |
| | 1984 | + }; |
| | 1985 | + |
| | 1986 | + }, |
| | 1987 | + |
| | 1988 | + _renderProxy: function() { |
| | 1989 | + |
| | 1990 | + var el = this.element, o = this.options; |
| | 1991 | + this.elementOffset = el.offset(); |
| | 1992 | + |
| | 1993 | + if(this._helper) { |
| | 1994 | + |
| | 1995 | + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); |
| | 1996 | + |
| | 1997 | + // fix ie6 offset TODO: This seems broken |
| | 1998 | + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), |
| | 1999 | + pxyoffset = ( ie6 ? 2 : -1 ); |
| | 2000 | + |
| | 2001 | + this.helper.addClass(this._helper).css({ |
| | 2002 | + width: this.element.outerWidth() + pxyoffset, |
| | 2003 | + height: this.element.outerHeight() + pxyoffset, |
| | 2004 | + position: 'absolute', |
| | 2005 | + left: this.elementOffset.left - ie6offset +'px', |
| | 2006 | + top: this.elementOffset.top - ie6offset +'px', |
| | 2007 | + zIndex: ++o.zIndex //TODO: Don't modify option |
| | 2008 | + }); |
| | 2009 | + |
| | 2010 | + this.helper |
| | 2011 | + .appendTo("body") |
| | 2012 | + .disableSelection(); |
| | 2013 | + |
| | 2014 | + } else { |
| | 2015 | + this.helper = this.element; |
| | 2016 | + } |
| | 2017 | + |
| | 2018 | + }, |
| | 2019 | + |
| | 2020 | + _change: { |
| | 2021 | + e: function(event, dx, dy) { |
| | 2022 | + return { width: this.originalSize.width + dx }; |
| | 2023 | + }, |
| | 2024 | + w: function(event, dx, dy) { |
| | 2025 | + var o = this.options, cs = this.originalSize, sp = this.originalPosition; |
| | 2026 | + return { left: sp.left + dx, width: cs.width - dx }; |
| | 2027 | + }, |
| | 2028 | + n: function(event, dx, dy) { |
| | 2029 | + var o = this.options, cs = this.originalSize, sp = this.originalPosition; |
| | 2030 | + return { top: sp.top + dy, height: cs.height - dy }; |
| | 2031 | + }, |
| | 2032 | + s: function(event, dx, dy) { |
| | 2033 | + return { height: this.originalSize.height + dy }; |
| | 2034 | + }, |
| | 2035 | + se: function(event, dx, dy) { |
| | 2036 | + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); |
| | 2037 | + }, |
| | 2038 | + sw: function(event, dx, dy) { |
| | 2039 | + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); |
| | 2040 | + }, |
| | 2041 | + ne: function(event, dx, dy) { |
| | 2042 | + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); |
| | 2043 | + }, |
| | 2044 | + nw: function(event, dx, dy) { |
| | 2045 | + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); |
| | 2046 | + } |
| | 2047 | + }, |
| | 2048 | + |
| | 2049 | + _propagate: function(n, event) { |
| | 2050 | + $.ui.plugin.call(this, n, [event, this.ui()]); |
| | 2051 | + (n != "resize" && this._trigger(n, event, this.ui())); |
| | 2052 | + }, |
| | 2053 | + |
| | 2054 | + plugins: {}, |
| | 2055 | + |
| | 2056 | + ui: function() { |
| | 2057 | + return { |
| | 2058 | + originalElement: this.originalElement, |
| | 2059 | + element: this.element, |
| | 2060 | + helper: this.helper, |
| | 2061 | + position: this.position, |
| | 2062 | + size: this.size, |
| | 2063 | + originalSize: this.originalSize, |
| | 2064 | + originalPosition: this.originalPosition |
| | 2065 | + }; |
| | 2066 | + } |
| | 2067 | + |
| | 2068 | +})); |
| | 2069 | + |
| | 2070 | +$.extend($.ui.resizable, { |
| | 2071 | + version: "1.7.2", |
| | 2072 | + eventPrefix: "resize", |
| | 2073 | + defaults: { |
| | 2074 | + alsoResize: false, |
| | 2075 | + animate: false, |
| | 2076 | + animateDuration: "slow", |
| | 2077 | + animateEasing: "swing", |
| | 2078 | + aspectRatio: false, |
| | 2079 | + autoHide: false, |
| | 2080 | + cancel: ":input,option", |
| | 2081 | + containment: false, |
| | 2082 | + delay: 0, |
| | 2083 | + distance: 1, |
| | 2084 | + ghost: false, |
| | 2085 | + grid: false, |
| | 2086 | + handles: "e,s,se", |
| | 2087 | + helper: false, |
| | 2088 | + maxHeight: null, |
| | 2089 | + maxWidth: null, |
| | 2090 | + minHeight: 10, |
| | 2091 | + minWidth: 10, |
| | 2092 | + zIndex: 1000 |
| | 2093 | + } |
| | 2094 | +}); |
| | 2095 | + |
| | 2096 | +/* |
| | 2097 | + * Resizable Extensions |
| | 2098 | + */ |
| | 2099 | + |
| | 2100 | +$.ui.plugin.add("resizable", "alsoResize", { |
| | 2101 | + |
| | 2102 | + start: function(event, ui) { |
| | 2103 | + |
| | 2104 | + var self = $(this).data("resizable"), o = self.options; |
| | 2105 | + |
| | 2106 | + _store = function(exp) { |
| | 2107 | + $(exp).each(function() { |
| | 2108 | + $(this).data("resizable-alsoresize", { |
| | 2109 | + width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10), |
| | 2110 | + left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10) |
| | 2111 | + }); |
| | 2112 | + }); |
| | 2113 | + }; |
| | 2114 | + |
| | 2115 | + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { |
| | 2116 | + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } |
| | 2117 | + else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); } |
| | 2118 | + }else{ |
| | 2119 | + _store(o.alsoResize); |
| | 2120 | + } |
| | 2121 | + }, |
| | 2122 | + |
| | 2123 | + resize: function(event, ui){ |
| | 2124 | + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; |
| | 2125 | + |
| | 2126 | + var delta = { |
| | 2127 | + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, |
| | 2128 | + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 |
| | 2129 | + }, |
| | 2130 | + |
| | 2131 | + _alsoResize = function(exp, c) { |
| | 2132 | + $(exp).each(function() { |
| | 2133 | + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left']; |
| | 2134 | + |
| | 2135 | + $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) { |
| | 2136 | + var sum = (start[prop]||0) + (delta[prop]||0); |
| | 2137 | + if (sum && sum >= 0) |
| | 2138 | + style[prop] = sum || null; |
| | 2139 | + }); |
| | 2140 | + |
| | 2141 | + //Opera fixing relative position |
| | 2142 | + if (/relative/.test(el.css('position')) && $.browser.opera) { |
| | 2143 | + self._revertToRelativePosition = true; |
| | 2144 | + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); |
| | 2145 | + } |
| | 2146 | + |
| | 2147 | + el.css(style); |
| | 2148 | + }); |
| | 2149 | + }; |
| | 2150 | + |
| | 2151 | + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { |
| | 2152 | + $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); }); |
| | 2153 | + }else{ |
| | 2154 | + _alsoResize(o.alsoResize); |
| | 2155 | + } |
| | 2156 | + }, |
| | 2157 | + |
| | 2158 | + stop: function(event, ui){ |
| | 2159 | + var self = $(this).data("resizable"); |
| | 2160 | + |
| | 2161 | + //Opera fixing relative position |
| | 2162 | + if (self._revertToRelativePosition && $.browser.opera) { |
| | 2163 | + self._revertToRelativePosition = false; |
| | 2164 | + el.css({ position: 'relative' }); |
| | 2165 | + } |
| | 2166 | + |
| | 2167 | + $(this).removeData("resizable-alsoresize-start"); |
| | 2168 | + } |
| | 2169 | +}); |
| | 2170 | + |
| | 2171 | +$.ui.plugin.add("resizable", "animate", { |
| | 2172 | + |
| | 2173 | + stop: function(event, ui) { |
| | 2174 | + var self = $(this).data("resizable"), o = self.options; |
| | 2175 | + |
| | 2176 | + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), |
| | 2177 | + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, |
| | 2178 | + soffsetw = ista ? 0 : self.sizeDiff.width; |
| | 2179 | + |
| | 2180 | + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, |
| | 2181 | + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, |
| | 2182 | + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; |
| | 2183 | + |
| | 2184 | + self.element.animate( |
| | 2185 | + $.extend(style, top && left ? { top: top, left: left } : {}), { |
| | 2186 | + duration: o.animateDuration, |
| | 2187 | + easing: o.animateEasing, |
| | 2188 | + step: function() { |
| | 2189 | + |
| | 2190 | + var data = { |
| | 2191 | + width: parseInt(self.element.css('width'), 10), |
| | 2192 | + height: parseInt(self.element.css('height'), 10), |
| | 2193 | + top: parseInt(self.element.css('top'), 10), |
| | 2194 | + left: parseInt(self.element.css('left'), 10) |
| | 2195 | + }; |
| | 2196 | + |
| | 2197 | + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); |
| | 2198 | + |
| | 2199 | + // propagating resize, and updating values for each animation step |
| | 2200 | + self._updateCache(data); |
| | 2201 | + self._propagate("resize", event); |
| | 2202 | + |
| | 2203 | + } |
| | 2204 | + } |
| | 2205 | + ); |
| | 2206 | + } |
| | 2207 | + |
| | 2208 | +}); |
| | 2209 | + |
| | 2210 | +$.ui.plugin.add("resizable", "containment", { |
| | 2211 | + |
| | 2212 | + start: function(event, ui) { |
| | 2213 | + var self = $(this).data("resizable"), o = self.options, el = self.element; |
| | 2214 | + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; |
| | 2215 | + if (!ce) return; |
| | 2216 | + |
| | 2217 | + self.containerElement = $(ce); |
| | 2218 | + |
| | 2219 | + if (/document/.test(oc) || oc == document) { |
| | 2220 | + self.containerOffset = { left: 0, top: 0 }; |
| | 2221 | + self.containerPosition = { left: 0, top: 0 }; |
| | 2222 | + |
| | 2223 | + self.parentData = { |
| | 2224 | + element: $(document), left: 0, top: 0, |
| | 2225 | + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight |
| | 2226 | + }; |
| | 2227 | + } |
| | 2228 | + |
| | 2229 | + // i'm a node, so compute top, left, right, bottom |
| | 2230 | + else { |
| | 2231 | + var element = $(ce), p = []; |
| | 2232 | + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); |
| | 2233 | + |
| | 2234 | + self.containerOffset = element.offset(); |
| | 2235 | + self.containerPosition = element.position(); |
| | 2236 | + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; |
| | 2237 | + |
| | 2238 | + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, |
| | 2239 | + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); |
| | 2240 | + |
| | 2241 | + self.parentData = { |
| | 2242 | + element: ce, left: co.left, top: co.top, width: width, height: height |
| | 2243 | + }; |
| | 2244 | + } |
| | 2245 | + }, |
| | 2246 | + |
| | 2247 | + resize: function(event, ui) { |
| | 2248 | + var self = $(this).data("resizable"), o = self.options, |
| | 2249 | + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, |
| | 2250 | + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; |
| | 2251 | + |
| | 2252 | + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; |
| | 2253 | + |
| | 2254 | + if (cp.left < (self._helper ? co.left : 0)) { |
| | 2255 | + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); |
| | 2256 | + if (pRatio) self.size.height = self.size.width / o.aspectRatio; |
| | 2257 | + self.position.left = o.helper ? co.left : 0; |
| | 2258 | + } |
| | 2259 | + |
| | 2260 | + if (cp.top < (self._helper ? co.top : 0)) { |
| | 2261 | + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); |
| | 2262 | + if (pRatio) self.size.width = self.size.height * o.aspectRatio; |
| | 2263 | + self.position.top = self._helper ? co.top : 0; |
| | 2264 | + } |
| | 2265 | + |
| | 2266 | + self.offset.left = self.parentData.left+self.position.left; |
| | 2267 | + self.offset.top = self.parentData.top+self.position.top; |
| | 2268 | + |
| | 2269 | + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), |
| | 2270 | + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); |
| | 2271 | + |
| | 2272 | + var isParent = self.containerElement.get(0) == self.element.parent().get(0), |
| | 2273 | + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); |
| | 2274 | + |
| | 2275 | + if(isParent && isOffsetRelative) woset -= self.parentData.left; |
| | 2276 | + |
| | 2277 | + if (woset + self.size.width >= self.parentData.width) { |
| | 2278 | + self.size.width = self.parentData.width - woset; |
| | 2279 | + if (pRatio) self.size.height = self.size.width / self.aspectRatio; |
| | 2280 | + } |
| | 2281 | + |
| | 2282 | + if (hoset + self.size.height >= self.parentData.height) { |
| | 2283 | + self.size.height = self.parentData.height - hoset; |
| | 2284 | + if (pRatio) self.size.width = self.size.height * self.aspectRatio; |
| | 2285 | + } |
| | 2286 | + }, |
| | 2287 | + |
| | 2288 | + stop: function(event, ui){ |
| | 2289 | + var self = $(this).data("resizable"), o = self.options, cp = self.position, |
| | 2290 | + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; |
| | 2291 | + |
| | 2292 | + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; |
| | 2293 | + |
| | 2294 | + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) |
| | 2295 | + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); |
| | 2296 | + |
| | 2297 | + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) |
| | 2298 | + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); |
| | 2299 | + |
| | 2300 | + } |
| | 2301 | +}); |
| | 2302 | + |
| | 2303 | +$.ui.plugin.add("resizable", "ghost", { |
| | 2304 | + |
| | 2305 | + start: function(event, ui) { |
| | 2306 | + |
| | 2307 | + var self = $(this).data("resizable"), o = self.options, cs = self.size; |
| | 2308 | + |
| | 2309 | + self.ghost = self.originalElement.clone(); |
| | 2310 | + self.ghost |
| | 2311 | + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) |
| | 2312 | + .addClass('ui-resizable-ghost') |
| | 2313 | + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); |
| | 2314 | + |
| | 2315 | + self.ghost.appendTo(self.helper); |
| | 2316 | + |
| | 2317 | + }, |
| | 2318 | + |
| | 2319 | + resize: function(event, ui){ |
| | 2320 | + var self = $(this).data("resizable"), o = self.options; |
| | 2321 | + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); |
| | 2322 | + }, |
| | 2323 | + |
| | 2324 | + stop: function(event, ui){ |
| | 2325 | + var self = $(this).data("resizable"), o = self.options; |
| | 2326 | + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); |
| | 2327 | + } |
| | 2328 | + |
| | 2329 | +}); |
| | 2330 | + |
| | 2331 | +$.ui.plugin.add("resizable", "grid", { |
| | 2332 | + |
| | 2333 | + resize: function(event, ui) { |
| | 2334 | + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; |
| | 2335 | + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; |
| | 2336 | + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); |
| | 2337 | + |
| | 2338 | + if (/^(se|s|e)$/.test(a)) { |
| | 2339 | + self.size.width = os.width + ox; |
| | 2340 | + self.size.height = os.height + oy; |
| | 2341 | + } |
| | 2342 | + else if (/^(ne)$/.test(a)) { |
| | 2343 | + self.size.width = os.width + ox; |
| | 2344 | + self.size.height = os.height + oy; |
| | 2345 | + self.position.top = op.top - oy; |
| | 2346 | + } |
| | 2347 | + else if (/^(sw)$/.test(a)) { |
| | 2348 | + self.size.width = os.width + ox; |
| | 2349 | + self.size.height = os.height + oy; |
| | 2350 | + self.position.left = op.left - ox; |
| | 2351 | + } |
| | 2352 | + else { |
| | 2353 | + self.size.width = os.width + ox; |
| | 2354 | + self.size.height = os.height + oy; |
| | 2355 | + self.position.top = op.top - oy; |
| | 2356 | + self.position.left = op.left - ox; |
| | 2357 | + } |
| | 2358 | + } |
| | 2359 | + |
| | 2360 | +}); |
| | 2361 | + |
| | 2362 | +var num = function(v) { |
| | 2363 | + return parseInt(v, 10) || 0; |
| | 2364 | +}; |
| | 2365 | + |
| | 2366 | +var isNumber = function(value) { |
| | 2367 | + return !isNaN(parseInt(value, 10)); |
| | 2368 | +}; |
| | 2369 | + |
| | 2370 | +})(jQuery); |
| | 2371 | +/* |
| | 2372 | + * jQuery UI Dialog 1.7.2 |
| | 2373 | + * |
| | 2374 | + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) |
| | 2375 | + * Dual licensed under the MIT (MIT-LICENSE.txt) |
| | 2376 | + * and GPL (GPL-LICENSE.txt) licenses. |
| | 2377 | + * |
| | 2378 | + * http://docs.jquery.com/UI/Dialog |
| | 2379 | + * |
| | 2380 | + * Depends: |
| | 2381 | + * ui.core.js |
| | 2382 | + * ui.draggable.js |
| | 2383 | + * ui.resizable.js |
| | 2384 | + */ |
| | 2385 | +(function($) { |
| | 2386 | + |
| | 2387 | +var setDataSwitch = { |
| | 2388 | + dragStart: "start.draggable", |
| | 2389 | + drag: "drag.draggable", |
| | 2390 | + dragStop: "stop.draggable", |
| | 2391 | + maxHeight: "maxHeight.resizable", |
| | 2392 | + minHeight: "minHeight.resizable", |
| | 2393 | + maxWidth: "maxWidth.resizable", |
| | 2394 | + minWidth: "minWidth.resizable", |
| | 2395 | + resizeStart: "start.resizable", |
| | 2396 | + resize: "drag.resizable", |
| | 2397 | + resizeStop: "stop.resizable" |
| | 2398 | + }, |
| | 2399 | + |
| | 2400 | + uiDialogClasses = |
| | 2401 | + 'ui-dialog ' + |
| | 2402 | + 'ui-widget ' + |
| | 2403 | + 'ui-widget-content ' + |
| | 2404 | + 'ui-corner-all '; |
| | 2405 | + |
| | 2406 | +$.widget("ui.dialog", { |
| | 2407 | + |
| | 2408 | + _init: function() { |
| | 2409 | + this.originalTitle = this.element.attr('title'); |
| | 2410 | + |
| | 2411 | + var self = this, |
| | 2412 | + options = this.options, |
| | 2413 | + |
| | 2414 | + title = options.title || this.originalTitle || ' ', |
| | 2415 | + titleId = $.ui.dialog.getTitleId(this.element), |
| | 2416 | + |
| | 2417 | + uiDialog = (this.uiDialog = $('<div/>')) |
| | 2418 | + .appendTo(document.body) |
| | 2419 | + .hide() |
| | 2420 | + .addClass(uiDialogClasses + options.dialogClass) |
| | 2421 | + .css({ |
| | 2422 | + position: 'absolute', |
| | 2423 | + overflow: 'hidden', |
| | 2424 | + zIndex: options.zIndex |
| | 2425 | + }) |
| | 2426 | + // setting tabIndex makes the div focusable |
| | 2427 | + // setting outline to 0 prevents a border on focus in Mozilla |
| | 2428 | + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { |
| | 2429 | + (options.closeOnEscape && event.keyCode |
| | 2430 | + && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event)); |
| | 2431 | + }) |
| | 2432 | + .attr({ |
| | 2433 | + role: 'dialog', |
| | 2434 | + 'aria-labelledby': titleId |
| | 2435 | + }) |
| | 2436 | + .mousedown(function(event) { |
| | 2437 | + self.moveToTop(false, event); |
| | 2438 | + }), |
| | 2439 | + |
| | 2440 | + uiDialogContent = this.element |
| | 2441 | + .show() |
| | 2442 | + .removeAttr('title') |
| | 2443 | + .addClass( |
| | 2444 | + 'ui-dialog-content ' + |
| | 2445 | + 'ui-widget-content') |
| | 2446 | + .appendTo(uiDialog), |
| | 2447 | + |
| | 2448 | + uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>')) |
| | 2449 | + .addClass( |
| | 2450 | + 'ui-dialog-titlebar ' + |
| | 2451 | + 'ui-widget-header ' + |
| | 2452 | + 'ui-corner-all ' + |
| | 2453 | + 'ui-helper-clearfix' |
| | 2454 | + ) |
| | 2455 | + .prependTo(uiDialog), |
| | 2456 | + |
| | 2457 | + uiDialogTitlebarClose = $('<a href="#"/>') |
| | 2458 | + .addClass( |
| | 2459 | + 'ui-dialog-titlebar-close ' + |
| | 2460 | + 'ui-corner-all' |
| | 2461 | + ) |
| | 2462 | + .attr('role', 'button') |
| | 2463 | + .hover( |
| | 2464 | + function() { |
| | 2465 | + uiDialogTitlebarClose.addClass('ui-state-hover'); |
| | 2466 | + }, |
| | 2467 | + function() { |
| | 2468 | + uiDialogTitlebarClose.removeClass('ui-state-hover'); |
| | 2469 | + } |
| | 2470 | + ) |
| | 2471 | + .focus(function() { |
| | 2472 | + uiDialogTitlebarClose.addClass('ui-state-focus'); |
| | 2473 | + }) |
| | 2474 | + .blur(function() { |
| | 2475 | + uiDialogTitlebarClose.removeClass('ui-state-focus'); |
| | 2476 | + }) |
| | 2477 | + .mousedown(function(ev) { |
| | 2478 | + ev.stopPropagation(); |
| | 2479 | + }) |
| | 2480 | + .click(function(event) { |
| | 2481 | + self.close(event); |
| | 2482 | + return false; |
| | 2483 | + }) |
| | 2484 | + .appendTo(uiDialogTitlebar), |
| | 2485 | + |
| | 2486 | + uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>')) |
| | 2487 | + .addClass( |
| | 2488 | + 'ui-icon ' + |
| | 2489 | + 'ui-icon-closethick' |
| | 2490 | + ) |
| | 2491 | + .text(options.closeText) |
| | 2492 | + .appendTo(uiDialogTitlebarClose), |
| | 2493 | + |
| | 2494 | + uiDialogTitle = $('<span/>') |
| | 2495 | + .addClass('ui-dialog-title') |
| | 2496 | + .attr('id', titleId) |
| | 2497 | + .html(title) |
| | 2498 | + .prependTo(uiDialogTitlebar); |
| | 2499 | + |
| | 2500 | + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); |
| | 2501 | + |
| | 2502 | + (options.draggable && $.fn.draggable && this._makeDraggable()); |
| | 2503 | + (options.resizable && $.fn.resizable && this._makeResizable()); |
| | 2504 | + |
| | 2505 | + this._createButtons(options.buttons); |
| | 2506 | + this._isOpen = false; |
| | 2507 | + |
| | 2508 | + (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); |
| | 2509 | + (options.autoOpen && this.open()); |
| | 2510 | + |
| | 2511 | + }, |
| | 2512 | + |
| | 2513 | + destroy: function() { |
| | 2514 | + (this.overlay && this.overlay.destroy()); |
| | 2515 | + this.uiDialog.hide(); |
| | 2516 | + this.element |
| | 2517 | + .unbind('.dialog') |
| | 2518 | + .removeData('dialog') |
| | 2519 | + .removeClass('ui-dialog-content ui-widget-content') |
| | 2520 | + .hide().appendTo('body'); |
| | 2521 | + this.uiDialog.remove(); |
| | 2522 | + |
| | 2523 | + (this.originalTitle && this.element.attr('title', this.originalTitle)); |
| | 2524 | + }, |
| | 2525 | + |
| | 2526 | + close: function(event) { |
| | 2527 | + var self = this; |
| | 2528 | + |
| | 2529 | + if (false === self._trigger('beforeclose', event)) { |
| | 2530 | + return; |
| | 2531 | + } |
| | 2532 | + |
| | 2533 | + (self.overlay && self.overlay.destroy()); |
| | 2534 | + self.uiDialog.unbind('keypress.ui-dialog'); |
| | 2535 | + |
| | 2536 | + (self.options.hide |
| | 2537 | + ? self.uiDialog.hide(self.options.hide, function() { |
| | 2538 | + self._trigger('close', event); |
| | 2539 | + }) |
| | 2540 | + : self.uiDialog.hide() && self._trigger('close', event)); |
| | 2541 | + |
| | 2542 | + $.ui.dialog.overlay.resize(); |
| | 2543 | + |
| | 2544 | + self._isOpen = false; |
| | 2545 | + |
| | 2546 | + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) |
| | 2547 | + if (self.options.modal) { |
| | 2548 | + var maxZ = 0; |
| | 2549 | + $('.ui-dialog').each(function() { |
| | 2550 | + if (this != self.uiDialog[0]) { |
| | 2551 | + maxZ = Math.max(maxZ, $(this).css('z-index')); |
| | 2552 | + } |
| | 2553 | + }); |
| | 2554 | + $.ui.dialog.maxZ = maxZ; |
| | 2555 | + } |
| | 2556 | + }, |
| | 2557 | + |
| | 2558 | + isOpen: function() { |
| | 2559 | + return this._isOpen; |
| | 2560 | + }, |
| | 2561 | + |
| | 2562 | + // the force parameter allows us to move modal dialogs to their correct |
| | 2563 | + // position on open |
| | 2564 | + moveToTop: function(force, event) { |
| | 2565 | + |
| | 2566 | + if ((this.options.modal && !force) |
| | 2567 | + || (!this.options.stack && !this.options.modal)) { |
| | 2568 | + return this._trigger('focus', event); |
| | 2569 | + } |
| | 2570 | + |
| | 2571 | + if (this.options.zIndex > $.ui.dialog.maxZ) { |
| | 2572 | + $.ui.dialog.maxZ = this.options.zIndex; |
| | 2573 | + } |
| | 2574 | + (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ)); |
| | 2575 | + |
| | 2576 | + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. |
| | 2577 | + // http://ui.jquery.com/bugs/ticket/3193 |
| | 2578 | + var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') }; |
| | 2579 | + this.uiDialog.css('z-index', ++$.ui.dialog.maxZ); |
| | 2580 | + this.element.attr(saveScroll); |
| | 2581 | + this._trigger('focus', event); |
| | 2582 | + }, |
| | 2583 | + |
| | 2584 | + open: function() { |
| | 2585 | + if (this._isOpen) { return; } |
| | 2586 | + |
| | 2587 | + var options = this.options, |
| | 2588 | + uiDialog = this.uiDialog; |
| | 2589 | + |
| | 2590 | + this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null; |
| | 2591 | + (uiDialog.next().length && uiDialog.appendTo('body')); |
| | 2592 | + this._size(); |
| | 2593 | + this._position(options.position); |
| | 2594 | + uiDialog.show(options.show); |
| | 2595 | + this.moveToTop(true); |
| | 2596 | + |
| | 2597 | + // prevent tabbing out of modal dialogs |
| | 2598 | + (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) { |
| | 2599 | + if (event.keyCode != $.ui.keyCode.TAB) { |
| | 2600 | + return; |
| | 2601 | + } |
| | 2602 | + |
| | 2603 | + var tabbables = $(':tabbable', this), |
| | 2604 | + first = tabbables.filter(':first')[0], |
| | 2605 | + last = tabbables.filter(':last')[0]; |
| | 2606 | + |
| | 2607 | + if (event.target == last && !event.shiftKey) { |
| | 2608 | + setTimeout(function() { |
| | 2609 | + first.focus(); |
| | 2610 | + }, 1); |
| | 2611 | + } else if (event.target == first && event.shiftKey) { |
| | 2612 | + setTimeout(function() { |
| | 2613 | + last.focus(); |
| | 2614 | + }, 1); |
| | 2615 | + } |
| | 2616 | + })); |
| | 2617 | + |
| | 2618 | + // set focus to the first tabbable element in the content area or the first button |
| | 2619 | + // if there are no tabbable elements, set focus on the dialog itself |
| | 2620 | + $([]) |
| | 2621 | + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) |
| | 2622 | + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) |
| | 2623 | + .add(uiDialog) |
| | 2624 | + .filter(':first') |
| | 2625 | + .focus(); |
| | 2626 | + |
| | 2627 | + this._trigger('open'); |
| | 2628 | + this._isOpen = true; |
| | 2629 | + }, |
| | 2630 | + |
| | 2631 | + _createButtons: function(buttons) { |
| | 2632 | + var self = this, |
| | 2633 | + hasButtons = false, |
| | 2634 | + uiDialogButtonPane = $('<div></div>') |
| | 2635 | + .addClass( |
| | 2636 | + 'ui-dialog-buttonpane ' + |
| | 2637 | + 'ui-widget-content ' + |
| | 2638 | + 'ui-helper-clearfix' |
| | 2639 | + ); |
| | 2640 | + |
| | 2641 | + // if we already have a button pane, remove it |
| | 2642 | + this.uiDialog.find('.ui-dialog-buttonpane').remove(); |
| | 2643 | + |
| | 2644 | + (typeof buttons == 'object' && buttons !== null && |
| | 2645 | + $.each(buttons, function() { return !(hasButtons = true); })); |
| | 2646 | + if (hasButtons) { |
| | 2647 | + $.each(buttons, function(name, fn) { |
| | 2648 | + $('<button type="button"></button>') |
| | 2649 | + .addClass( |
| | 2650 | + 'ui-state-default ' + |
| | 2651 | + 'ui-corner-all' |
| | 2652 | + ) |
| | 2653 | + .text(name) |
| | 2654 | + .click(function() { fn.apply(self.element[0], arguments); }) |
| | 2655 | + .hover( |
| | 2656 | + function() { |
| | 2657 | + $(this).addClass('ui-state-hover'); |
| | 2658 | + }, |
| | 2659 | + function() { |
| | 2660 | + $(this).removeClass('ui-state-hover'); |
| | 2661 | + } |
| | 2662 | + ) |
| | 2663 | + .focus(function() { |
| | 2664 | + $(this).addClass('ui-state-focus'); |
| | 2665 | + }) |
| | 2666 | + .blur(function() { |
| | 2667 | + $(this).removeClass('ui-state-focus'); |
| | 2668 | + }) |
| | 2669 | + .appendTo(uiDialogButtonPane); |
| | 2670 | + }); |
| | 2671 | + uiDialogButtonPane.appendTo(this.uiDialog); |
| | 2672 | + } |
| | 2673 | + }, |
| | 2674 | + |
| | 2675 | + _makeDraggable: function() { |
| | 2676 | + var self = this, |
| | 2677 | + options = this.options, |
| | 2678 | + heightBeforeDrag; |
| | 2679 | + |
| | 2680 | + this.uiDialog.draggable({ |
| | 2681 | + cancel: '.ui-dialog-content', |
| | 2682 | + handle: '.ui-dialog-titlebar', |
| | 2683 | + containment: 'document', |
| | 2684 | + start: function() { |
| | 2685 | + heightBeforeDrag = options.height; |
| | 2686 | + $(this).height($(this).height()).addClass("ui-dialog-dragging"); |
| | 2687 | + (options.dragStart && options.dragStart.apply(self.element[0], arguments)); |
| | 2688 | + }, |
| | 2689 | + drag: function() { |
| | 2690 | + (options.drag && options.drag.apply(self.element[0], arguments)); |
| | 2691 | + }, |
| | 2692 | + stop: function() { |
| | 2693 | + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); |
| | 2694 | + (options.dragStop && options.dragStop.apply(self.element[0], arguments)); |
| | 2695 | + $.ui.dialog.overlay.resize(); |
| | 2696 | + } |
| | 2697 | + }); |
| | 2698 | + }, |
| | 2699 | + |
| | 2700 | + _makeResizable: function(handles) { |
| | 2701 | + handles = (handles === undefined ? this.options.resizable : handles); |
| | 2702 | + var self = this, |
| | 2703 | + options = this.options, |
| | 2704 | + resizeHandles = typeof handles == 'string' |
| | 2705 | + ? handles |
| | 2706 | + : 'n,e,s,w,se,sw,ne,nw'; |
| | 2707 | + |
| | 2708 | + this.uiDialog.resizable({ |
| | 2709 | + cancel: '.ui-dialog-content', |
| | 2710 | + alsoResize: this.element, |
| | 2711 | + maxWidth: options.maxWidth, |
| | 2712 | + maxHeight: options.maxHeight, |
| | 2713 | + minWidth: options.minWidth, |
| | 2714 | + minHeight: options.minHeight, |
| | 2715 | + start: function() { |
| | 2716 | + $(this).addClass("ui-dialog-resizing"); |
| | 2717 | + (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); |
| | 2718 | + }, |
| | 2719 | + resize: function() { |
| | 2720 | + (options.resize && options.resize.apply(self.element[0], arguments)); |
| | 2721 | + }, |
| | 2722 | + handles: resizeHandles, |
| | 2723 | + stop: function() { |
| | 2724 | + $(this).removeClass("ui-dialog-resizing"); |
| | 2725 | + options.height = $(this).height(); |
| | 2726 | + options.width = $(this).width(); |
| | 2727 | + (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); |
| | 2728 | + $.ui.dialog.overlay.resize(); |
| | 2729 | + } |
| | 2730 | + }) |
| | 2731 | + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); |
| | 2732 | + }, |
| | 2733 | + |
| | 2734 | + _position: function(pos) { |
| | 2735 | + var wnd = $(window), doc = $(document), |
| | 2736 | + pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), |
| | 2737 | + minTop = pTop; |
| | 2738 | + |
| | 2739 | + if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { |
| | 2740 | + pos = [ |
| | 2741 | + pos == 'right' || pos == 'left' ? pos : 'center', |
| | 2742 | + pos == 'top' || pos == 'bottom' ? pos : 'middle' |
| | 2743 | + ]; |
| | 2744 | + } |
| | 2745 | + if (pos.constructor != Array) { |
| | 2746 | + pos = ['center', 'middle']; |
| | 2747 | + } |
| | 2748 | + if (pos[0].constructor == Number) { |
| | 2749 | + pLeft += pos[0]; |
| | 2750 | + } else { |
| | 2751 | + switch (pos[0]) { |
| | 2752 | + case 'left': |
| | 2753 | + pLeft += 0; |
| | 2754 | + break; |
| | 2755 | + case 'right': |
| | 2756 | + pLeft += wnd.width() - this.uiDialog.outerWidth(); |
| | 2757 | + break; |
| | 2758 | + default: |
| | 2759 | + case 'center': |
| | 2760 | + pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2; |
| | 2761 | + } |
| | 2762 | + } |
| | 2763 | + if (pos[1].constructor == Number) { |
| | 2764 | + pTop += pos[1]; |
| | 2765 | + } else { |
| | 2766 | + switch (pos[1]) { |
| | 2767 | + case 'top': |
| | 2768 | + pTop += 0; |
| | 2769 | + break; |
| | 2770 | + case 'bottom': |
| | 2771 | + pTop += wnd.height() - this.uiDialog.outerHeight(); |
| | 2772 | + break; |
| | 2773 | + default: |
| | 2774 | + case 'middle': |
| | 2775 | + pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2; |
| | 2776 | + } |
| | 2777 | + } |
| | 2778 | + |
| | 2779 | + // prevent the dialog from being too high (make sure the titlebar |
| | 2780 | + // is accessible) |
| | 2781 | + pTop = Math.max(pTop, minTop); |
| | 2782 | + this.uiDialog.css({top: pTop, left: pLeft}); |
| | 2783 | + }, |
| | 2784 | + |
| | 2785 | + _setData: function(key, value){ |
| | 2786 | + (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); |
| | 2787 | + switch (key) { |
| | 2788 | + case "buttons": |
| | 2789 | + this._createButtons(value); |
| | 2790 | + break; |
| | 2791 | + case "closeText": |
| | 2792 | + this.uiDialogTitlebarCloseText.text(value); |
| | 2793 | + break; |
| | 2794 | + case "dialogClass": |
| | 2795 | + this.uiDialog |
| | 2796 | + .removeClass(this.options.dialogClass) |
| | 2797 | + .addClass(uiDialogClasses + value); |
| | 2798 | + break; |
| | 2799 | + case "draggable": |
| | 2800 | + (value |
| | 2801 | + ? this._makeDraggable() |
| | 2802 | + : this.uiDialog.draggable('destroy')); |
| | 2803 | + break; |
| | 2804 | + case "height": |
| | 2805 | + this.uiDialog.height(value); |
| | 2806 | + break; |
| | 2807 | + case "position": |
| | 2808 | + this._position(value); |
| | 2809 | + break; |
| | 2810 | + case "resizable": |
| | 2811 | + var uiDialog = this.uiDialog, |
| | 2812 | + isResizable = this.uiDialog.is(':data(resizable)'); |
| | 2813 | + |
| | 2814 | + // currently resizable, becoming non-resizable |
| | 2815 | + (isResizable && !value && uiDialog.resizable('destroy')); |
| | 2816 | + |
| | 2817 | + // currently resizable, changing handles |
| | 2818 | + (isResizable && typeof value == 'string' && |
| | 2819 | + uiDialog.resizable('option', 'handles', value)); |
| | 2820 | + |
| | 2821 | + // currently non-resizable, becoming resizable |
| | 2822 | + (isResizable || this._makeResizable(value)); |
| | 2823 | + break; |
| | 2824 | + case "title": |
| | 2825 | + $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); |
| | 2826 | + break; |
| | 2827 | + case "width": |
| | 2828 | + this.uiDialog.width(value); |
| | 2829 | + break; |
| | 2830 | + } |
| | 2831 | + |
| | 2832 | + $.widget.prototype._setData.apply(this, arguments); |
| | 2833 | + }, |
| | 2834 | + |
| | 2835 | + _size: function() { |
| | 2836 | + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content |
| | 2837 | + * divs will both have width and height set, so we need to reset them |
| | 2838 | + */ |
| | 2839 | + var options = this.options; |
| | 2840 | + |
| | 2841 | + // reset content sizing |
| | 2842 | + this.element.css({ |
| | 2843 | + height: 0, |
| | 2844 | + minHeight: 0, |
| | 2845 | + width: 'auto' |
| | 2846 | + }); |
| | 2847 | + |
| | 2848 | + // reset wrapper sizing |
| | 2849 | + // determine the height of all the non-content elements |
| | 2850 | + var nonContentHeight = this.uiDialog.css({ |
| | 2851 | + height: 'auto', |
| | 2852 | + width: options.width |
| | 2853 | + }) |
| | 2854 | + .height(); |
| | 2855 | + |
| | 2856 | + this.element |
| | 2857 | + .css({ |
| | 2858 | + minHeight: Math.max(options.minHeight - nonContentHeight, 0), |
| | 2859 | + height: options.height == 'auto' |
| | 2860 | + ? 'auto' |
| | 2861 | + : Math.max(options.height - nonContentHeight, 0) |
| | 2862 | + }); |
| | 2863 | + } |
| | 2864 | +}); |
| | 2865 | + |
| | 2866 | +$.extend($.ui.dialog, { |
| | 2867 | + version: "1.7.2", |
| | 2868 | + defaults: { |
| | 2869 | + autoOpen: true, |
| | 2870 | + bgiframe: false, |
| | 2871 | + buttons: {}, |
| | 2872 | + closeOnEscape: true, |
| | 2873 | + closeText: 'close', |
| | 2874 | + dialogClass: '', |
| | 2875 | + draggable: true, |
| | 2876 | + hide: null, |
| | 2877 | + height: 'auto', |
| | 2878 | + maxHeight: false, |
| | 2879 | + maxWidth: false, |
| | 2880 | + minHeight: 150, |
| | 2881 | + minWidth: 150, |
| | 2882 | + modal: false, |
| | 2883 | + position: 'center', |
| | 2884 | + resizable: true, |
| | 2885 | + show: null, |
| | 2886 | + stack: true, |
| | 2887 | + title: '', |
| | 2888 | + width: 300, |
| | 2889 | + zIndex: 1000 |
| | 2890 | + }, |
| | 2891 | + |
| | 2892 | + getter: 'isOpen', |
| | 2893 | + |
| | 2894 | + uuid: 0, |
| | 2895 | + maxZ: 0, |
| | 2896 | + |
| | 2897 | + getTitleId: function($el) { |
| | 2898 | + return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); |
| | 2899 | + }, |
| | 2900 | + |
| | 2901 | + overlay: function(dialog) { |
| | 2902 | + this.$el = $.ui.dialog.overlay.create(dialog); |
| | 2903 | + } |
| | 2904 | +}); |
| | 2905 | + |
| | 2906 | +$.extend($.ui.dialog.overlay, { |
| | 2907 | + instances: [], |
| | 2908 | + maxZ: 0, |
| | 2909 | + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), |
| | 2910 | + function(event) { return event + '.dialog-overlay'; }).join(' '), |
| | 2911 | + create: function(dialog) { |
| | 2912 | + if (this.instances.length === 0) { |
| | 2913 | + // prevent use of anchors and inputs |
| | 2914 | + // we use a setTimeout in case the overlay is created from an |
| | 2915 | + // event that we're going to be cancelling (see #2804) |
| | 2916 | + setTimeout(function() { |
| | 2917 | + // handle $(el).dialog().dialog('close') (see #4065) |
| | 2918 | + if ($.ui.dialog.overlay.instances.length) { |
| | 2919 | + $(document).bind($.ui.dialog.overlay.events, function(event) { |
| | 2920 | + var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0; |
| | 2921 | + return (dialogZ > $.ui.dialog.overlay.maxZ); |
| | 2922 | + }); |
| | 2923 | + } |
| | 2924 | + }, 1); |
| | 2925 | + |
| | 2926 | + // allow closing by pressing the escape key |
| | 2927 | + $(document).bind('keydown.dialog-overlay', function(event) { |
| | 2928 | + (dialog.options.closeOnEscape && event.keyCode |
| | 2929 | + && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event)); |
| | 2930 | + }); |
| | 2931 | + |
| | 2932 | + // handle window resize |
| | 2933 | + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); |
| | 2934 | + } |
| | 2935 | + |
| | 2936 | + var $el = $('<div></div>').appendTo(document.body) |
| | 2937 | + .addClass('ui-widget-overlay').css({ |
| | 2938 | + width: this.width(), |
| | 2939 | + height: this.height() |
| | 2940 | + }); |
| | 2941 | + |
| | 2942 | + (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); |
| | 2943 | + |
| | 2944 | + this.instances.push($el); |
| | 2945 | + return $el; |
| | 2946 | + }, |
| | 2947 | + |
| | 2948 | + destroy: function($el) { |
| | 2949 | + this.instances.splice($.inArray(this.instances, $el), 1); |
| | 2950 | + |
| | 2951 | + if (this.instances.length === 0) { |
| | 2952 | + $([document, window]).unbind('.dialog-overlay'); |
| | 2953 | + } |
| | 2954 | + |
| | 2955 | + $el.remove(); |
| | 2956 | + |
| | 2957 | + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) |
| | 2958 | + var maxZ = 0; |
| | 2959 | + $.each(this.instances, function() { |
| | 2960 | + maxZ = Math.max(maxZ, this.css('z-index')); |
| | 2961 | + }); |
| | 2962 | + this.maxZ = maxZ; |
| | 2963 | + }, |
| | 2964 | + |
| | 2965 | + height: function() { |
| | 2966 | + // handle IE 6 |
| | 2967 | + if ($.browser.msie && $.browser.version < 7) { |
| | 2968 | + var scrollHeight = Math.max( |
| | 2969 | + document.documentElement.scrollHeight, |
| | 2970 | + document.body.scrollHeight |
| | 2971 | + ); |
| | 2972 | + var offsetHeight = Math.max( |
| | 2973 | + document.documentElement.offsetHeight, |
| | 2974 | + document.body.offsetHeight |
| | 2975 | + ); |
| | 2976 | + |
| | 2977 | + if (scrollHeight < offsetHeight) { |
| | 2978 | + return $(window).height() + 'px'; |
| | 2979 | + } else { |
| | 2980 | + return scrollHeight + 'px'; |
| | 2981 | + } |
| | 2982 | + // handle "good" browsers |
| | 2983 | + } else { |
| | 2984 | + return $(document).height() + 'px'; |
| | 2985 | + } |
| | 2986 | + }, |
| | 2987 | + |
| | 2988 | + width: function() { |
| | 2989 | + // handle IE 6 |
| | 2990 | + if ($.browser.msie && $.browser.version < 7) { |
| | 2991 | + var scrollWidth = Math.max( |
| | 2992 | + document.documentElement.scrollWidth, |
| | 2993 | + document.body.scrollWidth |
| | 2994 | + ); |
| | 2995 | + var offsetWidth = Math.max( |
| | 2996 | + document.documentElement.offsetWidth, |
| | 2997 | + document.body.offsetWidth |
| | 2998 | + ); |
| | 2999 | + |
| | 3000 | + if (scrollWidth < offsetWidth) { |
| | 3001 | + return $(window).width() + 'px'; |
| | 3002 | + } else { |
| | 3003 | + return scrollWidth + 'px'; |
| | 3004 | + } |
| | 3005 | + // handle "good" browsers |
| | 3006 | + } else { |
| | 3007 | + return $(document).width() + 'px'; |
| | 3008 | + } |
| | 3009 | + }, |
| | 3010 | + |
| | 3011 | + resize: function() { |
| | 3012 | + /* If the dialog is draggable and the user drags it past the |
| | 3013 | + * right edge of the window, the document becomes wider so we |
| | 3014 | + * need to stretch the overlay. If the user then drags the |
| | 3015 | + * dialog back to the left, the document will become narrower, |
| | 3016 | + * so we need to shrink the overlay to the appropriate size. |
| | 3017 | + * This is handled by shrinking the overlay before setting it |
| | 3018 | + * to the full document size. |
| | 3019 | + */ |
| | 3020 | + var $overlays = $([]); |
| | 3021 | + $.each($.ui.dialog.overlay.instances, function() { |
| | 3022 | + $overlays = $overlays.add(this); |
| | 3023 | + }); |
| | 3024 | + |
| | 3025 | + $overlays.css({ |
| | 3026 | + width: 0, |
| | 3027 | + height: 0 |
| | 3028 | + }).css({ |
| | 3029 | + width: $.ui.dialog.overlay.width(), |
| | 3030 | + height: $.ui.dialog.overlay.height() |
| | 3031 | + }); |
| | 3032 | + } |
| | 3033 | +}); |
| | 3034 | + |
| | 3035 | +$.extend($.ui.dialog.overlay.prototype, { |
| | 3036 | + destroy: function() { |
| | 3037 | + $.ui.dialog.overlay.destroy(this.$el); |
| | 3038 | + } |
| | 3039 | +}); |
| | 3040 | + |
| | 3041 | +})(jQuery); |
| | 3042 | +/* |
| | 3043 | + * jQuery UI Tabs 1.7.2 |
| | 3044 | + * |
| | 3045 | + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) |
| | 3046 | + * Dual licensed under the MIT (MIT-LICENSE.txt) |
| | 3047 | + * and GPL (GPL-LICENSE.txt) licenses. |
| | 3048 | + * |
| | 3049 | + * http://docs.jquery.com/UI/Tabs |
| | 3050 | + * |
| | 3051 | + * Depends: |
| | 3052 | + * ui.core.js |
| | 3053 | + */ |
| | 3054 | +(function($) { |
| | 3055 | + |
| | 3056 | +$.widget("ui.tabs", { |
| | 3057 | + |
| | 3058 | + _init: function() { |
| | 3059 | + if (this.options.deselectable !== undefined) { |
| | 3060 | + this.options.collapsible = this.options.deselectable; |
| | 3061 | + } |
| | 3062 | + this._tabify(true); |
| | 3063 | + }, |
| | 3064 | + |
| | 3065 | + _setData: function(key, value) { |
| | 3066 | + if (key == 'selected') { |
| | 3067 | + if (this.options.collapsible && value == this.options.selected) { |
| | 3068 | + return; |
| | 3069 | + } |
| | 3070 | + this.select(value); |
| | 3071 | + } |
| | 3072 | + else { |
| | 3073 | + this.options[key] = value; |
| | 3074 | + if (key == 'deselectable') { |
| | 3075 | + this.options.collapsible = value; |
| | 3076 | + } |
| | 3077 | + this._tabify(); |
| | 3078 | + } |
| | 3079 | + }, |
| | 3080 | + |
| | 3081 | + _tabId: function(a) { |
| | 3082 | + return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') || |
| | 3083 | + this.options.idPrefix + $.data(a); |
| | 3084 | + }, |
| | 3085 | + |
| | 3086 | + _sanitizeSelector: function(hash) { |
| | 3087 | + return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":" |
| | 3088 | + }, |
| | 3089 | + |
| | 3090 | + _cookie: function() { |
| | 3091 | + var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0])); |
| | 3092 | + return $.cookie.apply(null, [cookie].concat($.makeArray(arguments))); |
| | 3093 | + }, |
| | 3094 | + |
| | 3095 | + _ui: function(tab, panel) { |
| | 3096 | + return { |
| | 3097 | + tab: tab, |
| | 3098 | + panel: panel, |
| | 3099 | + index: this.anchors.index(tab) |
| | 3100 | + }; |
| | 3101 | + }, |
| | 3102 | + |
| | 3103 | + _cleanup: function() { |
| | 3104 | + // restore all former loading tabs labels |
| | 3105 | + this.lis.filter('.ui-state-processing').removeClass('ui-state-processing') |
| | 3106 | + .find('span:data(label.tabs)') |
| | 3107 | + .each(function() { |
| | 3108 | + var el = $(this); |
| | 3109 | + el.html(el.data('label.tabs')).removeData('label.tabs'); |
| | 3110 | + }); |
| | 3111 | + }, |
| | 3112 | + |
| | 3113 | + _tabify: function(init) { |
| | 3114 | + |
| | 3115 | + this.list = this.element.children('ul:first'); |
| | 3116 | + this.lis = $('li:has(a[href])', this.list); |
| | 3117 | + this.anchors = this.lis.map(function() { return $('a', this)[0]; }); |
| | 3118 | + this.panels = $([]); |
| | 3119 | + |
| | 3120 | + var self = this, o = this.options; |
| | 3121 | + |
| | 3122 | + var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash |
| | 3123 | + this.anchors.each(function(i, a) { |
| | 3124 | + var href = $(a).attr('href'); |
| | 3125 | + |
| | 3126 | + // For dynamically created HTML that contains a hash as href IE < 8 expands |
| | 3127 | + // such href to the full page url with hash and then misinterprets tab as ajax. |
| | 3128 | + // Same consideration applies for an added tab with a fragment identifier |
| | 3129 | + // since a[href=#fragment-identifier] does unexpectedly not match. |
| | 3130 | + // Thus normalize href attribute... |
| | 3131 | + var hrefBase = href.split('#')[0], baseEl; |
| | 3132 | + if (hrefBase && (hrefBase === location.toString().split('#')[0] || |
| | 3133 | + (baseEl = $('base')[0]) && hrefBase === baseEl.href)) { |
| | 3134 | + href = a.hash; |
| | 3135 | + a.href = href; |
| | 3136 | + } |
| | 3137 | + |
| | 3138 | + // inline tab |
| | 3139 | + if (fragmentId.test(href)) { |
| | 3140 | + self.panels = self.panels.add(self._sanitizeSelector(href)); |
| | 3141 | + } |
| | 3142 | + |
| | 3143 | + // remote tab |
| | 3144 | + else if (href != '#') { // prevent loading the page itself if href is just "#" |
| | 3145 | + $.data(a, 'href.tabs', href); // required for restore on destroy |
| | 3146 | + |
| | 3147 | + // TODO until #3808 is fixed strip fragment identifier from url |
| | 3148 | + // (IE fails to load from such url) |
| | 3149 | + $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data |
| | 3150 | + |
| | 3151 | + var id = self._tabId(a); |
| | 3152 | + a.href = '#' + id; |
| | 3153 | + var $panel = $('#' + id); |
| | 3154 | + if (!$panel.length) { |
| | 3155 | + $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom') |
| | 3156 | + .insertAfter(self.panels[i - 1] || self.list); |
| | 3157 | + $panel.data('destroy.tabs', true); |
| | 3158 | + } |
| | 3159 | + self.panels = self.panels.add($panel); |
| | 3160 | + } |
| | 3161 | + |
| | 3162 | + // invalid tab href |
| | 3163 | + else { |
| | 3164 | + o.disabled.push(i); |
| | 3165 | + } |
| | 3166 | + }); |
| | 3167 | + |
| | 3168 | + // initialization from scratch |
| | 3169 | + if (init) { |
| | 3170 | + |
| | 3171 | + // attach necessary classes for styling |
| | 3172 | + this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all'); |
| | 3173 | + this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); |
| | 3174 | + this.lis.addClass('ui-state-default ui-corner-top'); |
| | 3175 | + this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom'); |
| | 3176 | + |
| | 3177 | + // Selected tab |
| | 3178 | + // use "selected" option or try to retrieve: |
| | 3179 | + // 1. from fragment identifier in url |
| | 3180 | + // 2. from cookie |
| | 3181 | + // 3. from selected class attribute on <li> |
| | 3182 | + if (o.selected === undefined) { |
| | 3183 | + if (location.hash) { |
| | 3184 | + this.anchors.each(function(i, a) { |
| | 3185 | + if (a.hash == location.hash) { |
| | 3186 | + o.selected = i; |
| | 3187 | + return false; // break |
| | 3188 | + } |
| | 3189 | + }); |
| | 3190 | + } |
| | 3191 | + if (typeof o.selected != 'number' && o.cookie) { |
| | 3192 | + o.selected = parseInt(self._cookie(), 10); |
| | 3193 | + } |
| | 3194 | + if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) { |
| | 3195 | + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); |
| | 3196 | + } |
| | 3197 | + o.selected = o.selected || 0; |
| | 3198 | + } |
| | 3199 | + else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release |
| | 3200 | + o.selected = -1; |
| | 3201 | + } |
| | 3202 | + |
| | 3203 | + // sanity check - default to first tab... |
| | 3204 | + o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0; |
| | 3205 | + |
| | 3206 | + // Take disabling tabs via class attribute from HTML |
| | 3207 | + // into account and update option properly. |
| | 3208 | + // A selected tab cannot become disabled. |
| | 3209 | + o.disabled = $.unique(o.disabled.concat( |
| | 3210 | + $.map(this.lis.filter('.ui-state-disabled'), |
| | 3211 | + function(n, i) { return self.lis.index(n); } ) |
| | 3212 | + )).sort(); |
| | 3213 | + |
| | 3214 | + if ($.inArray(o.selected, o.disabled) != -1) { |
| | 3215 | + o.disabled.splice($.inArray(o.selected, o.disabled), 1); |
| | 3216 | + } |
| | 3217 | + |
| | 3218 | + // highlight selected tab |
| | 3219 | + this.panels.addClass('ui-tabs-hide'); |
| | 3220 | + this.lis.removeClass('ui-tabs-selected ui-state-active'); |
| | 3221 | + if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list |
| | 3222 | + this.panels.eq(o.selected).removeClass('ui-tabs-hide'); |
| | 3223 | + this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active'); |
| | 3224 | + |
| | 3225 | + // seems to be expected behavior that the show callback is fired |
| | 3226 | + self.element.queue("tabs", function() { |
| | 3227 | + self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected])); |
| | 3228 | + }); |
| | 3229 | + |
| | 3230 | + this.load(o.selected); |
| | 3231 | + } |
| | 3232 | + |
| | 3233 | + // clean up to avoid memory leaks in certain versions of IE 6 |
| | 3234 | + $(window).bind('unload', function() { |
| | 3235 | + self.lis.add(self.anchors).unbind('.tabs'); |
| | 3236 | + self.lis = self.anchors = self.panels = null; |
| | 3237 | + }); |
| | 3238 | + |
| | 3239 | + } |
| | 3240 | + // update selected after add/remove |
| | 3241 | + else { |
| | 3242 | + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); |
| | 3243 | + } |
| | 3244 | + |
| | 3245 | + // update collapsible |
| | 3246 | + this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible'); |
| | 3247 | + |
| | 3248 | + // set or update cookie after init and add/remove respectively |
| | 3249 | + if (o.cookie) { |
| | 3250 | + this._cookie(o.selected, o.cookie); |
| | 3251 | + } |
| | 3252 | + |
| | 3253 | + // disable tabs |
| | 3254 | + for (var i = 0, li; (li = this.lis[i]); i++) { |
| | 3255 | + $(li)[$.inArray(i, o.disabled) != -1 && |
| | 3256 | + !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled'); |
| | 3257 | + } |
| | 3258 | + |
| | 3259 | + // reset cache if switching from cached to not cached |
| | 3260 | + if (o.cache === false) { |
| | 3261 | + this.anchors.removeData('cache.tabs'); |
| | 3262 | + } |
| | 3263 | + |
| | 3264 | + // remove all handlers before, tabify may run on existing tabs after add or option change |
| | 3265 | + this.lis.add(this.anchors).unbind('.tabs'); |
| | 3266 | + |
| | 3267 | + if (o.event != 'mouseover') { |
| | 3268 | + var addState = function(state, el) { |
| | 3269 | + if (el.is(':not(.ui-state-disabled)')) { |
| | 3270 | + el.addClass('ui-state-' + state); |
| | 3271 | + } |
| | 3272 | + }; |
| | 3273 | + var removeState = function(state, el) { |
| | 3274 | + el.removeClass('ui-state-' + state); |
| | 3275 | + }; |
| | 3276 | + this.lis.bind('mouseover.tabs', function() { |
| | 3277 | + addState('hover', $(this)); |
| | 3278 | + }); |
| | 3279 | + this.lis.bind('mouseout.tabs', function() { |
| | 3280 | + removeState('hover', $(this)); |
| | 3281 | + }); |
| | 3282 | + this.anchors.bind('focus.tabs', function() { |
| | 3283 | + addState('focus', $(this).closest('li')); |
| | 3284 | + }); |
| | 3285 | + this.anchors.bind('blur.tabs', function() { |
| | 3286 | + removeState('focus', $(this).closest('li')); |
| | 3287 | + }); |
| | 3288 | + } |
| | 3289 | + |
| | 3290 | + // set up animations |
| | 3291 | + var hideFx, showFx; |
| | 3292 | + if (o.fx) { |
| | 3293 | + if ($.isArray(o.fx)) { |
| | 3294 | + hideFx = o.fx[0]; |
| | 3295 | + showFx = o.fx[1]; |
| | 3296 | + } |
| | 3297 | + else { |
| | 3298 | + hideFx = showFx = o.fx; |
| | 3299 | + } |
| | 3300 | + } |
| | 3301 | + |
| | 3302 | + // Reset certain styles left over from animation |
| | 3303 | + // and prevent IE's ClearType bug... |
| | 3304 | + function resetStyle($el, fx) { |
| | 3305 | + $el.css({ display: '' }); |
| | 3306 | + if ($.browser.msie && fx.opacity) { |
| | 3307 | + $el[0].style.removeAttribute('filter'); |
| | 3308 | + } |
| | 3309 | + } |
| | 3310 | + |
| | 3311 | + // Show a tab... |
| | 3312 | + var showTab = showFx ? |
| | 3313 | + function(clicked, $show) { |
| | 3314 | + $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active'); |
| | 3315 | + $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way |
| | 3316 | + .animate(showFx, showFx.duration || 'normal', function() { |
| | 3317 | + resetStyle($show, showFx); |
| | 3318 | + self._trigger('show', null, self._ui(clicked, $show[0])); |
| | 3319 | + }); |
| | 3320 | + } : |
| | 3321 | + function(clicked, $show) { |
| | 3322 | + $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active'); |
| | 3323 | + $show.removeClass('ui-tabs-hide'); |
| | 3324 | + self._trigger('show', null, self._ui(clicked, $show[0])); |
| | 3325 | + }; |
| | 3326 | + |
| | 3327 | + // Hide a tab, $show is optional... |
| | 3328 | + var hideTab = hideFx ? |
| | 3329 | + function(clicked, $hide) { |
| | 3330 | + $hide.animate(hideFx, hideFx.duration || 'normal', function() { |
| | 3331 | + self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default'); |
| | 3332 | + $hide.addClass('ui-tabs-hide'); |
| | 3333 | + resetStyle($hide, hideFx); |
| | 3334 | + self.element.dequeue("tabs"); |
| | 3335 | + }); |
| | 3336 | + } : |
| | 3337 | + function(clicked, $hide, $show) { |
| | 3338 | + self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default'); |
| | 3339 | + $hide.addClass('ui-tabs-hide'); |
| | 3340 | + self.element.dequeue("tabs"); |
| | 3341 | + }; |
| | 3342 | + |
| | 3343 | + // attach tab event handler, unbind to avoid duplicates from former tabifying... |
| | 3344 | + this.anchors.bind(o.event + '.tabs', function() { |
| | 3345 | + var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'), |
| | 3346 | + $show = $(self._sanitizeSelector(this.hash)); |
| | 3347 | + |
| | 3348 | + // If tab is already selected and not collapsible or tab disabled or |
| | 3349 | + // or is already loading or click callback returns false stop here. |
| | 3350 | + // Check if click handler returns false last so that it is not executed |
| | 3351 | + // for a disabled or loading tab! |
| | 3352 | + if (($li.hasClass('ui-tabs-selected') && !o.collapsible) || |
| | 3353 | + $li.hasClass('ui-state-disabled') || |
| | 3354 | + $li.hasClass('ui-state-processing') || |
| | 3355 | + self._trigger('select', null, self._ui(this, $show[0])) === false) { |
| | 3356 | + this.blur(); |
| | 3357 | + return false; |
| | 3358 | + } |
| | 3359 | + |
| | 3360 | + o.selected = self.anchors.index(this); |
| | 3361 | + |
| | 3362 | + self.abort(); |
| | 3363 | + |
| | 3364 | + // if tab may be closed |
| | 3365 | + if (o.collapsible) { |
| | 3366 | + if ($li.hasClass('ui-tabs-selected')) { |
| | 3367 | + o.selected = -1; |
| | 3368 | + |
| | 3369 | + if (o.cookie) { |
| | 3370 | + self._cookie(o.selected, o.cookie); |
| | 3371 | + } |
| | 3372 | + |
| | 3373 | + self.element.queue("tabs", function() { |
| | 3374 | + hideTab(el, $hide); |
| | 3375 | + }).dequeue("tabs"); |
| | 3376 | + |
| | 3377 | + this.blur(); |
| | 3378 | + return false; |
| | 3379 | + } |
| | 3380 | + else if (!$hide.length) { |
| | 3381 | + if (o.cookie) { |
| | 3382 | + self._cookie(o.selected, o.cookie); |
| | 3383 | + } |
| | 3384 | + |
| | 3385 | + self.element.queue("tabs", function() { |
| | 3386 | + showTab(el, $show); |
| | 3387 | + }); |
| | 3388 | + |
| | 3389 | + self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 |
| | 3390 | + |
| | 3391 | + this.blur(); |
| | 3392 | + return false; |
| | 3393 | + } |
| | 3394 | + } |
| | 3395 | + |
| | 3396 | + if (o.cookie) { |
| | 3397 | + self._cookie(o.selected, o.cookie); |
| | 3398 | + } |
| | 3399 | + |
| | 3400 | + // show new tab |
| | 3401 | + if ($show.length) { |
| | 3402 | + if ($hide.length) { |
| | 3403 | + self.element.queue("tabs", function() { |
| | 3404 | + hideTab(el, $hide); |
| | 3405 | + }); |
| | 3406 | + } |
| | 3407 | + self.element.queue("tabs", function() { |
| | 3408 | + showTab(el, $show); |
| | 3409 | + }); |
| | 3410 | + |
| | 3411 | + self.load(self.anchors.index(this)); |
| | 3412 | + } |
| | 3413 | + else { |
| | 3414 | + throw 'jQuery UI Tabs: Mismatching fragment identifier.'; |
| | 3415 | + } |
| | 3416 | + |
| | 3417 | + // Prevent IE from keeping other link focussed when using the back button |
| | 3418 | + // and remove dotted border from clicked link. This is controlled via CSS |
| | 3419 | + // in modern browsers; blur() removes focus from address bar in Firefox |
| | 3420 | + // which can become a usability and annoying problem with tabs('rotate'). |
| | 3421 | + if ($.browser.msie) { |
| | 3422 | + this.blur(); |
| | 3423 | + } |
| | 3424 | + |
| | 3425 | + }); |
| | 3426 | + |
| | 3427 | + // disable click in any case |
| | 3428 | + this.anchors.bind('click.tabs', function(){return false;}); |
| | 3429 | + |
| | 3430 | + }, |
| | 3431 | + |
| | 3432 | + destroy: function() { |
| | 3433 | + var o = this.options; |
| | 3434 | + |
| | 3435 | + this.abort(); |
| | 3436 | + |
| | 3437 | + this.element.unbind('.tabs') |
| | 3438 | + .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible') |
| | 3439 | + .removeData('tabs'); |
| | 3440 | + |
| | 3441 | + this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); |
| | 3442 | + |
| | 3443 | + this.anchors.each(function() { |
| | 3444 | + var href = $.data(this, 'href.tabs'); |
| | 3445 | + if (href) { |
| | 3446 | + this.href = href; |
| | 3447 | + } |
| | 3448 | + var $this = $(this).unbind('.tabs'); |
| | 3449 | + $.each(['href', 'load', 'cache'], function(i, prefix) { |
| | 3450 | + $this.removeData(prefix + '.tabs'); |
| | 3451 | + }); |
| | 3452 | + }); |
| | 3453 | + |
| | 3454 | + this.lis.unbind('.tabs').add(this.panels).each(function() { |
| | 3455 | + if ($.data(this, 'destroy.tabs')) { |
| | 3456 | + $(this).remove(); |
| | 3457 | + } |
| | 3458 | + else { |
| | 3459 | + $(this).removeClass([ |
| | 3460 | + 'ui-state-default', |
| | 3461 | + 'ui-corner-top', |
| | 3462 | + 'ui-tabs-selected', |
| | 3463 | + 'ui-state-active', |
| | 3464 | + 'ui-state-hover', |
| | 3465 | + 'ui-state-focus', |
| | 3466 | + 'ui-state-disabled', |
| | 3467 | + 'ui-tabs-panel', |
| | 3468 | + 'ui-widget-content', |
| | 3469 | + 'ui-corner-bottom', |
| | 3470 | + 'ui-tabs-hide' |
| | 3471 | + ].join(' ')); |
| | 3472 | + } |
| | 3473 | + }); |
| | 3474 | + |
| | 3475 | + if (o.cookie) { |
| | 3476 | + this._cookie(null, o.cookie); |
| | 3477 | + } |
| | 3478 | + }, |
| | 3479 | + |
| | 3480 | + add: function(url, label, index) { |
| | 3481 | + if (index === undefined) { |
| | 3482 | + index = this.anchors.length; // append by default |
| | 3483 | + } |
| | 3484 | + |
| | 3485 | + var self = this, o = this.options, |
| | 3486 | + $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)), |
| | 3487 | + id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]); |
| | 3488 | + |
| | 3489 | + $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true); |
| | 3490 | + |
| | 3491 | + // try to find an existing element before creating a new one |
| | 3492 | + var $panel = $('#' + id); |
| | 3493 | + if (!$panel.length) { |
| | 3494 | + $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true); |
| | 3495 | + } |
| | 3496 | + $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide'); |
| | 3497 | + |
| | 3498 | + if (index >= this.lis.length) { |
| | 3499 | + $li.appendTo(this.list); |
| | 3500 | + $panel.appendTo(this.list[0].parentNode); |
| | 3501 | + } |
| | 3502 | + else { |
| | 3503 | + $li.insertBefore(this.lis[index]); |
| | 3504 | + $panel.insertBefore(this.panels[index]); |
| | 3505 | + } |
| | 3506 | + |
| | 3507 | + o.disabled = $.map(o.disabled, |
| | 3508 | + function(n, i) { return n >= index ? ++n : n; }); |
| | 3509 | + |
| | 3510 | + this._tabify(); |
| | 3511 | + |
| | 3512 | + if (this.anchors.length == 1) { // after tabify |
| | 3513 | + $li.addClass('ui-tabs-selected ui-state-active'); |
| | 3514 | + $panel.removeClass('ui-tabs-hide'); |
| | 3515 | + this.element.queue("tabs", function() { |
| | 3516 | + self._trigger('show', null, self._ui(self.anchors[0], self.panels[0])); |
| | 3517 | + }); |
| | 3518 | + |
| | 3519 | + this.load(0); |
| | 3520 | + } |
| | 3521 | + |
| | 3522 | + // callback |
| | 3523 | + this._trigger('add', null, this._ui(this.anchors[index], this.panels[index])); |
| | 3524 | + }, |
| | 3525 | + |
| | 3526 | + remove: function(index) { |
| | 3527 | + var o = this.options, $li = this.lis.eq(index).remove(), |
| | 3528 | + $panel = this.panels.eq(index).remove(); |
| | 3529 | + |
| | 3530 | + // If selected tab was removed focus tab to the right or |
| | 3531 | + // in case the last tab was removed the tab to the left. |
| | 3532 | + if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) { |
| | 3533 | + this.select(index + (index + 1 < this.anchors.length ? 1 : -1)); |
| | 3534 | + } |
| | 3535 | + |
| | 3536 | + o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }), |
| | 3537 | + function(n, i) { return n >= index ? --n : n; }); |
| | 3538 | + |
| | 3539 | + this._tabify(); |
| | 3540 | + |
| | 3541 | + // callback |
| | 3542 | + this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0])); |
| | 3543 | + }, |
| | 3544 | + |
| | 3545 | + enable: function(index) { |
| | 3546 | + var o = this.options; |
| | 3547 | + if ($.inArray(index, o.disabled) == -1) { |
| | 3548 | + return; |
| | 3549 | + } |
| | 3550 | + |
| | 3551 | + this.lis.eq(index).removeClass('ui-state-disabled'); |
| | 3552 | + o.disabled = $.grep(o.disabled, function(n, i) { return n != index; }); |
| | 3553 | + |
| | 3554 | + // callback |
| | 3555 | + this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index])); |
| | 3556 | + }, |
| | 3557 | + |
| | 3558 | + disable: function(index) { |
| | 3559 | + var self = this, o = this.options; |
| | 3560 | + if (index != o.selected) { // cannot disable already selected tab |
| | 3561 | + this.lis.eq(index).addClass('ui-state-disabled'); |
| | 3562 | + |
| | 3563 | + o.disabled.push(index); |
| | 3564 | + o.disabled.sort(); |
| | 3565 | + |
| | 3566 | + // callback |
| | 3567 | + this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index])); |
| | 3568 | + } |
| | 3569 | + }, |
| | 3570 | + |
| | 3571 | + select: function(index) { |
| | 3572 | + if (typeof index == 'string') { |
| | 3573 | + index = this.anchors.index(this.anchors.filter('[href$=' + index + ']')); |
| | 3574 | + } |
| | 3575 | + else if (index === null) { // usage of null is deprecated, TODO remove in next release |
| | 3576 | + index = -1; |
| | 3577 | + } |
| | 3578 | + if (index == -1 && this.options.collapsible) { |
| | 3579 | + index = this.options.selected; |
| | 3580 | + } |
| | 3581 | + |
| | 3582 | + this.anchors.eq(index).trigger(this.options.event + '.tabs'); |
| | 3583 | + }, |
| | 3584 | + |
| | 3585 | + load: function(index) { |
| | 3586 | + var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs'); |
| | 3587 | + |
| | 3588 | + this.abort(); |
| | 3589 | + |
| | 3590 | + // not remote or from cache |
| | 3591 | + if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) { |
| | 3592 | + this.element.dequeue("tabs"); |
| | 3593 | + return; |
| | 3594 | + } |
| | 3595 | + |
| | 3596 | + // load remote from here on |
| | 3597 | + this.lis.eq(index).addClass('ui-state-processing'); |
| | 3598 | + |
| | 3599 | + if (o.spinner) { |
| | 3600 | + var span = $('span', a); |
| | 3601 | + span.data('label.tabs', span.html()).html(o.spinner); |
| | 3602 | + } |
| | 3603 | + |
| | 3604 | + this.xhr = $.ajax($.extend({}, o.ajaxOptions, { |
| | 3605 | + url: url, |
| | 3606 | + success: function(r, s) { |
| | 3607 | + $(self._sanitizeSelector(a.hash)).html(r); |
| | 3608 | + |
| | 3609 | + // take care of tab labels |
| | 3610 | + self._cleanup(); |
| | 3611 | + |
| | 3612 | + if (o.cache) { |
| | 3613 | + $.data(a, 'cache.tabs', true); // if loaded once do not load them again |
| | 3614 | + } |
| | 3615 | + |
| | 3616 | + // callbacks |
| | 3617 | + self._trigger('load', null, self._ui(self.anchors[index], self.panels[index])); |
| | 3618 | + try { |
| | 3619 | + o.ajaxOptions.success(r, s); |
| | 3620 | + } |
| | 3621 | + catch (e) {} |
| | 3622 | + |
| | 3623 | + // last, so that load event is fired before show... |
| | 3624 | + self.element.dequeue("tabs"); |
| | 3625 | + } |
| | 3626 | + })); |
| | 3627 | + }, |
| | 3628 | + |
| | 3629 | + abort: function() { |
| | 3630 | + // stop possibly running animations |
| | 3631 | + this.element.queue([]); |
| | 3632 | + this.panels.stop(false, true); |
| | 3633 | + |
| | 3634 | + // terminate pending requests from other tabs |
| | 3635 | + if (this.xhr) { |
| | 3636 | + this.xhr.abort(); |
| | 3637 | + delete this.xhr; |
| | 3638 | + } |
| | 3639 | + |
| | 3640 | + // take care of tab labels |
| | 3641 | + this._cleanup(); |
| | 3642 | + |
| | 3643 | + }, |
| | 3644 | + |
| | 3645 | + url: function(index, url) { |
| | 3646 | + this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url); |
| | 3647 | + }, |
| | 3648 | + |
| | 3649 | + length: function() { |
| | 3650 | + return this.anchors.length; |
| | 3651 | + } |
| | 3652 | + |
| | 3653 | +}); |
| | 3654 | + |
| | 3655 | +$.extend($.ui.tabs, { |
| | 3656 | + version: '1.7.2', |
| | 3657 | + getter: 'length', |
| | 3658 | + defaults: { |
| | 3659 | + ajaxOptions: null, |
| | 3660 | + cache: false, |
| | 3661 | + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } |
| | 3662 | + collapsible: false, |
| | 3663 | + disabled: [], |
| | 3664 | + event: 'click', |
| | 3665 | + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } |
| | 3666 | + idPrefix: 'ui-tabs-', |
| | 3667 | + panelTemplate: '<div></div>', |
| | 3668 | + spinner: '<em>Loading…</em>', |
| | 3669 | + tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>' |
| | 3670 | + } |
| | 3671 | +}); |
| | 3672 | + |
| | 3673 | +/* |
| | 3674 | + * Tabs Extensions |
| | 3675 | + */ |
| | 3676 | + |
| | 3677 | +/* |
| | 3678 | + * Rotate |
| | 3679 | + */ |
| | 3680 | +$.extend($.ui.tabs.prototype, { |
| | 3681 | + rotation: null, |
| | 3682 | + rotate: function(ms, continuing) { |
| | 3683 | + |
| | 3684 | + var self = this, o = this.options; |
| | 3685 | + |
| | 3686 | + var rotate = self._rotate || (self._rotate = function(e) { |
| | 3687 | + clearTimeout(self.rotation); |
| | 3688 | + self.rotation = setTimeout(function() { |
| | 3689 | + var t = o.selected; |
| | 3690 | + self.select( ++t < self.anchors.length ? t : 0 ); |
| | 3691 | + }, ms); |
| | 3692 | + |
| | 3693 | + if (e) { |
| | 3694 | + e.stopPropagation(); |
| | 3695 | + } |
| | 3696 | + }); |
| | 3697 | + |
| | 3698 | + var stop = self._unrotate || (self._unrotate = !continuing ? |
| | 3699 | + function(e) { |
| | 3700 | + if (e.clientX) { // in case of a true click |
| | 3701 | + self.rotate(null); |
| | 3702 | + } |
| | 3703 | + } : |
| | 3704 | + function(e) { |
| | 3705 | + t = o.selected; |
| | 3706 | + rotate(); |
| | 3707 | + }); |
| | 3708 | + |
| | 3709 | + // start rotation |
| | 3710 | + if (ms) { |
| | 3711 | + this.element.bind('tabsshow', rotate); |
| | 3712 | + this.anchors.bind(o.event + '.tabs', stop); |
| | 3713 | + rotate(); |
| | 3714 | + } |
| | 3715 | + // stop rotation |
| | 3716 | + else { |
| | 3717 | + clearTimeout(self.rotation); |
| | 3718 | + this.element.unbind('tabsshow', rotate); |
| | 3719 | + this.anchors.unbind(o.event + '.tabs', stop); |
| | 3720 | + delete this._rotate; |
| | 3721 | + delete this._unrotate; |
| | 3722 | + } |
| | 3723 | + } |
| | 3724 | +}); |
| | 3725 | + |
| | 3726 | +})(jQuery); |
| | 3727 | +/* JavaScript for MediaWIki JS2 */ |
| | 3728 | + |
| | 3729 | +/** |
| | 3730 | + * This is designed to be directly compatible with (and is essentially taken |
| | 3731 | + * directly from) the mv_embed code for bringing internationalized messages into |
| | 3732 | + * the JavaScript space. As such, if we get to the point of merging that stuff |
| | 3733 | + * into the main branch this code will be uneeded and probably cause issues. |
| | 3734 | + */ |
| | 3735 | +// Creates global message object if not already in existence |
| | 3736 | +if ( !gMsg ) var gMsg = {}; |
| | 3737 | +if( ! mw ) var mw = { }; |
| | 3738 | + |
| | 3739 | +/** |
| | 3740 | + * Caches a list of messages for later retrieval |
| | 3741 | + * @param {Object} msgSet Hash of key:value pairs of messages to cache |
| | 3742 | + */ |
| | 3743 | +if( ! mw.addMessages ){ |
| | 3744 | + mw.addMessages = function( msgSet ){ |
| | 3745 | + for ( var i in msgSet ){ |
| | 3746 | + gMsg[ i ] = msgSet[i]; |
| | 3747 | + } |
| | 3748 | + } |
| | 3749 | +} |
| | 3750 | + |
| | 3751 | +/** |
| | 3752 | + * Retieves a message from the global message cache, performing on-the-fly |
| | 3753 | + * replacements using MediaWiki message syntax ($1, $2, etc.) |
| | 3754 | + * @param {String} key Name of message as it is in MediaWiki |
| | 3755 | + * @param {Array} args Array of replacement arguments |
| | 3756 | + */ |
| | 3757 | +function gM( key, args ) { |
| | 3758 | + var ms = ''; |
| | 3759 | + if ( key in gMsg ) { |
| | 3760 | + ms = gMsg[ key ]; |
| | 3761 | + if ( typeof args == 'object' || typeof args == 'array' ) { |
| | 3762 | + for ( var v in args ){ |
| | 3763 | + var rep = '\$'+ ( parseInt(v) + 1 ); |
| | 3764 | + ms = ms.replace( rep, args[v]); |
| | 3765 | + } |
| | 3766 | + } else if ( typeof args =='string' || typeof args =='number' ) { |
| | 3767 | + ms = ms.replace( /\$1/, args ); |
| | 3768 | + } |
| | 3769 | + return ms; |
| | 3770 | + } else { |
| | 3771 | + return '[' + key + ']'; |
| | 3772 | + } |
| | 3773 | +} |
| | 3774 | +/** |
| | 3775 | + * Mimics the no-conflict method used by the js2 stuff |
| | 3776 | + */ |
| | 3777 | +$j = jQuery.noConflict(); |
| | 3778 | +/** |
| | 3779 | + * Provides js2 compatible onload hook |
| | 3780 | + * @param func Function to call when ready |
| | 3781 | + */ |
| | 3782 | +mw.addOnloadHook = function( func ) { |
| | 3783 | + $j(document).ready( func ); |
| | 3784 | +} |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/jquery/plugins.js |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 3785 | 3785 | + native |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/langrid/TranslatedThread.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 3786 | 3786 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/langrid/SourceView.php |
| — | — | @@ -1,53 +1,53 @@ |
| 2 | | -<?php
|
| 3 | | -class SourceView {
|
| 4 | | - public $thread;
|
| 5 | | - public $langridAccessObject;
|
| 6 | | - public $request;
|
| 7 | | -
|
| 8 | | - function __construct( $thread, $request ) {
|
| 9 | | - $this->thread = $thread;
|
| 10 | | - $this->langridAccessObject = new LanguageGridAccessObject();
|
| 11 | | - $this->request = $request;
|
| 12 | | - }
|
| 13 | | -
|
| 14 | | - function methodAppliesToThread( $method ) {
|
| 15 | | - return $this->request->getVal( 'lqt_method' ) == $method &&
|
| 16 | | - $this->request->getVal( 'lqt_operand' ) == $this->thread->id();
|
| 17 | | - }
|
| 18 | | -
|
| 19 | | - function getMethod() {
|
| 20 | | - return $this->request->getVal( 'lqt_method' );
|
| 21 | | - }
|
| 22 | | -
|
| 23 | | - function getLang() {
|
| 24 | | - return $this->request->getVal( 'setlang' );
|
| 25 | | - }
|
| 26 | | -
|
| 27 | | - function showSource( $thread ) {
|
| 28 | | -
|
| 29 | | - $sourceBody = MultilangThreadController::getSourceSentence( $thread );
|
| 30 | | -
|
| 31 | | - $cancelUrl = LqtView::talkpageUrl( $thread->title(), null, $thread,
|
| 32 | | - true , $this->request );
|
| 33 | | - $languageCode = $this->getLang();
|
| 34 | | - if( !$languageCode ) {
|
| 35 | | - $languageCode = $this->langridAccessObject->getSourceLanguage( $thread->id() );
|
| 36 | | - }
|
| 37 | | - $hideMsg = wfMsg( 'multilang_lqt_hide_original',
|
| 38 | | - LanguageGridAccessObject::convertLanguageCodeIntoLanguageName( $languageCode ) );
|
| 39 | | - if( is_null( $hideMsg ) ) {
|
| 40 | | - $hideMsg = 'Hide';
|
| 41 | | - }
|
| 42 | | -
|
| 43 | | - $sourceBody .= Xml::tags( 'a',
|
| 44 | | - array( 'href' => $cancelUrl, 'id' => 'mw-source-cancel' ),
|
| 45 | | - $hideMsg );
|
| 46 | | -
|
| 47 | | - $tag = Xml::tags( 'div', array( 'class' => 'source-content' ),
|
| 48 | | - $sourceBody );
|
| 49 | | -
|
| 50 | | - return $tag;
|
| 51 | | - }
|
| 52 | | -
|
| 53 | | -}
|
| 54 | | -?>
|
| | 2 | +<?php |
| | 3 | +class SourceView { |
| | 4 | + public $thread; |
| | 5 | + public $langridAccessObject; |
| | 6 | + public $request; |
| | 7 | + |
| | 8 | + function __construct( $thread, $request ) { |
| | 9 | + $this->thread = $thread; |
| | 10 | + $this->langridAccessObject = new LanguageGridAccessObject(); |
| | 11 | + $this->request = $request; |
| | 12 | + } |
| | 13 | + |
| | 14 | + function methodAppliesToThread( $method ) { |
| | 15 | + return $this->request->getVal( 'lqt_method' ) == $method && |
| | 16 | + $this->request->getVal( 'lqt_operand' ) == $this->thread->id(); |
| | 17 | + } |
| | 18 | + |
| | 19 | + function getMethod() { |
| | 20 | + return $this->request->getVal( 'lqt_method' ); |
| | 21 | + } |
| | 22 | + |
| | 23 | + function getLang() { |
| | 24 | + return $this->request->getVal( 'setlang' ); |
| | 25 | + } |
| | 26 | + |
| | 27 | + function showSource( $thread ) { |
| | 28 | + |
| | 29 | + $sourceBody = MultilangThreadController::getSourceSentence( $thread ); |
| | 30 | + |
| | 31 | + $cancelUrl = LqtView::talkpageUrl( $thread->title(), null, $thread, |
| | 32 | + true , $this->request ); |
| | 33 | + $languageCode = $this->getLang(); |
| | 34 | + if( !$languageCode ) { |
| | 35 | + $languageCode = $this->langridAccessObject->getSourceLanguage( $thread->id() ); |
| | 36 | + } |
| | 37 | + $hideMsg = wfMsg( 'multilang_lqt_hide_original', |
| | 38 | + LanguageGridAccessObject::convertLanguageCodeIntoLanguageName( $languageCode ) ); |
| | 39 | + if( is_null( $hideMsg ) ) { |
| | 40 | + $hideMsg = 'Hide'; |
| | 41 | + } |
| | 42 | + |
| | 43 | + $sourceBody .= Xml::tags( 'a', |
| | 44 | + array( 'href' => $cancelUrl, 'id' => 'mw-source-cancel' ), |
| | 45 | + $hideMsg ); |
| | 46 | + |
| | 47 | + $tag = Xml::tags( 'div', array( 'class' => 'source-content' ), |
| | 48 | + $sourceBody ); |
| | 49 | + |
| | 50 | + return $tag; |
| | 51 | + } |
| | 52 | + |
| | 53 | +} |
| | 54 | +?> |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/langrid/SourceView.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 55 | 55 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/langrid/MultilangLqt.php |
| — | — | @@ -1,36 +1,36 @@ |
| 2 | | -<?php
|
| 3 | | -$dir = dirname( __FILE__ ) . '/';
|
| 4 | | -
|
| 5 | | -$wgExtensionMessagesFiles['LiquidThreads'] = $dir . 'MultilangLqt.i18n.php'; // Added for Multilang Extension
|
| 6 | | -
|
| 7 | | -// Classes
|
| 8 | | -$wgAutoloadClasses['HTMLTranslator'] = $dir . 'HTMLTranslator.php';
|
| 9 | | -$wgAutoloadClasses['LanguageGridAccessObject'] = $dir . 'LanguageGridAccessObject.php';
|
| 10 | | -$wgAutoloadClasses['MetaTranslator'] = $dir . 'MetaTranslator.php';
|
| 11 | | -$wgAutoloadClasses['MultilangLqtHooks'] = $dir . 'MultilangLqtHooks.php';
|
| 12 | | -$wgAutoloadClasses['MultilangThreadController'] = $dir . 'MultilangThreadController.php';
|
| 13 | | -$wgAutoloadClasses['SourceView'] = $dir . 'SourceView.php';
|
| 14 | | -$wgAutoloadClasses['ThreadLanguage'] = $dir . 'ThreadLanguage.php';
|
| 15 | | -$wgAutoloadClasses['TranslatedSubject'] = $dir . 'TranslatedSubject.php';
|
| 16 | | -$wgAutoloadClasses['TranslatedThread'] = $dir . 'TranslatedThread.php';
|
| 17 | | -
|
| 18 | | -// Language Grid
|
| 19 | | -$wgAutoloadClasses['LangridAccessClient'] = $dir . '../../LanguageGrid/api/class/client/LangridAccessClient.class.php';
|
| 20 | | -
|
| 21 | | -// hook
|
| 22 | | -$wgHooks['LiquidThreadsSaveReply'][] = 'MultilangLqtHooks::saveReply';
|
| 23 | | -$wgHooks['LiquidThreadsThreadCommands'][] = 'MultilangLqtHooks::onThreadCommands';
|
| 24 | | -$wgHooks['LiquidThreadsThreadPermalinkView'][] = 'MultilangLqtHooks::onThreadPermalinkView';
|
| 25 | | -$wgHooks['LiquidThreadsEditingFormContent'][] = 'MultilangLqtHooks::translateRoot';
|
| 26 | | -$wgHooks['LiquidThreadsThreadSignature'][] = 'MultilangLqtHooks::onThreadSignature';
|
| 27 | | -$wgHooks['LiquidThreadsShowThreadHeading'][] = 'MultilangLqtHooks::translateSubject';
|
| 28 | | -$wgHooks['LiquidThreadsGetTOC'][] = 'MultilangLqtHooks::translateSubjectforTOC';
|
| 29 | | -$wgHooks['LiquidThreadsShowPostContent'][] = 'MultilangLqtHooks::translateBody';
|
| 30 | | -$wgHooks['LiquidThreadsThreadMajorCommands'][] = 'MultilangLqtHooks::onThreadMajorCommands';
|
| 31 | | -$wgHooks['LiquidThreadsShowPostThreadBody'][] = 'MultilangLqtHooks::onShowPostThreadBody';
|
| 32 | | -$wgHooks['LiquidThreadsDoInlineEditForm'][] = 'MultilangLqtHooks::onDoInlineEditForm';
|
| 33 | | -$wgHooks['LiquidThreadsAfterNewPostMetadataUpdates'][] = 'MultilangLqtHooks::saveSourceLang';
|
| 34 | | -$wgHooks['LiquidThreadsAfterReplyMetadataUpdates'][] = 'MultilangLqtHooks::saveSourceLang';
|
| 35 | | -$wgHooks['LiquidThreadsEndOfShowNewThreadForm'][] = 'MultilangLqtHooks::showLanguageSelector';
|
| 36 | | -$wgHooks['LiquidThreadsShowReplyForm'][] = 'MultilangLqtHooks::showLanguageSelector';
|
| 37 | | -
|
| | 2 | +<?php |
| | 3 | +$dir = dirname( __FILE__ ) . '/'; |
| | 4 | + |
| | 5 | +$wgExtensionMessagesFiles['LiquidThreads'] = $dir . 'MultilangLqt.i18n.php'; // Added for Multilang Extension |
| | 6 | + |
| | 7 | +// Classes |
| | 8 | +$wgAutoloadClasses['HTMLTranslator'] = $dir . 'HTMLTranslator.php'; |
| | 9 | +$wgAutoloadClasses['LanguageGridAccessObject'] = $dir . 'LanguageGridAccessObject.php'; |
| | 10 | +$wgAutoloadClasses['MetaTranslator'] = $dir . 'MetaTranslator.php'; |
| | 11 | +$wgAutoloadClasses['MultilangLqtHooks'] = $dir . 'MultilangLqtHooks.php'; |
| | 12 | +$wgAutoloadClasses['MultilangThreadController'] = $dir . 'MultilangThreadController.php'; |
| | 13 | +$wgAutoloadClasses['SourceView'] = $dir . 'SourceView.php'; |
| | 14 | +$wgAutoloadClasses['ThreadLanguage'] = $dir . 'ThreadLanguage.php'; |
| | 15 | +$wgAutoloadClasses['TranslatedSubject'] = $dir . 'TranslatedSubject.php'; |
| | 16 | +$wgAutoloadClasses['TranslatedThread'] = $dir . 'TranslatedThread.php'; |
| | 17 | + |
| | 18 | +// Language Grid |
| | 19 | +$wgAutoloadClasses['LangridAccessClient'] = $dir . '../../LanguageGrid/api/class/client/LangridAccessClient.class.php'; |
| | 20 | + |
| | 21 | +// hook |
| | 22 | +$wgHooks['LiquidThreadsSaveReply'][] = 'MultilangLqtHooks::saveReply'; |
| | 23 | +$wgHooks['LiquidThreadsThreadCommands'][] = 'MultilangLqtHooks::onThreadCommands'; |
| | 24 | +$wgHooks['LiquidThreadsThreadPermalinkView'][] = 'MultilangLqtHooks::onThreadPermalinkView'; |
| | 25 | +$wgHooks['LiquidThreadsEditingFormContent'][] = 'MultilangLqtHooks::translateRoot'; |
| | 26 | +$wgHooks['LiquidThreadsThreadSignature'][] = 'MultilangLqtHooks::onThreadSignature'; |
| | 27 | +$wgHooks['LiquidThreadsShowThreadHeading'][] = 'MultilangLqtHooks::translateSubject'; |
| | 28 | +$wgHooks['LiquidThreadsGetTOC'][] = 'MultilangLqtHooks::translateSubjectforTOC'; |
| | 29 | +$wgHooks['LiquidThreadsShowPostContent'][] = 'MultilangLqtHooks::translateBody'; |
| | 30 | +$wgHooks['LiquidThreadsThreadMajorCommands'][] = 'MultilangLqtHooks::onThreadMajorCommands'; |
| | 31 | +$wgHooks['LiquidThreadsShowPostThreadBody'][] = 'MultilangLqtHooks::onShowPostThreadBody'; |
| | 32 | +$wgHooks['LiquidThreadsDoInlineEditForm'][] = 'MultilangLqtHooks::onDoInlineEditForm'; |
| | 33 | +$wgHooks['LiquidThreadsAfterNewPostMetadataUpdates'][] = 'MultilangLqtHooks::saveSourceLang'; |
| | 34 | +$wgHooks['LiquidThreadsAfterReplyMetadataUpdates'][] = 'MultilangLqtHooks::saveSourceLang'; |
| | 35 | +$wgHooks['LiquidThreadsEndOfShowNewThreadForm'][] = 'MultilangLqtHooks::showLanguageSelector'; |
| | 36 | +$wgHooks['LiquidThreadsShowReplyForm'][] = 'MultilangLqtHooks::showLanguageSelector'; |
| | 37 | + |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/langrid/MultilangLqt.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 38 | 38 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/langrid/HTMLTranslator.php |
| — | — | @@ -1,46 +1,46 @@ |
| 2 | | -<?php
|
| 3 | | -
|
| 4 | | -
|
| 5 | | -
|
| 6 | | -class HTMLTranslator {
|
| 7 | | - /**
|
| 8 | | - * Constructor
|
| 9 | | - * @param $sourceLang SourceLanguage
|
| 10 | | - */
|
| 11 | | - public function __construct() {
|
| 12 | | - }
|
| 13 | | -
|
| 14 | | - public function HTMLTranslate($func, $param, $order, $sourceLang, $targetLang, $source, $resultFunc, $statusFunc) {
|
| 15 | | - $unTag=$this->removeTags($source);
|
| 16 | | - $param[$order[2]]=$unTag;
|
| 17 | | -
|
| 18 | | - $result=$this->doTranslate($func, $param, $sourceLang, $targetLang, $unTag, $resultFunc, $statusFunc);
|
| 19 | | -
|
| 20 | | - return $result;
|
| 21 | | - }
|
| 22 | | -
|
| 23 | | - private function removeTags($source) {
|
| 24 | | - return preg_replace('/<[^<]+?>/', '', $source);
|
| 25 | | - }
|
| 26 | | -
|
| 27 | | - /**
|
| 28 | | - * Translate body
|
| 29 | | - */
|
| 30 | | - private function doTranslate($func, $param, $sourceLang, $targetLang, $source, $resultFunc, $statusFunc) {
|
| 31 | | - if($resultFunc==null) {
|
| 32 | | - return call_user_func_array($func, $param);
|
| 33 | | - }else {
|
| 34 | | - $response=call_user_func_array($func, $param);
|
| 35 | | -
|
| 36 | | - $status=call_user_func_array($statusFunc, array($response));
|
| 37 | | - if($status == 'OK') {
|
| 38 | | - return call_user_func_array($resultFunc, array($response));
|
| 39 | | - }else {
|
| 40 | | - return null;
|
| 41 | | - }
|
| 42 | | - }
|
| 43 | | - }
|
| 44 | | -}
|
| 45 | | -
|
| 46 | | -?>
|
| | 2 | +<?php |
| | 3 | + |
| | 4 | + |
| | 5 | + |
| | 6 | +class HTMLTranslator { |
| | 7 | + /** |
| | 8 | + * Constructor |
| | 9 | + * @param $sourceLang SourceLanguage |
| | 10 | + */ |
| | 11 | + public function __construct() { |
| | 12 | + } |
| | 13 | + |
| | 14 | + public function HTMLTranslate($func, $param, $order, $sourceLang, $targetLang, $source, $resultFunc, $statusFunc) { |
| | 15 | + $unTag=$this->removeTags($source); |
| | 16 | + $param[$order[2]]=$unTag; |
| | 17 | + |
| | 18 | + $result=$this->doTranslate($func, $param, $sourceLang, $targetLang, $unTag, $resultFunc, $statusFunc); |
| | 19 | + |
| | 20 | + return $result; |
| | 21 | + } |
| | 22 | + |
| | 23 | + private function removeTags($source) { |
| | 24 | + return preg_replace('/<[^<]+?>/', '', $source); |
| | 25 | + } |
| | 26 | + |
| | 27 | + /** |
| | 28 | + * Translate body |
| | 29 | + */ |
| | 30 | + private function doTranslate($func, $param, $sourceLang, $targetLang, $source, $resultFunc, $statusFunc) { |
| | 31 | + if($resultFunc==null) { |
| | 32 | + return call_user_func_array($func, $param); |
| | 33 | + }else { |
| | 34 | + $response=call_user_func_array($func, $param); |
| | 35 | + |
| | 36 | + $status=call_user_func_array($statusFunc, array($response)); |
| | 37 | + if($status == 'OK') { |
| | 38 | + return call_user_func_array($resultFunc, array($response)); |
| | 39 | + }else { |
| | 40 | + return null; |
| | 41 | + } |
| | 42 | + } |
| | 43 | + } |
| | 44 | +} |
| | 45 | + |
| | 46 | +?> |
| 47 | 47 | |
| \ No newline at end of file |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/langrid/HTMLTranslator.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 48 | 48 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/langrid/MetaTranslator.php |
| — | — | @@ -1,341 +1,341 @@ |
| 2 | | -<?php
|
| 3 | | -
|
| 4 | | -require_once('HTMLTranslator.php');
|
| 5 | | -
|
| 6 | | -class MetaTranslator {
|
| 7 | | - /* Translation parameters */
|
| 8 | | - private $sourceLang;
|
| 9 | | -
|
| 10 | | - /* in MetaTranslation process */
|
| 11 | | - private $noTranslations;
|
| 12 | | - private $tags_begin=array();
|
| 13 | | - private $tags_end=array();
|
| 14 | | -
|
| 15 | | - /* Constant */
|
| 16 | | - private $TAG_BEGIN="<notranslate>";
|
| 17 | | - private $TAG_END="</notranslate>";
|
| 18 | | - private $TAG_RELAXED='__________';
|
| 19 | | - private $LANG_TAG_BEGIN='[';
|
| 20 | | - private $LANG_TAG_END=']';
|
| 21 | | -
|
| 22 | | -
|
| 23 | | -
|
| 24 | | - /**
|
| 25 | | - * Constructor
|
| 26 | | - * @param $sourceLang SourceLanguage
|
| 27 | | - */
|
| 28 | | - public function __construct($sourceLang) {
|
| 29 | | - $this->setSourceLanguage($sourceLang);
|
| 30 | | - }
|
| 31 | | -
|
| 32 | | - /**
|
| 33 | | - *
|
| 34 | | - */
|
| 35 | | - public function metaTranslate($func, $param, $order, $meta=true, $attach=true, $resultFunc, $statusFunc) {
|
| 36 | | - $sourceLang=$param[$order[0]];
|
| 37 | | - $targetLang=$param[$order[1]];
|
| 38 | | - $source=$param[$order[2]];
|
| 39 | | -
|
| 40 | | -
|
| 41 | | - $encode=$this->preTranslation($source, $meta);
|
| 42 | | -
|
| 43 | | - $trans=$this->doTranslate($func, $param, $order, $sourceLang, $targetLang, $encode, $resultFunc, $statusFunc);
|
| 44 | | -
|
| 45 | | - if($trans==null) {
|
| 46 | | - //error occured
|
| 47 | | - return null;
|
| 48 | | - }
|
| 49 | | -
|
| 50 | | - $newparam=$param;
|
| 51 | | - $newparam[$order[2]]=$trans;
|
| 52 | | -
|
| 53 | | - $decode=$this->postTranslation($func, $newparam, $order, $meta, $attach, $resultFunc, $statusFunc);
|
| 54 | | -
|
| 55 | | - return $decode;
|
| 56 | | - }
|
| 57 | | -
|
| 58 | | - /**
|
| 59 | | - * PreProcess
|
| 60 | | - * @param $source Translated sentence
|
| 61 | | - * @param $meta MetaTranslate or not
|
| 62 | | - * @return Encoded sentence
|
| 63 | | - */
|
| 64 | | - public function preTranslation($source, $meta=true) {
|
| 65 | | - $this->noTranslations=array();
|
| 66 | | - $escEncode='';
|
| 67 | | -
|
| 68 | | - /* no-MetaTranslate */
|
| 69 | | - if($meta) {
|
| 70 | | - $this->tags_begin[]='[relax]';
|
| 71 | | - $this->tags_begin[]=$this->TAG_BEGIN;
|
| 72 | | -
|
| 73 | | - $this->tags_end[]='[/relax]';
|
| 74 | | - $this->tags_end[]=$this->TAG_END;
|
| 75 | | - }
|
| 76 | | -
|
| 77 | | - /* LanguageTags */
|
| 78 | | -
|
| 79 | | -
|
| 80 | | - /* Encoding */
|
| 81 | | - $escEncode=$this->encodeEscapes_relaxed($source);
|
| 82 | | -
|
| 83 | | - return $escEncode;
|
| 84 | | - }
|
| 85 | | -
|
| 86 | | -
|
| 87 | | - /**
|
| 88 | | - * PostProcess
|
| 89 | | - * @param $func Translator
|
| 90 | | - * @param $param Parameters for $func
|
| 91 | | - * @param $order Parameter position : $param[$order[0]]=SourceLanguage, $param[$order[1]]=TargetLanguage, $param[$order[2]]=Source
|
| 92 | | - * @param $meta MetaTranslate or not
|
| 93 | | - * @param $attach Whether Description is necessary : Unnecessary->false
|
| 94 | | - * @param $resultFunc Such function that $resultFunc($func($param)) returns sentence
|
| 95 | | - * @return Sentence
|
| 96 | | - */
|
| 97 | | - public function postTranslation($func, $param, $order, $meta=true, $attach=true, $resultFunc=null, $statusFunc) {
|
| 98 | | - $source=$param[$order[2]];
|
| 99 | | -
|
| 100 | | - /* attach Descriptions */
|
| 101 | | - if($meta) {
|
| 102 | | - $this->attachDescriptions($func, $param, $order, $meta, $attach, $resultFunc, $statusFunc);
|
| 103 | | - }
|
| 104 | | -
|
| 105 | | - /* Decode */
|
| 106 | | - $result=$this->decodeEscapes($source);
|
| 107 | | -
|
| 108 | | -
|
| 109 | | - return $result;
|
| 110 | | - }
|
| 111 | | -
|
| 112 | | - /**
|
| 113 | | - * Replacing Intermediate Code into Escapes
|
| 114 | | - * @param $source Encoded sentence
|
| 115 | | - * @return Decoded sentence
|
| 116 | | - */
|
| 117 | | - private function decodeEscapes($source) {
|
| 118 | | - for($i=0; $i<count($this->noTranslations); $i++) {
|
| 119 | | - $source=str_ireplace($this->noTranslations[$i]['code'],
|
| 120 | | - $this->noTranslations[$i]['escape'], $source);
|
| 121 | | - }
|
| 122 | | -
|
| 123 | | - return $source;
|
| 124 | | - }
|
| 125 | | -
|
| 126 | | - /**
|
| 127 | | - * Attaching Descriptions
|
| 128 | | - */
|
| 129 | | - private function attachDescriptions($func, $param, $order, $meta, $attach, $resultFunc, $statusFunc) {
|
| 130 | | - $sourceLang=$param[$order[0]];
|
| 131 | | - $targetLang=$param[$order[1]];
|
| 132 | | -
|
| 133 | | -
|
| 134 | | - /* for all noTranslations */
|
| 135 | | - for($i=0; $i<count($this->noTranslations); $i++) {
|
| 136 | | - if($attach) {
|
| 137 | | - /* Recursive MetaTranslation */
|
| 138 | | - $meta=new MetaTranslator($sourceLang);
|
| 139 | | - $encode=$meta->preTranslation($this->noTranslations[$i]['escape']);
|
| 140 | | -
|
| 141 | | - $trans=$this->doTranslate($func, $param, $order, $sourceLang, $targetLang, $encode, $resultFunc, $statusFunc);
|
| 142 | | -
|
| 143 | | - $newparam=$param;
|
| 144 | | - $newparam[$order[2]]=$trans;
|
| 145 | | - $description=$meta->postTranslation($func, $newparam, $order, true, true, $resultFunc, $statusFunc);
|
| 146 | | -
|
| 147 | | - /* attaching */
|
| 148 | | - if($this->canAttach($this->noTranslations[$i]['escape'], $description)) {
|
| 149 | | - $this->noTranslations[$i]['escape'].='('.$description.')';
|
| 150 | | - }
|
| 151 | | - }
|
| 152 | | -
|
| 153 | | - $tagnum=$this->noTranslations[$i]['tag'];
|
| 154 | | - if($tagnum!=0) {
|
| 155 | | - $this->noTranslations[$i]['escape']=$this->tags_begin[$tagnum].
|
| 156 | | - $this->noTranslations[$i]['escape'].
|
| 157 | | - $this->tags_end[$tagnum];
|
| 158 | | - }else {
|
| 159 | | - $this->noTranslations[$i]['escape']=$this->TAG_RELAXED.
|
| 160 | | - $this->noTranslations[$i]['escape'].
|
| 161 | | - $this->TAG_RELAXED;
|
| 162 | | - }
|
| 163 | | - }
|
| 164 | | - }
|
| 165 | | -
|
| 166 | | - /**
|
| 167 | | - * Whether to Attach Descriptions
|
| 168 | | - */
|
| 169 | | - private function canAttach($escape, $description) {
|
| 170 | | - /* punctuations */
|
| 171 | | - $pattern='[\.| |．|,|，| |:|：|;|。|、|!|！|\?|？]';
|
| 172 | | - $comp1=@preg_replace($pattern, '', $escape);
|
| 173 | | - $comp2=@preg_replace($pattern, '', $description);
|
| 174 | | -
|
| 175 | | - return $comp1!==$comp2;
|
| 176 | | - }
|
| 177 | | -
|
| 178 | | - /**
|
| 179 | | - * Translate body
|
| 180 | | - */
|
| 181 | | - private function doTranslate($func, $param, $order, $sourceLang, $targetLang, $source, $resultFunc, $statusFunc) {
|
| 182 | | - $param[$order[0]]=$sourceLang;
|
| 183 | | - $param[$order[1]]=$targetLang;
|
| 184 | | - $param[$order[2]]=$source;
|
| 185 | | -
|
| 186 | | - $ht=new HTMLTranslator();
|
| 187 | | -
|
| 188 | | -
|
| 189 | | - $result = $ht->HTMLTranslate($func, $param, $order, $sourceLang, $targetLang, $source, $resultFunc, $statusFunc);
|
| 190 | | -
|
| 191 | | - return $result;
|
| 192 | | - }
|
| 193 | | -
|
| 194 | | - /**
|
| 195 | | - * Replacing Escapes into Intermediate Code : relaxed mode
|
| 196 | | - */
|
| 197 | | - private function encodeEscapes_relaxed($source) {
|
| 198 | | - $array=explode($this->TAG_RELAXED, $source);
|
| 199 | | -
|
| 200 | | - $relaxed='';
|
| 201 | | - for($i=0; $i<count($array)-1; $i++) {
|
| 202 | | - $relaxed.=$array[$i];
|
| 203 | | -
|
| 204 | | - if($i%2==0) {
|
| 205 | | - $relaxed.=$this->tags_begin[0];
|
| 206 | | - }else {
|
| 207 | | - $relaxed.=$this->tags_end[0];
|
| 208 | | - }
|
| 209 | | - }
|
| 210 | | - $relaxed.=$array[count($array)-1];
|
| 211 | | -
|
| 212 | | - return $this->encodeEscapes_strict($relaxed);
|
| 213 | | - }
|
| 214 | | -
|
| 215 | | - /**
|
| 216 | | - * Replacing Escapes into Intermediate Code : strict mode
|
| 217 | | - */
|
| 218 | | - private function encodeEscapes_strict($source) {
|
| 219 | | - $encode='';
|
| 220 | | - $escape='';
|
| 221 | | - $indent=0;
|
| 222 | | - $id=0;
|
| 223 | | - $tagStart=0;
|
| 224 | | - $tagEnd=0;
|
| 225 | | -
|
| 226 | | - $buf='';
|
| 227 | | - for($i=0; $i<mb_strlen($source); $i++) {
|
| 228 | | - $buf.=mb_substr($source, $i, 1);
|
| 229 | | -
|
| 230 | | - /* escape begins */
|
| 231 | | - $len=$this->startsWith($this->tags_begin, $buf);
|
| 232 | | - if($len!=-1) {
|
| 233 | | - /* before tag, do not escape */
|
| 234 | | - if($indent==0) {
|
| 235 | | - $encode.=mb_substr($buf, 0, mb_strlen($buf)-$len);
|
| 236 | | - $tagStart=$i;
|
| 237 | | - }else {
|
| 238 | | - $escape.=$buf;
|
| 239 | | - }
|
| 240 | | -
|
| 241 | | - $buf='';
|
| 242 | | -
|
| 243 | | - $indent++;
|
| 244 | | - continue;
|
| 245 | | - }
|
| 246 | | -
|
| 247 | | -
|
| 248 | | - /* escape ends */
|
| 249 | | - $len=$this->startsWith($this->tags_end, $buf, $tagNumber);
|
| 250 | | - if($len!=-1) {
|
| 251 | | - $indent--;
|
| 252 | | -
|
| 253 | | - $escape.=$buf;
|
| 254 | | - /* after tag, do not escape */
|
| 255 | | - if($indent==0) {
|
| 256 | | - $escape=mb_substr($escape, 0, mb_strlen($escape)-$len);
|
| 257 | | - $escape=$this->removeDescription($escape);
|
| 258 | | - $escape=trim($escape);
|
| 259 | | - $tagEnd=$i;
|
| 260 | | - $interCode=$this->getInterCode($tagStart, $tagEnd);
|
| 261 | | - $this->noTranslations[$id]=array('escape'=>$escape,
|
| 262 | | - 'code'=>$interCode,
|
| 263 | | - 'tag'=>$tagNumber);
|
| 264 | | - $id++;
|
| 265 | | - $encode.=' '.$interCode.' ';
|
| 266 | | - $escape='';
|
| 267 | | - }
|
| 268 | | -
|
| 269 | | - $buf='';
|
| 270 | | - continue;
|
| 271 | | - }
|
| 272 | | -
|
| 273 | | - }
|
| 274 | | - return $encode.$buf;
|
| 275 | | - }
|
| 276 | | -
|
| 277 | | - /**
|
| 278 | | - * if $str startsWith one of $array, return strlen($array[$i]), else -1
|
| 279 | | - */
|
| 280 | | - private function startsWith($array, $str, &$num=null) {
|
| 281 | | - for($i=0; $i<count($array); $i++) {
|
| 282 | | - if(strpos($str, $array[$i])!==false) {
|
| 283 | | - $num=$i;
|
| 284 | | - return mb_strlen($array[$i]);
|
| 285 | | - }
|
| 286 | | - }
|
| 287 | | -
|
| 288 | | - return -1;
|
| 289 | | - }
|
| 290 | | -
|
| 291 | | - /**
|
| 292 | | - * Removing Descriptions
|
| 293 | | - */
|
| 294 | | - private function removeDescription($source) {
|
| 295 | | - $ret='';
|
| 296 | | - $indent=0;
|
| 297 | | -
|
| 298 | | - for($i=0; $i<mb_strlen($source); $i++) {
|
| 299 | | - $buf=mb_substr($source, $i, 1);
|
| 300 | | -
|
| 301 | | - if($buf=='(') {
|
| 302 | | - $indent++;
|
| 303 | | - }
|
| 304 | | -
|
| 305 | | - if($indent==0) {
|
| 306 | | - $ret.=$buf;
|
| 307 | | - }
|
| 308 | | -
|
| 309 | | - if($buf==')') {
|
| 310 | | - $indent--;
|
| 311 | | - }
|
| 312 | | - }
|
| 313 | | -
|
| 314 | | - return $ret;
|
| 315 | | -
|
| 316 | | - }
|
| 317 | | -
|
| 318 | | -
|
| 319 | | - private function getInterCode($tagStart, $tagEnd) {
|
| 320 | | - $alt=dechex($tagStart).'x'.dechex($tagEnd);
|
| 321 | | - $search=array('0','1','2','3','4','5','6','7','8','9');
|
| 322 | | - $replace=array('g','h','i','j','k','l','m','n','o','p');
|
| 323 | | -
|
| 324 | | - $result=str_replace($search, $replace, $alt);
|
| 325 | | -
|
| 326 | | - return 'xxx'.$result.'xxx';
|
| 327 | | - }
|
| 328 | | -
|
| 329 | | - /**
|
| 330 | | - * Setter
|
| 331 | | - */
|
| 332 | | - public function setSourceLanguage($sourceLang) {
|
| 333 | | - $this->sourceLang=$sourceLang;
|
| 334 | | - }
|
| 335 | | -
|
| 336 | | - public function getSourceLanguage() {
|
| 337 | | - return $this->sourceLang;
|
| 338 | | - }
|
| 339 | | -}
|
| 340 | | -
|
| 341 | | -?>
|
| | 2 | +<?php |
| | 3 | + |
| | 4 | +require_once('HTMLTranslator.php'); |
| | 5 | + |
| | 6 | +class MetaTranslator { |
| | 7 | + /* Translation parameters */ |
| | 8 | + private $sourceLang; |
| | 9 | + |
| | 10 | + /* in MetaTranslation process */ |
| | 11 | + private $noTranslations; |
| | 12 | + private $tags_begin=array(); |
| | 13 | + private $tags_end=array(); |
| | 14 | + |
| | 15 | + /* Constant */ |
| | 16 | + private $TAG_BEGIN="<notranslate>"; |
| | 17 | + private $TAG_END="</notranslate>"; |
| | 18 | + private $TAG_RELAXED='__________'; |
| | 19 | + private $LANG_TAG_BEGIN='['; |
| | 20 | + private $LANG_TAG_END=']'; |
| | 21 | + |
| | 22 | + |
| | 23 | + |
| | 24 | + /** |
| | 25 | + * Constructor |
| | 26 | + * @param $sourceLang SourceLanguage |
| | 27 | + */ |
| | 28 | + public function __construct($sourceLang) { |
| | 29 | + $this->setSourceLanguage($sourceLang); |
| | 30 | + } |
| | 31 | + |
| | 32 | + /** |
| | 33 | + * |
| | 34 | + */ |
| | 35 | + public function metaTranslate($func, $param, $order, $meta=true, $attach=true, $resultFunc, $statusFunc) { |
| | 36 | + $sourceLang=$param[$order[0]]; |
| | 37 | + $targetLang=$param[$order[1]]; |
| | 38 | + $source=$param[$order[2]]; |
| | 39 | + |
| | 40 | + |
| | 41 | + $encode=$this->preTranslation($source, $meta); |
| | 42 | + |
| | 43 | + $trans=$this->doTranslate($func, $param, $order, $sourceLang, $targetLang, $encode, $resultFunc, $statusFunc); |
| | 44 | + |
| | 45 | + if($trans==null) { |
| | 46 | + //error occured |
| | 47 | + return null; |
| | 48 | + } |
| | 49 | + |
| | 50 | + $newparam=$param; |
| | 51 | + $newparam[$order[2]]=$trans; |
| | 52 | + |
| | 53 | + $decode=$this->postTranslation($func, $newparam, $order, $meta, $attach, $resultFunc, $statusFunc); |
| | 54 | + |
| | 55 | + return $decode; |
| | 56 | + } |
| | 57 | + |
| | 58 | + /** |
| | 59 | + * PreProcess |
| | 60 | + * @param $source Translated sentence |
| | 61 | + * @param $meta MetaTranslate or not |
| | 62 | + * @return Encoded sentence |
| | 63 | + */ |
| | 64 | + public function preTranslation($source, $meta=true) { |
| | 65 | + $this->noTranslations=array(); |
| | 66 | + $escEncode=''; |
| | 67 | + |
| | 68 | + /* no-MetaTranslate */ |
| | 69 | + if($meta) { |
| | 70 | + $this->tags_begin[]='[relax]'; |
| | 71 | + $this->tags_begin[]=$this->TAG_BEGIN; |
| | 72 | + |
| | 73 | + $this->tags_end[]='[/relax]'; |
| | 74 | + $this->tags_end[]=$this->TAG_END; |
| | 75 | + } |
| | 76 | + |
| | 77 | + /* LanguageTags */ |
| | 78 | + |
| | 79 | + |
| | 80 | + /* Encoding */ |
| | 81 | + $escEncode=$this->encodeEscapes_relaxed($source); |
| | 82 | + |
| | 83 | + return $escEncode; |
| | 84 | + } |
| | 85 | + |
| | 86 | + |
| | 87 | + /** |
| | 88 | + * PostProcess |
| | 89 | + * @param $func Translator |
| | 90 | + * @param $param Parameters for $func |
| | 91 | + * @param $order Parameter position : $param[$order[0]]=SourceLanguage, $param[$order[1]]=TargetLanguage, $param[$order[2]]=Source |
| | 92 | + * @param $meta MetaTranslate or not |
| | 93 | + * @param $attach Whether Description is necessary : Unnecessary->false |
| | 94 | + * @param $resultFunc Such function that $resultFunc($func($param)) returns sentence |
| | 95 | + * @return Sentence |
| | 96 | + */ |
| | 97 | + public function postTranslation($func, $param, $order, $meta=true, $attach=true, $resultFunc=null, $statusFunc) { |
| | 98 | + $source=$param[$order[2]]; |
| | 99 | + |
| | 100 | + /* attach Descriptions */ |
| | 101 | + if($meta) { |
| | 102 | + $this->attachDescriptions($func, $param, $order, $meta, $attach, $resultFunc, $statusFunc); |
| | 103 | + } |
| | 104 | + |
| | 105 | + /* Decode */ |
| | 106 | + $result=$this->decodeEscapes($source); |
| | 107 | + |
| | 108 | + |
| | 109 | + return $result; |
| | 110 | + } |
| | 111 | + |
| | 112 | + /** |
| | 113 | + * Replacing Intermediate Code into Escapes |
| | 114 | + * @param $source Encoded sentence |
| | 115 | + * @return Decoded sentence |
| | 116 | + */ |
| | 117 | + private function decodeEscapes($source) { |
| | 118 | + for($i=0; $i<count($this->noTranslations); $i++) { |
| | 119 | + $source=str_ireplace($this->noTranslations[$i]['code'], |
| | 120 | + $this->noTranslations[$i]['escape'], $source); |
| | 121 | + } |
| | 122 | + |
| | 123 | + return $source; |
| | 124 | + } |
| | 125 | + |
| | 126 | + /** |
| | 127 | + * Attaching Descriptions |
| | 128 | + */ |
| | 129 | + private function attachDescriptions($func, $param, $order, $meta, $attach, $resultFunc, $statusFunc) { |
| | 130 | + $sourceLang=$param[$order[0]]; |
| | 131 | + $targetLang=$param[$order[1]]; |
| | 132 | + |
| | 133 | + |
| | 134 | + /* for all noTranslations */ |
| | 135 | + for($i=0; $i<count($this->noTranslations); $i++) { |
| | 136 | + if($attach) { |
| | 137 | + /* Recursive MetaTranslation */ |
| | 138 | + $meta=new MetaTranslator($sourceLang); |
| | 139 | + $encode=$meta->preTranslation($this->noTranslations[$i]['escape']); |
| | 140 | + |
| | 141 | + $trans=$this->doTranslate($func, $param, $order, $sourceLang, $targetLang, $encode, $resultFunc, $statusFunc); |
| | 142 | + |
| | 143 | + $newparam=$param; |
| | 144 | + $newparam[$order[2]]=$trans; |
| | 145 | + $description=$meta->postTranslation($func, $newparam, $order, true, true, $resultFunc, $statusFunc); |
| | 146 | + |
| | 147 | + /* attaching */ |
| | 148 | + if($this->canAttach($this->noTranslations[$i]['escape'], $description)) { |
| | 149 | + $this->noTranslations[$i]['escape'].='('.$description.')'; |
| | 150 | + } |
| | 151 | + } |
| | 152 | + |
| | 153 | + $tagnum=$this->noTranslations[$i]['tag']; |
| | 154 | + if($tagnum!=0) { |
| | 155 | + $this->noTranslations[$i]['escape']=$this->tags_begin[$tagnum]. |
| | 156 | + $this->noTranslations[$i]['escape']. |
| | 157 | + $this->tags_end[$tagnum]; |
| | 158 | + }else { |
| | 159 | + $this->noTranslations[$i]['escape']=$this->TAG_RELAXED. |
| | 160 | + $this->noTranslations[$i]['escape']. |
| | 161 | + $this->TAG_RELAXED; |
| | 162 | + } |
| | 163 | + } |
| | 164 | + } |
| | 165 | + |
| | 166 | + /** |
| | 167 | + * Whether to Attach Descriptions |
| | 168 | + */ |
| | 169 | + private function canAttach($escape, $description) { |
| | 170 | + /* punctuations */ |
| | 171 | + $pattern='[\.| |．|,|，| |:|：|;|。|、|!|！|\?|？]'; |
| | 172 | + $comp1=@preg_replace($pattern, '', $escape); |
| | 173 | + $comp2=@preg_replace($pattern, '', $description); |
| | 174 | + |
| | 175 | + return $comp1!==$comp2; |
| | 176 | + } |
| | 177 | + |
| | 178 | + /** |
| | 179 | + * Translate body |
| | 180 | + */ |
| | 181 | + private function doTranslate($func, $param, $order, $sourceLang, $targetLang, $source, $resultFunc, $statusFunc) { |
| | 182 | + $param[$order[0]]=$sourceLang; |
| | 183 | + $param[$order[1]]=$targetLang; |
| | 184 | + $param[$order[2]]=$source; |
| | 185 | + |
| | 186 | + $ht=new HTMLTranslator(); |
| | 187 | + |
| | 188 | + |
| | 189 | + $result = $ht->HTMLTranslate($func, $param, $order, $sourceLang, $targetLang, $source, $resultFunc, $statusFunc); |
| | 190 | + |
| | 191 | + return $result; |
| | 192 | + } |
| | 193 | + |
| | 194 | + /** |
| | 195 | + * Replacing Escapes into Intermediate Code : relaxed mode |
| | 196 | + */ |
| | 197 | + private function encodeEscapes_relaxed($source) { |
| | 198 | + $array=explode($this->TAG_RELAXED, $source); |
| | 199 | + |
| | 200 | + $relaxed=''; |
| | 201 | + for($i=0; $i<count($array)-1; $i++) { |
| | 202 | + $relaxed.=$array[$i]; |
| | 203 | + |
| | 204 | + if($i%2==0) { |
| | 205 | + $relaxed.=$this->tags_begin[0]; |
| | 206 | + }else { |
| | 207 | + $relaxed.=$this->tags_end[0]; |
| | 208 | + } |
| | 209 | + } |
| | 210 | + $relaxed.=$array[count($array)-1]; |
| | 211 | + |
| | 212 | + return $this->encodeEscapes_strict($relaxed); |
| | 213 | + } |
| | 214 | + |
| | 215 | + /** |
| | 216 | + * Replacing Escapes into Intermediate Code : strict mode |
| | 217 | + */ |
| | 218 | + private function encodeEscapes_strict($source) { |
| | 219 | + $encode=''; |
| | 220 | + $escape=''; |
| | 221 | + $indent=0; |
| | 222 | + $id=0; |
| | 223 | + $tagStart=0; |
| | 224 | + $tagEnd=0; |
| | 225 | + |
| | 226 | + $buf=''; |
| | 227 | + for($i=0; $i<mb_strlen($source); $i++) { |
| | 228 | + $buf.=mb_substr($source, $i, 1); |
| | 229 | + |
| | 230 | + /* escape begins */ |
| | 231 | + $len=$this->startsWith($this->tags_begin, $buf); |
| | 232 | + if($len!=-1) { |
| | 233 | + /* before tag, do not escape */ |
| | 234 | + if($indent==0) { |
| | 235 | + $encode.=mb_substr($buf, 0, mb_strlen($buf)-$len); |
| | 236 | + $tagStart=$i; |
| | 237 | + }else { |
| | 238 | + $escape.=$buf; |
| | 239 | + } |
| | 240 | + |
| | 241 | + $buf=''; |
| | 242 | + |
| | 243 | + $indent++; |
| | 244 | + continue; |
| | 245 | + } |
| | 246 | + |
| | 247 | + |
| | 248 | + /* escape ends */ |
| | 249 | + $len=$this->startsWith($this->tags_end, $buf, $tagNumber); |
| | 250 | + if($len!=-1) { |
| | 251 | + $indent--; |
| | 252 | + |
| | 253 | + $escape.=$buf; |
| | 254 | + /* after tag, do not escape */ |
| | 255 | + if($indent==0) { |
| | 256 | + $escape=mb_substr($escape, 0, mb_strlen($escape)-$len); |
| | 257 | + $escape=$this->removeDescription($escape); |
| | 258 | + $escape=trim($escape); |
| | 259 | + $tagEnd=$i; |
| | 260 | + $interCode=$this->getInterCode($tagStart, $tagEnd); |
| | 261 | + $this->noTranslations[$id]=array('escape'=>$escape, |
| | 262 | + 'code'=>$interCode, |
| | 263 | + 'tag'=>$tagNumber); |
| | 264 | + $id++; |
| | 265 | + $encode.=' '.$interCode.' '; |
| | 266 | + $escape=''; |
| | 267 | + } |
| | 268 | + |
| | 269 | + $buf=''; |
| | 270 | + continue; |
| | 271 | + } |
| | 272 | + |
| | 273 | + } |
| | 274 | + return $encode.$buf; |
| | 275 | + } |
| | 276 | + |
| | 277 | + /** |
| | 278 | + * if $str startsWith one of $array, return strlen($array[$i]), else -1 |
| | 279 | + */ |
| | 280 | + private function startsWith($array, $str, &$num=null) { |
| | 281 | + for($i=0; $i<count($array); $i++) { |
| | 282 | + if(strpos($str, $array[$i])!==false) { |
| | 283 | + $num=$i; |
| | 284 | + return mb_strlen($array[$i]); |
| | 285 | + } |
| | 286 | + } |
| | 287 | + |
| | 288 | + return -1; |
| | 289 | + } |
| | 290 | + |
| | 291 | + /** |
| | 292 | + * Removing Descriptions |
| | 293 | + */ |
| | 294 | + private function removeDescription($source) { |
| | 295 | + $ret=''; |
| | 296 | + $indent=0; |
| | 297 | + |
| | 298 | + for($i=0; $i<mb_strlen($source); $i++) { |
| | 299 | + $buf=mb_substr($source, $i, 1); |
| | 300 | + |
| | 301 | + if($buf=='(') { |
| | 302 | + $indent++; |
| | 303 | + } |
| | 304 | + |
| | 305 | + if($indent==0) { |
| | 306 | + $ret.=$buf; |
| | 307 | + } |
| | 308 | + |
| | 309 | + if($buf==')') { |
| | 310 | + $indent--; |
| | 311 | + } |
| | 312 | + } |
| | 313 | + |
| | 314 | + return $ret; |
| | 315 | + |
| | 316 | + } |
| | 317 | + |
| | 318 | + |
| | 319 | + private function getInterCode($tagStart, $tagEnd) { |
| | 320 | + $alt=dechex($tagStart).'x'.dechex($tagEnd); |
| | 321 | + $search=array('0','1','2','3','4','5','6','7','8','9'); |
| | 322 | + $replace=array('g','h','i','j','k','l','m','n','o','p'); |
| | 323 | + |
| | 324 | + $result=str_replace($search, $replace, $alt); |
| | 325 | + |
| | 326 | + return 'xxx'.$result.'xxx'; |
| | 327 | + } |
| | 328 | + |
| | 329 | + /** |
| | 330 | + * Setter |
| | 331 | + */ |
| | 332 | + public function setSourceLanguage($sourceLang) { |
| | 333 | + $this->sourceLang=$sourceLang; |
| | 334 | + } |
| | 335 | + |
| | 336 | + public function getSourceLanguage() { |
| | 337 | + return $this->sourceLang; |
| | 338 | + } |
| | 339 | +} |
| | 340 | + |
| | 341 | +?> |
| 342 | 342 | |
| \ No newline at end of file |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/langrid/MetaTranslator.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 343 | 343 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/langrid/MultilangLqtHooks.php |
| — | — | @@ -1,185 +1,185 @@ |
| 2 | | -<?php
|
| 3 | | -class MultilangLqtHooks {
|
| 4 | | -
|
| 5 | | - static $translatedSubject;
|
| 6 | | -
|
| 7 | | - static function saveReply( &$info, &$e, &$thread ) {
|
| 8 | | - $replyTo = $info['replyTo'];
|
| 9 | | - $subject = $replyTo->subject();
|
| 10 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 11 | | - $translatedSubject = $langridAccessObject->translateSubject($replyTo, $subject);
|
| 12 | | - $replyTo->setSubject( $translatedSubject );
|
| 13 | | - $info['replyTo'] = $replyTo;
|
| 14 | | - return true;
|
| 15 | | - }
|
| 16 | | -
|
| 17 | | - static function onThreadCommands( $thread, &$commands ) {
|
| 18 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 19 | | - if ( !$langridAccessObject->needsNoTranslation( $thread->id() ) ) {
|
| 20 | | - $translatedRoot = $langridAccessObject->translatedRootByThread( $thread );
|
| 21 | | - if ( isset( $translatedRoot ) ) {
|
| 22 | | - $thread->setRoot( $translatedRoot );
|
| 23 | | - }
|
| 24 | | - }
|
| 25 | | -
|
| 26 | | - $translated_history_url = LqtView::permalinkUrlWithQuery( $thread, array( 'action' => 'history' ) );
|
| 27 | | - $commands['history'] = array( 'label' => wfMsgExt( 'history_short', 'parseinline' ),
|
| 28 | | - 'href' => $translated_history_url,
|
| 29 | | - 'enabled' => true );
|
| 30 | | - return true;
|
| 31 | | - }
|
| 32 | | -
|
| 33 | | - static function onThreadPermalinkView( $threadParmalinkView, &$thread ) {
|
| 34 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 35 | | - $originalRoot = $langridAccessObject->originalRootbyRoot( $threadParmalinkView->article );
|
| 36 | | - if ( is_null( $originalRoot ) ) {
|
| 37 | | - $thread = Threads::withRoot( $threadParmalinkView->article );
|
| 38 | | - } else {
|
| 39 | | - $thread = Threads::withRoot( $originalRoot );
|
| 40 | | - }
|
| 41 | | -
|
| 42 | | - return true;
|
| 43 | | - }
|
| 44 | | -
|
| 45 | | - static function translateRoot( $thread, &$article, $talkpage) {
|
| 46 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 47 | | - $article = $langridAccessObject->translatedRootByRoot($thread->root());
|
| 48 | | - return true;
|
| 49 | | - }
|
| 50 | | -
|
| 51 | | - static function onThreadSignature( $thread, &$signature) {
|
| 52 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 53 | | - $languageCode = $langridAccessObject->getSourceLanguage( $thread->id() );
|
| 54 | | - $signature .= wfMsg( 'multilang_lqt_post_language',
|
| 55 | | - LanguageGridAccessObject::convertLanguageCodeIntoLanguageName($languageCode));
|
| 56 | | - return true;
|
| 57 | | - }
|
| 58 | | -
|
| 59 | | - static function translateSubject( $thread, &$html ) {
|
| 60 | | - $sourceSubject = $thread->subjectWithoutIncrement();
|
| 61 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 62 | | - $translatedSubject = $langridAccessObject->translateSubject( $thread, $sourceSubject );
|
| 63 | | - if ( is_null( $translatedSubject ) ) {
|
| 64 | | - $html .= ' <font color="#f00">(Translation Failed)</font> ';
|
| 65 | | - } else {
|
| 66 | | - $html = LqtView::formatSubject( $translatedSubject );
|
| 67 | | - }
|
| 68 | | - return true;
|
| 69 | | - }
|
| 70 | | -
|
| 71 | | - static function translateSubjectforTOC( $thread ) {
|
| 72 | | - $sourceSubject = $thread->subjectWithoutIncrement();
|
| 73 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 74 | | - $translatedSubject = $langridAccessObject->translateSubject( $thread, $sourceSubject );
|
| 75 | | - if ( is_null( $translatedSubject ) ) {
|
| 76 | | - $thread->setSubject( $sourceSubject );
|
| 77 | | - } else {
|
| 78 | | - $thread->setSubject( $translatedSubject );
|
| 79 | | - }
|
| 80 | | - return true;
|
| 81 | | - }
|
| 82 | | -
|
| 83 | | - static function translateBody( $thread, &$post ) {
|
| 84 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 85 | | - $root = $langridAccessObject->translatedRootByThread($thread);
|
| 86 | | - if ( !is_null( $root ) ) {
|
| 87 | | - $post = $root;
|
| 88 | | - }
|
| 89 | | -
|
| 90 | | - return true;
|
| 91 | | - }
|
| 92 | | -
|
| 93 | | - static function onThreadMajorCommands( $thread, &$commands ) {
|
| 94 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 95 | | - if ( !$langridAccessObject->needsNoTranslation( $thread->id() ) ) {
|
| 96 | | - $languageCode = $langridAccessObject->getSourceLanguage( $thread->id() );
|
| 97 | | - $sourceMsg = wfMsg( 'multilang_lqt_show_original',
|
| 98 | | - LanguageGridAccessObject::convertLanguageCodeIntoLanguageName( $languageCode ) );
|
| 99 | | - if ( is_null( $sourceMsg ) ) $sourceMsg = 'Original';
|
| 100 | | - $sourceUrl = LqtView::talkpageUrl( $thread->title() , 'source', $thread,
|
| 101 | | - true /* include fragment */, true );
|
| 102 | | - $commands['source'] =
|
| 103 | | - array(
|
| 104 | | - 'label' => $sourceMsg,
|
| 105 | | - 'class' => 'lqt-command-source',
|
| 106 | | - 'href' => $sourceUrl,
|
| 107 | | - 'enabled' => true
|
| 108 | | - );
|
| 109 | | - }
|
| 110 | | -
|
| 111 | | - return true;
|
| 112 | | - }
|
| 113 | | -
|
| 114 | | - static function onShowPostThreadBody( $thread, $request, &$html ) {
|
| 115 | | - $sView = new SourceView( $thread, $request );
|
| 116 | | -
|
| 117 | | - // show source
|
| 118 | | - if ( $sView->methodAppliesToThread( 'source' ) ) {
|
| 119 | | - // As with above, flush HTML to avoid refactoring EditPage.
|
| 120 | | - $html .= '<hr>';
|
| 121 | | - $html .= $sView->showSource( $thread );
|
| 122 | | - } else {
|
| 123 | | - $html .= Xml::tags( 'div',
|
| 124 | | - array( 'class' => 'lqt-source-form lqt-edit-form',
|
| 125 | | - 'style' => 'display: none;' ),
|
| 126 | | - '' );
|
| 127 | | - }
|
| 128 | | -
|
| 129 | | - return true;
|
| 130 | | - }
|
| 131 | | -
|
| 132 | | - static function onDoInlineEditForm( $thread, $request, &$output ) {
|
| 133 | | - $sView = new SourceView( $thread, $request );
|
| 134 | | -
|
| 135 | | - if ( $sView->methodAppliesToThread( 'source' ) ) {
|
| 136 | | - $html = $sView->showSource( $thread );
|
| 137 | | - $output->addHTML( $html );
|
| 138 | | - }
|
| 139 | | -
|
| 140 | | - return true;
|
| 141 | | - }
|
| 142 | | -
|
| 143 | | - static function saveSourceLang( &$thread ) {
|
| 144 | | - $dbw = wfGetDB( DB_MASTER );
|
| 145 | | - $threadId = $thread->id();
|
| 146 | | -
|
| 147 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 148 | | - $postlang = $langridAccessObject->getTargetLanguage();
|
| 149 | | -
|
| 150 | | - $threadlang = ThreadLanguage::create( $threadId, $postlang );
|
| 151 | | -
|
| 152 | | - return true;
|
| 153 | | - }
|
| 154 | | -
|
| 155 | | - static function showLanguageSelector( &$e, $t ) {
|
| 156 | | - $language_label = wfMsg( 'multilang_lqt_language' );
|
| 157 | | -
|
| 158 | | - $lang_select_html .= Xml::openElement('select', array('name' => 'wpPostlang', 'id' => 'wpPostlang', 'style' => $select));
|
| 159 | | - global $wgLanguageSelectorLanguages,$wgContLang,$wgLang;
|
| 160 | | -
|
| 161 | | - //$postlang = $this->request->getVal( 'wpPostlang' );
|
| 162 | | - $langridAccessObject = new LanguageGridAccessObject();
|
| 163 | | - $postlang = $langridAccessObject->getTargetLanguage();
|
| 164 | | - if($postlang) {
|
| 165 | | - // for preview page
|
| 166 | | - $code = $postlang;
|
| 167 | | - } else {
|
| 168 | | - $code = $wgLang->getCode();
|
| 169 | | - }
|
| 170 | | -
|
| 171 | | - foreach ($wgLanguageSelectorLanguages as $ln) {
|
| 172 | | - $name = $wgContLang->getLanguageName($ln);
|
| 173 | | - if ($showCode) $name = wfBCP47($ln) . ' - ' . $name;
|
| 174 | | - $lang_select_html .= Xml::option($name, $ln, $ln == $code);
|
| 175 | | - }
|
| 176 | | - $lang_select_html .= Xml::closeElement('select');
|
| 177 | | - $e->editFormTextBeforeContent .=
|
| 178 | | - Xml::Label( $language_label, 'lqt_lang_name' ) .
|
| 179 | | - $lang_select_html .
|
| 180 | | - Xml::element( 'br' );
|
| 181 | | -
|
| 182 | | - return true;
|
| 183 | | - }
|
| 184 | | -
|
| 185 | | -}
|
| 186 | | -?>
|
| | 2 | +<?php |
| | 3 | +class MultilangLqtHooks { |
| | 4 | + |
| | 5 | + static $translatedSubject; |
| | 6 | + |
| | 7 | + static function saveReply( &$info, &$e, &$thread ) { |
| | 8 | + $replyTo = $info['replyTo']; |
| | 9 | + $subject = $replyTo->subject(); |
| | 10 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 11 | + $translatedSubject = $langridAccessObject->translateSubject($replyTo, $subject); |
| | 12 | + $replyTo->setSubject( $translatedSubject ); |
| | 13 | + $info['replyTo'] = $replyTo; |
| | 14 | + return true; |
| | 15 | + } |
| | 16 | + |
| | 17 | + static function onThreadCommands( $thread, &$commands ) { |
| | 18 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 19 | + if ( !$langridAccessObject->needsNoTranslation( $thread->id() ) ) { |
| | 20 | + $translatedRoot = $langridAccessObject->translatedRootByThread( $thread ); |
| | 21 | + if ( isset( $translatedRoot ) ) { |
| | 22 | + $thread->setRoot( $translatedRoot ); |
| | 23 | + } |
| | 24 | + } |
| | 25 | + |
| | 26 | + $translated_history_url = LqtView::permalinkUrlWithQuery( $thread, array( 'action' => 'history' ) ); |
| | 27 | + $commands['history'] = array( 'label' => wfMsgExt( 'history_short', 'parseinline' ), |
| | 28 | + 'href' => $translated_history_url, |
| | 29 | + 'enabled' => true ); |
| | 30 | + return true; |
| | 31 | + } |
| | 32 | + |
| | 33 | + static function onThreadPermalinkView( $threadParmalinkView, &$thread ) { |
| | 34 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 35 | + $originalRoot = $langridAccessObject->originalRootbyRoot( $threadParmalinkView->article ); |
| | 36 | + if ( is_null( $originalRoot ) ) { |
| | 37 | + $thread = Threads::withRoot( $threadParmalinkView->article ); |
| | 38 | + } else { |
| | 39 | + $thread = Threads::withRoot( $originalRoot ); |
| | 40 | + } |
| | 41 | + |
| | 42 | + return true; |
| | 43 | + } |
| | 44 | + |
| | 45 | + static function translateRoot( $thread, &$article, $talkpage) { |
| | 46 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 47 | + $article = $langridAccessObject->translatedRootByRoot($thread->root()); |
| | 48 | + return true; |
| | 49 | + } |
| | 50 | + |
| | 51 | + static function onThreadSignature( $thread, &$signature) { |
| | 52 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 53 | + $languageCode = $langridAccessObject->getSourceLanguage( $thread->id() ); |
| | 54 | + $signature .= wfMsg( 'multilang_lqt_post_language', |
| | 55 | + LanguageGridAccessObject::convertLanguageCodeIntoLanguageName($languageCode)); |
| | 56 | + return true; |
| | 57 | + } |
| | 58 | + |
| | 59 | + static function translateSubject( $thread, &$html ) { |
| | 60 | + $sourceSubject = $thread->subjectWithoutIncrement(); |
| | 61 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 62 | + $translatedSubject = $langridAccessObject->translateSubject( $thread, $sourceSubject ); |
| | 63 | + if ( is_null( $translatedSubject ) ) { |
| | 64 | + $html .= ' <font color="#f00">(Translation Failed)</font> '; |
| | 65 | + } else { |
| | 66 | + $html = LqtView::formatSubject( $translatedSubject ); |
| | 67 | + } |
| | 68 | + return true; |
| | 69 | + } |
| | 70 | + |
| | 71 | + static function translateSubjectforTOC( $thread ) { |
| | 72 | + $sourceSubject = $thread->subjectWithoutIncrement(); |
| | 73 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 74 | + $translatedSubject = $langridAccessObject->translateSubject( $thread, $sourceSubject ); |
| | 75 | + if ( is_null( $translatedSubject ) ) { |
| | 76 | + $thread->setSubject( $sourceSubject ); |
| | 77 | + } else { |
| | 78 | + $thread->setSubject( $translatedSubject ); |
| | 79 | + } |
| | 80 | + return true; |
| | 81 | + } |
| | 82 | + |
| | 83 | + static function translateBody( $thread, &$post ) { |
| | 84 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 85 | + $root = $langridAccessObject->translatedRootByThread($thread); |
| | 86 | + if ( !is_null( $root ) ) { |
| | 87 | + $post = $root; |
| | 88 | + } |
| | 89 | + |
| | 90 | + return true; |
| | 91 | + } |
| | 92 | + |
| | 93 | + static function onThreadMajorCommands( $thread, &$commands ) { |
| | 94 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 95 | + if ( !$langridAccessObject->needsNoTranslation( $thread->id() ) ) { |
| | 96 | + $languageCode = $langridAccessObject->getSourceLanguage( $thread->id() ); |
| | 97 | + $sourceMsg = wfMsg( 'multilang_lqt_show_original', |
| | 98 | + LanguageGridAccessObject::convertLanguageCodeIntoLanguageName( $languageCode ) ); |
| | 99 | + if ( is_null( $sourceMsg ) ) $sourceMsg = 'Original'; |
| | 100 | + $sourceUrl = LqtView::talkpageUrl( $thread->title() , 'source', $thread, |
| | 101 | + true /* include fragment */, true ); |
| | 102 | + $commands['source'] = |
| | 103 | + array( |
| | 104 | + 'label' => $sourceMsg, |
| | 105 | + 'class' => 'lqt-command-source', |
| | 106 | + 'href' => $sourceUrl, |
| | 107 | + 'enabled' => true |
| | 108 | + ); |
| | 109 | + } |
| | 110 | + |
| | 111 | + return true; |
| | 112 | + } |
| | 113 | + |
| | 114 | + static function onShowPostThreadBody( $thread, $request, &$html ) { |
| | 115 | + $sView = new SourceView( $thread, $request ); |
| | 116 | + |
| | 117 | + // show source |
| | 118 | + if ( $sView->methodAppliesToThread( 'source' ) ) { |
| | 119 | + // As with above, flush HTML to avoid refactoring EditPage. |
| | 120 | + $html .= '<hr>'; |
| | 121 | + $html .= $sView->showSource( $thread ); |
| | 122 | + } else { |
| | 123 | + $html .= Xml::tags( 'div', |
| | 124 | + array( 'class' => 'lqt-source-form lqt-edit-form', |
| | 125 | + 'style' => 'display: none;' ), |
| | 126 | + '' ); |
| | 127 | + } |
| | 128 | + |
| | 129 | + return true; |
| | 130 | + } |
| | 131 | + |
| | 132 | + static function onDoInlineEditForm( $thread, $request, &$output ) { |
| | 133 | + $sView = new SourceView( $thread, $request ); |
| | 134 | + |
| | 135 | + if ( $sView->methodAppliesToThread( 'source' ) ) { |
| | 136 | + $html = $sView->showSource( $thread ); |
| | 137 | + $output->addHTML( $html ); |
| | 138 | + } |
| | 139 | + |
| | 140 | + return true; |
| | 141 | + } |
| | 142 | + |
| | 143 | + static function saveSourceLang( &$thread ) { |
| | 144 | + $dbw = wfGetDB( DB_MASTER ); |
| | 145 | + $threadId = $thread->id(); |
| | 146 | + |
| | 147 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 148 | + $postlang = $langridAccessObject->getTargetLanguage(); |
| | 149 | + |
| | 150 | + $threadlang = ThreadLanguage::create( $threadId, $postlang ); |
| | 151 | + |
| | 152 | + return true; |
| | 153 | + } |
| | 154 | + |
| | 155 | + static function showLanguageSelector( &$e, $t ) { |
| | 156 | + $language_label = wfMsg( 'multilang_lqt_language' ); |
| | 157 | + |
| | 158 | + $lang_select_html .= Xml::openElement('select', array('name' => 'wpPostlang', 'id' => 'wpPostlang', 'style' => $select)); |
| | 159 | + global $wgLanguageSelectorLanguages,$wgContLang,$wgLang; |
| | 160 | + |
| | 161 | + //$postlang = $this->request->getVal( 'wpPostlang' ); |
| | 162 | + $langridAccessObject = new LanguageGridAccessObject(); |
| | 163 | + $postlang = $langridAccessObject->getTargetLanguage(); |
| | 164 | + if($postlang) { |
| | 165 | + // for preview page |
| | 166 | + $code = $postlang; |
| | 167 | + } else { |
| | 168 | + $code = $wgLang->getCode(); |
| | 169 | + } |
| | 170 | + |
| | 171 | + foreach ($wgLanguageSelectorLanguages as $ln) { |
| | 172 | + $name = $wgContLang->getLanguageName($ln); |
| | 173 | + if ($showCode) $name = wfBCP47($ln) . ' - ' . $name; |
| | 174 | + $lang_select_html .= Xml::option($name, $ln, $ln == $code); |
| | 175 | + } |
| | 176 | + $lang_select_html .= Xml::closeElement('select'); |
| | 177 | + $e->editFormTextBeforeContent .= |
| | 178 | + Xml::Label( $language_label, 'lqt_lang_name' ) . |
| | 179 | + $lang_select_html . |
| | 180 | + Xml::element( 'br' ); |
| | 181 | + |
| | 182 | + return true; |
| | 183 | + } |
| | 184 | + |
| | 185 | +} |
| | 186 | +?> |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/langrid/MultilangLqtHooks.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 187 | 187 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/langrid/MultilangThreadController.php |
| — | — | @@ -1,62 +1,62 @@ |
| 2 | | -<?php
|
| 3 | | -class MultilangThreadController {
|
| 4 | | - public $thread;
|
| 5 | | - public $langridAccessObject;
|
| 6 | | -
|
| 7 | | - //もしかして、これって$threadを上書きできない？
|
| 8 | | - //getThreadメソッドが必要？ by嶋田
|
| 9 | | - function __construct ( $thread ) {
|
| 10 | | - $this->thread = $thread;
|
| 11 | | - $this->langridAccessObject = new LanguageGridAccessObject();
|
| 12 | | - }
|
| 13 | | -
|
| 14 | | - function getRootId( $thread ) {
|
| 15 | | -
|
| 16 | | - }
|
| 17 | | -
|
| 18 | | - function rootById( $rootId ) {
|
| 19 | | - $article_cache = Thread::$articleCacheById[$rootId];
|
| 20 | | - if ( isset( $article_cache ) ) {
|
| 21 | | - return $article_cache;
|
| 22 | | - }
|
| 23 | | - $title_cache = Thread::$titleCacheById[$rootId];
|
| 24 | | - $title = isset( $title_cache ) ? $title_cache : Title::newFromID( $rootId );
|
| 25 | | - return $title ? new Article_LQT_Compat( $title ) : null;
|
| 26 | | - }
|
| 27 | | -
|
| 28 | | - function editMonolingualSubject( $subject ) {
|
| 29 | | - $threadId = $this->thread->id();
|
| 30 | | - if ( $this->langridAccessObject->needsNoTranslation( $threadId ) ) {
|
| 31 | | - $this->thread->setThisSubject( $subject );
|
| 32 | | - } else {
|
| 33 | | - $targetLang = $this->langridAccessObject->getTargetLanguage();
|
| 34 | | - $translatedThread = TranslatedThread::loadTranslatedThread( $threadId, $targetLang );
|
| 35 | | - $translatedThread->setTtSubject( $subject );
|
| 36 | | - $translatedThread->save();
|
| 37 | | - }
|
| 38 | | -
|
| 39 | | - foreach( $this->thread->replies() as $reply ) {
|
| 40 | | - $multilangThreadController = new MultilangThreadController( $reply );
|
| 41 | | - $multilangThreadController->editMonolingualSubject( $subject );
|
| 42 | | - }
|
| 43 | | - }
|
| 44 | | -
|
| 45 | | - function getSourceSentence( $thread ) {
|
| 46 | | - global $wgOut;
|
| 47 | | -
|
| 48 | | - $post = $thread->root();
|
| 49 | | - $oldid = $thread->isHistorical() ? $thread->rootRevision() : null;
|
| 50 | | -
|
| 51 | | - // Load compatibility layer for older versions
|
| 52 | | - if ( !( $post instanceof Article_LQT_Compat ) ) {
|
| 53 | | - wfWarn( "No article compatibility layer loaded, inefficiently duplicating information." );
|
| 54 | | - $post = new Article_LQT_Compat( $post->getTitle() );
|
| 55 | | - }
|
| 56 | | -
|
| 57 | | - $parserOutput = $post->getParserOutput( $oldid );
|
| 58 | | - $wgOut->addParserOutputNoText( $parserOutput );
|
| 59 | | -
|
| 60 | | - return $parserOutput->getText();
|
| 61 | | - }
|
| 62 | | -}
|
| 63 | | -?>
|
| | 2 | +<?php |
| | 3 | +class MultilangThreadController { |
| | 4 | + public $thread; |
| | 5 | + public $langridAccessObject; |
| | 6 | + |
| | 7 | + //もしかして、これって$threadを上書きできない？ |
| | 8 | + //getThreadメソッドが必要？ by嶋田 |
| | 9 | + function __construct ( $thread ) { |
| | 10 | + $this->thread = $thread; |
| | 11 | + $this->langridAccessObject = new LanguageGridAccessObject(); |
| | 12 | + } |
| | 13 | + |
| | 14 | + function getRootId( $thread ) { |
| | 15 | + |
| | 16 | + } |
| | 17 | + |
| | 18 | + function rootById( $rootId ) { |
| | 19 | + $article_cache = Thread::$articleCacheById[$rootId]; |
| | 20 | + if ( isset( $article_cache ) ) { |
| | 21 | + return $article_cache; |
| | 22 | + } |
| | 23 | + $title_cache = Thread::$titleCacheById[$rootId]; |
| | 24 | + $title = isset( $title_cache ) ? $title_cache : Title::newFromID( $rootId ); |
| | 25 | + return $title ? new Article_LQT_Compat( $title ) : null; |
| | 26 | + } |
| | 27 | + |
| | 28 | + function editMonolingualSubject( $subject ) { |
| | 29 | + $threadId = $this->thread->id(); |
| | 30 | + if ( $this->langridAccessObject->needsNoTranslation( $threadId ) ) { |
| | 31 | + $this->thread->setThisSubject( $subject ); |
| | 32 | + } else { |
| | 33 | + $targetLang = $this->langridAccessObject->getTargetLanguage(); |
| | 34 | + $translatedThread = TranslatedThread::loadTranslatedThread( $threadId, $targetLang ); |
| | 35 | + $translatedThread->setTtSubject( $subject ); |
| | 36 | + $translatedThread->save(); |
| | 37 | + } |
| | 38 | + |
| | 39 | + foreach( $this->thread->replies() as $reply ) { |
| | 40 | + $multilangThreadController = new MultilangThreadController( $reply ); |
| | 41 | + $multilangThreadController->editMonolingualSubject( $subject ); |
| | 42 | + } |
| | 43 | + } |
| | 44 | + |
| | 45 | + function getSourceSentence( $thread ) { |
| | 46 | + global $wgOut; |
| | 47 | + |
| | 48 | + $post = $thread->root(); |
| | 49 | + $oldid = $thread->isHistorical() ? $thread->rootRevision() : null; |
| | 50 | + |
| | 51 | + // Load compatibility layer for older versions |
| | 52 | + if ( !( $post instanceof Article_LQT_Compat ) ) { |
| | 53 | + wfWarn( "No article compatibility layer loaded, inefficiently duplicating information." ); |
| | 54 | + $post = new Article_LQT_Compat( $post->getTitle() ); |
| | 55 | + } |
| | 56 | + |
| | 57 | + $parserOutput = $post->getParserOutput( $oldid ); |
| | 58 | + $wgOut->addParserOutputNoText( $parserOutput ); |
| | 59 | + |
| | 60 | + return $parserOutput->getText(); |
| | 61 | + } |
| | 62 | +} |
| | 63 | +?> |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/langrid/MultilangThreadController.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 64 | 64 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/.project |
| — | — | @@ -1,11 +1,11 @@ |
| 2 | | -<?xml version="1.0" encoding="UTF-8"?>
|
| 3 | | -<projectDescription>
|
| 4 | | - <name>MultilingualLiquidThreads</name>
|
| 5 | | - <comment></comment>
|
| 6 | | - <projects>
|
| 7 | | - </projects>
|
| 8 | | - <buildSpec>
|
| 9 | | - </buildSpec>
|
| 10 | | - <natures>
|
| 11 | | - </natures>
|
| 12 | | -</projectDescription>
|
| | 2 | +<?xml version="1.0" encoding="UTF-8"?> |
| | 3 | +<projectDescription> |
| | 4 | + <name>MultilingualLiquidThreads</name> |
| | 5 | + <comment></comment> |
| | 6 | + <projects> |
| | 7 | + </projects> |
| | 8 | + <buildSpec> |
| | 9 | + </buildSpec> |
| | 10 | + <natures> |
| | 11 | + </natures> |
| | 12 | +</projectDescription> |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/.project |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 13 | 13 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/LiquidThreads.php |
| — | — | @@ -1,227 +1,227 @@ |
| 2 | | -<?php
|
| 3 | | -if ( !defined( 'MEDIAWIKI' ) )
|
| 4 | | - die();
|
| 5 | | -
|
| 6 | | -$wgExtensionCredits['other'][] = array(
|
| 7 | | - 'path' => __FILE__,
|
| 8 | | - 'name' => 'Liquid Threads',
|
| 9 | | - 'version' => '2.0-alpha',
|
| 10 | | - 'url' => 'http://www.mediawiki.org/wiki/Extension:LiquidThreads',
|
| 11 | | - 'author' => array( 'David McCabe', 'Andrew Garrett' ),
|
| 12 | | - 'descriptionmsg' => 'lqt-desc',
|
| 13 | | -);
|
| 14 | | -
|
| 15 | | -require( 'LqtFunctions.php' );
|
| 16 | | -
|
| 17 | | -define( 'NS_LQT_THREAD', efArrayDefault( 'egLqtNamespaceNumbers', 'Thread', 90 ) );
|
| 18 | | -define( 'NS_LQT_THREAD_TALK', efArrayDefault( 'egLqtNamespaceNumbers', 'Thread_talk', 91 ) );
|
| 19 | | -define( 'NS_LQT_SUMMARY', efArrayDefault( 'egLqtNamespaceNumbers', 'Summary', 92 ) );
|
| 20 | | -define( 'NS_LQT_SUMMARY_TALK', efArrayDefault( 'egLqtNamespaceNumbers', 'Summary_talk', 93 ) );
|
| 21 | | -define( 'LQT_NEWEST_CHANGES', 'nc' );
|
| 22 | | -define( 'LQT_NEWEST_THREADS', 'nt' );
|
| 23 | | -define( 'LQT_OLDEST_THREADS', 'ot' );
|
| 24 | | -
|
| 25 | | -// FIXME: would be neat if it was possible to somehow localise this.
|
| 26 | | -$wgCanonicalNamespaceNames[NS_LQT_THREAD] = 'Thread';
|
| 27 | | -$wgCanonicalNamespaceNames[NS_LQT_THREAD_TALK] = 'Thread_talk';
|
| 28 | | -$wgCanonicalNamespaceNames[NS_LQT_SUMMARY] = 'Summary';
|
| 29 | | -$wgCanonicalNamespaceNames[NS_LQT_SUMMARY_TALK] = 'Summary_talk';
|
| 30 | | -
|
| 31 | | -// FIXME: would be neat if it was possible to somehow localise this.
|
| 32 | | -$wgExtraNamespaces[NS_LQT_THREAD] = 'Thread';
|
| 33 | | -$wgExtraNamespaces[NS_LQT_THREAD_TALK] = 'Thread_talk';
|
| 34 | | -$wgExtraNamespaces[NS_LQT_SUMMARY] = 'Summary';
|
| 35 | | -$wgExtraNamespaces[NS_LQT_SUMMARY_TALK] = 'Summary_talk';
|
| 36 | | -
|
| 37 | | -// Localisation
|
| 38 | | -$dir = dirname( __FILE__ ) . '/';
|
| 39 | | -$wgExtensionMessagesFiles['LiquidThreads'] = $dir . 'i18n/Lqt.i18n.php';
|
| 40 | | -$wgExtensionMessagesFiles['LiquidThreadsMagic'] = $dir . 'i18n/LiquidThreads.magic.php';
|
| 41 | | -$wgExtensionAliasesFiles['LiquidThreads'] = $dir . 'i18n/Lqt.alias.php';
|
| 42 | | -
|
| 43 | | -// Parser Function Setup
|
| 44 | | -$wgHooks['ParserFirstCallInit'][] = 'lqtSetupParserFunctions';
|
| 45 | | -
|
| 46 | | -// Hooks
|
| 47 | | -// Main dispatch hook
|
| 48 | | -$wgHooks['MediaWikiPerformAction'][] = 'LqtDispatch::tryPage';
|
| 49 | | -$wgHooks['SkinTemplateTabs'][] = 'LqtDispatch::onSkinTemplateTabs';
|
| 50 | | -$wgHooks['SkinTemplateNavigation'][] = 'LqtDispatch::onSkinTemplateNavigation';
|
| 51 | | -
|
| 52 | | -// Customisation of recentchanges
|
| 53 | | -$wgHooks['OldChangesListRecentChangesLine'][] = 'LqtHooks::customizeOldChangesList';
|
| 54 | | -
|
| 55 | | -// Notification (watchlist, newtalk)
|
| 56 | | -$wgHooks['SkinTemplateOutputPageBeforeExec'][] = 'LqtHooks::setNewtalkHTML';
|
| 57 | | -$wgHooks['SpecialWatchlistQuery'][] = 'LqtHooks::beforeWatchlist';
|
| 58 | | -$wgHooks['ArticleEditUpdateNewTalk'][] = 'LqtHooks::updateNewtalkOnEdit';
|
| 59 | | -$wgHooks['PersonalUrls'][] = 'LqtHooks::onPersonalUrls';
|
| 60 | | -
|
| 61 | | -// Preferences
|
| 62 | | -$wgHooks['GetPreferences'][] = 'LqtHooks::getPreferences';
|
| 63 | | -
|
| 64 | | -// Export-related
|
| 65 | | -$wgHooks['XmlDumpWriterOpenPage'][] = 'LqtHooks::dumpThreadData';
|
| 66 | | -$wgHooks['ModifyExportQuery'][] = 'LqtHooks::modifyExportQuery';
|
| 67 | | -$wgHooks['OAIFetchRowsQuery'][] = 'LqtHooks::modifyOAIQuery';
|
| 68 | | -$wgHooks['OAIFetchRecordQuery'][] = 'LqtHooks::modifyOAIQuery';
|
| 69 | | -
|
| 70 | | -// Deletion
|
| 71 | | -$wgHooks['ArticleDeleteComplete'][] = 'LqtDeletionController::onArticleDeleteComplete';
|
| 72 | | -$wgHooks['ArticleRevisionUndeleted'][] = 'LqtDeletionController::onArticleRevisionUndeleted';
|
| 73 | | -$wgHooks['ArticleUndelete'][] = 'LqtDeletionController::onArticleUndelete';
|
| 74 | | -$wgHooks['ArticleConfirmDelete'][] = 'LqtDeletionController::onArticleConfirmDelete';
|
| 75 | | -$wgHooks['ArticleDelete'][] = 'LqtDeletionController::onArticleDelete';
|
| 76 | | -
|
| 77 | | -// Moving
|
| 78 | | -$wgHooks['SpecialMovepageAfterMove'][] = 'LqtHooks::onArticleMoveComplete';
|
| 79 | | -$wgHooks['AbortMove'][] = 'LqtHooks::onArticleMove';
|
| 80 | | -
|
| 81 | | -// Search
|
| 82 | | -$wgHooks['ShowSearchHitTitle'][] = 'LqtHooks::customiseSearchResultTitle';
|
| 83 | | -$wgHooks['SpecialSearchProfiles'][] = 'LqtHooks::customiseSearchProfiles';
|
| 84 | | -
|
| 85 | | -// Updates
|
| 86 | | -$wgHooks['LoadExtensionSchemaUpdates'][] = 'LqtHooks::onLoadExtensionSchemaUpdates';
|
| 87 | | -
|
| 88 | | -// Rename
|
| 89 | | -$wgHooks['RenameUserSQL'][] = 'LqtHooks::onUserRename';
|
| 90 | | -
|
| 91 | | -// Edit-related
|
| 92 | | -$wgHooks['EditPageBeforeEditChecks'][] = 'LqtHooks::editCheckBoxes';
|
| 93 | | -$wgHooks['ArticleSaveComplete'][] = 'LqtHooks::onArticleSaveComplete';
|
| 94 | | -
|
| 95 | | -// Blocking
|
| 96 | | -$wgHooks['UserIsBlockedFrom'][] = 'LqtHooks::userIsBlockedFrom';
|
| 97 | | -
|
| 98 | | -// Protection
|
| 99 | | -$wgHooks['TitleGetRestrictionTypes'][] = 'LqtHooks::getProtectionTypes';
|
| 100 | | -
|
| 101 | | -// Special pages
|
| 102 | | -$wgSpecialPages['MoveThread'] = 'SpecialMoveThread';
|
| 103 | | -$wgSpecialPages['NewMessages'] = 'SpecialNewMessages';
|
| 104 | | -$wgSpecialPages['SplitThread'] = 'SpecialSplitThread';
|
| 105 | | -$wgSpecialPages['MergeThread'] = 'SpecialMergeThread';
|
| 106 | | -// $wgSpecialPages['HotTopics'] = 'SpecialHotTopics';
|
| 107 | | -$wgSpecialPageGroups['NewMessages'] = 'wiki';
|
| 108 | | -
|
| 109 | | -// Classes
|
| 110 | | -$wgAutoloadClasses['LqtDispatch'] = $dir . 'classes/Dispatch.php';
|
| 111 | | -$wgAutoloadClasses['LqtView'] = $dir . 'classes/View.php';
|
| 112 | | -$wgAutoloadClasses['HistoricalThread'] = $dir . 'classes/HistoricalThread.php';
|
| 113 | | -$wgAutoloadClasses['Thread'] = $dir . 'classes/Thread.php';
|
| 114 | | -$wgAutoloadClasses['Threads'] = $dir . 'classes/Threads.php';
|
| 115 | | -$wgAutoloadClasses['NewMessages'] = $dir . 'classes/NewMessagesController.php';
|
| 116 | | -$wgAutoloadClasses['LqtParserFunctions'] = $dir . 'classes/ParserFunctions.php';
|
| 117 | | -$wgAutoloadClasses['LqtDeletionController'] = $dir . 'classes/DeletionController.php';
|
| 118 | | -$wgAutoloadClasses['LqtHooks'] = $dir . 'classes/Hooks.php';
|
| 119 | | -$wgAutoloadClasses['ThreadRevision'] = $dir . "/classes/ThreadRevision.php";
|
| 120 | | -$wgAutoloadClasses['SynchroniseThreadArticleDataJob'] = "$dir/classes/SynchroniseThreadArticleDataJob.php";
|
| 121 | | -$wgAutoloadClasses['ThreadHistoryPager'] = "$dir/classes/ThreadHistoryPager.php";
|
| 122 | | -$wgAutoloadClasses['TalkpageHistoryView'] = "$dir/pages/TalkpageHistoryView.php";
|
| 123 | | -$wgAutoloadClasses['LqtHotTopicsController'] = "$dir/classes/HotTopics.php";
|
| 124 | | -$wgAutoloadClasses['LqtLogFormatter'] = "$dir/classes/LogFormatter.php";
|
| 125 | | -
|
| 126 | | -// View classes
|
| 127 | | -$wgAutoloadClasses['TalkpageView'] = $dir . 'pages/TalkpageView.php';
|
| 128 | | -$wgAutoloadClasses['ThreadPermalinkView'] = $dir . 'pages/ThreadPermalinkView.php';
|
| 129 | | -$wgAutoloadClasses['TalkpageHeaderView'] = $dir . 'pages/TalkpageHeaderView.php';
|
| 130 | | -$wgAutoloadClasses['IndividualThreadHistoryView'] = $dir . 'pages/IndividualThreadHistoryView.php';
|
| 131 | | -$wgAutoloadClasses['ThreadDiffView'] = $dir . 'pages/ThreadDiffView.php';
|
| 132 | | -$wgAutoloadClasses['ThreadWatchView'] = $dir . 'pages/ThreadWatchView.php';
|
| 133 | | -$wgAutoloadClasses['ThreadProtectionFormView'] = $dir . 'pages/ThreadProtectionFormView.php';
|
| 134 | | -$wgAutoloadClasses['ThreadHistoryListingView'] = $dir . 'pages/ThreadHistoryListingView.php';
|
| 135 | | -$wgAutoloadClasses['ThreadHistoricalRevisionView'] = $dir . 'pages/ThreadHistoricalRevisionView.php';
|
| 136 | | -$wgAutoloadClasses['SummaryPageView'] = $dir . 'pages/SummaryPageView.php';
|
| 137 | | -$wgAutoloadClasses['NewUserMessagesView'] = $dir . 'pages/NewUserMessagesView.php';
|
| 138 | | -
|
| 139 | | -// Special pages
|
| 140 | | -$wgAutoloadClasses['ThreadActionPage'] = $dir . 'pages/ThreadActionPage.php';
|
| 141 | | -$wgAutoloadClasses['SpecialMoveThread'] = $dir . 'pages/SpecialMoveThread.php';
|
| 142 | | -$wgAutoloadClasses['SpecialNewMessages'] = $dir . 'pages/SpecialNewMessages.php';
|
| 143 | | -$wgAutoloadClasses['SpecialSplitThread'] = $dir . 'pages/SpecialSplitThread.php';
|
| 144 | | -$wgAutoloadClasses['SpecialMergeThread'] = $dir . 'pages/SpecialMergeThread.php';
|
| 145 | | -$wgAutoloadClasses['SpecialHotTopics'] = "$dir/pages/SpecialHotTopics.php";
|
| 146 | | -
|
| 147 | | -// Job queue
|
| 148 | | -$wgJobClasses['synchroniseThreadArticleData'] = 'SynchroniseThreadArticleDataJob';
|
| 149 | | -
|
| 150 | | -// Backwards-compatibility
|
| 151 | | -$wgAutoloadClasses['Article_LQT_Compat'] = $dir . 'compat/LqtCompatArticle.php';
|
| 152 | | -if ( version_compare( $wgVersion, '1.16', '<' ) ) {
|
| 153 | | - $wgAutoloadClasses['HTMLForm'] = "$dir/compat/HTMLForm.php";
|
| 154 | | - $wgExtensionMessagesFiles['Lqt-Compat'] = "$dir/compat/Lqt-compat.i18n.php";
|
| 155 | | -}
|
| 156 | | -
|
| 157 | | -// Logging
|
| 158 | | -$wgLogTypes[] = 'liquidthreads';
|
| 159 | | -$wgLogNames['liquidthreads'] = 'lqt-log-name';
|
| 160 | | -$wgLogHeaders['liquidthreads'] = 'lqt-log-header';
|
| 161 | | -
|
| 162 | | -foreach ( array( 'move', 'split', 'merge', 'subjectedit', 'resort' ) as $action ) {
|
| 163 | | - $wgLogActionsHandlers["liquidthreads/$action"] = 'LqtLogFormatter::formatLogEntry';
|
| 164 | | -}
|
| 165 | | -
|
| 166 | | -// Preferences
|
| 167 | | -$wgDefaultUserOptions['lqtnotifytalk'] = false;
|
| 168 | | -$wgDefaultUserOptions['lqtdisplaydepth'] = 5;
|
| 169 | | -$wgDefaultUserOptions['lqtdisplaycount'] = 25;
|
| 170 | | -$wgDefaultUserOptions['lqtcustomsignatures'] = true;
|
| 171 | | -
|
| 172 | | -// API
|
| 173 | | -$wgAutoloadClasses['ApiQueryLQTThreads'] = "$dir/api/ApiQueryLQTThreads.php";
|
| 174 | | -$wgAPIListModules['threads'] = 'ApiQueryLQTThreads';
|
| 175 | | -$wgAutoloadClasses['ApiFeedLQTThreads'] = "$dir/api/ApiFeedLQTThreads.php";
|
| 176 | | -$wgAPIModules['feedthreads'] = 'ApiFeedLQTThreads';
|
| 177 | | -$wgAutoloadClasses['ApiThreadAction'] = "$dir/api/ApiThreadAction.php";
|
| 178 | | -$wgAPIModules['threadaction'] = 'ApiThreadAction';
|
| 179 | | -
|
| 180 | | -// Name of the extension (wmf-specific, for splitting to versions)
|
| 181 | | -$wgLiquidThreadsExtensionName = 'LiquidThreads';
|
| 182 | | -
|
| 183 | | -/** CONFIGURATION SECTION */
|
| 184 | | -
|
| 185 | | -$wgDefaultUserOptions['lqt-watch-threads'] = true;
|
| 186 | | -
|
| 187 | | -$wgGroupPermissions['user']['lqt-split'] = true;
|
| 188 | | -$wgGroupPermissions['user']['lqt-merge'] = true;
|
| 189 | | -
|
| 190 | | -$wgAvailableRights[] = 'lqt-split';
|
| 191 | | -$wgAvailableRights[] = 'lqt-merge';
|
| 192 | | -
|
| 193 | | -/* Allows activation of LiquidThreads on individual pages */
|
| 194 | | -$wgLqtPages = array();
|
| 195 | | -
|
| 196 | | -/* Allows switching LiquidThreads off for regular talk pages
|
| 197 | | - (intended for testing and transition) */
|
| 198 | | -$wgLqtTalkPages = true;
|
| 199 | | -
|
| 200 | | -/* Whether or not to activate LiquidThreads email notifications */
|
| 201 | | -$wgLqtEnotif = true;
|
| 202 | | -
|
| 203 | | -/* Thread actions which do *not* cause threads to be "bumped" to the top */
|
| 204 | | -/* Using numbers because the change type constants are defined in Threads.php, don't
|
| 205 | | - want to have to parse it on every page view */
|
| 206 | | -$wgThreadActionsNoBump = array(
|
| 207 | | - 3 /* Edited summary */,
|
| 208 | | - 10 /* Merged from */,
|
| 209 | | - 12 /* Split from */,
|
| 210 | | - 2 /* Edited root */,
|
| 211 | | - 14 /* Adjusted sortkey */
|
| 212 | | -);
|
| 213 | | -
|
| 214 | | -/** Switch this on if you've migrated from a version before around May 2009 */
|
| 215 | | -$wgLiquidThreadsMigrate = false;
|
| 216 | | -
|
| 217 | | -/** The default number of threads per page */
|
| 218 | | -$wgLiquidThreadsDefaultPageLimit = 20;
|
| 219 | | -
|
| 220 | | -/** Whether or not to allow users to activate/deactivate LiquidThreads per-page */
|
| 221 | | -$wgLiquidThreadsAllowUserControl = true;
|
| 222 | | -
|
| 223 | | -/** Whether or not to allow users to activate/deactivate LiquidThreads in specific namespaces.
|
| 224 | | - NULL means either all or none, depending on the above. */
|
| 225 | | -$wgLiquidThreadsAllowUserControlNamespaces = null;
|
| 226 | | -
|
| 227 | | -// Multilingal LQT
|
| 228 | | -require_once( $dir . 'langrid/MultilangLqt.php' );
|
| | 2 | +<?php |
| | 3 | +if ( !defined( 'MEDIAWIKI' ) ) |
| | 4 | + die(); |
| | 5 | + |
| | 6 | +$wgExtensionCredits['other'][] = array( |
| | 7 | + 'path' => __FILE__, |
| | 8 | + 'name' => 'Liquid Threads', |
| | 9 | + 'version' => '2.0-alpha', |
| | 10 | + 'url' => 'http://www.mediawiki.org/wiki/Extension:LiquidThreads', |
| | 11 | + 'author' => array( 'David McCabe', 'Andrew Garrett' ), |
| | 12 | + 'descriptionmsg' => 'lqt-desc', |
| | 13 | +); |
| | 14 | + |
| | 15 | +require( 'LqtFunctions.php' ); |
| | 16 | + |
| | 17 | +define( 'NS_LQT_THREAD', efArrayDefault( 'egLqtNamespaceNumbers', 'Thread', 90 ) ); |
| | 18 | +define( 'NS_LQT_THREAD_TALK', efArrayDefault( 'egLqtNamespaceNumbers', 'Thread_talk', 91 ) ); |
| | 19 | +define( 'NS_LQT_SUMMARY', efArrayDefault( 'egLqtNamespaceNumbers', 'Summary', 92 ) ); |
| | 20 | +define( 'NS_LQT_SUMMARY_TALK', efArrayDefault( 'egLqtNamespaceNumbers', 'Summary_talk', 93 ) ); |
| | 21 | +define( 'LQT_NEWEST_CHANGES', 'nc' ); |
| | 22 | +define( 'LQT_NEWEST_THREADS', 'nt' ); |
| | 23 | +define( 'LQT_OLDEST_THREADS', 'ot' ); |
| | 24 | + |
| | 25 | +// FIXME: would be neat if it was possible to somehow localise this. |
| | 26 | +$wgCanonicalNamespaceNames[NS_LQT_THREAD] = 'Thread'; |
| | 27 | +$wgCanonicalNamespaceNames[NS_LQT_THREAD_TALK] = 'Thread_talk'; |
| | 28 | +$wgCanonicalNamespaceNames[NS_LQT_SUMMARY] = 'Summary'; |
| | 29 | +$wgCanonicalNamespaceNames[NS_LQT_SUMMARY_TALK] = 'Summary_talk'; |
| | 30 | + |
| | 31 | +// FIXME: would be neat if it was possible to somehow localise this. |
| | 32 | +$wgExtraNamespaces[NS_LQT_THREAD] = 'Thread'; |
| | 33 | +$wgExtraNamespaces[NS_LQT_THREAD_TALK] = 'Thread_talk'; |
| | 34 | +$wgExtraNamespaces[NS_LQT_SUMMARY] = 'Summary'; |
| | 35 | +$wgExtraNamespaces[NS_LQT_SUMMARY_TALK] = 'Summary_talk'; |
| | 36 | + |
| | 37 | +// Localisation |
| | 38 | +$dir = dirname( __FILE__ ) . '/'; |
| | 39 | +$wgExtensionMessagesFiles['LiquidThreads'] = $dir . 'i18n/Lqt.i18n.php'; |
| | 40 | +$wgExtensionMessagesFiles['LiquidThreadsMagic'] = $dir . 'i18n/LiquidThreads.magic.php'; |
| | 41 | +$wgExtensionAliasesFiles['LiquidThreads'] = $dir . 'i18n/Lqt.alias.php'; |
| | 42 | + |
| | 43 | +// Parser Function Setup |
| | 44 | +$wgHooks['ParserFirstCallInit'][] = 'lqtSetupParserFunctions'; |
| | 45 | + |
| | 46 | +// Hooks |
| | 47 | +// Main dispatch hook |
| | 48 | +$wgHooks['MediaWikiPerformAction'][] = 'LqtDispatch::tryPage'; |
| | 49 | +$wgHooks['SkinTemplateTabs'][] = 'LqtDispatch::onSkinTemplateTabs'; |
| | 50 | +$wgHooks['SkinTemplateNavigation'][] = 'LqtDispatch::onSkinTemplateNavigation'; |
| | 51 | + |
| | 52 | +// Customisation of recentchanges |
| | 53 | +$wgHooks['OldChangesListRecentChangesLine'][] = 'LqtHooks::customizeOldChangesList'; |
| | 54 | + |
| | 55 | +// Notification (watchlist, newtalk) |
| | 56 | +$wgHooks['SkinTemplateOutputPageBeforeExec'][] = 'LqtHooks::setNewtalkHTML'; |
| | 57 | +$wgHooks['SpecialWatchlistQuery'][] = 'LqtHooks::beforeWatchlist'; |
| | 58 | +$wgHooks['ArticleEditUpdateNewTalk'][] = 'LqtHooks::updateNewtalkOnEdit'; |
| | 59 | +$wgHooks['PersonalUrls'][] = 'LqtHooks::onPersonalUrls'; |
| | 60 | + |
| | 61 | +// Preferences |
| | 62 | +$wgHooks['GetPreferences'][] = 'LqtHooks::getPreferences'; |
| | 63 | + |
| | 64 | +// Export-related |
| | 65 | +$wgHooks['XmlDumpWriterOpenPage'][] = 'LqtHooks::dumpThreadData'; |
| | 66 | +$wgHooks['ModifyExportQuery'][] = 'LqtHooks::modifyExportQuery'; |
| | 67 | +$wgHooks['OAIFetchRowsQuery'][] = 'LqtHooks::modifyOAIQuery'; |
| | 68 | +$wgHooks['OAIFetchRecordQuery'][] = 'LqtHooks::modifyOAIQuery'; |
| | 69 | + |
| | 70 | +// Deletion |
| | 71 | +$wgHooks['ArticleDeleteComplete'][] = 'LqtDeletionController::onArticleDeleteComplete'; |
| | 72 | +$wgHooks['ArticleRevisionUndeleted'][] = 'LqtDeletionController::onArticleRevisionUndeleted'; |
| | 73 | +$wgHooks['ArticleUndelete'][] = 'LqtDeletionController::onArticleUndelete'; |
| | 74 | +$wgHooks['ArticleConfirmDelete'][] = 'LqtDeletionController::onArticleConfirmDelete'; |
| | 75 | +$wgHooks['ArticleDelete'][] = 'LqtDeletionController::onArticleDelete'; |
| | 76 | + |
| | 77 | +// Moving |
| | 78 | +$wgHooks['SpecialMovepageAfterMove'][] = 'LqtHooks::onArticleMoveComplete'; |
| | 79 | +$wgHooks['AbortMove'][] = 'LqtHooks::onArticleMove'; |
| | 80 | + |
| | 81 | +// Search |
| | 82 | +$wgHooks['ShowSearchHitTitle'][] = 'LqtHooks::customiseSearchResultTitle'; |
| | 83 | +$wgHooks['SpecialSearchProfiles'][] = 'LqtHooks::customiseSearchProfiles'; |
| | 84 | + |
| | 85 | +// Updates |
| | 86 | +$wgHooks['LoadExtensionSchemaUpdates'][] = 'LqtHooks::onLoadExtensionSchemaUpdates'; |
| | 87 | + |
| | 88 | +// Rename |
| | 89 | +$wgHooks['RenameUserSQL'][] = 'LqtHooks::onUserRename'; |
| | 90 | + |
| | 91 | +// Edit-related |
| | 92 | +$wgHooks['EditPageBeforeEditChecks'][] = 'LqtHooks::editCheckBoxes'; |
| | 93 | +$wgHooks['ArticleSaveComplete'][] = 'LqtHooks::onArticleSaveComplete'; |
| | 94 | + |
| | 95 | +// Blocking |
| | 96 | +$wgHooks['UserIsBlockedFrom'][] = 'LqtHooks::userIsBlockedFrom'; |
| | 97 | + |
| | 98 | +// Protection |
| | 99 | +$wgHooks['TitleGetRestrictionTypes'][] = 'LqtHooks::getProtectionTypes'; |
| | 100 | + |
| | 101 | +// Special pages |
| | 102 | +$wgSpecialPages['MoveThread'] = 'SpecialMoveThread'; |
| | 103 | +$wgSpecialPages['NewMessages'] = 'SpecialNewMessages'; |
| | 104 | +$wgSpecialPages['SplitThread'] = 'SpecialSplitThread'; |
| | 105 | +$wgSpecialPages['MergeThread'] = 'SpecialMergeThread'; |
| | 106 | +// $wgSpecialPages['HotTopics'] = 'SpecialHotTopics'; |
| | 107 | +$wgSpecialPageGroups['NewMessages'] = 'wiki'; |
| | 108 | + |
| | 109 | +// Classes |
| | 110 | +$wgAutoloadClasses['LqtDispatch'] = $dir . 'classes/Dispatch.php'; |
| | 111 | +$wgAutoloadClasses['LqtView'] = $dir . 'classes/View.php'; |
| | 112 | +$wgAutoloadClasses['HistoricalThread'] = $dir . 'classes/HistoricalThread.php'; |
| | 113 | +$wgAutoloadClasses['Thread'] = $dir . 'classes/Thread.php'; |
| | 114 | +$wgAutoloadClasses['Threads'] = $dir . 'classes/Threads.php'; |
| | 115 | +$wgAutoloadClasses['NewMessages'] = $dir . 'classes/NewMessagesController.php'; |
| | 116 | +$wgAutoloadClasses['LqtParserFunctions'] = $dir . 'classes/ParserFunctions.php'; |
| | 117 | +$wgAutoloadClasses['LqtDeletionController'] = $dir . 'classes/DeletionController.php'; |
| | 118 | +$wgAutoloadClasses['LqtHooks'] = $dir . 'classes/Hooks.php'; |
| | 119 | +$wgAutoloadClasses['ThreadRevision'] = $dir . "/classes/ThreadRevision.php"; |
| | 120 | +$wgAutoloadClasses['SynchroniseThreadArticleDataJob'] = "$dir/classes/SynchroniseThreadArticleDataJob.php"; |
| | 121 | +$wgAutoloadClasses['ThreadHistoryPager'] = "$dir/classes/ThreadHistoryPager.php"; |
| | 122 | +$wgAutoloadClasses['TalkpageHistoryView'] = "$dir/pages/TalkpageHistoryView.php"; |
| | 123 | +$wgAutoloadClasses['LqtHotTopicsController'] = "$dir/classes/HotTopics.php"; |
| | 124 | +$wgAutoloadClasses['LqtLogFormatter'] = "$dir/classes/LogFormatter.php"; |
| | 125 | + |
| | 126 | +// View classes |
| | 127 | +$wgAutoloadClasses['TalkpageView'] = $dir . 'pages/TalkpageView.php'; |
| | 128 | +$wgAutoloadClasses['ThreadPermalinkView'] = $dir . 'pages/ThreadPermalinkView.php'; |
| | 129 | +$wgAutoloadClasses['TalkpageHeaderView'] = $dir . 'pages/TalkpageHeaderView.php'; |
| | 130 | +$wgAutoloadClasses['IndividualThreadHistoryView'] = $dir . 'pages/IndividualThreadHistoryView.php'; |
| | 131 | +$wgAutoloadClasses['ThreadDiffView'] = $dir . 'pages/ThreadDiffView.php'; |
| | 132 | +$wgAutoloadClasses['ThreadWatchView'] = $dir . 'pages/ThreadWatchView.php'; |
| | 133 | +$wgAutoloadClasses['ThreadProtectionFormView'] = $dir . 'pages/ThreadProtectionFormView.php'; |
| | 134 | +$wgAutoloadClasses['ThreadHistoryListingView'] = $dir . 'pages/ThreadHistoryListingView.php'; |
| | 135 | +$wgAutoloadClasses['ThreadHistoricalRevisionView'] = $dir . 'pages/ThreadHistoricalRevisionView.php'; |
| | 136 | +$wgAutoloadClasses['SummaryPageView'] = $dir . 'pages/SummaryPageView.php'; |
| | 137 | +$wgAutoloadClasses['NewUserMessagesView'] = $dir . 'pages/NewUserMessagesView.php'; |
| | 138 | + |
| | 139 | +// Special pages |
| | 140 | +$wgAutoloadClasses['ThreadActionPage'] = $dir . 'pages/ThreadActionPage.php'; |
| | 141 | +$wgAutoloadClasses['SpecialMoveThread'] = $dir . 'pages/SpecialMoveThread.php'; |
| | 142 | +$wgAutoloadClasses['SpecialNewMessages'] = $dir . 'pages/SpecialNewMessages.php'; |
| | 143 | +$wgAutoloadClasses['SpecialSplitThread'] = $dir . 'pages/SpecialSplitThread.php'; |
| | 144 | +$wgAutoloadClasses['SpecialMergeThread'] = $dir . 'pages/SpecialMergeThread.php'; |
| | 145 | +$wgAutoloadClasses['SpecialHotTopics'] = "$dir/pages/SpecialHotTopics.php"; |
| | 146 | + |
| | 147 | +// Job queue |
| | 148 | +$wgJobClasses['synchroniseThreadArticleData'] = 'SynchroniseThreadArticleDataJob'; |
| | 149 | + |
| | 150 | +// Backwards-compatibility |
| | 151 | +$wgAutoloadClasses['Article_LQT_Compat'] = $dir . 'compat/LqtCompatArticle.php'; |
| | 152 | +if ( version_compare( $wgVersion, '1.16', '<' ) ) { |
| | 153 | + $wgAutoloadClasses['HTMLForm'] = "$dir/compat/HTMLForm.php"; |
| | 154 | + $wgExtensionMessagesFiles['Lqt-Compat'] = "$dir/compat/Lqt-compat.i18n.php"; |
| | 155 | +} |
| | 156 | + |
| | 157 | +// Logging |
| | 158 | +$wgLogTypes[] = 'liquidthreads'; |
| | 159 | +$wgLogNames['liquidthreads'] = 'lqt-log-name'; |
| | 160 | +$wgLogHeaders['liquidthreads'] = 'lqt-log-header'; |
| | 161 | + |
| | 162 | +foreach ( array( 'move', 'split', 'merge', 'subjectedit', 'resort' ) as $action ) { |
| | 163 | + $wgLogActionsHandlers["liquidthreads/$action"] = 'LqtLogFormatter::formatLogEntry'; |
| | 164 | +} |
| | 165 | + |
| | 166 | +// Preferences |
| | 167 | +$wgDefaultUserOptions['lqtnotifytalk'] = false; |
| | 168 | +$wgDefaultUserOptions['lqtdisplaydepth'] = 5; |
| | 169 | +$wgDefaultUserOptions['lqtdisplaycount'] = 25; |
| | 170 | +$wgDefaultUserOptions['lqtcustomsignatures'] = true; |
| | 171 | + |
| | 172 | +// API |
| | 173 | +$wgAutoloadClasses['ApiQueryLQTThreads'] = "$dir/api/ApiQueryLQTThreads.php"; |
| | 174 | +$wgAPIListModules['threads'] = 'ApiQueryLQTThreads'; |
| | 175 | +$wgAutoloadClasses['ApiFeedLQTThreads'] = "$dir/api/ApiFeedLQTThreads.php"; |
| | 176 | +$wgAPIModules['feedthreads'] = 'ApiFeedLQTThreads'; |
| | 177 | +$wgAutoloadClasses['ApiThreadAction'] = "$dir/api/ApiThreadAction.php"; |
| | 178 | +$wgAPIModules['threadaction'] = 'ApiThreadAction'; |
| | 179 | + |
| | 180 | +// Name of the extension (wmf-specific, for splitting to versions) |
| | 181 | +$wgLiquidThreadsExtensionName = 'LiquidThreads'; |
| | 182 | + |
| | 183 | +/** CONFIGURATION SECTION */ |
| | 184 | + |
| | 185 | +$wgDefaultUserOptions['lqt-watch-threads'] = true; |
| | 186 | + |
| | 187 | +$wgGroupPermissions['user']['lqt-split'] = true; |
| | 188 | +$wgGroupPermissions['user']['lqt-merge'] = true; |
| | 189 | + |
| | 190 | +$wgAvailableRights[] = 'lqt-split'; |
| | 191 | +$wgAvailableRights[] = 'lqt-merge'; |
| | 192 | + |
| | 193 | +/* Allows activation of LiquidThreads on individual pages */ |
| | 194 | +$wgLqtPages = array(); |
| | 195 | + |
| | 196 | +/* Allows switching LiquidThreads off for regular talk pages |
| | 197 | + (intended for testing and transition) */ |
| | 198 | +$wgLqtTalkPages = true; |
| | 199 | + |
| | 200 | +/* Whether or not to activate LiquidThreads email notifications */ |
| | 201 | +$wgLqtEnotif = true; |
| | 202 | + |
| | 203 | +/* Thread actions which do *not* cause threads to be "bumped" to the top */ |
| | 204 | +/* Using numbers because the change type constants are defined in Threads.php, don't |
| | 205 | + want to have to parse it on every page view */ |
| | 206 | +$wgThreadActionsNoBump = array( |
| | 207 | + 3 /* Edited summary */, |
| | 208 | + 10 /* Merged from */, |
| | 209 | + 12 /* Split from */, |
| | 210 | + 2 /* Edited root */, |
| | 211 | + 14 /* Adjusted sortkey */ |
| | 212 | +); |
| | 213 | + |
| | 214 | +/** Switch this on if you've migrated from a version before around May 2009 */ |
| | 215 | +$wgLiquidThreadsMigrate = false; |
| | 216 | + |
| | 217 | +/** The default number of threads per page */ |
| | 218 | +$wgLiquidThreadsDefaultPageLimit = 20; |
| | 219 | + |
| | 220 | +/** Whether or not to allow users to activate/deactivate LiquidThreads per-page */ |
| | 221 | +$wgLiquidThreadsAllowUserControl = true; |
| | 222 | + |
| | 223 | +/** Whether or not to allow users to activate/deactivate LiquidThreads in specific namespaces. |
| | 224 | + NULL means either all or none, depending on the above. */ |
| | 225 | +$wgLiquidThreadsAllowUserControlNamespaces = null; |
| | 226 | + |
| | 227 | +// Multilingal LQT |
| | 228 | +require_once( $dir . 'langrid/MultilangLqt.php' ); |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/LiquidThreads.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 229 | 229 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/classes/.copy.5083af11-2801-0010-9c4b-5d124da4a9ce.tmp |
| — | — | @@ -1,26 +1,26 @@ |
| 2 | | -<?php
|
| 3 | | -class LqtParserFunctions {
|
| 4 | | - static function useLiquidThreads( &$parser, $param = '1' ) {
|
| 5 | | - $offParams = array( 'no', 'off', 'disable' );
|
| 6 | | - // Figure out if they want to turn it off or on.
|
| 7 | | - $param = trim( strtolower( $param ) );
|
| 8 | | -
|
| 9 | | - if ( in_array( $param, $offParams ) || !$param ) {
|
| 10 | | - $param = 0;
|
| 11 | | - } else {
|
| 12 | | - $param = 1;
|
| 13 | | - }
|
| 14 | | -
|
| 15 | | - $parser->mOutput->setProperty( 'use-liquid-threads', $param );
|
| 16 | | - }
|
| 17 | | -
|
| 18 | | - static function lqtPageLimit( &$parser, $param = null ) {
|
| 19 | | - if ( $param && $param > 0 ) {
|
| 20 | | - $parser->mOutput->setProperty( 'lqt-page-limit', $param );
|
| 21 | | - }
|
| 22 | | - }
|
| 23 | | -
|
| 24 | | - static function efMetaTranslation( $input, $args, $parser ) {
|
| 25 | | - return '<notranslate><u>'.htmlspecialchars( $input ).'</u></notranslate>';
|
| 26 | | - }
|
| 27 | | -}
|
| | 2 | +<?php |
| | 3 | +class LqtParserFunctions { |
| | 4 | + static function useLiquidThreads( &$parser, $param = '1' ) { |
| | 5 | + $offParams = array( 'no', 'off', 'disable' ); |
| | 6 | + // Figure out if they want to turn it off or on. |
| | 7 | + $param = trim( strtolower( $param ) ); |
| | 8 | + |
| | 9 | + if ( in_array( $param, $offParams ) || !$param ) { |
| | 10 | + $param = 0; |
| | 11 | + } else { |
| | 12 | + $param = 1; |
| | 13 | + } |
| | 14 | + |
| | 15 | + $parser->mOutput->setProperty( 'use-liquid-threads', $param ); |
| | 16 | + } |
| | 17 | + |
| | 18 | + static function lqtPageLimit( &$parser, $param = null ) { |
| | 19 | + if ( $param && $param > 0 ) { |
| | 20 | + $parser->mOutput->setProperty( 'lqt-page-limit', $param ); |
| | 21 | + } |
| | 22 | + } |
| | 23 | + |
| | 24 | + static function efMetaTranslation( $input, $args, $parser ) { |
| | 25 | + return '<notranslate><u>'.htmlspecialchars( $input ).'</u></notranslate>'; |
| | 26 | + } |
| | 27 | +} |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/classes/.copy.5083af11-2801-0010-9c4b-5d124da4a9ce.tmp |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 28 | 28 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/classes/LogFormatter.php |
| — | — | @@ -1,44 +1,44 @@ |
| 2 | | -<?php
|
| 3 | | -
|
| 4 | | -// Contains formatter functions for all log entry types.
|
| 5 | | -class LqtLogFormatter {
|
| 6 | | - protected static function isForIRC( ) {
|
| 7 | | - // FIXME this is a horrific hack, but it's better than spewing HTML in the wrong
|
| 8 | | - // language to IRC.
|
| 9 | | - return in_string( '/LogPage::addEntry/', wfGetAllCallers() );
|
| 10 | | - }
|
| 11 | | -
|
| 12 | | - static function formatLogEntry( $type, $action, $title, $sk, $parameters ) {
|
| 13 | | - switch( $action ) {
|
| 14 | | - case 'merge':
|
| 15 | | - if ( $parameters[0] ) {
|
| 16 | | - $msg = 'lqt-log-action-merge-across';
|
| 17 | | - } else {
|
| 18 | | - $msg = 'lqt-log-action-merge-down';
|
| 19 | | - }
|
| 20 | | - break;
|
| 21 | | - default:
|
| 22 | | - $msg = 'lqt-log-action-' . $action;
|
| 23 | | - break;
|
| 24 | | - }
|
| 25 | | -
|
| 26 | | - $options = array( 'parseinline' );
|
| 27 | | -
|
| 28 | | - $forIRC = self::isForIRC();
|
| 29 | | -
|
| 30 | | - if ( $forIRC ) {
|
| 31 | | - global $wgContLang;
|
| 32 | | - $options['language'] = $wgContLang->getCode();
|
| 33 | | - }
|
| 34 | | -
|
| 35 | | - $replacements = array_merge( array( $title->getPrefixedText() ), $parameters );
|
| 36 | | -
|
| 37 | | - $html = wfMsgExt( $msg, $options, $replacements );
|
| 38 | | -
|
| 39 | | - if ( $forIRC ) {
|
| 40 | | - $html = StringUtils::delimiterReplace( '<', '>', '', $html );
|
| 41 | | - }
|
| 42 | | -
|
| 43 | | - return $html;
|
| 44 | | - }
|
| 45 | | -}
|
| | 2 | +<?php |
| | 3 | + |
| | 4 | +// Contains formatter functions for all log entry types. |
| | 5 | +class LqtLogFormatter { |
| | 6 | + protected static function isForIRC( ) { |
| | 7 | + // FIXME this is a horrific hack, but it's better than spewing HTML in the wrong |
| | 8 | + // language to IRC. |
| | 9 | + return in_string( '/LogPage::addEntry/', wfGetAllCallers() ); |
| | 10 | + } |
| | 11 | + |
| | 12 | + static function formatLogEntry( $type, $action, $title, $sk, $parameters ) { |
| | 13 | + switch( $action ) { |
| | 14 | + case 'merge': |
| | 15 | + if ( $parameters[0] ) { |
| | 16 | + $msg = 'lqt-log-action-merge-across'; |
| | 17 | + } else { |
| | 18 | + $msg = 'lqt-log-action-merge-down'; |
| | 19 | + } |
| | 20 | + break; |
| | 21 | + default: |
| | 22 | + $msg = 'lqt-log-action-' . $action; |
| | 23 | + break; |
| | 24 | + } |
| | 25 | + |
| | 26 | + $options = array( 'parseinline' ); |
| | 27 | + |
| | 28 | + $forIRC = self::isForIRC(); |
| | 29 | + |
| | 30 | + if ( $forIRC ) { |
| | 31 | + global $wgContLang; |
| | 32 | + $options['language'] = $wgContLang->getCode(); |
| | 33 | + } |
| | 34 | + |
| | 35 | + $replacements = array_merge( array( $title->getPrefixedText() ), $parameters ); |
| | 36 | + |
| | 37 | + $html = wfMsgExt( $msg, $options, $replacements ); |
| | 38 | + |
| | 39 | + if ( $forIRC ) { |
| | 40 | + $html = StringUtils::delimiterReplace( '<', '>', '', $html ); |
| | 41 | + } |
| | 42 | + |
| | 43 | + return $html; |
| | 44 | + } |
| | 45 | +} |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/classes/LogFormatter.php |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 46 | 46 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/classes/.copy.33c5ae11-2801-0010-9c4b-5d124da4a9ce.tmp |
| — | — | @@ -1,26 +1,26 @@ |
| 2 | | -<?php
|
| 3 | | -class LqtParserFunctions {
|
| 4 | | - static function useLiquidThreads( &$parser, $param = '1' ) {
|
| 5 | | - $offParams = array( 'no', 'off', 'disable' );
|
| 6 | | - // Figure out if they want to turn it off or on.
|
| 7 | | - $param = trim( strtolower( $param ) );
|
| 8 | | -
|
| 9 | | - if ( in_array( $param, $offParams ) || !$param ) {
|
| 10 | | - $param = 0;
|
| 11 | | - } else {
|
| 12 | | - $param = 1;
|
| 13 | | - }
|
| 14 | | -
|
| 15 | | - $parser->mOutput->setProperty( 'use-liquid-threads', $param );
|
| 16 | | - }
|
| 17 | | -
|
| 18 | | - static function lqtPageLimit( &$parser, $param = null ) {
|
| 19 | | - if ( $param && $param > 0 ) {
|
| 20 | | - $parser->mOutput->setProperty( 'lqt-page-limit', $param );
|
| 21 | | - }
|
| 22 | | - }
|
| 23 | | -
|
| 24 | | - static function efMetaTranslation( $input, $args, $parser ) {
|
| 25 | | - return '<notranslate><u>'.htmlspecialchars( $input ).'</u></notranslate>';
|
| 26 | | - }
|
| 27 | | -}
|
| | 2 | +<?php |
| | 3 | +class LqtParserFunctions { |
| | 4 | + static function useLiquidThreads( &$parser, $param = '1' ) { |
| | 5 | + $offParams = array( 'no', 'off', 'disable' ); |
| | 6 | + // Figure out if they want to turn it off or on. |
| | 7 | + $param = trim( strtolower( $param ) ); |
| | 8 | + |
| | 9 | + if ( in_array( $param, $offParams ) || !$param ) { |
| | 10 | + $param = 0; |
| | 11 | + } else { |
| | 12 | + $param = 1; |
| | 13 | + } |
| | 14 | + |
| | 15 | + $parser->mOutput->setProperty( 'use-liquid-threads', $param ); |
| | 16 | + } |
| | 17 | + |
| | 18 | + static function lqtPageLimit( &$parser, $param = null ) { |
| | 19 | + if ( $param && $param > 0 ) { |
| | 20 | + $parser->mOutput->setProperty( 'lqt-page-limit', $param ); |
| | 21 | + } |
| | 22 | + } |
| | 23 | + |
| | 24 | + static function efMetaTranslation( $input, $args, $parser ) { |
| | 25 | + return '<notranslate><u>'.htmlspecialchars( $input ).'</u></notranslate>'; |
| | 26 | + } |
| | 27 | +} |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/classes/.copy.33c5ae11-2801-0010-9c4b-5d124da4a9ce.tmp |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 28 | 28 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/lqt.pg.sql |
| — | — | @@ -1,67 +1,67 @@ |
| 2 | | -
|
| 3 | | -BEGIN;
|
| 4 | | -
|
| 5 | | -CREATE SEQUENCE thread_thread_id_seq;
|
| 6 | | -CREATE TABLE thread (
|
| 7 | | - thread_id INTEGER NOT NULL PRIMARY KEY DEFAULT nextval('thread_thread_id_seq'),
|
| 8 | | - thread_root INTEGER NOT NULL,
|
| 9 | | - thread_ancestor INTEGER NOT NULL,
|
| 10 | | - thread_parent INTEGER NOT NULL,
|
| 11 | | - thread_summary_page INTEGER NOT NULL,
|
| 12 | | - thread_subject TEXT NULL,
|
| 13 | | - thread_author_id INTEGER NULL,
|
| 14 | | - thread_author_name TEXT NULL,
|
| 15 | | - thread_modified TIMESTAMPTZ NULL DEFAULT now(),
|
| 16 | | - thread_created TIMESTAMPTZ NULL DEFAULT now(),
|
| 17 | | - thread_editedness SMALLINT NOT NULL DEFAULT 0,
|
| 18 | | - thread_article_namespace SMALLINT NOT NULL,
|
| 19 | | - thread_article_title TEXT NOT NULL,
|
| 20 | | - thread_article_id INTEGER NOT NULL,
|
| 21 | | - thread_type SMALLINT NOT NULL DEFAULT 0,
|
| 22 | | - thread_sortkey TEXT NOT NULL DEFAULT '',
|
| 23 | | - thread_replies INTEGER NOT NULL DEFAULT -1
|
| 24 | | -);
|
| 25 | | -
|
| 26 | | -CREATE UNIQUE INDEX thread_root_page ON thread(thread_root);
|
| 27 | | -CREATE INDEX thread_ancestor ON thread(thread_ancestor, thread_parent);
|
| 28 | | -CREATE INDEX thread_article_title ON thread(thread_article_namespace, thread_article_title, thread_sortkey);
|
| 29 | | -CREATE INDEX thread_article ON thread(thread_article_id, thread_sortkey);
|
| 30 | | -CREATE INDEX thread_modified ON thread(thread_modified);
|
| 31 | | -CREATE INDEX thread_created ON thread(thread_created);
|
| 32 | | -CREATE INDEX thread_summary_page ON thread(thread_summary_page);
|
| 33 | | -CREATE INDEX thread_author ON thread(thread_author_id,thread_author_name);
|
| 34 | | -CREATE INDEX thread_sortkey ON thread(thread_sortkey);
|
| 35 | | -
|
| 36 | | -CREATE TABLE historical_thread (
|
| 37 | | - hthread_id INTEGER NOT NULL,
|
| 38 | | - hthread_revision INTEGER NOT NULL,
|
| 39 | | - hthread_contents TEXT NOT NULL,
|
| 40 | | - hthread_change_type INTEGER NOT NULL,
|
| 41 | | - hthread_change_object INTEGER NOT NULL
|
| 42 | | -);
|
| 43 | | -CREATE UNIQUE INDEX historical_thread_unique ON historical_thread(hthread_id, hthread_revision);
|
| 44 | | -
|
| 45 | | -CREATE TABLE user_message_state (
|
| 46 | | - ums_user INTEGER NOT NULL,
|
| 47 | | - ums_thread INTEGER NOT NULL,
|
| 48 | | - ums_read_timestamp TIMESTAMPTZ
|
| 49 | | -);
|
| 50 | | -CREATE UNIQUE INDEX user_message_state_unique ON user_message_state(ums_user, ums_thread);
|
| 51 | | -
|
| 52 | | -CREATE SEQUENCE thread_history_th_id_seq;
|
| 53 | | -CREATE TABLE thread_history (
|
| 54 | | - th_id INTEGER NOT NULL PRIMARY KEY DEFAULT nextval('thread_history_th_id_seq'),
|
| 55 | | - th_thread INTEGER NOT NULL,
|
| 56 | | - th_timestamp TEXT NOT NULL,
|
| 57 | | - th_user INTEGER NOT NULL,
|
| 58 | | - th_user_text TEXT NOT NULL,
|
| 59 | | - th_change_type INTEGER NOT NULL,
|
| 60 | | - th_change_object INTEGER NOT NULL,
|
| 61 | | - th_change_comment TEXT NOT NULL,
|
| 62 | | - th_content TEXT NOT NULL
|
| 63 | | -);
|
| 64 | | -CREATE INDEX thread_history_thread ON thread_history(th_thread,th_timestamp);
|
| 65 | | -CREATE INDEX thread_history_user ON thread_history(th_user,th_user_text);
|
| 66 | | -
|
| 67 | | -COMMIT;
|
| | 2 | +-- Postgres version of the schema for the LiquidThreads extension |
| | 3 | + |
| | 4 | +BEGIN; |
| | 5 | + |
| | 6 | +CREATE SEQUENCE thread_thread_id_seq; |
| | 7 | +CREATE TABLE thread ( |
| | 8 | + thread_id INTEGER NOT NULL PRIMARY KEY DEFAULT nextval('thread_thread_id_seq'), |
| | 9 | + thread_root INTEGER NOT NULL, |
| | 10 | + thread_ancestor INTEGER NOT NULL, |
| | 11 | + thread_parent INTEGER NOT NULL, |
| | 12 | + thread_summary_page INTEGER NOT NULL, |
| | 13 | + thread_subject TEXT NULL, |
| | 14 | + thread_author_id INTEGER NULL, |
| | 15 | + thread_author_name TEXT NULL, |
| | 16 | + thread_modified TIMESTAMPTZ NULL DEFAULT now(), |
| | 17 | + thread_created TIMESTAMPTZ NULL DEFAULT now(), |
| | 18 | + thread_editedness SMALLINT NOT NULL DEFAULT 0, |
| | 19 | + thread_article_namespace SMALLINT NOT NULL, |
| | 20 | + thread_article_title TEXT NOT NULL, |
| | 21 | + thread_article_id INTEGER NOT NULL, |
| | 22 | + thread_type SMALLINT NOT NULL DEFAULT 0, |
| | 23 | + thread_sortkey TEXT NOT NULL DEFAULT '', |
| | 24 | + thread_replies INTEGER NOT NULL DEFAULT -1 |
| | 25 | +); |
| | 26 | + |
| | 27 | +CREATE UNIQUE INDEX thread_root_page ON thread(thread_root); |
| | 28 | +CREATE INDEX thread_ancestor ON thread(thread_ancestor, thread_parent); |
| | 29 | +CREATE INDEX thread_article_title ON thread(thread_article_namespace, thread_article_title, thread_sortkey); |
| | 30 | +CREATE INDEX thread_article ON thread(thread_article_id, thread_sortkey); |
| | 31 | +CREATE INDEX thread_modified ON thread(thread_modified); |
| | 32 | +CREATE INDEX thread_created ON thread(thread_created); |
| | 33 | +CREATE INDEX thread_summary_page ON thread(thread_summary_page); |
| | 34 | +CREATE INDEX thread_author ON thread(thread_author_id,thread_author_name); |
| | 35 | +CREATE INDEX thread_sortkey ON thread(thread_sortkey); |
| | 36 | + |
| | 37 | +CREATE TABLE historical_thread ( |
| | 38 | + hthread_id INTEGER NOT NULL, |
| | 39 | + hthread_revision INTEGER NOT NULL, |
| | 40 | + hthread_contents TEXT NOT NULL, |
| | 41 | + hthread_change_type INTEGER NOT NULL, |
| | 42 | + hthread_change_object INTEGER NOT NULL |
| | 43 | +); |
| | 44 | +CREATE UNIQUE INDEX historical_thread_unique ON historical_thread(hthread_id, hthread_revision); |
| | 45 | + |
| | 46 | +CREATE TABLE user_message_state ( |
| | 47 | + ums_user INTEGER NOT NULL, |
| | 48 | + ums_thread INTEGER NOT NULL, |
| | 49 | + ums_read_timestamp TIMESTAMPTZ |
| | 50 | +); |
| | 51 | +CREATE UNIQUE INDEX user_message_state_unique ON user_message_state(ums_user, ums_thread); |
| | 52 | + |
| | 53 | +CREATE SEQUENCE thread_history_th_id_seq; |
| | 54 | +CREATE TABLE thread_history ( |
| | 55 | + th_id INTEGER NOT NULL PRIMARY KEY DEFAULT nextval('thread_history_th_id_seq'), |
| | 56 | + th_thread INTEGER NOT NULL, |
| | 57 | + th_timestamp TEXT NOT NULL, |
| | 58 | + th_user INTEGER NOT NULL, |
| | 59 | + th_user_text TEXT NOT NULL, |
| | 60 | + th_change_type INTEGER NOT NULL, |
| | 61 | + th_change_object INTEGER NOT NULL, |
| | 62 | + th_change_comment TEXT NOT NULL, |
| | 63 | + th_content TEXT NOT NULL |
| | 64 | +); |
| | 65 | +CREATE INDEX thread_history_thread ON thread_history(th_thread,th_timestamp); |
| | 66 | +CREATE INDEX thread_history_user ON thread_history(th_user,th_user_text); |
| | 67 | + |
| | 68 | +COMMIT; |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/lqt.pg.sql |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 68 | 69 | + native |
| Index: trunk/extensions/MultilingualLiquidThreads/schema-changes/thread_signature.sql |
| — | — | @@ -1,2 +1,2 @@ |
| 2 | | -ALTER TABLE /*_*/thread ADD COLUMN thread_signature TINYBLOB NULL;
|
| | 2 | +-- Add thread_signature field |
| | 3 | +ALTER TABLE /*_*/thread ADD COLUMN thread_signature TINYBLOB NULL; |
| Property changes on: trunk/extensions/MultilingualLiquidThreads/schema-changes/thread_signature.sql |
| ___________________________________________________________________ |
| Name: svn:eol-style |
| 3 | 4 | + native |